# HG changeset patch # User Edouard Tisserant <edouard.tisserant@gmail.com> # Date 1677867649 -3600 # Node ID 838242d34741a7cc2cf87baf76970b0095cd6536 # Parent 99263915a91d86734366e9863322de571848e0de# Parent ac0e6de439b5d2561c1c6037d9c6026dd541f5f6 Merged default in wxPython4 branch diff -r ac0e6de439b5 -r 838242d34741 .github/workflows/run_tests_in_docker.yml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/.github/workflows/run_tests_in_docker.yml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,68 @@ +name: Docker Image CI + +on: + push: + branches: [ wxPython4 ] + +jobs: + + build: + + runs-on: ubuntu-latest + + steps: + - uses: actions/checkout@v3 + with: + path: beremiz + + - uses: actions/checkout@v3 + with: + repository: beremiz/matiec + ref: 2a25f4dbf4e2b1e017a3a583db7dede4771fe523 + path: matiec + + - uses: actions/checkout@v3 + with: + repository: open62541/open62541 + ref: v1.3.3 + path: open62541 + submodules: recursive + + - name: Cache docker image + id: cache-docker + uses: actions/cache@v3 + env: + cache-name: cache-docker + with: + path: /tmp/latest.tar + key: ${{ runner.os }}-build-${{ env.cache-name }}-${{ hashFiles('beremiz/tests/tools/Docker/beremiz-sikuli') }} + + - if: ${{ steps.cache-docker.outputs.cache-hit == false }} + name: Create docker image + run: | + cd beremiz/tests/tools/Docker + ./build_docker_image.sh + docker image save --output="/tmp/latest.tar" beremiz_sikuli + + - if: ${{ steps.cache-docker.outputs.cache-hit != false }} + name: Re-use docker image + run: | + docker image load --input="/tmp/latest.tar" + + - name: Create docker container + run: | + cd beremiz/tests/tools/Docker + ./create_docker_container.sh ${{ github.workspace }}/test + + - name: Run tests in docker + run: | + cd beremiz/tests/tools/Docker + ./do_test_in_docker.sh + + - name: Upload test resuts artifact + uses: actions/upload-artifact@v3 + if: failure() + with: + name: test_results + path: ${{ github.workspace }}/test + retention-days: 5 diff -r ac0e6de439b5 -r 838242d34741 .hgignore --- a/.hgignore Wed Mar 01 10:54:54 2023 +0100 +++ b/.hgignore Fri Mar 03 19:20:49 2023 +0100 @@ -24,3 +24,5 @@ doc/_build doc/locale + +^.*\$py.class$ diff -r ac0e6de439b5 -r 838242d34741 Beremiz.py --- a/Beremiz.py Wed Mar 01 10:54:54 2023 +0100 +++ b/Beremiz.py Fri Mar 03 19:20:49 2023 +0100 @@ -50,6 +50,7 @@ self.modules = ["BeremizIDE"] self.debug = os.path.exists("BEREMIZ_DEBUG") self.handle_exception = None + self.logf = None def Bpath(self, *args): return os.path.join(self.app_dir, *args) @@ -62,12 +63,13 @@ print("-h --help Print this help") print("-u --updatecheck URL Retrieve update information by checking URL") print("-e --extend PathToExtension Extend IDE functionality by loading at start additional extensions") + print("-l --log path write content of console tab to given file") print("") print("") def SetCmdOptions(self): - self.shortCmdOpts = "hu:e:" - self.longCmdOpts = ["help", "updatecheck=", "extend="] + self.shortCmdOpts = "hu:e:l:" + self.longCmdOpts = ["help", "updatecheck=", "extend=", "log="] def ProcessOption(self, o, a): if o in ("-h", "--help"): @@ -77,6 +79,8 @@ self.updateinfo_url = a if o in ("-e", "--extend"): self.extensions.append(a) + if o in ("-l", "--log"): + self.logf = open(a, 'a') def ProcessCommandLineArgs(self): self.SetCmdOptions() @@ -182,10 +186,10 @@ def InstallExceptionHandler(self): import version import util.ExceptionHandler - self.handle_exception = util.ExceptionHandler.AddExceptHook(version.app_version) + self.handle_exception = util.ExceptionHandler.AddExceptHook(version.app_version, logf=self.logf) def CreateUI(self): - self.frame = self.BeremizIDE.Beremiz(None, self.projectOpen, self.buildpath) + self.frame = self.BeremizIDE.Beremiz(None, self.projectOpen, self.buildpath, logf=self.logf) def CloseSplash(self): if self.splash: diff -r ac0e6de439b5 -r 838242d34741 BeremizIDE.py --- a/BeremizIDE.py Wed Mar 01 10:54:54 2023 +0100 +++ b/BeremizIDE.py Fri Mar 03 19:20:49 2023 +0100 @@ -28,10 +28,9 @@ from __future__ import print_function import os import sys -import tempfile import shutil -import random import time +import signal from time import time as gettime from threading import Lock, Timer, currentThread @@ -39,6 +38,7 @@ import wx.lib.buttons import wx.lib.statbmp import wx.stc +import wx.adv import version @@ -47,9 +47,8 @@ from editors.TextViewer import TextViewer from editors.ResourceEditor import ConfigurationEditor, ResourceEditor from editors.DataTypeEditor import DataTypeEditor -from util import paths as paths +from util.paths import Bpath from util.MiniTextControler import MiniTextControler -from util.ProcessLogger import ProcessLogger from util.BitmapLibrary import GetBitmap from controls.LogViewer import LogViewer from controls.CustomStyledTextCtrl import CustomStyledTextCtrl @@ -84,15 +83,11 @@ EncodeFileSystemPath, \ DecodeFileSystemPath - -beremiz_dir = paths.AbsDir(__file__) - - -def Bpath(*args): - return os.path.join(beremiz_dir, *args) +from LocalRuntimeMixin import LocalRuntimeMixin + def AppendMenu(parent, help, id, kind, text): - return parent.Append(help=help, id=id, kind=kind, text=text) + return parent.Append(wx.MenuItem(helpString=help, id=id, kind=kind, text=text)) MAX_RECENT_PROJECTS = 9 @@ -115,7 +110,7 @@ class LogPseudoFile(object): """ Base class for file like objects to facilitate StdOut for the Shell.""" - def __init__(self, output, risecall): + def __init__(self, output, risecall, logf): self.red_white = 1 self.red_yellow = 2 self.black_white = wx.stc.STC_STYLE_DEFAULT @@ -131,8 +126,12 @@ self.LastRefreshTime = gettime() self.LastRefreshTimer = None self.refreshPending = False + self.logf = logf def write(self, s, style=None): + if self.logf is not None: + self.logf.write(s) + self.logf.flush() self.StackLock.acquire() self.stack.append((s, style)) self.StackLock.release() @@ -179,7 +178,7 @@ if style is None: style = self.black_white if style != self.black_white: - self.output.StartStyling(self.output.GetLength(), 0xff) + self.output.StartStyling(self.output.GetLength()) # Temporary deactivate read only mode on StyledTextCtrl for # adding text. It seems that text modifications, even @@ -236,7 +235,7 @@ ID_FILEMENURECENTPROJECTS = wx.NewId() -class Beremiz(IDEFrame): +class Beremiz(IDEFrame, LocalRuntimeMixin): def _init_utils(self): self.ConfNodeMenu = wx.Menu(title='') @@ -250,9 +249,9 @@ kind=wx.ITEM_NORMAL, text=_(u'New') + '\tCTRL+N') AppendMenu(parent, help='', id=wx.ID_OPEN, kind=wx.ITEM_NORMAL, text=_(u'Open') + '\tCTRL+O') - parent.AppendMenu(ID_FILEMENURECENTPROJECTS, _("&Recent Projects"), self.RecentProjectsMenu) + parent.Append(ID_FILEMENURECENTPROJECTS, _("&Recent Projects"), self.RecentProjectsMenu) parent.AppendSeparator() - parent.AppendMenu(wx.ID_ANY, _("&Tutorials and Examples"), self.TutorialsProjectsMenu) + parent.Append(wx.ID_ANY, _("&Tutorials and Examples"), self.TutorialsProjectsMenu) exemples_dir = Bpath("exemples") project_list = sorted(os.listdir(exemples_dir)) @@ -314,10 +313,10 @@ for name, text, helpstr, children in items: if len(children) > 0: new_menu = wx.Menu(title='') - menu.AppendMenu(wx.ID_ANY, text, new_menu) + menu.AppendSubMenu(new_menu, text) self._RecursiveAddMenuItems(new_menu, children) else: - item = menu.Append(wx.ID_ANY, text, helpstr) + item = menu.Append(wx.MenuItem(text=text, helpString=helpstr, kind=wx.ITEM_NORMAL, id=wx.ID_ANY)) self.Bind(wx.EVT_MENU, self.GetAddConfNodeFunction(name), item) def _init_coll_AddMenu_Items(self, parent): @@ -334,16 +333,16 @@ item = parent.Append(wx.ID_ANY, _(u'Community support'), '') self.Bind(wx.EVT_MENU, handler, item) - parent.Append(help='', id=wx.ID_ABOUT, - kind=wx.ITEM_NORMAL, text=_(u'About')) + parent.Append(wx.MenuItem(helpString='', id=wx.ID_ABOUT, + kind=wx.ITEM_NORMAL, text=_(u'About'))) self.Bind(wx.EVT_MENU, self.OnAboutMenu, id=wx.ID_ABOUT) def _init_coll_ConnectionStatusBar_Fields(self, parent): parent.SetFieldsCount(3) - parent.SetStatusText(number=0, text='') - parent.SetStatusText(number=1, text='') - parent.SetStatusText(number=2, text='') + parent.SetStatusText(i=0, text='') + parent.SetStatusText(i=1, text='') + parent.SetStatusText(i=2, text='') parent.SetStatusWidths([-1, 300, 200]) @@ -356,6 +355,8 @@ self.Bind(wx.EVT_MENU, self.OnOpenWidgetInspector, id=inspectorID) accels = [wx.AcceleratorEntry(wx.ACCEL_CTRL | wx.ACCEL_ALT, ord('I'), inspectorID)] + self.methodLock = Lock() + for method, shortcut in [("Stop", wx.WXK_F4), ("Run", wx.WXK_F5), ("Transfer", wx.WXK_F6), @@ -365,8 +366,15 @@ def OnMethodGen(obj, meth): def OnMethod(evt): if obj.CTR is not None: - obj.CTR.CallMethod('_'+meth) - wx.CallAfter(self.RefreshStatusToolBar) + if obj.methodLock.acquire(False): + obj.CTR.CallMethod('_'+meth) + obj.methodLock.release() + wx.CallAfter(obj.RefreshStatusToolBar) + else: + # Postpone call if one of method already running + # can happen because of long method using log, + # itself calling wx.Yield + wx.CallLater(50, OnMethod, evt) return OnMethod newid = wx.NewId() self.Bind(wx.EVT_MENU, OnMethodGen(self, method), id=newid) @@ -395,6 +403,7 @@ self.LogConsole.MarkerDefine(0, wx.stc.STC_MARK_CIRCLE, "BLACK", "RED") self.LogConsole.SetModEventMask(wx.stc.STC_MOD_INSERTTEXT) + self.LogConsole.SetCaretPeriod(0) self.LogConsole.Bind(wx.stc.EVT_STC_MARGINCLICK, self.OnLogConsoleMarginClick) self.LogConsole.Bind(wx.stc.EVT_STC_MODIFIED, self.OnLogConsoleModified) @@ -409,7 +418,7 @@ # self.BottomNoteBook.Split(self.BottomNoteBook.GetPageIndex(self.LogViewer), wx.RIGHT) StatusToolBar = wx.ToolBar(self, -1, wx.DefaultPosition, wx.DefaultSize, - wx.TB_FLAT | wx.TB_NODIVIDER | wx.NO_BORDER) + wx.TB_FLAT | wx.TB_HORIZONTAL | wx.NO_BORDER) StatusToolBar.SetToolBitmapSize(wx.Size(25, 25)) StatusToolBar.Realize() self.Panes["StatusToolBar"] = StatusToolBar @@ -420,7 +429,7 @@ self.AUIManager.Update() - self.ConnectionStatusBar = esb.EnhancedStatusBar(self, style=wx.ST_SIZEGRIP) + self.ConnectionStatusBar = esb.EnhancedStatusBar(self, style=wx.STB_SIZEGRIP) self._init_coll_ConnectionStatusBar_Fields(self.ConnectionStatusBar) self.ProgressStatusBar = wx.Gauge(self.ConnectionStatusBar, -1, range=100) self.ConnectionStatusBar.AddWidget(self.ProgressStatusBar, esb.ESB_EXACT_FIT, esb.ESB_EXACT_FIT, 2) @@ -436,17 +445,16 @@ # found here. os.environ["PATH"] = os.getcwd()+';'+os.environ["PATH"] - def __init__(self, parent, projectOpen=None, buildpath=None, ctr=None, debug=True): + def __init__(self, parent, projectOpen=None, buildpath=None, ctr=None, debug=True, logf=None): + # Add beremiz's icon in top left corner of the frame self.icon = wx.Icon(Bpath("images", "brz.ico"), wx.BITMAP_TYPE_ICO) self.__init_execute_path() IDEFrame.__init__(self, parent, debug) - self.Log = LogPseudoFile(self.LogConsole, self.SelectTab) - - self.local_runtime = None - self.runtime_port = None - self.local_runtime_tmpdir = None + self.Log = LogPseudoFile(self.LogConsole, self.SelectTab, logf) + + LocalRuntimeMixin.__init__(self, self.Log) self.LastPanelSelected = None @@ -501,6 +509,8 @@ self.RefreshAll() self.LogConsole.SetFocus() + signal.signal(signal.SIGTERM,self.signalTERM_handler) + def RefreshTitle(self): name = _("Beremiz") if self.CTR is not None: @@ -511,37 +521,6 @@ else: self.SetTitle(name) - def StartLocalRuntime(self, taskbaricon=True): - if (self.local_runtime is None) or (self.local_runtime.exitcode is not None): - # create temporary directory for runtime working directory - self.local_runtime_tmpdir = tempfile.mkdtemp() - # choose an arbitrary random port for runtime - self.runtime_port = int(random.random() * 1000) + 61131 - self.Log.write(_("Starting local runtime...\n")) - # launch local runtime - self.local_runtime = ProcessLogger( - self.Log, - "\"%s\" \"%s\" -p %s -i localhost %s %s" % ( - sys.executable, - Bpath("Beremiz_service.py"), - self.runtime_port, - {False: "-x 0", True: "-x 1"}[taskbaricon], - self.local_runtime_tmpdir), - no_gui=False, - timeout=500, keyword=self.local_runtime_tmpdir, - cwd=self.local_runtime_tmpdir) - self.local_runtime.spin() - return self.runtime_port - - def KillLocalRuntime(self): - if self.local_runtime is not None: - # shutdown local runtime - self.local_runtime.kill(gently=False) - # clear temp dir - shutil.rmtree(self.local_runtime_tmpdir) - - self.local_runtime = None - def OnOpenWidgetInspector(self, evt): # Activate the widget inspection tool from wx.lib.inspection import InspectionTool @@ -560,7 +539,8 @@ event.Skip() def OnLogConsoleUpdateUI(self, event): - self.SetCopyBuffer(self.LogConsole.GetSelectedText(), True) + if event.GetUpdated()==wx.stc.STC_UPDATE_SELECTION: + self.SetCopyBuffer(self.LogConsole.GetSelectedText(), True) event.Skip() def OnLogConsoleMarginClick(self, event): @@ -667,6 +647,11 @@ # prevent event to continue, i.e. cancel closing event.Veto() + def signalTERM_handler(self, sig, frame): + print ("Signal TERM caught: kill local runtime and quit, no save") + self.KillLocalRuntime() + sys.exit() + def RefreshFileMenu(self): self.RefreshRecentProjectsMenu() @@ -722,7 +707,7 @@ while self.RecentProjectsMenu.GetMenuItemCount() > 0: item = self.RecentProjectsMenu.FindItemByPosition(0) - self.RecentProjectsMenu.RemoveItem(item) + self.RecentProjectsMenu.Remove(item) self.FileMenu.Enable(ID_FILEMENURECENTPROJECTS, len(recent_projects) > 0) for idx, projectpath in enumerate(recent_projects): @@ -769,8 +754,9 @@ for confnode_method in self.CTR.StatusMethods: if "method" in confnode_method and confnode_method.get("shown", True): - tool = StatusToolBar.AddSimpleTool( - wx.ID_ANY, GetBitmap(confnode_method.get("bitmap", "Unknown")), + tool = StatusToolBar.AddTool( + wx.ID_ANY, confnode_method["name"], + GetBitmap(confnode_method.get("bitmap", "Unknown")), confnode_method["tooltip"]) self.Bind(wx.EVT_MENU, self.GetMenuCallBackFunction(confnode_method["method"]), tool) @@ -821,7 +807,7 @@ else: self.EditMenu.Delete(item.GetId()) self.LastPanelSelected = None - self.MenuBar.UpdateMenus() + self.MenuBar.Refresh() def RefreshAll(self): self.RefreshStatusToolBar() @@ -988,7 +974,15 @@ self.Close() def OnAboutMenu(self, event): - info = version.GetAboutDialogInfo() + info = wx.adv.AboutDialogInfo() + info = version.GetAboutDialogInfo(info) + info.Name = "Beremiz" + info.Description = _("Open Source framework for automation, " + "implementing IEC 61131 IDE with constantly growing set of extensions " + "and flexible PLC runtime.") + + info.Icon = wx.Icon(Bpath("images", "about_brz_logo.png"), wx.BITMAP_TYPE_PNG) + ShowAboutDialog(self, info) def OnProjectTreeItemBeginEdit(self, event): diff -r ac0e6de439b5 -r 838242d34741 Beremiz_cli.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/Beremiz_cli.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,121 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +import os +import posixpath +import sys +import time + +from functools import wraps +from importlib import import_module + +import click + +class CLISession(object): + def __init__(self, **kwargs): + self.__dict__.update(kwargs) + self.controller = None + +pass_session = click.make_pass_decorator(CLISession) + + +@click.group(chain=True) +@click.option( + "--project-home", + envvar="PROJECT_HOME", + default=".", + metavar="PATH", + help="Changes the project folder location.", +) +@click.option( + "--config", + nargs=2, + multiple=True, + metavar="KEY VALUE", + help="Overrides a config key/value pair.", +) +@click.option( + "--keep", "-k", is_flag=True, + help="Keep local runtime, do not kill it after executing commands.", +) +@click.option("--verbose", "-v", is_flag=True, help="Enables verbose mode.") +@click.option( + "--buildpath", "-b", help="Where to store files created during build." +) +@click.option( + "--uri", "-u", help="URI to reach remote PLC." +) +@click.version_option("0.1") +@click.pass_context +def cli(ctx, **kwargs): + """Beremiz CLI manipulates beremiz projects and runtimes. """ + + ctx.obj = CLISession(**kwargs) + +def ensure_controller(func): + @wraps(func) + def func_wrapper(session, *args, **kwargs): + if session.controller is None: + session.controller = import_module("CLIController").CLIController(session) + ret = func(session, *args, **kwargs) + return ret + + return func_wrapper + +@cli.command() +@click.option( + "--target", "-t", help="Target system triplet." +) +@pass_session +@ensure_controller +def build(session, target): + """Builds project. """ + def processor(): + return session.controller.build_project(target) + return processor + +@cli.command() +@pass_session +@ensure_controller +def transfer(session): + """Transfer program to PLC runtim.""" + def processor(): + return session.controller.transfer_project() + return processor + +@cli.command() +@pass_session +@ensure_controller +def run(session): + """Run program already present in PLC. """ + def processor(): + return session.controller.run_project() + return processor + + +@cli.resultcallback() +@pass_session +def process_pipeline(session, processors, **kwargs): + ret = 0 + for processor in processors: + ret = processor() + if ret != 0: + if len(processors) > 1 : + click.echo("Command sequence aborted") + break + + if session.keep: + click.echo("Press Ctrl+C to quit") + try: + while True: + time.sleep(1) + except KeyboardInterrupt: + pass + + session.controller.finish() + + return ret + +if __name__ == '__main__': + cli() + diff -r ac0e6de439b5 -r 838242d34741 Beremiz_service.py --- a/Beremiz_service.py Wed Mar 01 10:54:54 2023 +0100 +++ b/Beremiz_service.py Fri Mar 03 19:20:49 2023 +0100 @@ -37,6 +37,7 @@ from builtins import str as text from past.builtins import execfile from six.moves import builtins +from functools import partial import runtime from runtime.PyroServer import PyroServer @@ -238,6 +239,7 @@ if havewx: import re + import wx.adv if wx.VERSION >= (3, 0, 0): app = wx.App(redirect=False) @@ -279,7 +281,7 @@ def SetTests(self, tests): self.Tests = tests - class BeremizTaskBarIcon(wx.TaskBarIcon): + class BeremizTaskBarIcon(wx.adv.TaskBarIcon): TBMENU_START = wx.NewId() TBMENU_STOP = wx.NewId() TBMENU_CHANGE_NAME = wx.NewId() @@ -291,7 +293,7 @@ TBMENU_QUIT = wx.NewId() def __init__(self, pyroserver): - wx.TaskBarIcon.__init__(self) + wx.adv.TaskBarIcon.__init__(self) self.pyroserver = pyroserver # Set the image self.UpdateIcon(None) @@ -339,7 +341,7 @@ elif "wxGTK" in wx.PlatformInfo: img = img.Scale(22, 22) # wxMac can be any size upto 128x128, so leave the source img alone.... - icon = wx.IconFromBitmap(img.ConvertToBitmap()) + icon = wx.Icon(img.ConvertToBitmap()) return icon def OnTaskBarStartPLC(self, evt): @@ -426,7 +428,12 @@ if havewx: from twisted.internet import wxreactor wxreactor.install() - from twisted.internet import reactor + from twisted.internet import reactor + reactor.registerWxApp(app) + else: + # from twisted.internet import pollreactor + # pollreactor.install() + from twisted.internet import reactor havetwisted = True except ImportError: @@ -435,13 +442,6 @@ pyruntimevars = {} -if havetwisted: - if havewx: - reactor.registerWxApp(app) - -twisted_reactor_thread_id = None -ui_thread = None - if havewx: wx_eval_lock = Semaphore(0) @@ -455,24 +455,18 @@ obj.res = default_evaluator(tocall, *args, **kwargs) wx_eval_lock.release() + main_thread_id = currentThread().ident def evaluator(tocall, *args, **kwargs): - # To prevent deadlocks, check if current thread is not one of the UI - # UI threads can be either the one from WX main loop or - # worker thread from twisted "threadselect" reactor + # To prevent deadlocks, check if current thread is not one already main current_id = currentThread().ident - if ui_thread is not None \ - and ui_thread.ident != current_id \ - and (not havetwisted or ( - twisted_reactor_thread_id is not None - and twisted_reactor_thread_id != current_id)): - + if main_thread_id != current_id: o = type('', (object,), dict(call=(tocall, args, kwargs), res=None)) wx.CallAfter(wx_evaluator, o) wx_eval_lock.acquire() return o.res else: - # avoid dead lock if called from the wx mainloop + # avoid dead lock if called from main : do job immediately return default_evaluator(tocall, *args, **kwargs) else: evaluator = default_evaluator @@ -559,13 +553,15 @@ except Exception: LogMessageAndException(_("WAMP client startup failed. ")) +pyro_thread = None + def FirstWorkerJob(): """ RPC through pyro/wamp/UI may lead to delegation to Worker, then this function ensures that Worker is already created when pyro starts """ - global pyro_thread, pyroserver, ui_thread, reactor, twisted_reactor_thread_id + global pyro_thread, pyroserver pyro_thread_started = Lock() pyro_thread_started.acquire() @@ -585,43 +581,59 @@ sys.stdout.write(_("Current working directory :") + WorkingDir + "\n") sys.stdout.flush() - if not (havetwisted or havewx): - return + runtime.GetPLCObjectSingleton().AutoLoad(autostart) + +if havetwisted and havewx: + + waker_func = wx.CallAfter + + # This orders ui loop to signal when ready on Stdout + waker_func(print,"UI thread started successfully.") + + # interleaved worker copes with wxreactor by delegating all asynchronous + # calls to wx's mainloop + runtime.MainWorker.interleave(waker_func, reactor.stop, FirstWorkerJob) + + try: + reactor.run(installSignalHandlers=False) + except KeyboardInterrupt: + pass + + runtime.MainWorker.stop() + +elif havewx: + + try: + app.MainLoop + except KeyboardInterrupt: + pass + +elif havetwisted: ui_thread_started = Lock() ui_thread_started.acquire() - if havetwisted: - # reactor._installSignalHandlersAgain() - def ui_thread_target(): - # FIXME: had to disable SignaHandlers install because - # signal not working in non-main thread - reactor.run(installSignalHandlers=False) - else: - ui_thread_target = app.MainLoop - - ui_thread = Thread(target=ui_thread_target, name="UIThread") + + reactor.callLater(0, ui_thread_started.release) + + ui_thread = Thread( + target=partial(reactor.run, installSignalHandlers=False), + name="UIThread") ui_thread.start() - # This order ui loop to unblock main thread when ready. - if havetwisted: - def signal_uithread_started(): - global twisted_reactor_thread_id - twisted_reactor_thread_id = currentThread().ident - ui_thread_started.release() - reactor.callLater(0, signal_uithread_started) - else: - wx.CallAfter(ui_thread_started.release) - - # Wait for ui thread to be effective ui_thread_started.acquire() print("UI thread started successfully.") - - runtime.GetPLCObjectSingleton().AutoLoad(autostart) - -try: - runtime.MainWorker.runloop(FirstWorkerJob) -except KeyboardInterrupt: - pass + try: + # blocking worker loop + runtime.MainWorker.runloop(FirstWorkerJob) + except KeyboardInterrupt: + pass +else: + try: + # blocking worker loop + runtime.MainWorker.runloop(FirstWorkerJob) + except KeyboardInterrupt: + pass + pyroserver.Quit() pyro_thread.join() @@ -635,9 +647,9 @@ if havetwisted: reactor.stop() - ui_thread.join() + if not havewx: + ui_thread.join() elif havewx: app.ExitMainLoop() - ui_thread.join() sys.exit(0) diff -r ac0e6de439b5 -r 838242d34741 CLIController.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/CLIController.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,183 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +import os +import sys +from functools import wraps +from threading import Timer +from datetime import datetime + +import click + +import fake_wx + +from ProjectController import ProjectController +from LocalRuntimeMixin import LocalRuntimeMixin +from runtime.loglevels import LogLevelsCount, LogLevels + + +class Log: + + def __init__(self): + self.crlfpending = False + + def write(self, s): + if s: + if self.crlfpending: + sys.stdout.write("\n") + sys.stdout.write(s) + sys.stdout.flush() + self.crlfpending = 0 + + def write_error(self, s): + if s: + self.write("Error: "+s) + + def write_warning(self, s): + if s: + self.write("Warning: "+s) + + def flush(self): + sys.stdout.flush() + + def isatty(self): + return False + + def progress(self, s): + if s: + sys.stdout.write(s+"\r") + self.crlfpending = True + + +def with_project_loaded(func): + @wraps(func) + def func_wrapper(self, *args, **kwargs): + if not self.HasOpenedProject(): + if self.check_and_load_project(): + return 1 + self.apply_config() + return func(self, *args, **kwargs) + + return func_wrapper + +def connected(func): + @wraps(func) + def func_wrapper(self, *args, **kwargs): + if self._connector is None: + if self.session.uri: + self.BeremizRoot.setURI_location(self.session.uri) + if not self._Connect(): + return 1 + return func(self, *args, **kwargs) + + return func_wrapper + +class CLIController(LocalRuntimeMixin, ProjectController): + def __init__(self, session): + self.session = session + log = Log() + LocalRuntimeMixin.__init__(self, log, use_gui=False) + ProjectController.__init__(self, None, log) + self.CLIStatusTimer = None + self.KillCLIStatusTimer = False + + + def StartCLIStatusTimer(self): + if self.CLIStatusTimer is not None: + return + self.CLIStatusTimer = Timer(0.5, self.CLIStatusTimerProc) + self.KillCLIStatusTimer = False + self.CLIStatusTimer.start() + + def StopCLIStatusTimer(self): + if self.CLIStatusTimer is None: + return + self.KillCLIStatusTimer = True + self.CLIStatusTimer.cancel() + self.CLIStatusTimer = None + + def CLIStatusTimerProc(self): + self.CLIStatusTimer = None + if not self.KillCLIStatusTimer: + self.PullPLCStatusProc(None) + self.StartCLIStatusTimer() + + def _SetConnector(self, connector, update_status=True): + self._connector = connector + self.previous_log_count = [None]*LogLevelsCount + if connector is not None: + self.StartCLIStatusTimer() + else: + self.StopCLIStatusTimer() + if update_status: + self.UpdateMethodsFromPLCStatus() + + def UpdatePLCLog(self, log_count): + connector = self._connector + new_messages = [] + if connector: + for level, count, prev in zip( + xrange(LogLevelsCount), log_count, self.previous_log_count): + if count is not None and prev != count: + if prev is None: + dump_end = max(-1, count - 10) + else: + dump_end = prev - 1 + for msgidx in range(count-1, dump_end, -1): + message = connector.GetLogMessage(level, msgidx) + if message is not None: + msg, _tick, tv_sec, tv_nsec = message + date = datetime.utcfromtimestamp(tv_sec + tv_nsec * 1e-9) + txt = "%s at %s: %s\n" % (LogLevels[level], date.isoformat(' '), msg) + new_messages.append((date,txt)) + else: + break + self.previous_log_count[level] = count + new_messages.sort() + for date, txt in new_messages: + self.logger.write(txt) + + def check_and_load_project(self): + if not os.path.isdir(self.session.project_home): + self.logger.write_error( + _("\"%s\" is not a valid Beremiz project\n") % self.session.project_home) + return True + + errmsg, error = self.LoadProject(self.session.project_home, self.session.buildpath) + if error: + self.logger.write_error(errmsg) + return True + + def apply_config(self): + for k,v in self.session.config: + self.SetParamsAttribute("BeremizRoot."+k, v) + + @with_project_loaded + def build_project(self, target): + + if target: + self.SetParamsAttribute("BeremizRoot.TargetType", target) + + return 0 if self._Build() else 1 + + @with_project_loaded + @connected + def transfer_project(self): + + return 0 if self._Transfer() else 1 + + @with_project_loaded + @connected + def run_project(self): + + return 0 if self._Run() else 1 + + + def finish(self): + + self._Disconnect() + + if not self.session.keep: + self.KillLocalRuntime() + + diff -r ac0e6de439b5 -r 838242d34741 ConfigTreeNode.py --- a/ConfigTreeNode.py Wed Mar 01 10:54:54 2023 +0100 +++ b/ConfigTreeNode.py Fri Mar 03 19:20:49 2023 +0100 @@ -133,6 +133,15 @@ def CTNTestModified(self): return self.ChangesToSave + def CTNMarkModified(self): + oldChangesToSave = self.ChangesToSave + self.ChangesToSave = True + if not oldChangesToSave: + appframe = self.GetCTRoot().AppFrame + if appframe is not None: + appframe.RefreshTitle() + appframe.RefreshPageTitles() + def ProjectTestModified(self): """ recursively check modified status @@ -471,7 +480,7 @@ return None def GetView(self, onlyopened=False): - if self._View is None and not onlyopened and self.EditorType is not None: + if not self._View and not onlyopened and self.EditorType is not None: app_frame = self.GetCTRoot().AppFrame self._View = self.EditorType(app_frame.TabsOpened, self, app_frame) diff -r ac0e6de439b5 -r 838242d34741 IDEFrame.py --- a/IDEFrame.py Wed Mar 01 10:54:54 2023 +0100 +++ b/IDEFrame.py Fri Mar 03 19:20:49 2023 +0100 @@ -115,7 +115,7 @@ def AppendMenu(parent, help, kind, text, id=wx.ID_ANY): - return parent.Append(help=help, kind=kind, text=text, id=id) + return parent.Append(wx.MenuItem(helpString=help, kind=kind, text=text, id=id)) [ @@ -391,7 +391,7 @@ parent.AppendSeparator() add_menu = wx.Menu(title='') self._init_coll_AddMenu_Items(add_menu) - parent.AppendMenu(wx.ID_ADD, _(u"&Add Element"), add_menu) + parent.Append(wx.ID_ADD, _(u"&Add Element"), add_menu) AppendMenu(parent, help='', id=wx.ID_SELECTALL, kind=wx.ITEM_NORMAL, text=_(u'Select All') + '\tCTRL+A') AppendMenu(parent, help='', id=wx.ID_DELETE, @@ -442,7 +442,7 @@ kind=wx.ITEM_NORMAL, text=_(u'Clear Errors') + '\tCTRL+K') parent.AppendSeparator() zoommenu = wx.Menu(title='') - parent.AppendMenu(wx.ID_ZOOM_FIT, _("Zoom"), zoommenu) + parent.Append(wx.ID_ZOOM_FIT, _("Zoom"), zoommenu) for idx, value in enumerate(ZOOM_FACTORS): new_item = AppendMenu(zoommenu, help='', kind=wx.ITEM_RADIO, text=str(int(round(value * 100))) + "%") @@ -569,8 +569,8 @@ self.ProjectPanel = wx.SplitterWindow( id=ID_PLCOPENEDITORPROJECTPANEL, - name='ProjectPanel', parent=self.LeftNoteBook, point=wx.Point(0, 0), - size=wx.Size(0, 0), style=wx.SP_3D) + name='ProjectPanel', parent=self.LeftNoteBook, + size=wx.Size(0, 0)) self.ProjectTree = CustomTree(id=ID_PLCOPENEDITORPROJECTTREE, name='ProjectTree', @@ -617,7 +617,7 @@ MenuToolBar = wx.ToolBar(self, ID_PLCOPENEDITOREDITORMENUTOOLBAR, wx.DefaultPosition, wx.DefaultSize, - wx.TB_FLAT | wx.TB_NODIVIDER | wx.NO_BORDER) + wx.TB_FLAT | wx.TB_HORIZONTAL | wx.NO_BORDER) MenuToolBar.SetToolBitmapSize(wx.Size(25, 25)) MenuToolBar.Realize() self.Panes["MenuToolBar"] = MenuToolBar @@ -628,9 +628,10 @@ EditorToolBar = wx.ToolBar(self, ID_PLCOPENEDITOREDITORTOOLBAR, wx.DefaultPosition, wx.DefaultSize, - wx.TB_FLAT | wx.TB_NODIVIDER | wx.NO_BORDER) + wx.TB_FLAT | wx.TB_HORIZONTAL | wx.NO_BORDER) EditorToolBar.SetToolBitmapSize(wx.Size(25, 25)) EditorToolBar.AddRadioTool(ID_PLCOPENEDITOREDITORTOOLBARSELECTION, + _("Select"), GetBitmap("select"), wx.NullBitmap, _("Select an object")) @@ -921,12 +922,8 @@ :param elements: List of elements to refresh. """ - try: - for element in elements: - self.RefreshFunctions[element]() - except wx.PyDeadObjectError: - # ignore exceptions caused by refresh while quitting - pass + for element in elements: + self.RefreshFunctions[element]() def OnPageClose(self, event): """Callback function when AUINotebook Page closed with CloseButton @@ -1418,7 +1415,8 @@ self.AuiTabCtrl = auitabctrl if self.TabsOpened.GetPageCount() == 0: pane = self.AUIManager.GetPane(self.TabsOpened) - if pane.IsMaximized(): + # on wxPython 4.1.0, AuiPaneInfo has no "IsMaximized" attribute... + if (not hasattr(pane, "IsMaximized")) or pane.IsMaximized(): self.AUIManager.RestorePane(pane) self.AUIManager.Update() @@ -1499,17 +1497,23 @@ def GetTabsOpenedDClickFunction(self, tabctrl): def OnTabsOpenedDClick(event): pos = event.GetPosition() - if tabctrl.TabHitTest(pos.x, pos.y, None): + if tabctrl.TabHitTest(pos.x, pos.y): self.SwitchPerspective(event) event.Skip() return OnTabsOpenedDClick def SwitchPerspective(self, evt): pane = self.AUIManager.GetPane(self.TabsOpened) - if pane.IsMaximized(): + # on wxPython 4.1.0, AuiPaneInfo has no "IsMaximized" attribute... + IsMaximized = pane.IsMaximized() if hasattr(pane, "IsMaximized") \ + else (self.TabBookIsMaximized if hasattr(self, "TabBookIsMaximized") \ + else False) + if IsMaximized: self.AUIManager.RestorePane(pane) + self.TabBookIsMaximized = False else: self.AUIManager.MaximizePane(pane) + self.TabBookIsMaximized = True self.AUIManager.Update() def SwitchFullScrMode(self, evt): @@ -1808,7 +1812,7 @@ else: block_type = "Action" self.LastToolTipItem = item - wx.CallAfter(self.ProjectTree.SetToolTipString, + wx.CallAfter(self.ProjectTree.SetToolTip, "%s : %s : %s" % ( block_type, bodytype, item_infos["name"])) elif self.LastToolTipItem is not None: @@ -1923,7 +1927,7 @@ new_item = AppendMenu(menu, help='', kind=wx.ITEM_NORMAL, text=_("Paste POU")) self.Bind(wx.EVT_MENU, self.OnPastePou, new_item) if self.GetCopyBuffer() is None: - menu.Enable(new_item, False) + new_item.Enable(False) elif name == "Configurations": menu = wx.Menu(title='') @@ -2118,7 +2122,7 @@ MenuToolBar.AddSeparator() else: id, bitmap, help, callback = toolbar_item - MenuToolBar.AddSimpleTool(id=id, shortHelpString=help, bitmap=GetBitmap(bitmap)) + MenuToolBar.AddTool(id, help, GetBitmap(bitmap), help) if callback is not None: self.Bind(wx.EVT_TOOL, callback, id=id) MenuToolBar.Realize() @@ -2155,13 +2159,13 @@ self.CurrentEditorToolBar = [] EditorToolBar = self.Panes["EditorToolBar"] if EditorToolBar: - for radio, modes, id, method, picture, help in self.EditorToolBarItems[menu]: + for radio, modes, id, method_name, picture, help in self.EditorToolBarItems[menu]: if modes & self.DrawingMode: if radio or self.DrawingMode == FREEDRAWING_MODE: - EditorToolBar.AddRadioTool(id, GetBitmap(picture), wx.NullBitmap, help) + EditorToolBar.AddRadioTool(id, method_name, GetBitmap(picture), wx.NullBitmap, help) else: - EditorToolBar.AddSimpleTool(id, GetBitmap(picture), help) - self.Bind(wx.EVT_MENU, getattr(self, method), id=id) + EditorToolBar.AddTool(id, method_name, GetBitmap(picture), help) + self.Bind(wx.EVT_MENU, getattr(self, method_name), id=id) self.CurrentEditorToolBar.append(id) EditorToolBar.Realize() self.AUIManager.GetPane("EditorToolBar").Show() diff -r ac0e6de439b5 -r 838242d34741 LocalRuntimeMixin.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/LocalRuntimeMixin.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,57 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +import os +import sys +import tempfile +import random +import shutil + +from util.ProcessLogger import ProcessLogger +from util.paths import Bpath + +LocalRuntimeInterpreterPath = \ + os.environ.get("BEREMIZPYTHONPATH", sys.executable) + +LocalHost = os.environ.get("BEREMIZ_LOCAL_HOST", "localhost") + +class LocalRuntimeMixin(): + + def __init__(self, log, use_gui=True): + self.local_runtime_log = log + self.local_runtime = None + self.runtime_port = None + self.local_runtime_tmpdir = None + self.use_gui = use_gui + + def StartLocalRuntime(self): + if (self.local_runtime is None) or (self.local_runtime.exitcode is not None): + # create temporary directory for runtime working directory + self.local_runtime_tmpdir = tempfile.mkdtemp() + # choose an arbitrary random port for runtime + self.runtime_port = int(random.random() * 1000) + 61131 + self.local_runtime_log.write(_("Starting local runtime...\n")) + # launch local runtime + self.local_runtime = ProcessLogger( + self.local_runtime_log, + ("\"%s\" \"%s\" -p %s -i "+LocalHost+" %s %s") % ( + LocalRuntimeInterpreterPath, + Bpath("Beremiz_service.py"), + self.runtime_port, + {False: "-x 0", True: "-x 1"}[self.use_gui], + self.local_runtime_tmpdir), + no_gui=False, + timeout=500, keyword=self.local_runtime_tmpdir, + cwd=self.local_runtime_tmpdir) + self.local_runtime.spin() + return self.runtime_port + + def KillLocalRuntime(self): + if self.local_runtime is not None: + # shutdown local runtime + self.local_runtime.kill(gently=False) + # clear temp dir + shutil.rmtree(self.local_runtime_tmpdir) + + self.local_runtime = None + diff -r ac0e6de439b5 -r 838242d34741 PLCOpenEditor.py --- a/PLCOpenEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/PLCOpenEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -31,6 +31,7 @@ import getopt import wx +import wx.adv import version import util.paths as paths @@ -355,6 +356,7 @@ open_pdf(os.path.join(beremiz_dir, "plcopen", "TC6_XML_V101.pdf")) def OnAboutMenu(self, event): + info = wx.adv.AboutDialogInfo() info = version.GetAboutDialogInfo() info.Name = "PLCOpenEditor" info.Description = _("PLCOpenEditor is part of Beremiz project.\n\n" diff -r ac0e6de439b5 -r 838242d34741 ProjectController.py --- a/ProjectController.py Wed Mar 01 10:54:54 2023 +0100 +++ b/ProjectController.py Fri Mar 03 19:20:49 2023 +0100 @@ -1226,6 +1226,13 @@ self.logger.write_error(traceback.format_exc()) return False + # Extensions also need plcCFLAGS in case they include beremiz.h + CTNLocationCFilesAndCFLAGS = [ + (loc, [ + (code, self.plcCFLAGS+" "+cflags) + for code,cflags in code_and_cflags], do_calls) + for loc, code_and_cflags, do_calls in CTNLocationCFilesAndCFLAGS] + self.LocationCFilesAndCFLAGS = LibCFilesAndCFLAGS + \ CTNLocationCFilesAndCFLAGS self.LDFLAGS = CTNLDFLAGS + LibLDFLAGS @@ -1526,7 +1533,8 @@ # clear previous_plcstate to restore status # in UpdateMethodsFromPLCStatus() self.previous_plcstate = "" - self.AppFrame.ProgressStatusBar.Hide() + if self.AppFrame is not None: + self.AppFrame.ProgressStatusBar.Hide() self.UpdateMethodsFromPLCStatus() def PullPLCStatusProc(self, event): @@ -1790,13 +1798,16 @@ """ Start PLC """ + success = False if self.GetIECProgramsAndVariables(): self._connector.StartPLC() self.logger.write(_("Starting PLC\n")) self._connect_debug() + success = True else: self.logger.write_error(_("Couldn't start PLC !\n")) wx.CallAfter(self.UpdateMethodsFromPLCStatus) + return success def _Stop(self): """ @@ -1810,6 +1821,10 @@ wx.CallAfter(self.UpdateMethodsFromPLCStatus) + def StartLocalRuntime(self): + if self.AppFrame: + return self.AppFrame.StartLocalRuntime() + def _SetConnector(self, connector, update_status=True): self._connector = connector if self.AppFrame is not None: @@ -1826,6 +1841,7 @@ wx.CallAfter(self.UpdateMethodsFromPLCStatus) def _Connect(self): + success = False # don't accept re-connetion if already connected if self._connector is not None: self.logger.write_error( @@ -1887,6 +1903,8 @@ else: self.logger.write_warning( _("Debug does not match PLC - stop/transfert/start to re-enable\n")) + success = True + return success def CompareLocalAndRemotePLC(self): if self._connector is None: @@ -1910,6 +1928,7 @@ self._SetConnector(None) def _Transfer(self): + success = False if self.IsPLCStarted(): dialog = wx.MessageDialog( self.AppFrame, @@ -1972,16 +1991,19 @@ if self.GetIECProgramsAndVariables(): self.UnsubscribeAllDebugIECVariable() self.ProgramTransferred() - self.AppFrame.CloseObsoleteDebugTabs() - self.AppFrame.RefreshPouInstanceVariablesPanel() - self.AppFrame.LogViewer.ResetLogCounters() + if self.AppFrame is not None: + self.AppFrame.CloseObsoleteDebugTabs() + self.AppFrame.RefreshPouInstanceVariablesPanel() + self.AppFrame.LogViewer.ResetLogCounters() self.logger.write(_("PLC installed successfully.\n")) + success = True else: self.logger.write_error(_("Missing debug data\n")) else: self.logger.write_error(_("PLC couldn't be installed\n")) wx.CallAfter(self.UpdateMethodsFromPLCStatus) + return success def _Repair(self): dialog = wx.MessageDialog( diff -r ac0e6de439b5 -r 838242d34741 README.md --- a/README.md Wed Mar 01 10:54:54 2023 +0100 +++ b/README.md Fri Mar 03 19:20:49 2023 +0100 @@ -1,4 +1,6 @@ +<!--- [](https://beremiz.readthedocs.io) +--> # Beremiz # @@ -10,109 +12,200 @@ Beremiz consists of two components: -* Integrated Development Environment (IDE), [Beremiz.py](https://bitbucket.org/automforge/beremiz/src/tip/Beremiz.py?at=default). It's running on user's computer and is used to write/compile/debug PLC programs and control PLC runtime. -* Reference runtime implementation in python, [Beremiz_service.py](https://bitbucket.org/automforge/beremiz/src/tip/Beremiz_service.py?at=default). It's running on target platform, communicates with I/O and executes PLC program. +* Integrated Development Environment (IDE), Beremiz.py. It is running on user's computer and is used to write/compile/debug PLC programs and control PLC runtime. +* Reference runtime implementation in python, Beremiz_service.py. It's running on target platform, communicates with I/O and executes PLC program. See official [Beremiz website](http://www.beremiz.org/) for more information. -## Build on Linux ## - -* Prerequisites - - # Ubuntu/Debian : - sudo apt-get install build-essential bison flex autoconf - sudo apt-get install python-wxgtk3.0 pyro mercurial - sudo apt-get install python-nevow python-matplotlib python-lxml python-zeroconf python-cycler - sudo apt-get install python-autobahn python-u-msgpack - - sudo apt-get install libpython2.7-dev - pip2 install --user sslpsk posix_spawn - -* Prepare - - mkdir ~/Beremiz - cd ~/Beremiz - -* Get Source Code - - cd ~/Beremiz - hg clone https://bitbucket.org/automforge/beremiz - hg clone https://bitbucket.org/automforge/matiec - -* Build MatIEC compiler - - cd ~/Beremiz/matiec - autoreconf -i - ./configure - make - -* Build CanFestival (optional) - Only needed for CANopen support. Please read CanFestival manual to choose CAN interface other than 'virtual'. - - cd ~/Beremiz - hg clone http://dev.automforge.net/CanFestival-3 - cd ~/Beremiz/CanFestival-3 - ./configure --can=virtual - make - -* Build Modbus library (optional) - Only needed for Modbus support. - - cd ~/Beremiz - hg clone https://bitbucket.org/mjsousa/modbus Modbus - cd ~/Beremiz/Modbus - make - -* Build BACnet (optional) - Only needed for BACnet support. - - cd ~/Beremiz - svn checkout https://svn.code.sf.net/p/bacnet/code/trunk/bacnet-stack/ BACnet - cd BACnet - make MAKE_DEFINE='-fPIC' MY_BACNET_DEFINES='-DPRINT_ENABLED=1 -DBACAPP_ALL -DBACFILE -DINTRINSIC_REPORTING -DBACNET_TIME_MASTER -DBACNET_PROPERTY_LISTS=1 -DBACNET_PROTOCOL_REVISION=16' library - - -* Launch Beremiz IDE - - cd ~/Beremiz/beremiz - python Beremiz.py +## Install latest release ## + +Windows installer and Snap package for Linux are available in [Github releases](https://github.com/beremiz/beremiz/releases) and [Snapcraft's store](https://snapcraft.io/beremiz) + +## Tutorials and examples ## + +In IDE, find menu "File>Tutorials and examples" to quickly open examples that should run as-is. + +There are more examples in `tests/projects` and `exemples` directories. + +Some example and test are shown on [Beremiz youtube channel](https://www.youtube.com/channel/UCcE4KYI0p1f6CmSwtzyg-ZA). + +## Development with Beremiz ## + +Developers are invited to subscribe to [mailing list](https://sourceforge.net/p/beremiz/mailman/beremiz-devel/) (beremiz-devel@lists.sourceforge.net). + +The list is moderated and requires subscription before posting. + +To subscribe to the mailing list go [here](https://sourceforge.net/p/beremiz/mailman/beremiz-devel/). + +Searchable archive using search engine of your choice is available [here](http://beremiz-devel.2374573.n4.nabble.com/). + +## Build on Linux (developer setup) ## + +### Prerequisites (Ubuntu/Debian) : +``` +sudo apt-get install build-essential bison flex autoconf +sudo apt-get install python2-dev libpython2.7-dev libgtk-3-dev libssl-dev libgl1-mesa-dev libglu1-mesa-dev python-setuptools + +python2 -m pip install \ + future \ + matplotlib \ + msgpack_python \ + u-msgpack-python \ + zeroconf2 \ + enum34 \ + pyro \ + sslpsk \ + posix_spawn \ + twisted \ + nevow \ + autobahn \ + click \ + opcua \ + pycountry \ + fonttools \ + Brotli \ + lxml==4.5.0 \ + wxPython==4.1.1 + +``` + +### Prepare build directory + +All commands hereafter assume that selected directory to contain all downloaded source code and build results is `~/Beremiz` + +``` +mkdir ~/Beremiz +cd ~/Beremiz +``` + +### Get Source Code (Mercurial) + +``` +cd ~/Beremiz +hg clone https://hg.beremiz.org/beremiz +hg clone https://hg.beremiz.org/matiec +``` + +### Get Source Code (Git) + +``` +cd ~/Beremiz +git clone https://github.com/beremiz/beremiz +git clone https://github.com/beremiz/matiec +``` + +### Build MatIEC compiler + +``` +cd ~/Beremiz/matiec +autoreconf -i +./configure +make +``` + +### Build CanFestival (optional) + +Only needed for CANopen support. Please read CanFestival manual to choose CAN interface other than `virtual`. + +``` +cd ~/Beremiz +hg clone http://hg.beremiz.org/CanFestival-3 +cd ~/Beremiz/CanFestival-3 +./configure --can=virtual +make +``` + +### Build Modbus library (optional) + +Only needed for Modbus support. + +``` +cd ~/Beremiz +hg clone https://hg.beremiz.org/Modbus +cd ~/Beremiz/Modbus +make +``` + +### Build BACnet (optional) + +Only needed for BACnet support. + +``` +cd ~/Beremiz +svn checkout https://svn.code.sf.net/p/bacnet/code/trunk/bacnet-stack/ BACnet +cd BACnet +make MAKE_DEFINE='-fPIC' MY_BACNET_DEFINES='-DPRINT_ENABLED=1 -DBACAPP_ALL -DBACFILE -DINTRINSIC_REPORTING -DBACNET_TIME_MASTER -DBACNET_PROPERTY_LISTS=1 -DBACNET_PROTOCOL_REVISION=16' library +``` + +### Launch Beremiz IDE + +``` +cd ~/Beremiz/beremiz +python Beremiz.py +``` ## Run standalone Beremiz runtime ## -Runtime implementation can be different on different platforms. -For example, PLC used Cortex-M most likely would have C-based runtime. Beremiz project contains reference implementation in python, that can be easily run on GNU/Linux, Windows and Mac OS X. -This section will describe how to run it. - -If project's URL is 'LOCAL://', then IDE launches temprorary instance of Beremiz python runtime (Beremiz_service.py) localy as user tries to connect to PLC. This allows to debug programs localy without PLC. - -If you want to run Beremiz_service.py as standalone service, then follow these instructions: - * Start standalone Beremiz service - cd ~/Beremiz - mkdir beremiz_workdir - cd ~/beremiz - python Beremiz_service.py -p 61194 -i localhost -x 0 -a 1 ~/Beremiz/beremiz_workdir - -* Launch Beremiz IDE - - cd ~/Beremiz/beremiz - python Beremiz.py - -* Open/Create PLC project in Beremiz IDE. - Enter target location URI in project's settings (project->Config->BeremizRoot/URI_location) pointed to your running Beremiz service (For example, PYRO://127.0.0.1:61194). - Save project and connect to running Beremiz service. - -## Examples ## - -Almost for all functionality exists example in ['tests'](https://bitbucket.org/automforge/beremiz/src/tip/tests/?at=default) directory. -Most of examples are shown on [Beremiz youtube channel](https://www.youtube.com/channel/UCcE4KYI0p1f6CmSwtzyg-ZA). +``` +mkdir ~/beremiz_runtime_workdir +python Beremiz_service.py -p 61194 -i localhost -x 0 -a 1 ~/beremiz_runtime_workdir +``` + +To connect IDE with runtime, enter target location URI in project's settings (project->Config->BeremizRoot/URI_location) pointed to your running Beremiz service in this case : + +``` +PYRO://127.0.0.1:61194 +``` + +If project's URL is 'LOCAL://', then IDE launches on demand a local instance of Beremiz python runtime working on a temporary directory. + +## Build documentation + +Source code for documentation is stored in `doc` directory in project's source tree. +It's written in reStructuredText (ReST) and uses Sphinx to generate documentation in different formats. + +To build documentation you need following packages on Ubuntu/Debian: + +``` +sudo apt-get install build-essential python-sphynx +``` + +### Documentation in HTML + +Build documentation + +``` +cd ~/Beremiz/doc +make all +``` + +Result documentation is stored in directories `doc/_build/dirhtml*`. + +### Documentation in PDF + +To build pdf documentation you have to install additional packages on Ubuntu/Debian: + +``` +sudo apt-get install textlive-latex-base texlive-latex-recommended \ + texlive-fonts-recommended texlive-latex-extra +``` + +Build documentation + +``` +cd ~/Beremiz/doc +make latexpdf +``` + +Result documentation is stored in `doc/_build/latex/Beremiz.pdf`. ## Documentation ## * See [Beremiz youtube channel](https://www.youtube.com/channel/UCcE4KYI0p1f6CmSwtzyg-ZA) to get quick information how to use Beremiz IDE. - - * [Official user manual](http://beremiz.readthedocs.io/) is built from sources in doc directory. + + * [Official documentation](http://beremiz.readthedocs.io/) is built from sources in doc directory. Documentation does not cover all aspects of Beremiz use yet. Contribution are very welcome! @@ -126,12 +219,3 @@ * See official [Beremiz website](http://www.beremiz.org/) for more information. -## Support and development ## - -Main community support channel is [mailing list](https://sourceforge.net/p/beremiz/mailman/beremiz-devel/) (beremiz-devel@lists.sourceforge.net). - -The list is moderated and requires subscription for posting to it. - -To subscribe to the mailing list go [here](https://sourceforge.net/p/beremiz/mailman/beremiz-devel/). - -Searchable archive using search engine of your choice is available [here](http://beremiz-devel.2374573.n4.nabble.com/). \ No newline at end of file diff -r ac0e6de439b5 -r 838242d34741 bacnet/BacnetSlaveEditor.py --- a/bacnet/BacnetSlaveEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/bacnet/BacnetSlaveEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -367,8 +367,7 @@ "Engineering Units": {"GridCellEditor": wx.grid.GridCellChoiceEditor, # use string renderer with choice editor! "GridCellRenderer": wx.grid.GridCellStringRenderer, - # syntax for GridCellChoiceEditor -> comma separated values - "GridCellEditorParam": ','.join([x[0] for x in BACnetEngineeringUnits])} + "GridCellEditorConstructorArgs": [x[0] for x in BACnetEngineeringUnits]} } # obj_properties should be a dictionary, with keys "Object Identifier", @@ -576,7 +575,10 @@ PropertyName = self.BACnetObjectType.PropertyNames[col] PropertyConfig = self.BACnetObjectType.PropertyConfig[PropertyName] grid.SetReadOnly(row, col, False) - grid.SetCellEditor(row, col, PropertyConfig["GridCellEditor"]()) + GridCellEditorConstructorArgs = \ + PropertyConfig["GridCellEditorConstructorArgs"] + if "GridCellEditorConstructorArgs" in PropertyConfig else [] + grid.SetCellEditor(row, col, PropertyConfig["GridCellEditor"](*GridCellEditorConstructorArgs)) grid.SetCellRenderer(row, col, PropertyConfig["GridCellRenderer"]()) grid.SetCellBackgroundColour(row, col, wx.WHITE) grid.SetCellTextColour(row, col, wx.BLACK) @@ -816,7 +818,7 @@ self, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) controls_sizer.Add(button) @@ -826,7 +828,7 @@ # use only to enable drag'n'drop # self.VariablesGrid.SetDropTarget(VariableDropTarget(self)) self.VariablesGrid.Bind( - wx.grid.EVT_GRID_CELL_CHANGE, self.OnVariablesGridCellChange) + wx.grid.EVT_GRID_CELL_CHANGING, self.OnVariablesGridCellChange) # self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_LEFT_CLICK, self.OnVariablesGridCellLeftClick) # self.VariablesGrid.Bind(wx.grid.EVT_GRID_EDITOR_SHOWN, self.OnVariablesGridEditorShown) self.MainSizer.Add(self.VariablesGrid, flag=wx.GROW) diff -r ac0e6de439b5 -r 838242d34741 canfestival/NetworkEditor.py --- a/canfestival/NetworkEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/canfestival/NetworkEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -68,7 +68,7 @@ main_sizer.AddGrowableCol(0) main_sizer.AddGrowableRow(0) - main_sizer.AddWindow(self.NetworkNodes, 0, border=5, flag=wx.GROW | wx.ALL) + main_sizer.Add(self.NetworkNodes, 0, border=5, flag=wx.GROW | wx.ALL) self.NetworkEditor.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 connectors/SchemeEditor.py --- a/connectors/SchemeEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/connectors/SchemeEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -28,19 +28,19 @@ (wx.StaticText(self, label=label), wx.ALIGN_CENTER_VERTICAL), (txtctrl, wx.GROW)]: - self.fieldsizer.AddWindow(win, flag=flag) + self.fieldsizer.Add(win, flag=flag) self.fieldsizer.AddSpacer(20) if self.EnableIDSelector: self.mainsizer = wx.FlexGridSizer(cols=2, hgap=10, vgap=10) - self.mainsizer.AddSizer(self.fieldsizer) + self.mainsizer.Add(self.fieldsizer) self.idselector = IDBrowser( self, parent.ctr, # use a callafter, as editor can be deleted by calling SetURI partial(wx.CallAfter, parent.SetURI), self.txtctrls["ID"].SetValue) - self.mainsizer.AddWindow(self.idselector) + self.mainsizer.Add(self.idselector) self.SetSizer(self.mainsizer) else: self.SetSizer(self.fieldsizer) diff -r ac0e6de439b5 -r 838242d34741 connectors/__init__.py --- a/connectors/__init__.py Wed Mar 01 10:54:54 2023 +0100 +++ b/connectors/__init__.py Fri Mar 03 19:20:49 2023 +0100 @@ -27,6 +27,7 @@ from __future__ import absolute_import +import os from os import listdir, path from connectors.ConnectorBase import ConnectorBase @@ -60,6 +61,8 @@ schemes += [scheme] +LocalHost = os.environ.get("BEREMIZ_LOCAL_HOST", "localhost") + def ConnectorFactory(uri, confnodesroot): """ Return a connector corresponding to the URI @@ -76,9 +79,8 @@ # pyro connection to local runtime # started on demand, listening on random port scheme = "PYRO" - runtime_port = confnodesroot.AppFrame.StartLocalRuntime( - taskbaricon=True) - uri = "PYROLOC://127.0.0.1:" + str(runtime_port) + runtime_port = confnodesroot.StartLocalRuntime() + uri = "PYROLOC://"+LocalHost+":" + str(runtime_port) # commented code to enable for MDNS:// support # elif _scheme == "MDNS": diff -r ac0e6de439b5 -r 838242d34741 controls/CustomEditableListBox.py --- a/controls/CustomEditableListBox.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/CustomEditableListBox.py Fri Mar 03 19:20:49 2023 +0100 @@ -25,13 +25,13 @@ from __future__ import absolute_import import wx -import wx.gizmos +import wx.adv -class CustomEditableListBox(wx.gizmos.EditableListBox): +class CustomEditableListBox(wx.adv.EditableListBox): def __init__(self, *args, **kwargs): - wx.gizmos.EditableListBox.__init__(self, *args, **kwargs) + wx.adv.EditableListBox.__init__(self, *args, **kwargs) listbox = self.GetListCtrl() listbox.Bind(wx.EVT_KEY_DOWN, self.OnKeyDown) @@ -44,7 +44,7 @@ (self.GetDelButton(), _("Delete item"), "_OnDelButton"), (self.GetUpButton(), _("Move up"), "_OnUpButton"), (self.GetDownButton(), _("Move down"), "_OnDownButton")]: - button.SetToolTipString(tooltip) + button.SetToolTip(tooltip) button.Bind(wx.EVT_BUTTON, self.GetButtonPressedFunction(call_function)) self.Editing = False diff -r ac0e6de439b5 -r 838242d34741 controls/CustomStyledTextCtrl.py --- a/controls/CustomStyledTextCtrl.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/CustomStyledTextCtrl.py Fri Mar 03 19:20:49 2023 +0100 @@ -105,9 +105,9 @@ [self.GetMarginWidth(i) for i in xrange(3)], 0) if x <= margin_width: - self.SetCursor(wx.StockCursor(wx.CURSOR_ARROW)) + self.SetCursor(wx.Cursor(wx.CURSOR_ARROW)) else: - self.SetCursor(wx.StockCursor(wx.CURSOR_IBEAM)) + self.SetCursor(wx.Cursor(wx.CURSOR_IBEAM)) else: event.Skip() else: diff -r ac0e6de439b5 -r 838242d34741 controls/CustomTable.py --- a/controls/CustomTable.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/CustomTable.py Fri Mar 03 19:20:49 2023 +0100 @@ -40,7 +40,7 @@ """ def __init__(self, parent, data, colnames): # The base class must be initialized *first* - wx.grid.PyGridTableBase.__init__(self) + wx.grid.GridTableBase.__init__(self) self.data = data self.colnames = colnames self.Highlights = {} @@ -64,7 +64,7 @@ return self.colnames[col] def GetRowLabelValue(self, row, translate=True): - return row + return str(row) def GetValue(self, row, col): if row < self.GetNumberRows(): diff -r ac0e6de439b5 -r 838242d34741 controls/CustomToolTip.py --- a/controls/CustomToolTip.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/CustomToolTip.py Fri Mar 03 19:20:49 2023 +0100 @@ -137,7 +137,7 @@ max_width = max_height = 0 # Create a memory DC for calculating text extent - dc = wx.MemoryDC(wx.EmptyBitmap(1, 1)) + dc = wx.MemoryDC(wx.Bitmap(1, 1)) dc.SetFont(self.Font) # Compute max tip text size @@ -175,7 +175,6 @@ dc.SetFont(self.Font) # Draw Tool tip - dc.BeginDrawing() tip_width, tip_height = self.GetToolTipSize() # Draw background rectangle @@ -188,6 +187,5 @@ _line_width, line_height = dc.GetTextExtent(line) line_offset += line_height - dc.EndDrawing() event.Skip() diff -r ac0e6de439b5 -r 838242d34741 controls/CustomTree.py --- a/controls/CustomTree.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/CustomTree.py Fri Mar 03 19:20:49 2023 +0100 @@ -120,9 +120,9 @@ _item, flags = self.HitTest(pos) bitmap_rect = self.GetBitmapRect() - if ((bitmap_rect.InsideXY(pos.x, pos.y) or + if ((bitmap_rect.Contains(pos.x, pos.y) or flags & wx.TREE_HITTEST_NOWHERE) and self.AddMenu is not None): - wx.CallAfter(self.PopupMenuXY, self.AddMenu, pos.x, pos.y) + wx.CallAfter(self.PopupMenu, self.AddMenu, pos.x, pos.y) event.Skip() def OnEraseBackground(self, event): diff -r ac0e6de439b5 -r 838242d34741 controls/DebugVariablePanel/DebugVariableGraphicViewer.py --- a/controls/DebugVariablePanel/DebugVariableGraphicViewer.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DebugVariablePanel/DebugVariableGraphicViewer.py Fri Mar 03 19:20:49 2023 +0100 @@ -166,6 +166,7 @@ # Display message if data is invalid if message is not None: wx.CallAfter(self.ShowMessage, message) + return False # Data contain a reference to a variable to debug elif values[1] == "debug": @@ -174,7 +175,7 @@ # If mouse is dropped in graph canvas bounding box and graph is # not 3D canvas, graphs will be merged rect = self.ParentControl.GetAxesBoundingBox() - if not self.ParentControl.Is3DCanvas() and rect.InsideXY(x, y): + if not self.ParentControl.Is3DCanvas() and rect.Contains(x, y): # Default merge type is parallel merge_type = GRAPH_PARALLEL @@ -182,7 +183,7 @@ # wall be merged orthogonally merge_rect = wx.Rect(rect.x, rect.y, rect.width / 2., rect.height) - if merge_rect.InsideXY(x, y): + if merge_rect.Contains(x, y): merge_type = GRAPH_ORTHOGONAL # Merge graphs @@ -209,6 +210,8 @@ self.ParentWindow.InsertValue(values[0], target_idx, force=True) + return True + return False def OnLeave(self): """ @@ -278,7 +281,6 @@ FigureCanvas.__init__(self, parent, -1, self.Figure) self.SetWindowStyle(wx.WANTS_CHARS) - self.SetBackgroundColour(wx.WHITE) # Bind wx events self.Bind(wx.EVT_LEFT_DCLICK, self.OnLeftDClick) @@ -625,7 +627,7 @@ (x0, y0), (x1, y1) = t.get_window_extent().get_points() rect = wx.Rect(x0, height - y1, x1 - x0, y1 - y0) # Check if mouse was over label - if rect.InsideXY(x, y): + if rect.Contains(x, y): item_idx = i break @@ -736,7 +738,7 @@ (x0, y0), (x1, y1) = t.get_window_extent().get_points() rect = wx.Rect(x0, height - y1, x1 - x0, y1 - y0) # Check if mouse was over label - if rect.InsideXY(event.x, height - event.y): + if rect.Contains(event.x, height - event.y): item_idx = i menu_direction = dir break @@ -756,7 +758,7 @@ # Update resize highlight if event.y <= 5: if self.SetHighlight(HIGHLIGHT_RESIZE): - self.SetCursor(wx.StockCursor(wx.CURSOR_SIZENS)) + self.SetCursor(wx.Cursor(wx.CURSOR_SIZENS)) self.ParentWindow.ForceRefresh() else: if self.SetHighlight(HIGHLIGHT_NONE): @@ -832,7 +834,7 @@ # Check that double click was done inside figure pos = event.GetPosition() rect = self.GetAxesBoundingBox() - if rect.InsideXY(pos.x, pos.y): + if rect.Contains(pos.x, pos.y): # Reset Cursor tick to value before starting clicking self.ParentWindow.SetCursorTick(self.StartCursorTick) # Toggle to text Viewer(s) @@ -926,10 +928,10 @@ # Mouse is over Viewer figure and graph is not 3D bbox = self.GetAxesBoundingBox() - if bbox.InsideXY(x, y) and not self.Is3DCanvas(): + if bbox.Contains(x, y) and not self.Is3DCanvas(): rect = wx.Rect(bbox.x, bbox.y, bbox.width // 2, bbox.height) # Mouse is over Viewer left part of figure - if rect.InsideXY(x, y): + if rect.Contains(x, y): self.SetHighlight(HIGHLIGHT_LEFT) # Mouse is over Viewer right part of figure @@ -1381,8 +1383,6 @@ # rendering destGC = wx.GCDC(destDC) - destGC.BeginDrawing() - # Get canvas size and figure bounding box in canvas width, height = self.GetSize() bbox = self.GetAxesBoundingBox() @@ -1409,7 +1409,5 @@ # Draw other Viewer common elements self.DrawCommonElements(destGC, self.GetButtons()) - destGC.EndDrawing() - self._isDrawn = True self.gui_repaint(drawDC=drawDC) diff -r ac0e6de439b5 -r 838242d34741 controls/DebugVariablePanel/DebugVariablePanel.py --- a/controls/DebugVariablePanel/DebugVariablePanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DebugVariablePanel/DebugVariablePanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -134,6 +134,7 @@ # Display message if data is invalid if message is not None: wx.CallAfter(self.ShowMessage, message) + return False # Data contain a reference to a variable to debug elif values[1] == "debug": @@ -147,6 +148,9 @@ else: self.ParentWindow.InsertValue(values[0], force=True) + return True + return False + def OnLeave(self): """ Function called when mouse is leave Drop Target @@ -202,7 +206,6 @@ # data is available self.Force = False - self.SetBackgroundColour(wx.WHITE) main_sizer = wx.BoxSizer(wx.VERTICAL) @@ -221,14 +224,14 @@ self.GraphicPanels = [] graphics_button_sizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(graphics_button_sizer, border=5, flag=wx.GROW | wx.ALL) + main_sizer.Add(graphics_button_sizer, border=5, flag=wx.GROW | wx.ALL) range_label = wx.StaticText(self, label=_('Range:')) - graphics_button_sizer.AddWindow(range_label, flag=wx.ALIGN_CENTER_VERTICAL) + graphics_button_sizer.Add(range_label, flag=wx.ALIGN_CENTER_VERTICAL) self.CanvasRange = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnRangeChanged, self.CanvasRange) - graphics_button_sizer.AddWindow(self.CanvasRange, 1, + graphics_button_sizer.Add(self.CanvasRange, 1, border=5, flag=wx.LEFT | wx.ALIGN_CENTER_VERTICAL) @@ -246,10 +249,10 @@ button = wx.lib.buttons.GenBitmapButton( self, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) self.Bind(wx.EVT_BUTTON, getattr(self, "On" + name), button) - graphics_button_sizer.AddWindow(button, border=5, flag=wx.LEFT) + graphics_button_sizer.Add(button, border=5, flag=wx.LEFT) self.CanvasPosition = wx.ScrollBar( self, size=wx.Size(0, 16), style=wx.SB_HORIZONTAL) @@ -263,19 +266,19 @@ self.OnPositionChanging, self.CanvasPosition) self.CanvasPosition.Bind(wx.EVT_SCROLL_PAGEDOWN, self.OnPositionChanging, self.CanvasPosition) - main_sizer.AddWindow(self.CanvasPosition, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) + main_sizer.Add(self.CanvasPosition, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) self.TickSizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(self.TickSizer, border=5, flag=wx.ALL | wx.GROW) + main_sizer.Add(self.TickSizer, border=5, flag=wx.ALL | wx.GROW) self.TickLabel = wx.StaticText(self) - self.TickSizer.AddWindow(self.TickLabel, border=5, flag=wx.RIGHT) + self.TickSizer.Add(self.TickLabel, border=5, flag=wx.RIGHT) self.MaskLabel = wx.TextCtrl(self, style=wx.TE_READONLY | wx.TE_CENTER | wx.NO_BORDER) - self.TickSizer.AddWindow(self.MaskLabel, 1, border=5, flag=wx.RIGHT | wx.GROW) + self.TickSizer.Add(self.MaskLabel, 1, border=5, flag=wx.RIGHT | wx.GROW) self.TickTimeLabel = wx.StaticText(self) - self.TickSizer.AddWindow(self.TickTimeLabel) + self.TickSizer.Add(self.TickTimeLabel) self.GraphicsWindow = wx.ScrolledWindow(self, style=wx.HSCROLL | wx.VSCROLL) self.GraphicsWindow.SetBackgroundColour(wx.WHITE) @@ -284,7 +287,7 @@ self.GraphicsWindow.Bind(wx.EVT_SIZE, self.OnGraphicsWindowResize) self.GraphicsWindow.Bind(wx.EVT_MOUSEWHEEL, self.OnGraphicsWindowMouseWheel) - main_sizer.AddWindow(self.GraphicsWindow, 1, flag=wx.GROW) + main_sizer.Add(self.GraphicsWindow, 1, flag=wx.GROW) self.GraphicsSizer = wx.BoxSizer(wx.VERTICAL) self.GraphicsWindow.SetSizer(self.GraphicsSizer) @@ -441,7 +444,7 @@ x, y = panel.GetPosition() width, height = panel.GetSize() rect = wx.Rect(x, y, width, height) - if rect.InsideXY(x_mouse, y_mouse) or \ + if rect.Contains(x_mouse, y_mouse) or \ idx == 0 and y_mouse < 0 or \ idx == len(self.GraphicPanels) - 1 and y_mouse > panel.GetPosition()[1]: panel.RefreshHighlight(x_mouse - x, y_mouse - y) @@ -488,7 +491,7 @@ xw, yw = panel.GetPosition() width, height = panel.GetSize() bbox = wx.Rect(xw, yw, width, height) - if bbox.InsideXY(x_mouse, y_mouse): + if bbox.Contains(x_mouse, y_mouse): panel.ShowButtons(True) merge_type = GRAPH_PARALLEL if isinstance(panel, DebugVariableTextViewer) or panel.Is3DCanvas(): @@ -497,9 +500,9 @@ wx.CallAfter(self.MoveValue, variable, idx, True) else: rect = panel.GetAxesBoundingBox(True) - if rect.InsideXY(x_mouse, y_mouse): + if rect.Contains(x_mouse, y_mouse): merge_rect = wx.Rect(rect.x, rect.y, rect.width // 2, rect.height) - if merge_rect.InsideXY(x_mouse, y_mouse): + if merge_rect.Contains(x_mouse, y_mouse): merge_type = GRAPH_ORTHOGONAL wx.CallAfter(self.MergeGraphs, variable, idx, merge_type, force=True) else: @@ -510,7 +513,7 @@ return width, height = self.GraphicsWindow.GetVirtualSize() rect = wx.Rect(0, 0, width, height) - if rect.InsideXY(x_mouse, y_mouse): + if rect.Contains(x_mouse, y_mouse): wx.CallAfter(self.MoveValue, variable, len(self.GraphicPanels), True) self.ForceRefresh() @@ -518,7 +521,7 @@ self.GraphicsSizer.Clear() for panel in self.GraphicPanels: - self.GraphicsSizer.AddWindow(panel, flag=wx.GROW) + self.GraphicsSizer.Add(panel, flag=wx.GROW) self.GraphicsSizer.Layout() self.RefreshGraphicsWindowScrollbars() diff -r ac0e6de439b5 -r 838242d34741 controls/DebugVariablePanel/DebugVariableTextViewer.py --- a/controls/DebugVariablePanel/DebugVariableTextViewer.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DebugVariablePanel/DebugVariableTextViewer.py Fri Mar 03 19:20:49 2023 +0100 @@ -96,6 +96,7 @@ # Display message if data is invalid if message is not None: wx.CallAfter(self.ShowMessage, message) + return False # Data contain a reference to a variable to debug elif values[1] == "debug": @@ -118,6 +119,8 @@ self.ParentWindow.InsertValue(values[0], target_idx, force=True) + return True + return False def OnLeave(self): """ @@ -195,7 +198,7 @@ # Create buffered DC for drawing in panel width, height = self.GetSize() - bitmap = wx.EmptyBitmap(width, height) + bitmap = wx.Bitmap(width, height) dc = wx.BufferedDC(wx.PaintDC(self), bitmap) dc.Clear() @@ -203,8 +206,6 @@ # rendering gc = wx.GCDC(dc) - gc.BeginDrawing() - # Get first item item = self.ItemsDict.values()[0] @@ -232,8 +233,6 @@ # Draw other Viewer common elements self.DrawCommonElements(gc) - gc.EndDrawing() - def OnLeftDown(self, event): """ Function called when mouse left button is pressed @@ -252,7 +251,7 @@ # start a move drag'n drop of item variable x, y = event.GetPosition() item_path_bbox = wx.Rect(20, (height - h) / 2, w, h) - if item_path_bbox.InsideXY(x, y): + if item_path_bbox.Contains(x, y): self.ShowButtons(False) data = wx.TextDataObject(str((item.GetVariable(), "debug", "move"))) dragSource = wx.DropSource(self) diff -r ac0e6de439b5 -r 838242d34741 controls/DebugVariablePanel/GraphButton.py --- a/controls/DebugVariablePanel/GraphButton.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DebugVariablePanel/GraphButton.py Fri Mar 03 19:20:49 2023 +0100 @@ -146,7 +146,7 @@ # Test if point is inside button w, h = self.Bitmap.GetSize() rect = wx.Rect(self.Position.x, self.Position.y, w, h) - return rect.InsideXY(x, y) + return rect.Contains(x, y) def ProcessCallback(self): """ diff -r ac0e6de439b5 -r 838242d34741 controls/DiscoveryPanel.py --- a/controls/DiscoveryPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DiscoveryPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -44,17 +44,17 @@ class DiscoveryPanel(wx.Panel, listmix.ColumnSorterMixin): def _init_coll_MainSizer_Items(self, parent): - parent.AddWindow(self.staticText1, 0, border=20, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) - parent.AddWindow(self.ServicesList, 0, border=20, flag=wx.LEFT | wx.RIGHT | wx.GROW) - parent.AddSizer(self.ButtonGridSizer, 0, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) + parent.Add(self.staticText1, 0, border=20, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) + parent.Add(self.ServicesList, 0, border=20, flag=wx.LEFT | wx.RIGHT | wx.GROW) + parent.Add(self.ButtonGridSizer, 0, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) def _init_coll_MainSizer_Growables(self, parent): parent.AddGrowableCol(0) parent.AddGrowableRow(1) def _init_coll_ButtonGridSizer_Items(self, parent): - parent.AddWindow(self.RefreshButton, 0, border=0, flag=0) - # parent.AddWindow(self.ByIPCheck, 0, border=0, flag=0) + parent.Add(self.RefreshButton, 0, border=0, flag=0) + # parent.Add(self.ByIPCheck, 0, border=0, flag=0) def _init_coll_ButtonGridSizer_Growables(self, parent): parent.AddGrowableCol(0) @@ -129,10 +129,23 @@ self.IfacesMonitorTimer.Start(2000) self.Bind(wx.EVT_TIMER, self.IfacesMonitor, self.IfacesMonitorTimer) + def _cleanup(self): + if self.IfacesMonitorTimer is not None: + self.IfacesMonitorTimer.Stop() + self.IfacesMonitorTimer = None + if self.Browser is not None: + self.Browser.cancel() + self.Browser = None + if self.ZeroConfInstance is not None: + self.ZeroConfInstance.close() + self.ZeroConfInstance = None + def __del__(self): - self.IfacesMonitorTimer.Stop() - self.Browser.cancel() - self.ZeroConfInstance.close() + self._cleanup() + + def Destroy(self): + self._cleanup() + wx.Panel.Destroy(self) def IfacesMonitor(self, event): NewState = get_all_addresses(socket.AF_INET) diff -r ac0e6de439b5 -r 838242d34741 controls/DurationCellEditor.py --- a/controls/DurationCellEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/DurationCellEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -46,12 +46,12 @@ self.Duration = wx.TextCtrl(self, size=wx.Size(0, -1), style=wx.TE_PROCESS_ENTER) self.Duration.Bind(wx.EVT_KEY_DOWN, self.OnDurationChar) - main_sizer.AddWindow(self.Duration, flag=wx.GROW) + main_sizer.Add(self.Duration, flag=wx.GROW) # create browse button self.EditButton = wx.Button(self, label='...', size=wx.Size(30, -1)) self.Bind(wx.EVT_BUTTON, self.OnEditButtonClick, self.EditButton) - main_sizer.AddWindow(self.EditButton, flag=wx.GROW) + main_sizer.Add(self.EditButton, flag=wx.GROW) self.Bind(wx.EVT_SIZE, self.OnSize) @@ -98,12 +98,12 @@ self.Duration.SetFocus() -class DurationCellEditor(wx.grid.PyGridCellEditor): +class DurationCellEditor(wx.grid.GridCellEditor): ''' Grid cell editor that uses DurationCellControl to display an edit button. ''' def __init__(self, table, colname): - wx.grid.PyGridCellEditor.__init__(self) + wx.grid.GridCellEditor.__init__(self) self.Table = table self.Colname = colname diff -r ac0e6de439b5 -r 838242d34741 controls/EnhancedStatusBar.py --- a/controls/EnhancedStatusBar.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/EnhancedStatusBar.py Fri Mar 03 19:20:49 2023 +0100 @@ -85,12 +85,12 @@ class EnhancedStatusBar(wx.StatusBar): - def __init__(self, parent, id=wx.ID_ANY, style=wx.ST_SIZEGRIP, + def __init__(self, parent, id=wx.ID_ANY, style=wx.STB_SIZEGRIP, name="EnhancedStatusBar"): """Default Class Constructor. EnhancedStatusBar.__init__(self, parent, id=wx.ID_ANY, - style=wx.ST_SIZEGRIP, + style=wx.STB_SIZEGRIP, name="EnhancedStatusBar") """ @@ -100,7 +100,7 @@ self._curPos = 0 self._parent = parent - wx.EVT_SIZE(self, self.OnSize) + self.Bind(wx.EVT_SIZE, self.OnSize) wx.CallAfter(self.OnSize, None) def OnSize(self, event): diff -r ac0e6de439b5 -r 838242d34741 controls/FolderTree.py --- a/controls/FolderTree.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/FolderTree.py Fri Mar 03 19:20:49 2023 +0100 @@ -74,12 +74,12 @@ self.Bind(wx.EVT_TREE_ITEM_COLLAPSED, self.OnTreeItemCollapsed, self.Tree) self.Bind(wx.EVT_TREE_BEGIN_LABEL_EDIT, self.OnTreeBeginLabelEdit, self.Tree) self.Bind(wx.EVT_TREE_END_LABEL_EDIT, self.OnTreeEndLabelEdit, self.Tree) - main_sizer.AddWindow(self.Tree, 1, flag=wx.GROW) + main_sizer.Add(self.Tree, 1, flag=wx.GROW) if filter is not None: self.Filter = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnFilterChanged, self.Filter) - main_sizer.AddWindow(self.Filter, flag=wx.GROW) + main_sizer.Add(self.Filter, flag=wx.GROW) else: self.Filter = None @@ -160,7 +160,7 @@ if wx.Platform != '__WXMSW__': item, item_cookie = self.Tree.GetNextChild(root, item_cookie) elif self.Tree.GetItemText(item) != filename: - item = self.Tree.InsertItemBefore(root, idx, filename, self.TreeImageDict[item_type]) + item = self.Tree.InsertItem(root, idx, filename, self.TreeImageDict[item_type]) filepath = os.path.join(folderpath, filename) if item_type != FILE: if self.Tree.IsExpanded(item): diff -r ac0e6de439b5 -r 838242d34741 controls/LibraryPanel.py --- a/controls/LibraryPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/LibraryPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -77,12 +77,12 @@ search_textctrl = self.SearchCtrl.GetChildren()[0] search_textctrl.Bind(wx.EVT_CHAR, self.OnKeyDown) - main_sizer.AddWindow(self.SearchCtrl, flag=wx.GROW) + main_sizer.Add(self.SearchCtrl, flag=wx.GROW) # Add Splitter window for tree and block comment to main sizer splitter_window = wx.SplitterWindow(self) splitter_window.SetSashGravity(1.0) - main_sizer.AddWindow(splitter_window, flag=wx.GROW) + main_sizer.Add(splitter_window, flag=wx.GROW) # Add TreeCtrl for functions and function blocks library in splitter # window @@ -216,7 +216,7 @@ # Set data associated to tree item (only save that item is a # category) - self.Tree.SetPyData(category_item, {"type": CATEGORY}) + self.Tree.SetItemData(category_item, {"type": CATEGORY}) # Iterate over functions and function blocks defined in library # category add a tree item to category tree item for each of @@ -253,7 +253,7 @@ if blocktype["extensible"] else None), "comment": _(comment) + blocktype.get("usage", "") } - self.Tree.SetPyData(blocktype_item, block_data) + self.Tree.SetItemData(blocktype_item, block_data) # Select block tree item in tree if it corresponds to # previously selected one diff -r ac0e6de439b5 -r 838242d34741 controls/LocationCellEditor.py --- a/controls/LocationCellEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/LocationCellEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -46,12 +46,12 @@ self.Location = wx.TextCtrl(self, size=wx.Size(0, -1), style=wx.TE_PROCESS_ENTER) self.Location.Bind(wx.EVT_KEY_DOWN, self.OnLocationChar) - main_sizer.AddWindow(self.Location, flag=wx.GROW) + main_sizer.Add(self.Location, flag=wx.GROW) # create browse button self.BrowseButton = wx.Button(self, label='...', size=wx.Size(30, -1)) self.BrowseButton.Bind(wx.EVT_BUTTON, self.OnBrowseButtonClick) - main_sizer.AddWindow(self.BrowseButton, flag=wx.GROW) + main_sizer.Add(self.BrowseButton, flag=wx.GROW) self.Bind(wx.EVT_SIZE, self.OnSize) @@ -150,12 +150,12 @@ self.Location.SetFocus() -class LocationCellEditor(wx.grid.PyGridCellEditor): +class LocationCellEditor(wx.grid.GridCellEditor): ''' Grid cell editor that uses LocationCellControl to display a browse button. ''' def __init__(self, table, controller): - wx.grid.PyGridCellEditor.__init__(self) + wx.grid.GridCellEditor.__init__(self) self.Table = table self.Controller = controller @@ -178,7 +178,7 @@ self.CellControl.SetVarType(self.Table.GetValueByName(row, 'Type')) self.CellControl.SetFocus() - def EndEditInternal(self, row, col, grid, old_loc): + def EndEdit(self, row, col, grid, old_loc): loc = self.CellControl.GetValue() changed = loc != old_loc if changed: @@ -201,13 +201,8 @@ self.CellControl.Disable() return changed - if wx.VERSION >= (3, 0, 0): - def EndEdit(self, row, col, grid, oldval): - return self.EndEditInternal(row, col, grid, oldval) - else: - def EndEdit(self, row, col, grid): - old_loc = self.Table.GetValueByName(row, 'Location') - return self.EndEditInternal(row, col, grid, old_loc) + def ApplyEdit(self, row, col, grid): + pass def SetSize(self, rect): self.CellControl.SetDimensions(rect.x + 1, rect.y, diff -r ac0e6de439b5 -r 838242d34741 controls/LogViewer.py --- a/controls/LogViewer.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/LogViewer.py Fri Mar 03 19:20:49 2023 +0100 @@ -99,8 +99,8 @@ width, height = self.GetClientSize() range_rect = self.GetRangeRect() thumb_rect = self.GetThumbRect() - if range_rect.InsideXY(posx, posy): - if thumb_rect.InsideXY(posx, posy): + if range_rect.Contains(posx, posy): + if thumb_rect.Contains(posx, posy): self.ThumbScrollingStartPos = wx.Point(posx, posy) elif posy < thumb_rect.y: self.Parent.ScrollToLast() @@ -139,13 +139,12 @@ def OnPaint(self, event): dc = wx.BufferedPaintDC(self) dc.Clear() - dc.BeginDrawing() gc = wx.GCDC(dc) width, height = self.GetClientSize() - gc.SetPen(wx.Pen(wx.NamedColour("GREY"), 3)) + gc.SetPen(wx.Pen(wx.Colour("GREY"), 3)) gc.SetBrush(wx.GREY_BRUSH) gc.DrawLines(ArrowPoints(wx.TOP, width * 0.75, width * 0.5, 2, (width + height) // 4 - 3)) @@ -162,7 +161,7 @@ if self.Parent.IsMessagePanelBottom(): exclusion_rect.height = height - width - exclusion_rect.y if exclusion_rect != thumb_rect: - colour = wx.NamedColour("LIGHT GREY") + colour = wx.Colour("LIGHT GREY") gc.SetPen(wx.Pen(colour)) gc.SetBrush(wx.Brush(colour)) @@ -179,7 +178,6 @@ gc.DrawRectangle(thumb_rect.x, thumb_rect.y, thumb_rect.width, thumb_rect.height) - dc.EndDrawing() event.Skip() @@ -207,7 +205,7 @@ def HitTest(self, x, y): rect = wx.Rect(self.Position.x, self.Position.y, self.Size.width, self.Size.height) - if rect.InsideXY(x, y): + if rect.Contains(x, y): return True return False @@ -217,7 +215,7 @@ def Draw(self, dc): dc.SetPen(wx.TRANSPARENT_PEN) - dc.SetBrush(wx.Brush(wx.NamedColour("LIGHT GREY"))) + dc.SetBrush(wx.Brush(wx.Colour("LIGHT GREY"))) dc.DrawRectangle(self.Position.x, self.Position.y, self.Size.width, self.Size.height) @@ -303,7 +301,7 @@ main_sizer.AddGrowableRow(1) filter_sizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(filter_sizer, border=5, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) + main_sizer.Add(filter_sizer, border=5, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) self.MessageFilter = wx.ComboBox(self, style=wx.CB_READONLY) self.MessageFilter.Append(_("All")) @@ -312,7 +310,7 @@ for level in levels: self.MessageFilter.Append(_(level)) self.Bind(wx.EVT_COMBOBOX, self.OnMessageFilterChanged, self.MessageFilter) - filter_sizer.AddWindow(self.MessageFilter, 1, border=5, flag=wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) + filter_sizer.Add(self.MessageFilter, 1, border=5, flag=wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) self.SearchMessage = wx.SearchCtrl(self, style=wx.TE_PROCESS_ENTER) self.SearchMessage.ShowSearchButton(True) @@ -322,18 +320,18 @@ self.OnSearchMessageSearchButtonClick, self.SearchMessage) self.Bind(wx.EVT_SEARCHCTRL_CANCEL_BTN, self.OnSearchMessageCancelButtonClick, self.SearchMessage) - filter_sizer.AddWindow(self.SearchMessage, 3, border=5, flag=wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) + filter_sizer.Add(self.SearchMessage, 3, border=5, flag=wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) self.CleanButton = wx.lib.buttons.GenBitmapButton(self, bitmap=GetBitmap("Clean"), size=wx.Size(28, 28), style=wx.NO_BORDER) - self.CleanButton.SetToolTipString(_("Clean log messages")) + self.CleanButton.SetToolTip(_("Clean log messages")) self.Bind(wx.EVT_BUTTON, self.OnCleanButton, self.CleanButton) - filter_sizer.AddWindow(self.CleanButton) + filter_sizer.Add(self.CleanButton) message_panel_sizer = wx.FlexGridSizer(cols=2, hgap=0, rows=1, vgap=0) message_panel_sizer.AddGrowableCol(0) message_panel_sizer.AddGrowableRow(0) - main_sizer.AddSizer(message_panel_sizer, border=5, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) + main_sizer.Add(message_panel_sizer, border=5, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) self.MessagePanel = wx.Panel(self) if wx.Platform == '__WXMSW__': @@ -349,10 +347,10 @@ self.MessagePanel.Bind(wx.EVT_ERASE_BACKGROUND, self.OnMessagePanelEraseBackground) self.MessagePanel.Bind(wx.EVT_PAINT, self.OnMessagePanelPaint) self.MessagePanel.Bind(wx.EVT_SIZE, self.OnMessagePanelResize) - message_panel_sizer.AddWindow(self.MessagePanel, flag=wx.GROW) + message_panel_sizer.Add(self.MessagePanel, flag=wx.GROW) self.MessageScrollBar = LogScrollBar(self, wx.Size(16, -1)) - message_panel_sizer.AddWindow(self.MessageScrollBar, flag=wx.GROW) + message_panel_sizer.Add(self.MessageScrollBar, flag=wx.GROW) self.SetSizer(main_sizer) @@ -534,10 +532,9 @@ def RefreshView(self): width, height = self.MessagePanel.GetClientSize() - bitmap = wx.EmptyBitmap(width, height) + bitmap = wx.Bitmap(width, height) dc = wx.BufferedDC(wx.ClientDC(self.MessagePanel), bitmap) dc.Clear() - dc.BeginDrawing() if self.CurrentMessage is not None: @@ -559,8 +556,6 @@ draw_date = message.Date != previous_message.Date message = previous_message - dc.EndDrawing() - self.MessageScrollBar.RefreshThumbPosition() def IsPLCLogEmpty(self): @@ -711,7 +706,7 @@ if message is not None: menu = wx.Menu(title='') - menu_entry = menu.Append(help='', id=wx.ID_ANY, kind=wx.ITEM_NORMAL, text=_("Copy")) + menu_entry = menu.Append(wx.ID_ANY, _("Copy")) self.Bind(wx.EVT_MENU, self.GetCopyMessageToClipboardFunction(message), menu_entry) self.MessagePanel.PopupMenu(menu) diff -r ac0e6de439b5 -r 838242d34741 controls/PouInstanceVariablesPanel.py --- a/controls/PouInstanceVariablesPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/PouInstanceVariablesPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -1,4 +1,4 @@ -#!/usr/bin/env python +#.!/usr/bin/env python # -*- coding: utf-8 -*- # This file is part of Beremiz, a Integrated Development Environment for @@ -93,7 +93,7 @@ rect = wx.Rect(images_bbx.x + 4, images_bbx.y + 4, r_image_w, r_image_h) for r_image in rightimages: - if rect.Inside(point): + if rect.Contains(point): return r_image rect.x += r_image_w + 4 @@ -132,7 +132,7 @@ self.ParentButton = wx.lib.buttons.GenBitmapButton( self, bitmap=GetBitmap("top"), size=wx.Size(28, 28), style=wx.NO_BORDER) - self.ParentButton.SetToolTipString(_("Parent instance")) + self.ParentButton.SetToolTip(_("Parent instance")) self.Bind(wx.EVT_BUTTON, self.OnParentButtonClick, self.ParentButton) @@ -142,7 +142,7 @@ self.DebugButton = wx.lib.buttons.GenBitmapButton( self, bitmap=GetBitmap("debug_instance"), size=wx.Size(28, 28), style=wx.NO_BORDER) - self.DebugButton.SetToolTipString(_("Debug instance")) + self.DebugButton.SetToolTip(_("Debug instance")) self.Bind(wx.EVT_BUTTON, self.OnDebugButtonClick, self.DebugButton) @@ -188,16 +188,16 @@ buttons_sizer = wx.FlexGridSizer(cols=3, hgap=0, rows=1, vgap=0) - buttons_sizer.AddWindow(self.ParentButton) - buttons_sizer.AddWindow(self.InstanceChoice, flag=wx.GROW) - buttons_sizer.AddWindow(self.DebugButton) + buttons_sizer.Add(self.ParentButton) + buttons_sizer.Add(self.InstanceChoice, flag=wx.GROW) + buttons_sizer.Add(self.DebugButton) buttons_sizer.AddGrowableCol(1) buttons_sizer.AddGrowableRow(0) main_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=3, vgap=0) - main_sizer.AddSizer(buttons_sizer, flag=wx.GROW) - main_sizer.AddWindow(self.VariablesList, flag=wx.GROW) - main_sizer.AddWindow(self.FilterCtrl, flag=wx.GROW) + main_sizer.Add(buttons_sizer, flag=wx.GROW) + main_sizer.Add(self.VariablesList, flag=wx.GROW) + main_sizer.Add(self.FilterCtrl, flag=wx.GROW) main_sizer.AddGrowableCol(0) main_sizer.AddGrowableRow(1) diff -r ac0e6de439b5 -r 838242d34741 controls/ProjectPropertiesPanel.py --- a/controls/ProjectPropertiesPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/ProjectPropertiesPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -57,7 +57,7 @@ border |= wx.BOTTOM st = wx.StaticText(parent, label=label) - sizer.AddWindow(st, border=10, + sizer.Add(st, border=10, flag=wx.ALIGN_CENTER_VERTICAL | border | wx.LEFT) tc = wx.TextCtrl(parent, style=wx.TE_PROCESS_ENTER) @@ -65,7 +65,7 @@ callback = self.GetTextCtrlChangedFunction(tc, name) self.Bind(wx.EVT_TEXT_ENTER, callback, tc) tc.Bind(wx.EVT_KILL_FOCUS, callback) - sizer.AddWindow(tc, border=10, + sizer.Add(tc, border=10, flag=wx.GROW | border | wx.RIGHT) def __init__(self, parent, controller=None, window=None, enable_required=True, scrolling=True): @@ -125,19 +125,19 @@ pageSize_st = wx.StaticText(self.GraphicsPanel, label=_('Page Size (optional):')) - graphicpanel_sizer.AddWindow( + graphicpanel_sizer.Add( pageSize_st, border=10, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP | wx.LEFT | wx.RIGHT) pageSize_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=2, vgap=5) pageSize_sizer.AddGrowableCol(1) - graphicpanel_sizer.AddSizer(pageSize_sizer, border=10, + graphicpanel_sizer.Add(pageSize_sizer, border=10, flag=wx.GROW | wx.LEFT | wx.RIGHT) for name, label in [('PageWidth', _('Width:')), ('PageHeight', _('Height:'))]: st = wx.StaticText(self.GraphicsPanel, label=label) - pageSize_sizer.AddWindow(st, border=12, + pageSize_sizer.Add(st, border=12, flag=wx.ALIGN_CENTER_VERTICAL | wx.LEFT) sp = wx.SpinCtrl(self.GraphicsPanel, @@ -146,15 +146,15 @@ callback = self.GetPageSizeChangedFunction(sp, name) self.Bind(wx.EVT_TEXT_ENTER, callback, sp) sp.Bind(wx.EVT_KILL_FOCUS, callback) - pageSize_sizer.AddWindow(sp, flag=wx.GROW) + pageSize_sizer.Add(sp, flag=wx.GROW) scaling_st = wx.StaticText(self.GraphicsPanel, label=_('Grid Resolution:')) - graphicpanel_sizer.AddWindow(scaling_st, border=10, + graphicpanel_sizer.Add(scaling_st, border=10, flag=wx.GROW | wx.LEFT | wx.RIGHT) scaling_nb = wx.Notebook(self.GraphicsPanel) - graphicpanel_sizer.AddWindow(scaling_nb, border=10, + graphicpanel_sizer.Add(scaling_nb, border=10, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.Scalings = {} @@ -173,7 +173,7 @@ border = wx.BOTTOM st = wx.StaticText(scaling_panel, label=label) - scalingpanel_sizer.AddWindow( + scalingpanel_sizer.Add( st, border=10, flag=wx.ALIGN_CENTER_VERTICAL | border | wx.LEFT) @@ -183,7 +183,7 @@ callback = self.GetScalingChangedFunction(sp, language, name) self.Bind(wx.EVT_TEXT_ENTER, callback, sp) sp.Bind(wx.EVT_KILL_FOCUS, callback) - scalingpanel_sizer.AddWindow(sp, border=10, + scalingpanel_sizer.Add(sp, border=10, flag=wx.GROW | border | wx.RIGHT) self.Scalings[language] = scaling_controls @@ -206,18 +206,18 @@ language_label = wx.StaticText(self.MiscellaneousPanel, label=_('Language (optional):')) - miscellaneouspanel_sizer.AddWindow(language_label, border=10, + miscellaneouspanel_sizer.Add(language_label, border=10, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP | wx.LEFT) self.Language = wx.ComboBox(self.MiscellaneousPanel, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnLanguageChanged, self.Language) - miscellaneouspanel_sizer.AddWindow(self.Language, border=10, + miscellaneouspanel_sizer.Add(self.Language, border=10, flag=wx.GROW | wx.TOP | wx.RIGHT) description_label = wx.StaticText( self.MiscellaneousPanel, label=_('Content Description (optional):')) - miscellaneouspanel_sizer.AddWindow(description_label, border=10, + miscellaneouspanel_sizer.Add(description_label, border=10, flag=wx.BOTTOM | wx.LEFT) self.ContentDescription = wx.TextCtrl( @@ -227,7 +227,7 @@ self.ContentDescription) self.ContentDescription.Bind(wx.EVT_KILL_FOCUS, self.OnContentDescriptionChanged) - miscellaneouspanel_sizer.AddWindow(self.ContentDescription, border=10, + miscellaneouspanel_sizer.Add(self.ContentDescription, border=10, flag=wx.GROW | wx.BOTTOM | wx.RIGHT) self.AddPage(self.MiscellaneousPanel, _("Miscellaneous")) diff -r ac0e6de439b5 -r 838242d34741 controls/SearchResultPanel.py --- a/controls/SearchResultPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/SearchResultPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -52,16 +52,16 @@ class SearchResultPanel(wx.Panel): def _init_coll_MainSizer_Items(self, parent): - parent.AddSizer(self.HeaderSizer, 0, border=0, flag=wx.GROW) - parent.AddWindow(self.SearchResultsTree, 1, border=0, flag=wx.GROW) + parent.Add(self.HeaderSizer, 0, border=0, flag=wx.GROW) + parent.Add(self.SearchResultsTree, 1, border=0, flag=wx.GROW) def _init_coll_MainSizer_Growables(self, parent): parent.AddGrowableCol(0) parent.AddGrowableRow(1) def _init_coll_HeaderSizer_Items(self, parent): - parent.AddWindow(self.HeaderLabel, 1, border=5, flag=wx.LEFT | wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) - parent.AddWindow(self.ResetButton, 0, border=0, flag=0) + parent.Add(self.HeaderLabel, 1, border=5, flag=wx.LEFT | wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) + parent.Add(self.ResetButton, 0, border=0, flag=0) def _init_coll_HeaderSizer_Growables(self, parent): parent.AddGrowableCol(0) @@ -90,7 +90,7 @@ self.ResetButton = wx.lib.buttons.GenBitmapButton( self, bitmap=GetBitmap("reset"), size=wx.Size(28, 28), style=wx.NO_BORDER) - self.ResetButton.SetToolTipString(_("Reset search result")) + self.ResetButton.SetToolTip(_("Reset search result")) self.Bind(wx.EVT_BUTTON, self.OnResetButton, self.ResetButton) self._init_sizers() diff -r ac0e6de439b5 -r 838242d34741 controls/TextCtrlAutoComplete.py --- a/controls/TextCtrlAutoComplete.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/TextCtrlAutoComplete.py Fri Mar 03 19:20:49 2023 +0100 @@ -97,7 +97,7 @@ parent_rect = wx.Rect(0, -parent_size[1], parent_size[0], parent_size[1]) if selected != wx.NOT_FOUND: wx.CallAfter(self.Parent.SetValueFromSelected, self.ListBox.GetString(selected)) - elif parent_rect.InsideXY(event.GetX(), event.GetY()): + elif parent_rect.Contains(event.GetX(), event.GetY()): result, x, y = self.Parent.HitTest(wx.Point(event.GetX(), event.GetY() + parent_size[1])) if result != wx.TE_HT_UNKNOWN: self.Parent.SetInsertionPoint(self.Parent.XYToPosition(x, y)) diff -r ac0e6de439b5 -r 838242d34741 controls/VariablePanel.py --- a/controls/VariablePanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/controls/VariablePanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -200,8 +200,7 @@ retain=self.Parent.ElementType != "function" and var_class in ["Local", "Input", "Output", "Global"], non_retain=self.Parent.ElementType != "function" and var_class in ["Local", "Input", "Output"]) if len(options) > 1: - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(",".join(map(_, options))) + editor = wx.grid.GridCellChoiceEditor(map(_, options)) else: grid.SetReadOnly(row, col, True) elif col != 0 and self._GetRowEdit(row): @@ -212,8 +211,7 @@ elif colname == "Initial Value": if var_class not in ["External", "InOut"]: if self.Parent.Controler.IsEnumeratedType(var_type): - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(",".join([""] + self.Parent.Controler.GetEnumeratedDataValues(var_type))) + editor = wx.grid.GridCellChoiceEditor([""] + self.Parent.Controler.GetEnumeratedDataValues(var_type)) else: editor = wx.grid.GridCellTextEditor() renderer = wx.grid.GridCellStringRenderer() @@ -229,11 +227,10 @@ if len(self.Parent.ClassList) == 1: grid.SetReadOnly(row, col, True) else: - editor = wx.grid.GridCellChoiceEditor() excluded = [] if self.Parent.IsFunctionBlockType(var_type): excluded.extend(["Local", "Temp"]) - editor.SetParameters(",".join([_(choice) for choice in self.Parent.ClassList if choice not in excluded])) + editor = wx.grid.GridCellChoiceEditor([_(choice) for choice in self.Parent.ClassList if choice not in excluded]) elif colname != "Documentation": grid.SetReadOnly(row, col, True) @@ -325,7 +322,7 @@ selected = None dialog.Destroy() if selected is None: - return + return False if selected == 0: location = "%I" + location elif selected == 1: @@ -360,7 +357,7 @@ var_name = dlg.GetValue() if dlg.ShowModal() == wx.ID_OK else None dlg.Destroy() if var_name is None: - return + return False elif var_name.upper() in [ name.upper() for name in self.ParentWindow.Controler.GetProjectPouNames(self.ParentWindow.Debug)]: @@ -388,7 +385,7 @@ selected = None dialog.Destroy() if selected is None: - return + return False if selected == 0: location = "%I" + location elif selected == 1: @@ -399,7 +396,7 @@ configs = self.ParentWindow.Controler.GetProjectConfigNames( self.ParentWindow.Debug) if len(configs) == 0: - return + return False if not var_name.upper() in [ name.upper() for name in self.ParentWindow.Controler.GetConfigurationVariableNames(configs[0])]: @@ -417,7 +414,7 @@ var_infos.Class = "Local" var_infos.InitialValue = values[0] else: - return + return False else: var_infos.Class = "External" var_infos.Number = len(self.ParentWindow.Values) @@ -429,6 +426,9 @@ if message is not None: wx.CallAfter(self.ShowMessage, message) + return False + + return True def ShowMessage(self, message): message = wx.MessageDialog(self.ParentWindow, message, _("Error"), wx.OK | wx.ICON_ERROR) @@ -456,32 +456,32 @@ controls_sizer = wx.FlexGridSizer(cols=10, hgap=5, rows=1, vgap=5) controls_sizer.AddGrowableCol(5) controls_sizer.AddGrowableRow(0) - self.MainSizer.AddSizer(controls_sizer, border=5, flag=wx.GROW | wx.ALL) + self.MainSizer.Add(controls_sizer, border=5, flag=wx.GROW | wx.ALL) self.ReturnTypeLabel = wx.StaticText(self, label=_('Return Type:')) - controls_sizer.AddWindow(self.ReturnTypeLabel, flag=wx.ALIGN_CENTER_VERTICAL) + controls_sizer.Add(self.ReturnTypeLabel, flag=wx.ALIGN_CENTER_VERTICAL) self.ReturnType = wx.ComboBox(self, size=wx.Size(145, -1), style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnReturnTypeChanged, self.ReturnType) - controls_sizer.AddWindow(self.ReturnType) + controls_sizer.Add(self.ReturnType) self.DescriptionLabel = wx.StaticText(self, label=_('Description:')) - controls_sizer.AddWindow(self.DescriptionLabel, flag=wx.ALIGN_CENTER_VERTICAL) + controls_sizer.Add(self.DescriptionLabel, flag=wx.ALIGN_CENTER_VERTICAL) self.Description = wx.TextCtrl(self, size=wx.Size(250, -1), style=wx.TE_PROCESS_ENTER) self.Bind(wx.EVT_TEXT_ENTER, self.OnDescriptionChanged, self.Description) self.Description.Bind(wx.EVT_KILL_FOCUS, self.OnDescriptionChanged) - controls_sizer.AddWindow(self.Description) + controls_sizer.Add(self.Description) class_filter_label = wx.StaticText(self, label=_('Class Filter:')) - controls_sizer.AddWindow(class_filter_label, flag=wx.ALIGN_CENTER_VERTICAL) + controls_sizer.Add(class_filter_label, flag=wx.ALIGN_CENTER_VERTICAL) self.ClassFilter = wx.ComboBox(self, size=wx.Size(145, -1), style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnClassFilter, self.ClassFilter) - controls_sizer.AddWindow(self.ClassFilter) + controls_sizer.Add(self.ClassFilter) for name, bitmap, help in [ ("AddButton", "add_element", _("Add variable")), @@ -490,19 +490,19 @@ ("DownButton", "down", _("Move variable down"))]: button = wx.lib.buttons.GenBitmapButton(self, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - controls_sizer.AddWindow(button) + controls_sizer.Add(button) self.VariablesGrid = CustomGrid(self, style=wx.VSCROLL | wx.HSCROLL) self.VariablesGrid.SetDropTarget(VariableDropTarget(self)) - self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, + self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGED, self.OnVariablesGridCellChange) self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_LEFT_CLICK, self.OnVariablesGridCellLeftClick) self.VariablesGrid.Bind(wx.grid.EVT_GRID_EDITOR_SHOWN, self.OnVariablesGridEditorShown) - self.MainSizer.AddWindow(self.VariablesGrid, flag=wx.GROW) + self.MainSizer.Add(self.VariablesGrid, flag=wx.GROW) self.SetSizer(self.MainSizer) @@ -575,7 +575,6 @@ self.PanelWidthMin = sum(self.ColSettings["size"]) - self.ElementType = element_type self.BodyType = None for choice in self.FilterChoices: @@ -848,7 +847,7 @@ # build a submenu containing standard IEC types base_menu = wx.Menu(title='') for base_type in self.Controler.GetBaseTypes(): - item = base_menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=base_type) + item = base_menu.Append(wx.ID_ANY, helpString='', kind=wx.ITEM_NORMAL, item=base_type) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(base_type), item) type_menu.AppendMenu(wx.ID_ANY, _("Base Types"), base_menu) @@ -858,7 +857,7 @@ datatype_menu = wx.Menu(title='') datatypes = self.Controler.GetDataTypes(basetypes=False, confnodetypes=False) for datatype in datatypes: - item = datatype_menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=datatype) + item = datatype_menu.Append(wx.ID_ANY, helpString='', kind=wx.ITEM_NORMAL, item=datatype) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(datatype), item) type_menu.AppendMenu(wx.ID_ANY, _("User Data Types"), datatype_menu) @@ -869,7 +868,7 @@ # build a submenu containing confnode types confnode_datatype_menu = wx.Menu(title='') for datatype in category["list"]: - item = confnode_datatype_menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=datatype) + item = confnode_datatype_menu.Append(wx.ID_ANY, helpString='', kind=wx.ITEM_NORMAL, item=datatype) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(datatype), item) type_menu.AppendMenu(wx.ID_ANY, category["name"], confnode_datatype_menu) @@ -883,13 +882,13 @@ functionblock_menu = wx.Menu(title='') fbtypes = self.Controler.GetFunctionBlockTypes(self.TagName) for functionblock_type in fbtypes: - item = functionblock_menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=functionblock_type) + item = functionblock_menu.Append(wx.ID_ANY, helpString='', kind=wx.ITEM_NORMAL, item=functionblock_type) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(functionblock_type), item) type_menu.AppendMenu(wx.ID_ANY, _("Function Block Types"), functionblock_menu) def BuildArrayTypesMenu(self, type_menu): - item = type_menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=_("Array")) + item = type_menu.Append(wx.ID_ANY, helpString='', kind=wx.ITEM_NORMAL, item=_("Array")) self.Bind(wx.EVT_MENU, self.VariableArrayTypeFunction, item) def OnVariablesGridEditorShown(self, event): @@ -916,7 +915,7 @@ corner_y = rect.y + self.VariablesGrid.GetColLabelSize() # pop up this new menu - self.VariablesGrid.PopupMenuXY(type_menu, corner_x, corner_y) + self.VariablesGrid.PopupMenu(type_menu, corner_x, corner_y) type_menu.Destroy() event.Veto() value = self.Values[row].Type diff -r ac0e6de439b5 -r 838242d34741 dialogs/AboutDialog.py --- a/dialogs/AboutDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/AboutDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -34,6 +34,7 @@ from __future__ import absolute_import import os import wx +import wx.adv from wx.lib.agw.hyperlink import HyperLinkCtrl @@ -52,7 +53,8 @@ image = None if self.info.Icon: - bitmap = wx.BitmapFromIcon(self.info.Icon) + bitmap = wx.Bitmap() + bitmap.CopyFromIcon(self.info.Icon) image = wx.StaticBitmap(self, bitmap=bitmap) name = wx.StaticText(self, label="%s %s" % (info.Name, info.Version)) @@ -172,4 +174,4 @@ if os.name == "nt": AboutDialog(parent, info) else: - wx.AboutBox(info) + wx.adv.AboutBox(info) diff -r ac0e6de439b5 -r 838242d34741 dialogs/ActionBlockDialog.py --- a/dialogs/ActionBlockDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/ActionBlockDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -85,35 +85,29 @@ readonly = False colname = self.GetColLabelValue(col, False) if colname == "Qualifier": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.QualifierList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.QualifierList) if colname == "Duration": editor = wx.grid.GridCellTextEditor() renderer = wx.grid.GridCellStringRenderer() readonly = not self.Parent.DurationList[self.data[row].qualifier] elif colname == "Type": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.TypeList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.TypeList) elif colname == "Value": value_type = self.data[row].type if value_type == "Action": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.ActionList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.ActionList) elif value_type == "Variable": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.VariableList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.VariableList) elif value_type == "Inline": editor = wx.grid.GridCellTextEditor() renderer = wx.grid.GridCellStringRenderer() elif colname == "Indicator": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.VariableList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.VariableList) grid.SetCellEditor(row, col, editor) grid.SetCellRenderer(row, col, renderer) grid.SetReadOnly(row, col, readonly) - grid.SetCellBackgroundColour(row, col, wx.WHITE) self.ResizeRow(grid, row) # ------------------------------------------------------------------------------- @@ -133,11 +127,11 @@ top_sizer = wx.FlexGridSizer(cols=5, hgap=5, rows=1, vgap=0) top_sizer.AddGrowableCol(0) top_sizer.AddGrowableRow(0) - main_sizer.AddSizer(top_sizer, border=20, + main_sizer.Add(top_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) actions_label = wx.StaticText(self, label=_('Actions:')) - top_sizer.AddWindow(actions_label, flag=wx.ALIGN_BOTTOM) + top_sizer.Add(actions_label, flag=wx.ALIGN_BOTTOM) for name, bitmap, help in [ ("AddButton", "add_element", _("Add action")), @@ -147,28 +141,28 @@ button = wx.lib.buttons.GenBitmapButton( self, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - top_sizer.AddWindow(button) + top_sizer.Add(button) self.ActionsGrid = CustomGrid(self, size=wx.Size(-1, 250), style=wx.VSCROLL) self.ActionsGrid.DisableDragGridSize() self.ActionsGrid.EnableScrolling(False, True) - self.ActionsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, + self.ActionsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGING, self.OnActionsGridCellChange) - main_sizer.AddSizer(self.ActionsGrid, border=20, + main_sizer.Add(self.ActionsGrid, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) self.Table = ActionTable(self, [], GetActionTableColnames()) typelist = GetTypeList() - self.TypeList = ",".join(map(_, typelist)) + self.TypeList = map(_, typelist) self.TranslateType = dict([(_(value), value) for value in typelist]) self.ColSizes = [60, 90, 130, 200, 50] self.ColAlignements = [wx.ALIGN_LEFT, wx.ALIGN_LEFT, wx.ALIGN_LEFT, wx.ALIGN_LEFT, wx.ALIGN_LEFT] @@ -201,15 +195,15 @@ wx.CallAfter(self.Table.ResetView, self.ActionsGrid) event.Skip() - def SetQualifierList(self, list): - self.QualifierList = ",".join(list) - self.DurationList = list - - def SetVariableList(self, list): - self.VariableList = "," + ",".join([variable.Name for variable in list]) - - def SetActionList(self, list): - self.ActionList = "," + ",".join(list) + def SetQualifierList(self, odict): + self.QualifierList = [qname for qname in odict] + self.DurationList = odict + + def SetVariableList(self, lst): + self.VariableList = [variable.Name for variable in lst] + + def SetActionList(self, lst): + self.ActionList = lst def SetValues(self, actions): for action in actions: diff -r ac0e6de439b5 -r 838242d34741 dialogs/ArrayTypeDialog.py --- a/dialogs/ArrayTypeDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/ArrayTypeDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -50,31 +50,31 @@ main_sizer.AddGrowableRow(1) top_sizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(top_sizer, border=20, + main_sizer.Add(top_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) basetype_label = wx.StaticText(self, label=_('Base Type:')) - top_sizer.AddWindow(basetype_label, 1, flag=wx.ALIGN_BOTTOM) + top_sizer.Add(basetype_label, 1, flag=wx.ALIGN_BOTTOM) self.BaseType = wx.ComboBox(self, style=wx.CB_READONLY) - top_sizer.AddWindow(self.BaseType, 1, flag=wx.GROW) + top_sizer.Add(self.BaseType, 1, flag=wx.GROW) self.Dimensions = CustomEditableListBox(self, label=_("Dimensions:"), - style=(wx.gizmos.EL_ALLOW_NEW | - wx.gizmos.EL_ALLOW_EDIT | - wx.gizmos.EL_ALLOW_DELETE)) + style=(wx.adv.EL_ALLOW_NEW | + wx.adv.EL_ALLOW_EDIT | + wx.adv.EL_ALLOW_DELETE)) for func in ["_OnLabelEndEdit", "_OnAddButton", "_OnDelButton", "_OnUpButton", "_OnDownButton"]: setattr(self.Dimensions, func, self.OnDimensionsChanged) - main_sizer.AddSizer(self.Dimensions, border=20, + main_sizer.Add(self.Dimensions, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/BlockPreviewDialog.py --- a/dialogs/BlockPreviewDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/BlockPreviewDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -75,8 +75,7 @@ # Add default dialog buttons sizer self.ButtonSizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, - self.ButtonSizer.GetAffirmativeButton()) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) self.Element = None # Graphic element to display in preview self.MinElementSize = None # Graphic element minimal size @@ -120,7 +119,7 @@ # Create a sizer for dividing parameters in two columns self.ColumnSizer = wx.BoxSizer(wx.HORIZONTAL) - self.MainSizer.AddSizer(self.ColumnSizer, border=20, + self.MainSizer.Add(self.ColumnSizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) # Create a sizer for left column @@ -129,7 +128,7 @@ self.LeftGridSizer.AddGrowableCol(0) if left_growable_row is not None: self.LeftGridSizer.AddGrowableRow(left_growable_row) - self.ColumnSizer.AddSizer(self.LeftGridSizer, 1, border=5, + self.ColumnSizer.Add(self.LeftGridSizer, 1, border=5, flag=wx.GROW | wx.RIGHT | wx.EXPAND) # Create a sizer for right column @@ -138,7 +137,7 @@ self.RightGridSizer.AddGrowableCol(0) if right_growable_row is not None: self.RightGridSizer.AddGrowableRow(right_growable_row) - self.ColumnSizer.AddSizer(self.RightGridSizer, 1, border=5, + self.ColumnSizer.Add(self.RightGridSizer, 1, border=5, flag=wx.GROW | wx.LEFT) self.SetSizer(self.MainSizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/BrowseLocationsDialog.py --- a/dialogs/BrowseLocationsDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/BrowseLocationsDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -76,7 +76,7 @@ main_sizer.AddGrowableRow(1) locations_label = wx.StaticText(self, label=_('Locations available:')) - main_sizer.AddWindow(locations_label, border=20, + main_sizer.Add(locations_label, border=20, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) self.LocationsTree = wx.TreeCtrl(self, @@ -88,7 +88,7 @@ self.LocationsTree.SetInitialSize(wx.Size(-1, 300)) self.Bind(wx.EVT_TREE_ITEM_ACTIVATED, self.OnLocationsTreeItemActivated, self.LocationsTree) - main_sizer.AddWindow(self.LocationsTree, border=20, + main_sizer.Add(self.LocationsTree, border=20, flag=wx.LEFT | wx.RIGHT | wx.GROW) self.RenameCheckBox = wx.CheckBox(self, label=_("Rename variable to signal name")) @@ -97,37 +97,37 @@ self.RenameCheckBox.SetValue(default_checked) self.do_rename = default_checked - main_sizer.AddWindow(self.RenameCheckBox, border=20, + main_sizer.Add(self.RenameCheckBox, border=20, flag=wx.LEFT | wx.RIGHT | wx.GROW) button_gridsizer = wx.FlexGridSizer(cols=5, hgap=5, rows=1, vgap=0) button_gridsizer.AddGrowableCol(1) button_gridsizer.AddGrowableCol(3) button_gridsizer.AddGrowableRow(0) - main_sizer.AddSizer(button_gridsizer, border=20, + main_sizer.Add(button_gridsizer, border=20, flag=wx.BOTTOM | wx.LEFT | wx.RIGHT | wx.GROW) direction_label = wx.StaticText(self, label=_('Direction:')) - button_gridsizer.AddWindow(direction_label, + button_gridsizer.Add(direction_label, flag=wx.ALIGN_CENTER_VERTICAL) self.DirFilterChoice = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnFilterChoice, self.DirFilterChoice) - button_gridsizer.AddWindow(self.DirFilterChoice, + button_gridsizer.Add(self.DirFilterChoice, flag=wx.GROW | wx.ALIGN_CENTER_VERTICAL) filter_label = wx.StaticText(self, label=_('Type:')) - button_gridsizer.AddWindow(filter_label, + button_gridsizer.Add(filter_label, flag=wx.ALIGN_CENTER_VERTICAL) self.TypeFilterChoice = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnFilterChoice, self.TypeFilterChoice) - button_gridsizer.AddWindow(self.TypeFilterChoice, + button_gridsizer.Add(self.TypeFilterChoice, flag=wx.GROW | wx.ALIGN_CENTER_VERTICAL) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - button_gridsizer.AddSizer(button_sizer, flag=wx.ALIGN_RIGHT) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + button_gridsizer.Add(button_sizer, flag=wx.ALIGN_RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/BrowseValuesLibraryDialog.py --- a/dialogs/BrowseValuesLibraryDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/BrowseValuesLibraryDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -51,13 +51,13 @@ self.ButtonSizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.ButtonSizer.GetAffirmativeButton().GetId()) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) self.flexGridSizer1 = wx.FlexGridSizer(cols=1, hgap=0, rows=3, vgap=10) - self.flexGridSizer1.AddWindow(self.staticText1, 0, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) - self.flexGridSizer1.AddWindow(self.ValuesLibrary, 0, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) - self.flexGridSizer1.AddSizer(self.ButtonSizer, 0, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) + self.flexGridSizer1.Add(self.staticText1, 0, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) + self.flexGridSizer1.Add(self.ValuesLibrary, 0, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) + self.flexGridSizer1.Add(self.ButtonSizer, 0, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.flexGridSizer1.AddGrowableCol(0) self.flexGridSizer1.AddGrowableRow(1) diff -r ac0e6de439b5 -r 838242d34741 dialogs/ConnectionDialog.py --- a/dialogs/ConnectionDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/ConnectionDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -59,7 +59,7 @@ # Create label for connection type type_label = wx.StaticText(self, label=_('Type:')) - self.LeftGridSizer.AddWindow(type_label, flag=wx.GROW) + self.LeftGridSizer.Add(type_label, flag=wx.GROW) # Create radio buttons for selecting connection type self.TypeRadioButtons = {} @@ -70,39 +70,39 @@ style=(wx.RB_GROUP if first else 0)) radio_button.SetValue(first) self.Bind(wx.EVT_RADIOBUTTON, self.OnTypeChanged, radio_button) - self.LeftGridSizer.AddWindow(radio_button, flag=wx.GROW) + self.LeftGridSizer.Add(radio_button, flag=wx.GROW) self.TypeRadioButtons[type] = radio_button first = False # Create label for connection name name_label = wx.StaticText(self, label=_('Name:')) - self.LeftGridSizer.AddWindow(name_label, flag=wx.GROW) + self.LeftGridSizer.Add(name_label, flag=wx.GROW) # Create text control for defining connection name self.ConnectionName = wx.TextCtrl(self) self.ConnectionName.SetMinSize(wx.Size(200, -1)) self.Bind(wx.EVT_TEXT, self.OnNameChanged, self.ConnectionName) - self.LeftGridSizer.AddWindow(self.ConnectionName, flag=wx.GROW) + self.LeftGridSizer.Add(self.ConnectionName, flag=wx.GROW) # Add preview panel and associated label to sizers self.Preview.SetMinSize(wx.Size(-1, 100)) - self.LeftGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.LeftGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.LeftGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.LeftGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) - self.ColumnSizer.RemoveSizer(self.RightGridSizer) + self.ColumnSizer.Remove(self.RightGridSizer) # Add button for applying connection name modification to all connection # of POU if apply_button: self.ApplyToAllButton = wx.Button(self, label=_("Propagate Name")) - self.ApplyToAllButton.SetToolTipString( + self.ApplyToAllButton.SetToolTip( _("Apply name modification to all continuations with the same name")) self.Bind(wx.EVT_BUTTON, self.OnApplyToAll, self.ApplyToAllButton) - self.ButtonSizer.AddWindow(self.ApplyToAllButton, flag=wx.LEFT) + self.ButtonSizer.Add(self.ApplyToAllButton, flag=wx.LEFT) else: self.ConnectionName.ChangeValue( controller.GenerateNewName( diff -r ac0e6de439b5 -r 838242d34741 dialogs/DurationEditorDialog.py --- a/dialogs/DurationEditorDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/DurationEditorDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -68,7 +68,7 @@ main_sizer.AddGrowableRow(0) controls_sizer = wx.FlexGridSizer(cols=len(CONTROLS), hgap=10, rows=2, vgap=10) - main_sizer.AddSizer(controls_sizer, border=20, + main_sizer.Add(controls_sizer, border=20, flag=wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) controls = [] @@ -85,14 +85,14 @@ controls.append((st, txtctrl)) for st, txtctrl in controls: - controls_sizer.AddWindow(st, flag=wx.GROW) + controls_sizer.Add(st, flag=wx.GROW) for st, txtctrl in controls: - controls_sizer.AddWindow(txtctrl, flag=wx.GROW) + controls_sizer.Add(txtctrl, flag=wx.GROW) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) @@ -153,6 +153,7 @@ return duration def OnOK(self, event): + event.Skip() self.OnCloseDialog() def OnCloseDialog(self): diff -r ac0e6de439b5 -r 838242d34741 dialogs/FBDBlockDialog.py --- a/dialogs/FBDBlockDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/FBDBlockDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -68,7 +68,7 @@ # Create static box around library panel type_staticbox = wx.StaticBox(self, label=_('Type:')) left_staticboxsizer = wx.StaticBoxSizer(type_staticbox, wx.VERTICAL) - self.LeftGridSizer.AddSizer(left_staticboxsizer, border=5, flag=wx.GROW) + self.LeftGridSizer.Add(left_staticboxsizer, border=5, flag=wx.GROW) # Create Library panel and add it to static box self.LibraryPanel = LibraryPanel(self) @@ -77,65 +77,65 @@ # Set function to call when selection in Library panel changed setattr(self.LibraryPanel, "_OnTreeItemSelected", self.OnLibraryTreeItemSelected) - left_staticboxsizer.AddWindow(self.LibraryPanel, 1, border=5, + left_staticboxsizer.Add(self.LibraryPanel, 1, border=5, flag=wx.GROW | wx.TOP) # Create sizer for other block parameters top_right_gridsizer = wx.FlexGridSizer(cols=2, hgap=0, rows=4, vgap=5) top_right_gridsizer.AddGrowableCol(1) - self.RightGridSizer.AddSizer(top_right_gridsizer, flag=wx.GROW) + self.RightGridSizer.Add(top_right_gridsizer, flag=wx.GROW) # Create label for block name name_label = wx.StaticText(self, label=_('Name:')) - top_right_gridsizer.AddWindow(name_label, + top_right_gridsizer.Add(name_label, flag=wx.ALIGN_CENTER_VERTICAL) # Create text control for defining block name self.BlockName = wx.TextCtrl(self) self.Bind(wx.EVT_TEXT, self.OnNameChanged, self.BlockName) - top_right_gridsizer.AddWindow(self.BlockName, flag=wx.GROW) + top_right_gridsizer.Add(self.BlockName, flag=wx.GROW) # Create label for extended block input number inputs_label = wx.StaticText(self, label=_('Inputs:')) - top_right_gridsizer.AddWindow(inputs_label, + top_right_gridsizer.Add(inputs_label, flag=wx.ALIGN_CENTER_VERTICAL) # Create spin control for defining extended block input number self.Inputs = wx.SpinCtrl(self, min=2, max=20, style=wx.SP_ARROW_KEYS) self.Bind(wx.EVT_SPINCTRL, self.OnInputsChanged, self.Inputs) - top_right_gridsizer.AddWindow(self.Inputs, flag=wx.GROW) + top_right_gridsizer.Add(self.Inputs, flag=wx.GROW) # Create label for block execution order execution_order_label = wx.StaticText(self, label=_('Execution Order:')) - top_right_gridsizer.AddWindow(execution_order_label, + top_right_gridsizer.Add(execution_order_label, flag=wx.ALIGN_CENTER_VERTICAL) # Create spin control for defining block execution order self.ExecutionOrder = wx.SpinCtrl(self, min=0, style=wx.SP_ARROW_KEYS) self.Bind(wx.EVT_SPINCTRL, self.OnExecutionOrderChanged, self.ExecutionOrder) - top_right_gridsizer.AddWindow(self.ExecutionOrder, flag=wx.GROW) + top_right_gridsizer.Add(self.ExecutionOrder, flag=wx.GROW) # Create label for block execution control execution_control_label = wx.StaticText(self, label=_('Execution Control:')) - top_right_gridsizer.AddWindow(execution_control_label, + top_right_gridsizer.Add(execution_control_label, flag=wx.ALIGN_CENTER_VERTICAL) # Create check box to enable block execution control self.ExecutionControl = wx.CheckBox(self) self.Bind(wx.EVT_CHECKBOX, self.OnExecutionOrderChanged, self.ExecutionControl) - top_right_gridsizer.AddWindow(self.ExecutionControl, flag=wx.GROW) + top_right_gridsizer.Add(self.ExecutionControl, flag=wx.GROW) # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer(self.ButtonSizer, border=20, + self.MainSizer.Add(self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) # Dictionary containing correspondence between parameter exchanged and diff -r ac0e6de439b5 -r 838242d34741 dialogs/FBDVariableDialog.py --- a/dialogs/FBDVariableDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/FBDVariableDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -73,49 +73,49 @@ # Create label for variable class class_label = wx.StaticText(self, label=_('Class:')) - self.LeftGridSizer.AddWindow(class_label, flag=wx.GROW) + self.LeftGridSizer.Add(class_label, flag=wx.GROW) # Create a combo box for defining variable class self.Class = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnClassChanged, self.Class) - self.LeftGridSizer.AddWindow(self.Class, flag=wx.GROW) + self.LeftGridSizer.Add(self.Class, flag=wx.GROW) # Create label for variable execution order execution_order_label = wx.StaticText(self, label=_('Execution Order:')) - self.LeftGridSizer.AddWindow(execution_order_label, flag=wx.GROW) + self.LeftGridSizer.Add(execution_order_label, flag=wx.GROW) # Create spin control for defining variable execution order self.ExecutionOrder = wx.SpinCtrl(self, min=0, style=wx.SP_ARROW_KEYS) self.Bind(wx.EVT_SPINCTRL, self.OnExecutionOrderChanged, self.ExecutionOrder) - self.LeftGridSizer.AddWindow(self.ExecutionOrder, flag=wx.GROW) + self.LeftGridSizer.Add(self.ExecutionOrder, flag=wx.GROW) # Create label for variable expression name_label = wx.StaticText(self, label=_('Expression:')) - self.RightGridSizer.AddWindow(name_label, border=5, + self.RightGridSizer.Add(name_label, border=5, flag=wx.GROW | wx.BOTTOM) # Create text control for defining variable expression self.Expression = wx.TextCtrl(self) self.Bind(wx.EVT_TEXT, self.OnExpressionChanged, self.Expression) - self.RightGridSizer.AddWindow(self.Expression, flag=wx.GROW) + self.RightGridSizer.Add(self.Expression, flag=wx.GROW) # Create a list box to selected variable expression in the list of # variables defined in POU self.VariableName = wx.ListBox(self, size=wx.Size(-1, 120), style=wx.LB_SINGLE | wx.LB_SORT) self.Bind(wx.EVT_LISTBOX, self.OnNameChanged, self.VariableName) - self.RightGridSizer.AddWindow(self.VariableName, border=4, flag=wx.GROW | wx.TOP) + self.RightGridSizer.Add(self.VariableName, border=4, flag=wx.GROW | wx.TOP) # Add preview panel and associated label to sizers - self.MainSizer.AddWindow(self.PreviewLabel, border=20, + self.MainSizer.Add(self.PreviewLabel, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) - self.MainSizer.AddWindow(self.Preview, border=20, + self.MainSizer.Add(self.Preview, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) diff -r ac0e6de439b5 -r 838242d34741 dialogs/FindInPouDialog.py --- a/dialogs/FindInPouDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/FindInPouDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -48,76 +48,76 @@ main_sizer.AddGrowableRow(0) controls_sizer = wx.BoxSizer(wx.VERTICAL) - main_sizer.AddSizer(controls_sizer, border=20, + main_sizer.Add(controls_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) patterns_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=1, vgap=5) patterns_sizer.AddGrowableCol(1) - controls_sizer.AddSizer(patterns_sizer, border=5, flag=wx.GROW | wx.BOTTOM) + controls_sizer.Add(patterns_sizer, border=5, flag=wx.GROW | wx.BOTTOM) find_label = wx.StaticText(panel, label=_("Find:")) - patterns_sizer.AddWindow(find_label, flag=wx.ALIGN_CENTER_VERTICAL) + patterns_sizer.Add(find_label, flag=wx.ALIGN_CENTER_VERTICAL) self.FindPattern = wx.TextCtrl(panel) self.Bind(wx.EVT_TEXT, self.OnFindPatternChanged, self.FindPattern) self.Bind(wx.EVT_CHAR_HOOK, self.OnEscapeKey) - patterns_sizer.AddWindow(self.FindPattern, flag=wx.GROW) + patterns_sizer.Add(self.FindPattern, flag=wx.GROW) params_sizer = wx.BoxSizer(wx.HORIZONTAL) - controls_sizer.AddSizer(params_sizer, border=5, flag=wx.GROW | wx.BOTTOM) + controls_sizer.Add(params_sizer, border=5, flag=wx.GROW | wx.BOTTOM) direction_staticbox = wx.StaticBox(panel, label=_("Direction")) direction_staticboxsizer = wx.StaticBoxSizer( direction_staticbox, wx.VERTICAL) - params_sizer.AddSizer(direction_staticboxsizer, 1, border=5, + params_sizer.Add(direction_staticboxsizer, 1, border=5, flag=wx.GROW | wx.RIGHT) self.Forward = wx.RadioButton(panel, label=_("Forward"), style=wx.RB_GROUP) - direction_staticboxsizer.AddWindow(self.Forward, border=5, + direction_staticboxsizer.Add(self.Forward, border=5, flag=wx.ALL | wx.GROW) self.Backward = wx.RadioButton(panel, label=_("Backward")) - direction_staticboxsizer.AddWindow(self.Backward, border=5, + direction_staticboxsizer.Add(self.Backward, border=5, flag=wx.ALL | wx.GROW) options_staticbox = wx.StaticBox(panel, label=_("Options")) options_staticboxsizer = wx.StaticBoxSizer( options_staticbox, wx.VERTICAL) - params_sizer.AddSizer(options_staticboxsizer, 1, flag=wx.GROW) + params_sizer.Add(options_staticboxsizer, 1, flag=wx.GROW) self.CaseSensitive = wx.CheckBox(panel, label=_("Case sensitive")) self.CaseSensitive.SetValue(True) - options_staticboxsizer.AddWindow(self.CaseSensitive, border=5, + options_staticboxsizer.Add(self.CaseSensitive, border=5, flag=wx.ALL | wx.GROW) self.WrapSearch = wx.CheckBox(panel, label=_("Wrap search")) self.WrapSearch.SetValue(True) - options_staticboxsizer.AddWindow(self.WrapSearch, border=5, + options_staticboxsizer.Add(self.WrapSearch, border=5, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) self.RegularExpressions = wx.CheckBox(panel, label=_("Regular expressions")) - options_staticboxsizer.AddWindow(self.RegularExpressions, border=5, + options_staticboxsizer.Add(self.RegularExpressions, border=5, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.GROW) buttons_sizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(buttons_sizer, border=20, + main_sizer.Add(buttons_sizer, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_RIGHT) self.FindButton = wx.Button(panel, label=_("Find")) self.FindButton.SetDefault() self.Bind(wx.EVT_BUTTON, self.OnFindButton, self.FindButton) - buttons_sizer.AddWindow(self.FindButton, border=5, flag=wx.RIGHT) + buttons_sizer.Add(self.FindButton, border=5, flag=wx.RIGHT) self.CloseButton = wx.Button(panel, label=_("Close")) self.Bind(wx.EVT_BUTTON, self.OnCloseButton, self.CloseButton) - buttons_sizer.AddWindow(self.CloseButton) + buttons_sizer.Add(self.CloseButton) # set the longest message here, to use it length to calculate # optimal size of dialog window self.RegExpSyntaxErrMsg = _("Syntax error in regular expression of pattern to search!") self.StatusLabel = wx.StaticText(panel, label=self.RegExpSyntaxErrMsg) - controls_sizer.AddWindow(self.StatusLabel, flag=wx.ALIGN_CENTER_VERTICAL) + controls_sizer.Add(self.StatusLabel) panel.SetSizer(main_sizer) main_sizer.Fit(self) diff -r ac0e6de439b5 -r 838242d34741 dialogs/ForceVariableDialog.py --- a/dialogs/ForceVariableDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/ForceVariableDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -189,7 +189,7 @@ info_sizer = wx.BoxSizer(wx.VERTICAL) message_label = wx.StaticText(self, label=_("Forcing Variable Value")) - info_sizer.AddWindow(message_label, border=10, + info_sizer.Add(message_label, border=10, flag=wx.ALIGN_LEFT | wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) if GetTypeValue[self.IEC_Type] in [getinteger, getfloat]: @@ -201,8 +201,8 @@ self.GetEnteredValue = self.GetValueDefault button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - info_sizer.AddSizer(button_sizer, border=10, flag=wx.ALIGN_RIGHT | wx.ALL) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + info_sizer.Add(button_sizer, border=10, flag=wx.ALIGN_RIGHT | wx.ALL) self.SetSizer(info_sizer) self.Fit() @@ -216,7 +216,7 @@ """Add simple text control to change variable of any type""" self.ValueCtrl = wx.TextCtrl(self) self.ValueCtrl.SetValue(defaultValue) - info_sizer.AddWindow(self.ValueCtrl, border=10, proportion=1, + info_sizer.Add(self.ValueCtrl, border=10, proportion=1, flag=wx.ALIGN_LEFT | wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) def GetValueDefault(self): @@ -235,11 +235,11 @@ sizer = wx.BoxSizer(wx.HORIZONTAL) self.InitCtrlDefault(sizer, defaultValue) self.SpinButtonCtrl = wx.SpinButton(self, style=wx.HORIZONTAL | wx.SP_WRAP) - sizer.AddWindow(self.SpinButtonCtrl, border=10, + sizer.Add(self.SpinButtonCtrl, border=10, flag=wx.ALIGN_LEFT | wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT | wx.EXPAND) self.Bind(wx.EVT_SPIN_UP, self.SpinButtonChanged) self.Bind(wx.EVT_SPIN_DOWN, self.SpinButtonChanged) - info_sizer.AddWindow(sizer, proportion=1, flag=wx.EXPAND) + info_sizer.Add(sizer, proportion=1, flag=wx.EXPAND) def SpinButtonChanged(self, evt): """Increment/decrement variable value""" @@ -261,7 +261,7 @@ if value is not None: self.ValueCtrl.SetValue(value) - info_sizer.AddWindow(self.ValueCtrl, border=10, + info_sizer.Add(self.ValueCtrl, border=10, flag=wx.ALIGN_LEFT | wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT | wx.GROW) def OnOK(self, event): diff -r ac0e6de439b5 -r 838242d34741 dialogs/IDMergeDialog.py --- a/dialogs/IDMergeDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/IDMergeDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -15,11 +15,11 @@ main_sizer = wx.BoxSizer(wx.VERTICAL) message = wx.StaticText(self, label=question) - main_sizer.AddWindow(message, border=20, + main_sizer.Add(message, border=20, flag=wx.ALIGN_CENTER_HORIZONTAL | wx.TOP | wx.LEFT | wx.RIGHT) self.check = wx.CheckBox(self, label=optiontext) - main_sizer.AddWindow(self.check, border=20, + main_sizer.Add(self.check, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_CENTER_HORIZONTAL) buttons_sizer = wx.BoxSizer(wx.HORIZONTAL) @@ -30,9 +30,9 @@ return lambda event: self.EndModal(_wxID) self.Bind(wx.EVT_BUTTON, OnButtonFactory(wxID), Button) - buttons_sizer.AddWindow(Button) + buttons_sizer.Add(Button) - main_sizer.AddSizer(buttons_sizer, border=20, + main_sizer.Add(buttons_sizer, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/LDElementDialog.py --- a/dialogs/LDElementDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/LDElementDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -63,7 +63,7 @@ # Create label for LD element modifier modifier_label = wx.StaticText(self, label=_('Modifier:')) - self.LeftGridSizer.AddWindow(modifier_label, border=5, + self.LeftGridSizer.Add(modifier_label, border=5, flag=wx.GROW | wx.BOTTOM) # Create radio buttons for selecting LD element modifier @@ -84,13 +84,13 @@ style=(wx.RB_GROUP if first else 0)) radio_button.SetValue(first) self.Bind(wx.EVT_RADIOBUTTON, self.OnModifierChanged, radio_button) - self.LeftGridSizer.AddWindow(radio_button, flag=wx.GROW) + self.LeftGridSizer.Add(radio_button, flag=wx.GROW) self.ModifierRadioButtons[modifier] = radio_button first = False # Create label for LD element variable element_variable_label = wx.StaticText(self, label=_('Variable:')) - self.LeftGridSizer.AddWindow(element_variable_label, border=5, + self.LeftGridSizer.Add(element_variable_label, border=5, flag=wx.GROW | wx.TOP) # Create a combo box for defining LD element variable @@ -99,15 +99,15 @@ self.ElementVariable) self.Bind(wx.EVT_TEXT, self.OnVariableChanged, self.ElementVariable) - self.LeftGridSizer.AddWindow(self.ElementVariable, border=5, + self.LeftGridSizer.Add(self.ElementVariable, border=5, flag=wx.GROW | wx.TOP) # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer(self.ButtonSizer, border=20, + self.MainSizer.Add(self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) # Save LD element class @@ -198,8 +198,9 @@ self.GetElementModifier(), value) - button = self.ButtonSizer.GetAffirmativeButton() - button.Enable(value != "") + # FIXME : how to disable OK button when content is not valid + # button = self.ButtonSizer.GetAffirmativeButton() + # button.Enable(value != "") # Call BlockPreviewDialog function BlockPreviewDialog.DrawPreview(self) diff -r ac0e6de439b5 -r 838242d34741 dialogs/LDPowerRailDialog.py --- a/dialogs/LDPowerRailDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/LDPowerRailDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -56,7 +56,7 @@ # Create label for connection type type_label = wx.StaticText(self, label=_('Type:')) - self.LeftGridSizer.AddWindow(type_label, flag=wx.GROW) + self.LeftGridSizer.Add(type_label, flag=wx.GROW) # Create radio buttons for selecting power rail type self.TypeRadioButtons = {} @@ -67,27 +67,27 @@ style=(wx.RB_GROUP if first else 0)) radio_button.SetValue(first) self.Bind(wx.EVT_RADIOBUTTON, self.OnTypeChanged, radio_button) - self.LeftGridSizer.AddWindow(radio_button, flag=wx.GROW) + self.LeftGridSizer.Add(radio_button, flag=wx.GROW) self.TypeRadioButtons[type] = radio_button first = False # Create label for power rail pin number pin_number_label = wx.StaticText(self, label=_('Pin number:')) - self.LeftGridSizer.AddWindow(pin_number_label, flag=wx.GROW) + self.LeftGridSizer.Add(pin_number_label, flag=wx.GROW) # Create spin control for defining power rail pin number self.PinNumber = wx.SpinCtrl(self, min=1, max=50, style=wx.SP_ARROW_KEYS) self.PinNumber.SetValue(1) self.Bind(wx.EVT_SPINCTRL, self.OnPinNumberChanged, self.PinNumber) - self.LeftGridSizer.AddWindow(self.PinNumber, flag=wx.GROW) + self.LeftGridSizer.Add(self.PinNumber, flag=wx.GROW) # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.Fit() diff -r ac0e6de439b5 -r 838242d34741 dialogs/MessageBoxOnce.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/dialogs/MessageBoxOnce.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,57 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +# This file is part of Beremiz +# Copyright (C) 2022: Edouard TISSERANT +# +# See COPYING file for copyrights details. + + +from __future__ import absolute_import +import wx + + +# class RichMessageDialog is still not available in wxPython 3.0.2 +class MessageBoxOnce(wx.Dialog): + """ + wx.MessageBox that user can ask not to show again + """ + def __init__(self, title, message, config_key): + self.Config = wx.ConfigBase.Get() + self.config_key = config_key + dont_show = self.Config.Read(self.config_key) == "True" + + if dont_show: + return + + wx.Dialog.__init__(self, None, title=title) + + main_sizer = wx.BoxSizer(wx.VERTICAL) + + message = wx.StaticText(self, label=message) + main_sizer.Add(message, border=20, + flag=wx.ALIGN_CENTER_HORIZONTAL | wx.TOP | wx.LEFT | wx.RIGHT) + + self.check = wx.CheckBox(self, label=_("don't show this message again")) + main_sizer.Add(self.check, border=20, + flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_CENTER_HORIZONTAL) + + buttons_sizer = wx.BoxSizer(wx.HORIZONTAL) + + Button = wx.Button(self, label="OK") + + self.Bind(wx.EVT_BUTTON, self.OnOKButton, Button) + buttons_sizer.Add(Button) + + main_sizer.Add(buttons_sizer, border=20, + flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_RIGHT) + + self.SetSizer(main_sizer) + self.Fit() + + self.ShowModal() + + def OnOKButton(self, event): + if self.check.GetValue(): + self.Config.Write(self.config_key, "True") + self.EndModal(wx.ID_OK) diff -r ac0e6de439b5 -r 838242d34741 dialogs/PouActionDialog.py --- a/dialogs/PouActionDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/PouActionDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -50,27 +50,26 @@ infos_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=3, vgap=15) infos_sizer.AddGrowableCol(1) - main_sizer.AddSizer(infos_sizer, border=20, + main_sizer.Add(infos_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) actionname_label = wx.StaticText(self, label=_('Action Name:')) - infos_sizer.AddWindow(actionname_label, border=4, + infos_sizer.Add(actionname_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.ActionName = wx.TextCtrl(self, size=wx.Size(180, -1)) - infos_sizer.AddWindow(self.ActionName, flag=wx.GROW) + infos_sizer.Add(self.ActionName, flag=wx.GROW) language_label = wx.StaticText(self, label=_('Language:')) - infos_sizer.AddWindow(language_label, border=4, + infos_sizer.Add(language_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.Language = wx.ComboBox(self, style=wx.CB_READONLY) - infos_sizer.AddWindow(self.Language, flag=wx.GROW) + infos_sizer.Add(self.Language, flag=wx.GROW) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, - button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/PouDialog.py --- a/dialogs/PouDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/PouDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -58,34 +58,34 @@ infos_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=3, vgap=15) infos_sizer.AddGrowableCol(1) - main_sizer.AddSizer(infos_sizer, border=20, + main_sizer.Add(infos_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) pouname_label = wx.StaticText(self, label=_('POU Name:')) - infos_sizer.AddWindow(pouname_label, border=4, + infos_sizer.Add(pouname_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.PouName = wx.TextCtrl(self) - infos_sizer.AddWindow(self.PouName, flag=wx.GROW) + infos_sizer.Add(self.PouName, flag=wx.GROW) poutype_label = wx.StaticText(self, label=_('POU Type:')) - infos_sizer.AddWindow(poutype_label, border=4, + infos_sizer.Add(poutype_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.PouType = wx.ComboBox(self, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnTypeChanged, self.PouType) - infos_sizer.AddWindow(self.PouType, flag=wx.GROW) + infos_sizer.Add(self.PouType, flag=wx.GROW) language_label = wx.StaticText(self, label=_('Language:')) - infos_sizer.AddWindow(language_label, border=4, + infos_sizer.Add(language_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.Language = wx.ComboBox(self, style=wx.CB_READONLY) - infos_sizer.AddWindow(self.Language, flag=wx.GROW) + infos_sizer.Add(self.Language, flag=wx.GROW) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/PouNameDialog.py --- a/dialogs/PouNameDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/PouNameDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -40,8 +40,7 @@ self.PouNames = [] - self.Bind(wx.EVT_BUTTON, self.OnOK, - self.GetSizer().GetItem(2).GetSizer().GetItem(1).GetSizer().GetAffirmativeButton()) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) def OnOK(self, event): message = None diff -r ac0e6de439b5 -r 838242d34741 dialogs/PouTransitionDialog.py --- a/dialogs/PouTransitionDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/PouTransitionDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -53,26 +53,26 @@ infos_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=3, vgap=10) infos_sizer.AddGrowableCol(1) - main_sizer.AddSizer(infos_sizer, border=20, + main_sizer.Add(infos_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) transitionname_label = wx.StaticText(self, label=_('Transition Name:')) - infos_sizer.AddWindow(transitionname_label, border=4, + infos_sizer.Add(transitionname_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.TransitionName = wx.TextCtrl(self, size=wx.Size(180, -1)) - infos_sizer.AddWindow(self.TransitionName, flag=wx.GROW) + infos_sizer.Add(self.TransitionName, flag=wx.GROW) language_label = wx.StaticText(self, label=_('Language:')) - infos_sizer.AddWindow(language_label, border=4, + infos_sizer.Add(language_label, border=4, flag=wx.ALIGN_CENTER_VERTICAL | wx.TOP) self.Language = wx.ComboBox(self, style=wx.CB_READONLY) - infos_sizer.AddWindow(self.Language, flag=wx.GROW) + infos_sizer.Add(self.Language, flag=wx.GROW) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, button_sizer.GetAffirmativeButton()) - main_sizer.AddSizer(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(button_sizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/ProjectDialog.py --- a/dialogs/ProjectDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/ProjectDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -42,12 +42,11 @@ self.ProjectProperties = ProjectPropertiesPanel( self, enable_required=enable_required, scrolling=False) - main_sizer.AddWindow(self.ProjectProperties, flag=wx.GROW) + main_sizer.Add(self.ProjectProperties, flag=wx.GROW) self.ButtonSizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - self.Bind(wx.EVT_BUTTON, self.OnOK, - self.ButtonSizer.GetAffirmativeButton()) - main_sizer.AddSizer(self.ButtonSizer, border=20, + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) + main_sizer.Add(self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/SFCDivergenceDialog.py --- a/dialogs/SFCDivergenceDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/SFCDivergenceDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -58,7 +58,7 @@ # Create label for divergence type type_label = wx.StaticText(self, label=_('Type:')) - self.LeftGridSizer.AddWindow(type_label, flag=wx.GROW) + self.LeftGridSizer.Add(type_label, flag=wx.GROW) # Create radio buttons for selecting divergence type divergence_buttons = [ @@ -80,7 +80,7 @@ style=(wx.RB_GROUP if first else 0)) radio_button.SetValue(first) self.Bind(wx.EVT_RADIOBUTTON, self.OnTypeChanged, radio_button) - self.LeftGridSizer.AddWindow(radio_button, flag=wx.GROW) + self.LeftGridSizer.Add(radio_button, flag=wx.GROW) self.TypeRadioButtons[type] = radio_button if first: focusbtn = type @@ -89,19 +89,19 @@ # Create label for number of divergence sequences sequences_label = wx.StaticText(self, label=_('Number of sequences:')) - self.LeftGridSizer.AddWindow(sequences_label, flag=wx.GROW) + self.LeftGridSizer.Add(sequences_label, flag=wx.GROW) # Create spin control for defining number of divergence sequences self.Sequences = wx.SpinCtrl(self, min=2, max=20, initial=2) self.Bind(wx.EVT_SPINCTRL, self.OnSequencesChanged, self.Sequences) - self.LeftGridSizer.AddWindow(self.Sequences, flag=wx.GROW) + self.LeftGridSizer.Add(self.Sequences, flag=wx.GROW) # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) diff -r ac0e6de439b5 -r 838242d34741 dialogs/SFCStepDialog.py --- a/dialogs/SFCStepDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/SFCStepDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -57,16 +57,16 @@ # Create label for SFC step name name_label = wx.StaticText(self, label=_('Name:')) - self.LeftGridSizer.AddWindow(name_label, flag=wx.GROW) + self.LeftGridSizer.Add(name_label, flag=wx.GROW) # Create text control for defining SFC step name self.StepName = wx.TextCtrl(self) self.Bind(wx.EVT_TEXT, self.OnNameChanged, self.StepName) - self.LeftGridSizer.AddWindow(self.StepName, flag=wx.GROW) + self.LeftGridSizer.Add(self.StepName, flag=wx.GROW) # Create label for SFC step connectors connectors_label = wx.StaticText(self, label=_('Connectors:')) - self.LeftGridSizer.AddWindow(connectors_label, flag=wx.GROW) + self.LeftGridSizer.Add(connectors_label, flag=wx.GROW) # Create check boxes for defining connectors available on SFC step self.ConnectorsCheckBox = {} @@ -77,15 +77,15 @@ if name == "output" or (name == "input" and not initial): check_box.SetValue(True) self.Bind(wx.EVT_CHECKBOX, self.OnConnectorsChanged, check_box) - self.LeftGridSizer.AddWindow(check_box, flag=wx.GROW) + self.LeftGridSizer.Add(check_box, flag=wx.GROW) self.ConnectorsCheckBox[name] = check_box # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) diff -r ac0e6de439b5 -r 838242d34741 dialogs/SFCStepNameDialog.py --- a/dialogs/SFCStepNameDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/SFCStepNameDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -42,8 +42,7 @@ self.Variables = [] self.StepNames = [] - self.Bind(wx.EVT_BUTTON, self.OnOK, - self.GetSizer().GetItem(2).GetSizer().GetItem(1).GetSizer().GetAffirmativeButton()) + self.Bind(wx.EVT_BUTTON, self.OnOK, id=self.GetAffirmativeId()) def OnOK(self, event): message = None diff -r ac0e6de439b5 -r 838242d34741 dialogs/SFCTransitionDialog.py --- a/dialogs/SFCTransitionDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/SFCTransitionDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -57,7 +57,7 @@ # Create label for transition type type_label = wx.StaticText(self, label=_('Type:')) - self.LeftGridSizer.AddWindow(type_label, flag=wx.GROW) + self.LeftGridSizer.Add(type_label, flag=wx.GROW) # Create combo box for selecting reference value reference = wx.ComboBox(self, style=wx.CB_READONLY) @@ -80,28 +80,28 @@ style=(wx.RB_GROUP if first else 0)) radio_button.SetValue(first) self.Bind(wx.EVT_RADIOBUTTON, self.OnTypeChanged, radio_button) - self.LeftGridSizer.AddWindow(radio_button, flag=wx.GROW) + self.LeftGridSizer.Add(radio_button, flag=wx.GROW) if control is not None: control.Enable(first) - self.LeftGridSizer.AddWindow(control, flag=wx.GROW) + self.LeftGridSizer.Add(control, flag=wx.GROW) self.TypeRadioButtons[type] = (radio_button, control) first = False # Create label for transition priority priority_label = wx.StaticText(self, label=_('Priority:')) - self.LeftGridSizer.AddWindow(priority_label, flag=wx.GROW) + self.LeftGridSizer.Add(priority_label, flag=wx.GROW) # Create spin control for defining priority value self.Priority = wx.SpinCtrl(self, min=0, style=wx.SP_ARROW_KEYS) self.Bind(wx.EVT_TEXT, self.OnPriorityChanged, self.Priority) - self.LeftGridSizer.AddWindow(self.Priority, flag=wx.GROW) + self.LeftGridSizer.Add(self.Priority, flag=wx.GROW) # Add preview panel and associated label to sizers - self.RightGridSizer.AddWindow(self.PreviewLabel, flag=wx.GROW) - self.RightGridSizer.AddWindow(self.Preview, flag=wx.GROW) + self.RightGridSizer.Add(self.PreviewLabel, flag=wx.GROW) + self.RightGridSizer.Add(self.Preview, flag=wx.GROW) # Add buttons sizer to sizers - self.MainSizer.AddSizer( + self.MainSizer.Add( self.ButtonSizer, border=20, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) diff -r ac0e6de439b5 -r 838242d34741 dialogs/SearchInProjectDialog.py --- a/dialogs/SearchInProjectDialog.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/SearchInProjectDialog.py Fri Mar 03 19:20:49 2023 +0100 @@ -54,59 +54,59 @@ pattern_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=2, vgap=5) pattern_sizer.AddGrowableCol(0) - main_sizer.AddSizer(pattern_sizer, border=20, + main_sizer.Add(pattern_sizer, border=20, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) pattern_label = wx.StaticText(self, label=_('Pattern to search:')) - pattern_sizer.AddWindow(pattern_label, flag=wx.ALIGN_BOTTOM) + pattern_sizer.Add(pattern_label, flag=wx.ALIGN_BOTTOM) self.CaseSensitive = wx.CheckBox(self, label=_('Case sensitive')) - pattern_sizer.AddWindow(self.CaseSensitive, flag=wx.GROW) + pattern_sizer.Add(self.CaseSensitive, flag=wx.GROW) self.Pattern = wx.TextCtrl(self, size=wx.Size(250, -1)) self.Bind(wx.EVT_TEXT, self.FindPatternChanged, self.Pattern) - pattern_sizer.AddWindow(self.Pattern, flag=wx.GROW) + pattern_sizer.Add(self.Pattern, flag=wx.GROW) self.Bind(wx.EVT_CHAR_HOOK, self.OnEscapeKey) self.RegularExpression = wx.CheckBox(self, label=_('Regular expression')) - pattern_sizer.AddWindow(self.RegularExpression, flag=wx.GROW) + pattern_sizer.Add(self.RegularExpression, flag=wx.GROW) scope_staticbox = wx.StaticBox(self, label=_('Scope')) scope_sizer = wx.StaticBoxSizer(scope_staticbox, wx.HORIZONTAL) - main_sizer.AddSizer(scope_sizer, border=20, + main_sizer.Add(scope_sizer, border=20, flag=wx.GROW | wx.LEFT | wx.RIGHT) scope_selection_sizer = wx.BoxSizer(wx.VERTICAL) - scope_sizer.AddSizer(scope_selection_sizer, 1, border=5, + scope_sizer.Add(scope_selection_sizer, 1, border=5, flag=wx.GROW | wx.TOP | wx.LEFT | wx.BOTTOM) self.WholeProject = wx.RadioButton(self, label=_('Whole Project'), style=wx.RB_GROUP) self.WholeProject.SetValue(True) self.Bind(wx.EVT_RADIOBUTTON, self.OnScopeChanged, self.WholeProject) - scope_selection_sizer.AddWindow(self.WholeProject, border=5, + scope_selection_sizer.Add(self.WholeProject, border=5, flag=wx.GROW | wx.BOTTOM) self.OnlyElements = wx.RadioButton(self, label=_('Only Elements')) self.Bind(wx.EVT_RADIOBUTTON, self.OnScopeChanged, self.OnlyElements) self.OnlyElements.SetValue(False) - scope_selection_sizer.AddWindow(self.OnlyElements, flag=wx.GROW) + scope_selection_sizer.Add(self.OnlyElements, flag=wx.GROW) self.ElementsList = wx.CheckListBox(self) self.ElementsList.Enable(False) - scope_sizer.AddWindow(self.ElementsList, 1, border=5, + scope_sizer.Add(self.ElementsList, 1, border=5, flag=wx.GROW | wx.TOP | wx.RIGHT | wx.BOTTOM) buttons_sizer = wx.BoxSizer(wx.HORIZONTAL) - main_sizer.AddSizer(buttons_sizer, border=20, + main_sizer.Add(buttons_sizer, border=20, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM | wx.ALIGN_RIGHT) self.FindButton = wx.Button(self, label=_("Find")) self.FindButton.SetDefault() self.Bind(wx.EVT_BUTTON, self.OnFindButton, self.FindButton) - buttons_sizer.AddWindow(self.FindButton, border=5, flag=wx.RIGHT) + buttons_sizer.Add(self.FindButton, border=5, flag=wx.RIGHT) self.CloseButton = wx.Button(self, label=_("Close")) self.Bind(wx.EVT_BUTTON, self.OnCloseButton, self.CloseButton) - buttons_sizer.AddWindow(self.CloseButton) + buttons_sizer.Add(self.CloseButton) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 dialogs/__init__.py --- a/dialogs/__init__.py Wed Mar 01 10:54:54 2023 +0100 +++ b/dialogs/__init__.py Fri Mar 03 19:20:49 2023 +0100 @@ -51,3 +51,4 @@ from dialogs.BrowseValuesLibraryDialog import BrowseValuesLibraryDialog from dialogs.UriEditor import UriEditor from dialogs.IDManager import IDManager +from dialogs.MessageBoxOnce import MessageBoxOnce diff -r ac0e6de439b5 -r 838242d34741 docutil/docsvg.py --- a/docutil/docsvg.py Wed Mar 01 10:54:54 2023 +0100 +++ b/docutil/docsvg.py Fri Mar 03 19:20:49 2023 +0100 @@ -24,8 +24,10 @@ from __future__ import absolute_import +import os import wx import subprocess +from dialogs import MessageBoxOnce def _get_inkscape_path(): @@ -86,11 +88,23 @@ _inkscape_version = _get_inkscape_version() return _inkscape_version -def open_svg(svgfile): - """ Generic function to open SVG file """ - - inkpath = get_inkscape_path() - if inkpath is None: - wx.MessageBox("Inkscape is not found or installed !") - else: - subprocess.Popen([inkpath,svgfile]) +if os.environ.has_key("SNAP"): + def open_svg(svgfile): + MessageBoxOnce("Launching Inkscape with xdg-open", + "Confined app can't launch Inkscape directly.\n"+ + "Instead, SVG file is passed to xdg-open.\n"+ + "Please select Inskape when proposed.\n\n"+ + "Notes: \n"+ + " - Inkscape must be installed on you system.\n"+ + " - If no choice is proposed, use file manager to change SVG file properties.\n", + "DocSVGSnapWarning") + + subprocess.Popen(["xdg-open",svgfile]) +else: + def open_svg(svgfile): + """ Generic function to open SVG file """ + inkpath = get_inkscape_path() + if inkpath is None: + wx.MessageBox("Inkscape is not found or installed !") + else: + subprocess.Popen([inkpath,svgfile]) diff -r ac0e6de439b5 -r 838242d34741 editors/CodeFileEditor.py --- a/editors/CodeFileEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/CodeFileEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -291,17 +291,16 @@ doc_end_pos = self.GetLength() for section in self.Controler.SECTIONS_NAMES: section_comments = self.SectionsComments[section] - start_pos = self.FindText(0, doc_end_pos, section_comments["comment"]) - end_pos = start_pos + len(section_comments["comment"]) - self.StartStyling(start_pos, 0xff) + start_pos, end_pos = self.FindText(0, doc_end_pos, section_comments["comment"]) + self.StartStyling(start_pos) self.SetStyling(end_pos - start_pos, STC_CODE_SECTION) self.SetLineState(self.LineFromPosition(start_pos), 1) - self.StartStyling(end_pos, 0x00) + self.StartStyling(end_pos) self.SetStyling(doc_end_pos - end_pos, stc.STC_STYLE_DEFAULT) def DoGetBestSize(self): - return self.ParentWindow.GetPanelBestSize() + return self.ParentWindow.GetBestSize() def RefreshModel(self): text = self.GetText() @@ -597,9 +596,9 @@ highlight_end_pos = end[1] + 1 else: highlight_end_pos = self.GetLineEndPosition(end[0] - 1) + end[1] + 2 - self.StartStyling(highlight_start_pos, 0xff) + self.StartStyling(highlight_start_pos) self.SetStyling(highlight_end_pos - highlight_start_pos, highlight_type) - self.StartStyling(highlight_end_pos, 0x00) + self.StartStyling(highlight_end_pos) self.SetStyling(len(self.GetText()) - highlight_end_pos, stc.STC_STYLE_DEFAULT) @@ -614,8 +613,7 @@ class ClassGridCellEditor(wx.grid.GridCellChoiceEditor): def __init__(self, table, row, col): - wx.grid.GridCellChoiceEditor.__init__(self) - self.SetParameters("input,memory,output") + wx.grid.GridCellChoiceEditor.__init__(self,["input","memory","output"]) class VariablesTable(CustomTable): @@ -678,7 +676,7 @@ main_sizer.AddGrowableRow(0) controls_sizer = wx.BoxSizer(wx.VERTICAL) - main_sizer.AddSizer(controls_sizer, border=5, flag=wx.ALL) + main_sizer.Add(controls_sizer, border=5, flag=wx.ALL) for name, bitmap, help in [ ("AddVariableButton", "add_element", _("Add variable")), @@ -687,15 +685,15 @@ ("DownVariableButton", "down", _("Move variable down"))]: button = wx.lib.buttons.GenBitmapButton(self, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - controls_sizer.AddWindow(button, border=5, flag=wx.BOTTOM) + controls_sizer.Add(button, border=5, flag=wx.BOTTOM) self.VariablesGrid = CustomGrid(self, style=wx.VSCROLL) - self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, self.OnVariablesGridCellChange) + self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGING, self.OnVariablesGridCellChange) self.VariablesGrid.Bind(wx.grid.EVT_GRID_CELL_LEFT_CLICK, self.OnVariablesGridCellLeftClick) self.VariablesGrid.Bind(wx.grid.EVT_GRID_EDITOR_SHOWN, self.OnVariablesGridEditorShown) - main_sizer.AddWindow(self.VariablesGrid, flag=wx.GROW) + main_sizer.Add(self.VariablesGrid, flag=wx.GROW) self.SetSizer(main_sizer) @@ -785,7 +783,7 @@ self.VariablesGrid.RefreshButtons() def DoGetBestSize(self): - return self.ParentWindow.GetPanelBestSize() + return self.ParentWindow.GetBestSize() def ShowErrorMessage(self, message): dialog = wx.MessageDialog(self, message, _("Error"), wx.OK | wx.ICON_ERROR) @@ -826,17 +824,17 @@ type_menu = wx.Menu(title='') base_menu = wx.Menu(title='') for base_type in self.Controler.GetBaseTypes(): - new_entry = base_menu.Append(help='', id=wx.ID_ANY, kind=wx.ITEM_NORMAL, text=base_type) + new_entry = base_menu.Append(wx.ID_ANY, base_type) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(base_type), new_entry) type_menu.AppendMenu(wx.ID_ANY, "Base Types", base_menu) datatype_menu = wx.Menu(title='') for datatype in self.Controler.GetDataTypes(): - new_entry = datatype_menu.Append(help='', id=wx.ID_ANY, kind=wx.ITEM_NORMAL, text=datatype) + new_entry = datatype_menu.Append(wx.ID_ANY, item=datatype) self.Bind(wx.EVT_MENU, self.GetVariableTypeFunction(datatype), new_entry) type_menu.AppendMenu(wx.ID_ANY, "User Data Types", datatype_menu) rect = self.VariablesGrid.BlockToDeviceRect((row, col), (row, col)) - self.VariablesGrid.PopupMenuXY(type_menu, rect.x + rect.width, rect.y + self.VariablesGrid.GetColLabelSize()) + self.VariablesGrid.PopupMenu(type_menu, rect.x + rect.width, rect.y + self.VariablesGrid.GetColLabelSize()) type_menu.Destroy() event.Veto() else: diff -r ac0e6de439b5 -r 838242d34741 editors/ConfTreeNodeEditor.py --- a/editors/ConfTreeNodeEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/ConfTreeNodeEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -120,7 +120,7 @@ bitmap = GetBitmap(bitmapname) if bitmap is None: - bitmap = wx.EmptyBitmap(0, 0) + bitmap = wx.Bitmap() wx.StaticBitmap.__init__(self, parent, ID, bitmap, @@ -148,18 +148,18 @@ if self.SHOW_BASE_PARAMS: baseparamseditor_sizer = wx.BoxSizer(wx.HORIZONTAL) - self.MainSizer.AddSizer(baseparamseditor_sizer, border=5, + self.MainSizer.Add(baseparamseditor_sizer, border=5, flag=wx.GROW | wx.ALL) self.FullIECChannel = wx.StaticText(self.Editor, -1) self.FullIECChannel.SetFont( wx.Font(faces["size"], wx.DEFAULT, wx.NORMAL, wx.BOLD, faceName=faces["helv"])) - baseparamseditor_sizer.AddWindow(self.FullIECChannel, + baseparamseditor_sizer.Add(self.FullIECChannel, flag=wx.ALIGN_CENTER_VERTICAL) updownsizer = wx.BoxSizer(wx.VERTICAL) - baseparamseditor_sizer.AddSizer(updownsizer, border=5, + baseparamseditor_sizer.Add(updownsizer, border=5, flag=wx.LEFT | wx.ALIGN_CENTER_VERTICAL) self.IECCUpButton = wx.lib.buttons.GenBitmapTextButton( @@ -169,14 +169,14 @@ style=wx.NO_BORDER) self.IECCUpButton.Bind(wx.EVT_BUTTON, self.GetItemChannelChangedFunction(1), self.IECCUpButton) - updownsizer.AddWindow(self.IECCUpButton, flag=wx.ALIGN_LEFT) + updownsizer.Add(self.IECCUpButton, flag=wx.ALIGN_LEFT) self.IECCDownButton = wx.lib.buttons.GenBitmapButton( self.Editor, bitmap=GetBitmap('IECCUp'), size=wx.Size(16, 16), style=wx.NO_BORDER) self.IECCDownButton.Bind(wx.EVT_BUTTON, self.GetItemChannelChangedFunction(-1), self.IECCDownButton) - updownsizer.AddWindow(self.IECCDownButton, flag=wx.ALIGN_LEFT) + updownsizer.Add(self.IECCDownButton, flag=wx.ALIGN_LEFT) self.ConfNodeName = wx.TextCtrl(self.Editor, size=wx.Size(150, 25)) @@ -187,17 +187,17 @@ wx.EVT_TEXT, self.GetTextCtrlCallBackFunction(self.ConfNodeName, "BaseParams.Name", True), self.ConfNodeName) - baseparamseditor_sizer.AddWindow( + baseparamseditor_sizer.Add( self.ConfNodeName, border=5, flag=wx.LEFT | wx.RIGHT | wx.ALIGN_CENTER_VERTICAL) buttons_sizer = self.GenerateMethodButtonSizer() - baseparamseditor_sizer.AddSizer(buttons_sizer, flag=wx.ALIGN_CENTER) + baseparamseditor_sizer.Add(buttons_sizer, flag=wx.ALIGN_CENTER) if tabs_num > 1: self.ConfNodeNoteBook = wx.Notebook(self.Editor) parent = self.ConfNodeNoteBook - self.MainSizer.AddWindow(self.ConfNodeNoteBook, 1, flag=wx.GROW) + self.MainSizer.Add(self.ConfNodeNoteBook, 1, flag=wx.GROW) else: parent = self.Editor self.ConfNodeNoteBook = None @@ -212,7 +212,7 @@ if self.ConfNodeNoteBook is not None: self.ConfNodeNoteBook.AddPage(editor, title) elif self.SHOW_BASE_PARAMS: - self.MainSizer.AddWindow(editor, 1, flag=wx.GROW) + self.MainSizer.Add(editor, 1, flag=wx.GROW) else: self.Editor = editor @@ -232,7 +232,7 @@ self.ParamsEditor.SetSizer(self.ParamsEditorSizer) self.ConfNodeParamsSizer = wx.BoxSizer(wx.VERTICAL) - self.ParamsEditorSizer.AddSizer(self.ConfNodeParamsSizer, border=5, + self.ParamsEditorSizer.Add(self.ConfNodeParamsSizer, border=5, flag=wx.LEFT | wx.RIGHT | wx.BOTTOM) self.RefreshConfNodeParamsSizer() @@ -240,7 +240,7 @@ if self.ConfNodeNoteBook is not None: self.ConfNodeNoteBook.AddPage(self.ParamsEditor, _("Config")) elif self.SHOW_BASE_PARAMS: - self.MainSizer.AddWindow(self.ParamsEditor, 1, flag=wx.GROW) + self.MainSizer.Add(self.ParamsEditor, 1, flag=wx.GROW) else: self.Editor = self.ParamsEditor else: @@ -317,7 +317,7 @@ label=confnode_method["name"], style=wx.NO_BORDER) button.SetFont(normal_bt_font) - button.SetToolTipString(confnode_method["tooltip"]) + button.SetToolTip(confnode_method["tooltip"]) if confnode_method.get("push", False): button.Bind(wx.EVT_LEFT_DOWN, self.GetButtonCallBackFunction(confnode_method["method"], True)) else: @@ -335,7 +335,7 @@ # hack to force size to mini if not confnode_method.get("enabled", True): button.Disable() - msizer.AddWindow(button, flag=wx.ALIGN_CENTER) + msizer.Add(button, flag=wx.ALIGN_CENTER) return msizer def UriOptions(self, event): @@ -380,32 +380,32 @@ flags = (wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) if first: flags |= wx.TOP - sizer.AddSizer(staticboxsizer, border=5, flag=flags) + sizer.Add(staticboxsizer, border=5, flag=flags) self.GenerateSizerElements(staticboxsizer, element_infos["children"], element_path) else: - boxsizer = wx.FlexGridSizer(cols=4, rows=1) + boxsizer = wx.FlexGridSizer(cols=4, rows=1, gap=wx.Size(0,0)) boxsizer.AddGrowableCol(1) flags = (wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) if first: flags |= wx.TOP - sizer.AddSizer(boxsizer, border=5, flag=flags) + sizer.Add(boxsizer, border=5, flag=flags) staticbitmap = GenStaticBitmap( ID=-1, bitmapname=element_infos["name"], name="%s_bitmap" % element_infos["name"], parent=self.ParamsEditor, pos=wx.Point(0, 0), size=wx.Size(24, 24), style=0) - boxsizer.AddWindow(staticbitmap, border=5, flag=wx.RIGHT) + boxsizer.Add(staticbitmap, border=5, flag=wx.RIGHT) statictext = wx.StaticText(self.ParamsEditor, label="%s:" % _(element_infos["name"])) - boxsizer.AddWindow(statictext, border=5, + boxsizer.Add(statictext, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.RIGHT) if isinstance(element_infos["type"], list): if isinstance(element_infos["value"], tuple): browse_boxsizer = wx.BoxSizer(wx.HORIZONTAL) - boxsizer.AddSizer(browse_boxsizer) + boxsizer.Add(browse_boxsizer) textctrl = wx.TextCtrl(self.ParamsEditor, size=wx.Size(275, -1), style=wx.TE_READONLY) @@ -414,10 +414,10 @@ value_infos = element_infos["value"][1] else: value_infos = None - browse_boxsizer.AddWindow(textctrl) + browse_boxsizer.Add(textctrl) button = wx.Button(self.ParamsEditor, label="...") - browse_boxsizer.AddWindow(button) + browse_boxsizer.Add(button) button.Bind(wx.EVT_BUTTON, self.GetBrowseCallBackFunction(element_infos["name"], textctrl, element_infos["type"], value_infos, element_path), @@ -425,7 +425,7 @@ else: combobox = wx.ComboBox(self.ParamsEditor, size=wx.Size(300, -1), style=wx.CB_READONLY) - boxsizer.AddWindow(combobox) + boxsizer.Add(combobox) if element_infos["use"] == "optional": combobox.Append("") @@ -435,13 +435,16 @@ name = element_infos["name"] value = element_infos["value"] - staticbox = wx.StaticBox(self.ParamsEditor, - label="%s - %s" % (_(name), _(value)), - size=wx.Size(10, 0)) - staticboxsizer = wx.StaticBoxSizer(staticbox, wx.VERTICAL) - sizer.AddSizer(staticboxsizer, border=5, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) - self.GenerateSizerElements(staticboxsizer, element_infos["children"], element_path) - callback = self.GetChoiceContentCallBackFunction(combobox, staticboxsizer, element_path) + staticboxsizer = None + if element_infos["children"]: + staticbox = wx.StaticBox(self.ParamsEditor, + label="%s - %s" % (_(name), _(value)), + size=wx.Size(10, 0)) + staticboxsizer = wx.StaticBoxSizer(staticbox, wx.VERTICAL) + sizer.Add(staticboxsizer, border=5, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) + self.GenerateSizerElements(staticboxsizer, element_infos["children"], element_path) + + callback = self.GetChoiceContentCallBackFunction(combobox, element_path) else: for choice in element_infos["type"]: combobox.Append(choice) @@ -463,7 +466,7 @@ size=wx.Size(300, -1), style=wx.SP_ARROW_KEYS | wx.ALIGN_RIGHT) spinctrl.SetRange(scmin, scmax) - boxsizer.AddWindow(spinctrl) + boxsizer.Add(spinctrl) if element_infos["value"] is not None: spinctrl.SetValue(element_infos["value"]) spinctrl.Bind(wx.EVT_SPINCTRL, @@ -473,7 +476,7 @@ else: if element_infos["type"] == "boolean": checkbox = wx.CheckBox(self.ParamsEditor) - boxsizer.AddWindow(checkbox, flag=wx.ALIGN_CENTER_VERTICAL | wx.RIGHT) + boxsizer.Add(checkbox, flag=wx.ALIGN_CENTER_VERTICAL | wx.RIGHT) if element_infos["value"] is not None: checkbox.SetValue(element_infos["value"]) checkbox.Bind(wx.EVT_CHECKBOX, @@ -490,7 +493,7 @@ size=wx.Size(300, -1), style=wx.SP_ARROW_KEYS | wx.ALIGN_RIGHT) spinctrl.SetRange(scmin, scmax) - boxsizer.AddWindow(spinctrl) + boxsizer.Add(spinctrl) if element_infos["value"] is not None: spinctrl.SetValue(element_infos["value"]) spinctrl.Bind(wx.EVT_SPINCTRL, @@ -513,12 +516,12 @@ self.EditButton = wx.Button(self.ParamsEditor, label='...', size=wx.Size(30, -1)) self.Bind(wx.EVT_BUTTON, self.UriOptions, self.EditButton) - uriSizer.AddWindow(textctrl, flag=wx.GROW) - uriSizer.AddWindow(self.EditButton, flag=wx.GROW) - - boxsizer.AddWindow(uriSizer) + uriSizer.Add(textctrl, flag=wx.GROW) + uriSizer.Add(self.EditButton, flag=wx.GROW) + + boxsizer.Add(uriSizer) else: - boxsizer.AddWindow(textctrl) + boxsizer.Add(textctrl) if element_infos["value"] is not None: textctrl.ChangeValue(str(element_infos["value"])) @@ -527,7 +530,7 @@ textctrl.Bind(wx.EVT_TEXT, callback) textctrl.Bind(wx.EVT_KILL_FOCUS, callback) - if not isinstance(element_infos["type"], list) and element_infos["use"] == "optional": + if not isinstance(element_infos["type"], list) and element_infos.get("use", None) == "optional": bt = wx.BitmapButton(self.ParamsEditor, bitmap=wx.ArtProvider.GetBitmap(wx.ART_UNDO, wx.ART_TOOLBAR, (16,16)), style=wx.BORDER_NONE) @@ -535,7 +538,7 @@ self.GetResetFunction(element_path), bt) - boxsizer.AddWindow(bt, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.LEFT) + boxsizer.Add(bt, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.LEFT) first = False sizer.Layout() self.RefreshScrollbars() @@ -579,7 +582,7 @@ event.Skip() return OnChoiceChanged - def GetChoiceContentCallBackFunction(self, choicectrl, staticboxsizer, path): + def GetChoiceContentCallBackFunction(self, choicectrl, path): def OnChoiceContentChanged(event): self.SetConfNodeParamsAttribute(path, choicectrl.GetStringSelection()) wx.CallAfter(self.RefreshConfNodeParamsSizer) diff -r ac0e6de439b5 -r 838242d34741 editors/DataTypeEditor.py --- a/editors/DataTypeEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/DataTypeEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -47,7 +47,7 @@ def AppendMenu(parent, help, kind, text): - return parent.Append(help=help, id=wx.ID_ANY, kind=kind, text=text) + return parent.Append(wx.MenuItem(helpString=help, id=wx.ID_ANY, kind=kind, text=text)) def GetElementsTableColnames(): @@ -155,49 +155,49 @@ self.MainSizer.AddGrowableRow(1) top_sizer = wx.BoxSizer(wx.HORIZONTAL) - self.MainSizer.AddSizer(top_sizer, border=5, + self.MainSizer.Add(top_sizer, border=5, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) derivation_type_label = wx.StaticText(self.Editor, label=_('Derivation Type:')) - top_sizer.AddWindow(derivation_type_label, border=5, + top_sizer.Add(derivation_type_label, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.LEFT | wx.RIGHT) self.DerivationType = wx.ComboBox(self.Editor, size=wx.Size(200, -1), style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnDerivationTypeChanged, self.DerivationType) - top_sizer.AddWindow(self.DerivationType, border=5, flag=wx.GROW | wx.RIGHT) + top_sizer.Add(self.DerivationType, border=5, flag=wx.GROW | wx.RIGHT) typeinfos_staticbox = wx.StaticBox(self.Editor, label=_('Type infos:')) typeinfos_sizer = wx.StaticBoxSizer(typeinfos_staticbox, wx.HORIZONTAL) - self.MainSizer.AddSizer(typeinfos_sizer, border=5, + self.MainSizer.Add(typeinfos_sizer, border=5, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) # Panel for Directly derived data types self.DirectlyPanel = wx.Panel(self.Editor, style=wx.TAB_TRAVERSAL) - typeinfos_sizer.AddWindow(self.DirectlyPanel, 1) + typeinfos_sizer.Add(self.DirectlyPanel, 1) directly_panel_sizer = wx.BoxSizer(wx.HORIZONTAL) directly_basetype_label = wx.StaticText(self.DirectlyPanel, label=_('Base Type:')) - directly_panel_sizer.AddWindow(directly_basetype_label, 1, border=5, + directly_panel_sizer.Add(directly_basetype_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.DirectlyBaseType = wx.ComboBox(self.DirectlyPanel, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnInfosChanged, self.DirectlyBaseType) - directly_panel_sizer.AddWindow(self.DirectlyBaseType, 1, border=5, + directly_panel_sizer.Add(self.DirectlyBaseType, 1, border=5, flag=wx.GROW | wx.ALL) directly_initialvalue_label = wx.StaticText(self.DirectlyPanel, label=_('Initial Value:')) - directly_panel_sizer.AddWindow(directly_initialvalue_label, 1, border=5, + directly_panel_sizer.Add(directly_initialvalue_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.DirectlyInitialValue = wx.TextCtrl(self.DirectlyPanel, style=wx.TE_PROCESS_ENTER | wx.TE_RICH) self.Bind(wx.EVT_TEXT_ENTER, self.OnReturnKeyPressed, self.DirectlyInitialValue) - directly_panel_sizer.AddWindow(self.DirectlyInitialValue, 1, border=5, + directly_panel_sizer.Add(self.DirectlyInitialValue, 1, border=5, flag=wx.ALL) self.DirectlyPanel.SetSizer(directly_panel_sizer) @@ -205,52 +205,52 @@ # Panel for Subrange data types self.SubrangePanel = wx.Panel(self.Editor, style=wx.TAB_TRAVERSAL) - typeinfos_sizer.AddWindow(self.SubrangePanel, 1) + typeinfos_sizer.Add(self.SubrangePanel, 1) subrange_panel_sizer = wx.GridSizer(cols=4, hgap=5, rows=3, vgap=0) subrange_basetype_label = wx.StaticText(self.SubrangePanel, label=_('Base Type:')) - subrange_panel_sizer.AddWindow(subrange_basetype_label, 1, border=5, + subrange_panel_sizer.Add(subrange_basetype_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.SubrangeBaseType = wx.ComboBox(self.SubrangePanel, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnSubrangeBaseTypeChanged, self.SubrangeBaseType) - subrange_panel_sizer.AddWindow(self.SubrangeBaseType, 1, border=5, + subrange_panel_sizer.Add(self.SubrangeBaseType, 1, border=5, flag=wx.GROW | wx.ALL) subrange_initialvalue_label = wx.StaticText(self.SubrangePanel, label=_('Initial Value:')) - subrange_panel_sizer.AddWindow(subrange_initialvalue_label, 1, border=5, + subrange_panel_sizer.Add(subrange_initialvalue_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.SubrangeInitialValue = CustomIntCtrl(self.SubrangePanel, style=wx.TAB_TRAVERSAL) self.SubrangeInitialValue.Bind(CustomIntCtrl.EVT_CUSTOM_INT, self.OnInfosChanged) - subrange_panel_sizer.AddWindow(self.SubrangeInitialValue, 1, border=5, + subrange_panel_sizer.Add(self.SubrangeInitialValue, 1, border=5, flag=wx.GROW | wx.ALL) subrange_minimum_label = wx.StaticText(self.SubrangePanel, label=_('Minimum:')) - subrange_panel_sizer.AddWindow(subrange_minimum_label, 1, border=5, + subrange_panel_sizer.Add(subrange_minimum_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.SubrangeMinimum = CustomIntCtrl(self.SubrangePanel, style=wx.TAB_TRAVERSAL) self.SubrangeMinimum.Bind(CustomIntCtrl.EVT_CUSTOM_INT, self.OnSubrangeMinimumChanged) - subrange_panel_sizer.AddWindow(self.SubrangeMinimum, 1, border=5, + subrange_panel_sizer.Add(self.SubrangeMinimum, 1, border=5, flag=wx.GROW | wx.ALL) for dummy in xrange(2): - subrange_panel_sizer.AddWindow(wx.Size(0, 0), 1) + subrange_panel_sizer.Add(wx.Size(0, 0), 1) subrange_maximum_label = wx.StaticText(self.SubrangePanel, label=_('Maximum:')) - subrange_panel_sizer.AddWindow(subrange_maximum_label, 1, border=5, + subrange_panel_sizer.Add(subrange_maximum_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.SubrangeMaximum = CustomIntCtrl(self.SubrangePanel, style=wx.TAB_TRAVERSAL) self.SubrangeMaximum.Bind(CustomIntCtrl.EVT_CUSTOM_INT, self.OnSubrangeMaximumChanged) - subrange_panel_sizer.AddWindow(self.SubrangeMaximum, 1, border=5, + subrange_panel_sizer.Add(self.SubrangeMaximum, 1, border=5, flag=wx.GROW | wx.ALL) self.SubrangePanel.SetSizer(subrange_panel_sizer) @@ -258,35 +258,35 @@ # Panel for Enumerated data types self.EnumeratedPanel = wx.Panel(self.Editor, style=wx.TAB_TRAVERSAL) - typeinfos_sizer.AddWindow(self.EnumeratedPanel, 1) + typeinfos_sizer.Add(self.EnumeratedPanel, 1) enumerated_panel_sizer = wx.BoxSizer(wx.HORIZONTAL) self.EnumeratedValues = CustomEditableListBox( self.EnumeratedPanel, label=_("Values:"), - style=(wx.gizmos.EL_ALLOW_NEW | - wx.gizmos.EL_ALLOW_EDIT | - wx.gizmos.EL_ALLOW_DELETE)) + style=(wx.adv.EL_ALLOW_NEW | + wx.adv.EL_ALLOW_EDIT | + wx.adv.EL_ALLOW_DELETE)) setattr(self.EnumeratedValues, "_OnLabelEndEdit", self.OnEnumeratedValueEndEdit) for func in ["_OnAddButton", "_OnDelButton", "_OnUpButton", "_OnDownButton"]: setattr(self.EnumeratedValues, func, self.OnEnumeratedValuesChanged) - enumerated_panel_sizer.AddWindow(self.EnumeratedValues, 1, border=5, + enumerated_panel_sizer.Add(self.EnumeratedValues, 1, border=5, flag=wx.GROW | wx.ALL) enumerated_panel_rightsizer = wx.BoxSizer(wx.HORIZONTAL) - enumerated_panel_sizer.AddSizer(enumerated_panel_rightsizer, 1) + enumerated_panel_sizer.Add(enumerated_panel_rightsizer, 1) enumerated_initialvalue_label = wx.StaticText(self.EnumeratedPanel, label=_('Initial Value:')) - enumerated_panel_rightsizer.AddWindow(enumerated_initialvalue_label, 1, + enumerated_panel_rightsizer.Add(enumerated_initialvalue_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.EnumeratedInitialValue = wx.ComboBox(self.EnumeratedPanel, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnInfosChanged, self.EnumeratedInitialValue) - enumerated_panel_rightsizer.AddWindow(self.EnumeratedInitialValue, 1, + enumerated_panel_rightsizer.Add(self.EnumeratedInitialValue, 1, border=5, flag=wx.ALL) self.EnumeratedPanel.SetSizer(enumerated_panel_sizer) @@ -294,7 +294,7 @@ # Panel for Array data types self.ArrayPanel = wx.Panel(self.Editor, style=wx.TAB_TRAVERSAL) - typeinfos_sizer.AddWindow(self.ArrayPanel, 1) + typeinfos_sizer.Add(self.ArrayPanel, 1) array_panel_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=2, vgap=0) array_panel_sizer.AddGrowableCol(0) @@ -302,41 +302,41 @@ array_panel_sizer.AddGrowableRow(1) array_panel_leftSizer = wx.BoxSizer(wx.HORIZONTAL) - array_panel_sizer.AddSizer(array_panel_leftSizer, flag=wx.GROW) + array_panel_sizer.Add(array_panel_leftSizer, flag=wx.GROW) array_basetype_label = wx.StaticText(self.ArrayPanel, label=_('Base Type:')) - array_panel_leftSizer.AddWindow(array_basetype_label, 1, border=5, + array_panel_leftSizer.Add(array_basetype_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.ArrayBaseType = wx.ComboBox(self.ArrayPanel, style=wx.CB_READONLY) self.Bind(wx.EVT_COMBOBOX, self.OnInfosChanged, self.ArrayBaseType) - array_panel_leftSizer.AddWindow(self.ArrayBaseType, 1, border=5, + array_panel_leftSizer.Add(self.ArrayBaseType, 1, border=5, flag=wx.GROW | wx.ALL) array_panel_rightsizer = wx.BoxSizer(wx.HORIZONTAL) - array_panel_sizer.AddSizer(array_panel_rightsizer, flag=wx.GROW) + array_panel_sizer.Add(array_panel_rightsizer, flag=wx.GROW) array_initialvalue_label = wx.StaticText(self.ArrayPanel, label=_('Initial Value:')) - array_panel_rightsizer.AddWindow(array_initialvalue_label, 1, border=5, + array_panel_rightsizer.Add(array_initialvalue_label, 1, border=5, flag=wx.ALIGN_CENTER_VERTICAL | wx.ALL) self.ArrayInitialValue = wx.TextCtrl(self.ArrayPanel, style=wx.TE_PROCESS_ENTER | wx.TE_RICH) self.Bind(wx.EVT_TEXT_ENTER, self.OnReturnKeyPressed, self.ArrayInitialValue) - array_panel_rightsizer.AddWindow(self.ArrayInitialValue, 1, border=5, + array_panel_rightsizer.Add(self.ArrayInitialValue, 1, border=5, flag=wx.ALL) self.ArrayDimensions = CustomEditableListBox( self.ArrayPanel, label=_("Dimensions:"), - style=(wx.gizmos.EL_ALLOW_NEW | - wx.gizmos.EL_ALLOW_EDIT | - wx.gizmos.EL_ALLOW_DELETE)) + style=(wx.adv.EL_ALLOW_NEW | + wx.adv.EL_ALLOW_EDIT | + wx.adv.EL_ALLOW_DELETE)) for func in ["_OnLabelEndEdit", "_OnAddButton", "_OnDelButton", "_OnUpButton", "_OnDownButton"]: setattr(self.ArrayDimensions, func, self.OnDimensionsChanged) - array_panel_sizer.AddWindow(self.ArrayDimensions, 0, border=5, + array_panel_sizer.Add(self.ArrayDimensions, 0, border=5, flag=wx.GROW | wx.ALL) self.ArrayPanel.SetSizer(array_panel_sizer) @@ -344,7 +344,7 @@ # Panel for Structure data types self.StructurePanel = wx.Panel(self.Editor, style=wx.TAB_TRAVERSAL) - typeinfos_sizer.AddWindow(self.StructurePanel, 1) + typeinfos_sizer.Add(self.StructurePanel, 1) structure_panel_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=2, vgap=0) structure_panel_sizer.AddGrowableCol(0) @@ -353,12 +353,12 @@ structure_button_sizer = wx.FlexGridSizer(cols=5, hgap=5, rows=1, vgap=0) structure_button_sizer.AddGrowableCol(0) structure_button_sizer.AddGrowableRow(0) - structure_panel_sizer.AddSizer(structure_button_sizer, 0, border=5, + structure_panel_sizer.Add(structure_button_sizer, 0, border=5, flag=wx.ALL | wx.GROW) structure_elements_label = wx.StaticText(self.StructurePanel, label=_('Elements :')) - structure_button_sizer.AddWindow(structure_elements_label, flag=wx.ALIGN_BOTTOM) + structure_button_sizer.Add(structure_elements_label, flag=wx.ALIGN_BOTTOM) for name, bitmap, help in [ ("StructureAddButton", "add_element", _("Add element")), @@ -369,17 +369,17 @@ bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - structure_button_sizer.AddWindow(button) + structure_button_sizer.Add(button) self.StructureElementsGrid = CustomGrid(self.StructurePanel, size=wx.Size(0, 150), style=wx.VSCROLL) - self.StructureElementsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, + self.StructureElementsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGED, self.OnStructureElementsGridCellChange) self.StructureElementsGrid.Bind(wx.grid.EVT_GRID_EDITOR_SHOWN, self.OnStructureElementsGridEditorShown) - structure_panel_sizer.AddWindow(self.StructureElementsGrid, flag=wx.GROW) + structure_panel_sizer.Add(self.StructureElementsGrid, flag=wx.GROW) self.StructurePanel.SetSizer(structure_panel_sizer) @@ -647,7 +647,7 @@ self.Bind(wx.EVT_MENU, self.ElementArrayTypeFunction, new_entry) rect = self.StructureElementsGrid.BlockToDeviceRect((row, col), (row, col)) - self.StructureElementsGrid.PopupMenuXY(type_menu, rect.x + rect.width, rect.y + self.StructureElementsGrid.GetColLabelSize()) + self.StructureElementsGrid.PopupMenu(type_menu, rect.x + rect.width, rect.y + self.StructureElementsGrid.GetColLabelSize()) type_menu.Destroy() event.Veto() else: @@ -786,7 +786,7 @@ value = control.GetValueStr() if isinstance(control, CustomIntCtrl) else \ control.GetValue() control.SetStyle(0, len(value), wx.TextAttr(wx.NullColour)) - elif isinstance(control, wx.gizmos.EditableListBox): + elif isinstance(control, wx.adv.EditableListBox): listctrl = control.GetListCtrl() for i in xrange(listctrl.GetItemCount()): listctrl.SetItemBackgroundColour(i, wx.NullColour) @@ -811,7 +811,7 @@ control.SetForegroundColour(highlight_type[1]) elif isinstance(control, wx.TextCtrl): control.SetStyle(start[1], end[1] + 1, wx.TextAttr(highlight_type[1], highlight_type[0])) - elif isinstance(control, wx.gizmos.EditableListBox): + elif isinstance(control, wx.adv.EditableListBox): listctrl = control.GetListCtrl() listctrl.SetItemBackgroundColour(infos[1], highlight_type[0]) listctrl.SetItemTextColour(infos[1], highlight_type[1]) diff -r ac0e6de439b5 -r 838242d34741 editors/FileManagementPanel.py --- a/editors/FileManagementPanel.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/FileManagementPanel.py Fri Mar 03 19:20:49 2023 +0100 @@ -43,14 +43,14 @@ main_sizer = wx.BoxSizer(wx.HORIZONTAL) left_sizer = wx.BoxSizer(wx.VERTICAL) - main_sizer.AddSizer(left_sizer, 1, border=5, flag=wx.GROW | wx.ALL) + main_sizer.Add(left_sizer, 1, border=5, flag=wx.GROW | wx.ALL) managed_dir_label = wx.StaticText(self.Editor, label=_(self.TagName) + ":") - left_sizer.AddWindow(managed_dir_label, border=5, flag=wx.GROW | wx.BOTTOM) + left_sizer.Add(managed_dir_label, border=5, flag=wx.GROW | wx.BOTTOM) FILTER = _("All files (*.*)|*.*|CSV files (*.csv)|*.csv") self.ManagedDir = FolderTree(self.Editor, self.Folder, FILTER) - left_sizer.AddWindow(self.ManagedDir, 1, flag=wx.GROW) + left_sizer.Add(self.ManagedDir, 1, flag=wx.GROW) managed_treectrl = self.ManagedDir.GetTreeCtrl() self.Bind(wx.EVT_TREE_SEL_CHANGED, self.OnTreeItemChanged, managed_treectrl) @@ -58,7 +58,7 @@ self.Bind(wx.EVT_TREE_BEGIN_DRAG, self.OnTreeBeginDrag, managed_treectrl) button_sizer = wx.BoxSizer(wx.VERTICAL) - main_sizer.AddSizer(button_sizer, border=5, + main_sizer.Add(button_sizer, border=5, flag=wx.ALL | wx.ALIGN_CENTER_VERTICAL) for idx, (name, bitmap, help) in enumerate([ @@ -70,26 +70,26 @@ self.Editor, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) if idx > 0: flag = wx.TOP else: flag = 0 self.Bind(wx.EVT_BUTTON, getattr(self, "On" + name), button) - button_sizer.AddWindow(button, border=20, flag=flag) + button_sizer.Add(button, border=20, flag=flag) right_sizer = wx.BoxSizer(wx.VERTICAL) - main_sizer.AddSizer(right_sizer, 1, border=5, flag=wx.GROW | wx.ALL) + main_sizer.Add(right_sizer, 1, border=5, flag=wx.GROW | wx.ALL) if wx.Platform == '__WXMSW__': system_dir_label = wx.StaticText(self.Editor, label=_("My Computer:")) else: system_dir_label = wx.StaticText(self.Editor, label=_("Home Directory:")) - right_sizer.AddWindow(system_dir_label, border=5, flag=wx.GROW | wx.BOTTOM) + right_sizer.Add(system_dir_label, border=5, flag=wx.GROW | wx.BOTTOM) self.SystemDir = FolderTree(self.Editor, self.HomeDirectory, FILTER, False) - right_sizer.AddWindow(self.SystemDir, 1, flag=wx.GROW) + right_sizer.Add(self.SystemDir, 1, flag=wx.GROW) system_treectrl = self.SystemDir.GetTreeCtrl() self.Bind(wx.EVT_TREE_SEL_CHANGED, self.OnTreeItemChanged, system_treectrl) diff -r ac0e6de439b5 -r 838242d34741 editors/ProjectNodeEditor.py --- a/editors/ProjectNodeEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/ProjectNodeEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -60,7 +60,7 @@ ConfTreeNodeEditor.__init__(self, parent, controler, window, tagname) buttons_sizer = self.GenerateMethodButtonSizer() - self.MainSizer.InsertSizer(0, buttons_sizer, 0, border=5, flag=wx.ALL) + self.MainSizer.Insert(0, buttons_sizer, 0, border=5, flag=wx.ALL) self.MainSizer.Layout() self.VariableEditor = self.VariableEditorPanel diff -r ac0e6de439b5 -r 838242d34741 editors/ResourceEditor.py --- a/editors/ResourceEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/ResourceEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -76,10 +76,6 @@ return [_("Interrupt"), _("Cyclic")] -def SingleCellEditor(*x): - return wx.grid.GridCellChoiceEditor() - - def CheckSingle(single, varlist): return single in varlist @@ -162,25 +158,21 @@ if interval != "" and IEC_TIME_MODEL.match(interval.upper()) is None: error = True elif colname == "Single": - editor = SingleCellEditor(self, colname) - editor.SetParameters(self.Parent.VariableList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.VariableList) if self.GetValueByName(row, "Triggering") != "Interrupt": grid.SetReadOnly(row, col, True) single = self.GetValueByName(row, colname) if single != "" and not CheckSingle(single, self.Parent.VariableList): error = True elif colname == "Triggering": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(",".join(map(_, GetTaskTriggeringOptions()))) + editor = wx.grid.GridCellChoiceEditor(map(_, GetTaskTriggeringOptions())) elif colname == "Type": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.TypeList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.TypeList) elif colname == "Priority": editor = wx.grid.GridCellNumberEditor() editor.SetParameters("0,65535") elif colname == "Task": - editor = wx.grid.GridCellChoiceEditor() - editor.SetParameters(self.Parent.TaskList) + editor = wx.grid.GridCellChoiceEditor(self.Parent.TaskList) grid.SetCellEditor(row, col, editor) grid.SetCellRenderer(row, col, renderer) @@ -230,16 +222,16 @@ tasks_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=2, vgap=5) tasks_sizer.AddGrowableCol(0) tasks_sizer.AddGrowableRow(1) - main_sizer.AddSizer(tasks_sizer, border=5, + main_sizer.Add(tasks_sizer, border=5, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) tasks_buttons_sizer = wx.FlexGridSizer(cols=5, hgap=5, rows=1, vgap=0) tasks_buttons_sizer.AddGrowableCol(0) tasks_buttons_sizer.AddGrowableRow(0) - tasks_sizer.AddSizer(tasks_buttons_sizer, flag=wx.GROW) + tasks_sizer.Add(tasks_buttons_sizer, flag=wx.GROW) tasks_label = wx.StaticText(self.Editor, label=_(u'Tasks:')) - tasks_buttons_sizer.AddWindow(tasks_label, flag=wx.ALIGN_BOTTOM) + tasks_buttons_sizer.Add(tasks_label, flag=wx.ALIGN_BOTTOM) for name, bitmap, help in [ ("AddTaskButton", "add_element", _("Add task")), @@ -250,27 +242,27 @@ bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - tasks_buttons_sizer.AddWindow(button) + tasks_buttons_sizer.Add(button) self.TasksGrid = CustomGrid(self.Editor, style=wx.VSCROLL) - self.TasksGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, self.OnTasksGridCellChange) - tasks_sizer.AddWindow(self.TasksGrid, flag=wx.GROW) + self.TasksGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGED, self.OnTasksGridCellChange) + tasks_sizer.Add(self.TasksGrid, flag=wx.GROW) instances_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=2, vgap=5) instances_sizer.AddGrowableCol(0) instances_sizer.AddGrowableRow(1) - main_sizer.AddSizer(instances_sizer, border=5, + main_sizer.Add(instances_sizer, border=5, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) instances_buttons_sizer = wx.FlexGridSizer(cols=5, hgap=5, rows=1, vgap=0) instances_buttons_sizer.AddGrowableCol(0) instances_buttons_sizer.AddGrowableRow(0) - instances_sizer.AddSizer(instances_buttons_sizer, flag=wx.GROW) + instances_sizer.Add(instances_buttons_sizer, flag=wx.GROW) instances_label = wx.StaticText(self.Editor, label=_(u'Instances:')) - instances_buttons_sizer.AddWindow(instances_label, flag=wx.ALIGN_BOTTOM) + instances_buttons_sizer.Add(instances_label, flag=wx.ALIGN_BOTTOM) for name, bitmap, help in [ ("AddInstanceButton", "add_element", _("Add instance")), @@ -280,13 +272,13 @@ button = wx.lib.buttons.GenBitmapButton( self.Editor, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - instances_buttons_sizer.AddWindow(button) + instances_buttons_sizer.Add(button) self.InstancesGrid = CustomGrid(self.Editor, style=wx.VSCROLL) - self.InstancesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, self.OnInstancesGridCellChange) - instances_sizer.AddWindow(self.InstancesGrid, flag=wx.GROW) + self.InstancesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGED, self.OnInstancesGridCellChange) + instances_sizer.Add(self.InstancesGrid, flag=wx.GROW) self.Editor.SetSizer(main_sizer) @@ -405,20 +397,20 @@ self.RefreshHighlightsTimer.Stop() def RefreshTypeList(self): - self.TypeList = "" + self.TypeList = [] blocktypes = self.Controler.GetBlockResource() for blocktype in blocktypes: - self.TypeList += ",%s" % blocktype + self.TypeList.append(blocktype) def RefreshTaskList(self): - self.TaskList = "" + self.TaskList = [] for row in xrange(self.TasksTable.GetNumberRows()): - self.TaskList += ",%s" % self.TasksTable.GetValueByName(row, "Name") + self.TaskList.append(self.TasksTable.GetValueByName(row, "Name")) def RefreshVariableList(self): - self.VariableList = "" + self.VariableList = [] for variable in self.Controler.GetEditedResourceVariables(self.TagName): - self.VariableList += ",%s" % variable + self.VariableList.append(variable) def RefreshModel(self): self.Controler.SetEditedResourceInfos(self.TagName, self.TasksTable.GetData(), self.InstancesTable.GetData()) @@ -481,7 +473,7 @@ wx.CallAfter(self.ShowErrorMessage, message) return - tasklist = [name for name in self.TaskList.split(",") if name != ""] + tasklist = [name for name in self.TaskList if name != ""] for i in xrange(self.TasksTable.GetNumberRows()): task = self.TasksTable.GetValueByName(i, "Name") if task in tasklist: diff -r ac0e6de439b5 -r 838242d34741 editors/TextViewer.py --- a/editors/TextViewer.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/TextViewer.py Fri Mar 03 19:20:49 2023 +0100 @@ -197,12 +197,20 @@ def Colourise(self, start, end): self.Editor.Colourise(start, end) - def StartStyling(self, pos, mask): - self.Editor.StartStyling(pos, mask) + def StartStyling(self, pos): + self.Editor.StartStyling(pos) + + INDIC0 = 0 + INDIC1 = 1 + INDIC2 = 2 def SetStyling(self, length, style): self.Editor.SetStyling(length, style) + def SetIndicatorCurrentFillRange(self, start, length, indic): + self.Editor.SetIndicatorCurrent(indic) + self.Editor.IndicatorFillRange(start, length) + def GetCurrentPos(self): return self.Editor.GetCurrentPos() @@ -562,7 +570,7 @@ start_pos = last_styled_pos = self.Editor.GetLineEndPosition(line_number - 1) + 1 self.RefreshLineFolding(line_number) end_pos = event.GetPosition() - self.StartStyling(start_pos, 0xff) + self.StartStyling(start_pos) current_context = self.Variables current_call = None @@ -597,9 +605,8 @@ else: self.SetStyling(current_pos - last_styled_pos, STC_PLC_EMPTY) if word not in ["]", ")"] and (self.GetCurrentPos() < last_styled_pos or self.GetCurrentPos() > current_pos): - self.StartStyling(last_styled_pos, wx.stc.STC_INDICS_MASK) - self.SetStyling(current_pos - last_styled_pos, wx.stc.STC_INDIC0_MASK) - self.StartStyling(current_pos, 0xff) + self.SetIndicatorCurrentFillRange(last_styled_pos, current_pos - last_styled_pos, self.INDIC0) + self.StartStyling(current_pos) else: self.SetStyling(current_pos - last_styled_pos, STC_PLC_EMPTY) last_styled_pos = current_pos @@ -700,9 +707,8 @@ else: self.SetStyling(current_pos - last_styled_pos, STC_PLC_EMPTY) if word not in ["]", ")"] and (self.GetCurrentPos() < last_styled_pos or self.GetCurrentPos() > current_pos): - self.StartStyling(last_styled_pos, wx.stc.STC_INDICS_MASK) - self.SetStyling(current_pos - last_styled_pos, wx.stc.STC_INDIC0_MASK) - self.StartStyling(current_pos, 0xff) + self.SetIndicatorCurrentFillRange(last_styled_pos, current_pos - last_styled_pos, self.INDIC0) + self.StartStyling(current_pos) if char == '.': if word != "]": if current_context is not None: @@ -975,8 +981,8 @@ else: highlight_end_pos = self.Editor.GetLineEndPosition(end[0] - 1) + end[1] - indent + 2 if highlight_start_pos < end_pos and highlight_end_pos > start_pos: - self.StartStyling(highlight_start_pos, 0xff) + self.StartStyling(highlight_start_pos) self.SetStyling(highlight_end_pos - highlight_start_pos, highlight_type) - self.StartStyling(highlight_start_pos, 0x00) + self.StartStyling(highlight_start_pos) until_end = max(0, len(self.Editor.GetText()) - highlight_end_pos) self.SetStyling(until_end, wx.stc.STC_STYLE_DEFAULT) diff -r ac0e6de439b5 -r 838242d34741 editors/Viewer.py --- a/editors/Viewer.py Wed Mar 01 10:54:54 2023 +0100 +++ b/editors/Viewer.py Fri Mar 03 19:20:49 2023 +0100 @@ -60,11 +60,11 @@ global CURSORS if CURSORS is None: CURSORS = [wx.NullCursor, - wx.StockCursor(wx.CURSOR_HAND), - wx.StockCursor(wx.CURSOR_SIZENWSE), - wx.StockCursor(wx.CURSOR_SIZENESW), - wx.StockCursor(wx.CURSOR_SIZEWE), - wx.StockCursor(wx.CURSOR_SIZENS)] + wx.Cursor(wx.CURSOR_HAND), + wx.Cursor(wx.CURSOR_SIZENWSE), + wx.Cursor(wx.CURSOR_SIZENESW), + wx.Cursor(wx.CURSOR_SIZEWE), + wx.Cursor(wx.CURSOR_SIZENS)] if wx.Platform == '__WXMSW__': @@ -317,7 +317,7 @@ selected = None dialog.Destroy() if selected is None: - return + return False if selected == 0: location = "%I" + location elif selected == 1: @@ -333,7 +333,7 @@ var_name = dlg.GetValue() if dlg.ShowModal() == wx.ID_OK else None dlg.Destroy() if var_name is None: - return + return False elif var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetProjectPouNames(self.ParentWindow.Debug)]: message = _("\"%s\" pou already exists!") % var_name elif not var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetEditedElementVariables(tagname, self.ParentWindow.Debug)]: @@ -363,7 +363,7 @@ var_name = dlg.GetValue() if dlg.ShowModal() == wx.ID_OK else None dlg.Destroy() if var_name is None: - return + return False elif var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetProjectPouNames(self.ParentWindow.Debug)]: message = _("\"%s\" pou already exists!") % var_name elif not var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetEditedElementVariables(tagname, self.ParentWindow.Debug)]: @@ -385,7 +385,7 @@ var_name = dlg.GetValue() if dlg.ShowModal() == wx.ID_OK else None dlg.Destroy() if var_name is None: - return + return False elif var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetProjectPouNames(self.ParentWindow.Debug)]: message = _("\"%s\" pou already exists!") % var_name elif not var_name.upper() in [name.upper() for name in self.ParentWindow.Controler.GetEditedElementVariables(tagname, self.ParentWindow.Debug)]: @@ -410,7 +410,7 @@ if len(tree[0]) > 0: menu = wx.Menu(title='') self.GenerateTreeMenu(x, y, scaling, menu, "", var_class, [(values[0], values[2], tree)]) - self.ParentWindow.PopupMenuXY(menu) + self.ParentWindow.PopupMenu(menu) else: self.ParentWindow.AddVariableBlock(x, y, scaling, var_class, values[0], values[2]) else: @@ -419,6 +419,8 @@ message = _("Variable don't belong to this POU!") if message is not None: wx.CallAfter(self.ShowMessage, message) + return False + return True def GenerateTreeMenu(self, x, y, scaling, menu, base_path, var_class, tree): for child_name, child_type, (child_tree, child_dimensions) in tree: @@ -429,8 +431,10 @@ if len(child_dimensions) > 0: child_path += "[%s]" % ",".join([str(dimension[0]) for dimension in child_dimensions]) child_name += "[]" - item = menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=child_name) - self.ParentWindow.Bind(wx.EVT_MENU, self.GetAddVariableBlockFunction(x, y, scaling, var_class, child_path, child_type), item) + + item = self.AppendItem(menu, + child_name, + self.GetAddVariableBlockFunction(x, y, scaling, var_class, child_path, child_type)) if len(child_tree) > 0: child_menu = wx.Menu(title='') self.GenerateTreeMenu(x, y, scaling, child_menu, child_path, var_class, child_tree) @@ -712,7 +716,7 @@ break faces["size"] -= 1 self.Editor.SetFont(font) - self.MiniTextDC = wx.MemoryDC(wx.EmptyBitmap(1, 1)) + self.MiniTextDC = wx.MemoryDC(wx.Bitmap(1, 1)) self.MiniTextDC.SetFont(wx.Font(faces["size"] * 0.75, wx.SWISS, wx.NORMAL, wx.NORMAL, faceName=faces["helv"])) self.CurrentScale = None @@ -825,15 +829,14 @@ def GetViewScale(self): return self.ViewScale - def GetLogicalDC(self, buffered=False): - if buffered: - bitmap = wx.EmptyBitmap(*self.Editor.GetClientSize()) - dc = wx.MemoryDC(bitmap) - else: - dc = wx.ClientDC(self.Editor) + def PrepareDC(self, dc): dc.SetFont(self.GetFont()) self.Editor.DoPrepareDC(dc) dc.SetUserScale(self.ViewScale[0], self.ViewScale[1]) + + def GetLogicalDC(self): + dc = wx.ClientDC(self.Editor) + self.PrepareDC(dc) return dc def RefreshRect(self, rect, eraseBackground=True): @@ -1058,7 +1061,7 @@ self.SelectedElement.SetSelected(False) self.SelectedElement = None if self.Mode == MODE_MOTION: - wx.CallAfter(self.Editor.SetCursor, wx.StockCursor(wx.CURSOR_HAND)) + wx.CallAfter(self.Editor.SetCursor, wx.Cursor(wx.CURSOR_HAND)) self.SavedMode = True # Return current drawing mode @@ -1116,13 +1119,13 @@ if self.DrawGrid: width = max(2, int(scaling[0] * self.ViewScale[0])) height = max(2, int(scaling[1] * self.ViewScale[1])) - bitmap = wx.EmptyBitmap(width, height) + bitmap = wx.Bitmap(width, height) dc = wx.MemoryDC(bitmap) dc.SetBackground(wx.Brush(self.Editor.GetBackgroundColour())) dc.Clear() dc.SetPen(MiterPen(wx.Colour(180, 180, 180))) dc.DrawPoint(0, 0) - self.GridBrush = wx.BrushFromBitmap(bitmap) + self.GridBrush = wx.Brush(bitmap) else: self.GridBrush = wx.TRANSPARENT_BRUSH else: @@ -1572,10 +1575,15 @@ iec_path = self.GetElementIECPath(self.SelectedElement) if iec_path is not None: menu = wx.Menu(title='') - item = menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=_("Force value")) - self.Bind(wx.EVT_MENU, self.GetForceVariableMenuFunction(iec_path.upper(), self.SelectedElement), item) - ritem = menu.Append(wx.ID_ANY, help='', kind=wx.ITEM_NORMAL, text=_("Release value")) - self.Bind(wx.EVT_MENU, self.GetReleaseVariableMenuFunction(iec_path.upper()), ritem) + item = self.AppendItem(menu, + _("Force value"), + self.GetForceVariableMenuFunction( + iec_path.upper(), + self.SelectedElement)) + + ritem = self.AppendItem(menu, + _("Release value"), + self.GetReleaseVariableMenuFunction(iec_path.upper())) if self.SelectedElement.IsForced(): ritem.Enable(True) else: @@ -1903,9 +1911,9 @@ def OnViewerMouseEvent(self, event): self.ResetBuffer() - if event.Leaving() and self.ToolTipElement is not None: + if (event.Leaving() or event.RightUp()) and self.ToolTipElement is not None: self.ToolTipElement.DestroyToolTip() - elif (not event.Entering() and + elif (not event.Entering() and not event.RightUp() and gettime() - self.LastToolTipCheckTime > REFRESH_PERIOD): self.LastToolTipCheckTime = gettime() element = None @@ -3379,7 +3387,7 @@ element = self.ParentWindow.GetCopyBuffer() if bbx is None: mouse_pos = self.Editor.ScreenToClient(wx.GetMousePosition()) - middle = wx.Rect(0, 0, *self.Editor.GetClientSize()).InsideXY(mouse_pos.x, mouse_pos.y) + middle = wx.Rect(0, 0, *self.Editor.GetClientSize()).Contains(mouse_pos.x, mouse_pos.y) if middle: x, y = self.CalcUnscrolledPosition(mouse_pos.x, mouse_pos.y) else: @@ -3633,7 +3641,6 @@ else: dc.SetBackground(wx.Brush(self.Editor.GetBackgroundColour())) dc.Clear() - dc.BeginDrawing() if self.Scaling is not None and self.DrawGrid and not printing: dc.SetPen(wx.TRANSPARENT_PEN) dc.SetBrush(self.GridBrush) @@ -3680,12 +3687,15 @@ self.InstanceName.Draw(dc) if self.rubberBand.IsShown(): self.rubberBand.Draw(dc) - dc.EndDrawing() def OnPaint(self, event): - dc = self.GetLogicalDC(True) + event.Skip() + sx,sy = self.Editor.GetClientSize() + if sx <= 0 or sy <= 0 : + return + dc = wx.MemoryDC(wx.Bitmap(sx,sy)) + self.PrepareDC(dc) self.DoDrawing(dc) wx.BufferedPaintDC(self.Editor, dc.GetAsBitmap()) if self.Debug: DebugViewer.RefreshNewData(self) - event.Skip() diff -r ac0e6de439b5 -r 838242d34741 etherlab/ConfigEditor.py --- a/etherlab/ConfigEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/etherlab/ConfigEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -16,7 +16,7 @@ import wx import wx.grid -import wx.gizmos +import wx.adv import wx.lib.buttons from plcopen.structures import IEC_KEYWORDS, TestIdentifier @@ -81,9 +81,9 @@ self.VariablesFilter.Bind(wx.EVT_COMBOBOX, self.OnVariablesFilterChanged) self.VariablesFilter.Bind(wx.EVT_TEXT_ENTER, self.OnVariablesFilterChanged) self.VariablesFilter.Bind(wx.EVT_CHAR, self.OnVariablesFilterKeyDown) - self.AddWindow(self.VariablesFilter, flag=wx.GROW) - - self.VariablesGrid = wx.gizmos.TreeListCtrl(parent, + self.Add(self.VariablesFilter, flag=wx.GROW) + + self.VariablesGrid = wx.adv.TreeListCtrl(parent, style=wx.TR_DEFAULT_STYLE | wx.TR_ROW_LINES | wx.TR_COLUMN_LINES | @@ -91,7 +91,7 @@ wx.TR_FULL_ROW_HIGHLIGHT) self.VariablesGrid.GetMainWindow().Bind(wx.EVT_LEFT_DOWN, self.OnVariablesGridLeftClick) - self.AddWindow(self.VariablesGrid, flag=wx.GROW) + self.Add(self.VariablesGrid, flag=wx.GROW) self.Filters = [] for desc, value in VARIABLES_FILTERS: @@ -274,10 +274,10 @@ variables_label = wx.StaticText(self.EthercatNodeEditor, label=_('Variable entries:')) - main_sizer.AddWindow(variables_label, border=10, flag=wx.TOP | wx.LEFT | wx.RIGHT) + main_sizer.Add(variables_label, border=10, flag=wx.TOP | wx.LEFT | wx.RIGHT) self.NodeVariables = NodeVariablesSizer(self.EthercatNodeEditor, self.Controler) - main_sizer.AddSizer(self.NodeVariables, border=10, + main_sizer.Add(self.NodeVariables, border=10, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.EthercatNodeEditor.SetSizer(main_sizer) @@ -310,7 +310,7 @@ self.EtherCATManagementTreebook = EtherCATManagementTreebook(self.EtherCATManagementEditor, self.Controler, self) - self.EtherCATManagermentEditor_Main_Sizer.AddSizer(self.EtherCATManagementTreebook, border=10, flag=wx.GROW) + self.EtherCATManagermentEditor_Main_Sizer.Add(self.EtherCATManagementTreebook, border=10, flag=wx.GROW) self.EtherCATManagementEditor.SetSizer(self.EtherCATManagermentEditor_Main_Sizer) return self.EtherCATManagementEditor @@ -449,6 +449,8 @@ if message is not None: wx.CallAfter(self.ShowMessage, message) + return False + return True def ShowMessage(self, message): message = wx.MessageDialog(self.ParentWindow, message, _("Error"), wx.OK | wx.ICON_ERROR) @@ -501,6 +503,8 @@ if message is not None: wx.CallAfter(self.ShowMessage, message) + return False + return True def ShowMessage(self, message): message = wx.MessageDialog(self.ParentWindow, message, _("Error"), wx.OK | wx.ICON_ERROR) @@ -617,7 +621,7 @@ self.MasterStateEditor_Panel = MasterStatePanelClass(self.MasterStateEditor, self.Controler) - self.MasterStateEditor_Panel_Main_Sizer.AddSizer(self.MasterStateEditor_Panel, border=10, flag=wx.GROW) + self.MasterStateEditor_Panel_Main_Sizer.Add(self.MasterStateEditor_Panel, border=10, flag=wx.GROW) self.MasterStateEditor.SetSizer(self.MasterStateEditor_Panel_Main_Sizer) return self.MasterStateEditor @@ -651,7 +655,7 @@ process_variables_label = wx.StaticText(self.EthercatMasterEditor, label=_("Process variables mapped between nodes:")) - process_variables_header.AddWindow(process_variables_label, 1, + process_variables_header.Add(process_variables_label, 1, flag=wx.ALIGN_CENTER_VERTICAL) for name, bitmap, help in [ @@ -661,14 +665,14 @@ ("DownVariableButton", "down", _("Move process variable down"))]: button = wx.lib.buttons.GenBitmapButton(self.EthercatMasterEditor, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - process_variables_header.AddWindow(button, border=5, flag=wx.LEFT) + process_variables_header.Add(button, border=5, flag=wx.LEFT) self.ProcessVariablesGrid = CustomGrid(self.EthercatMasterEditor, style=wx.VSCROLL) self.ProcessVariablesGrid.SetMinSize(wx.Size(0, 150)) self.ProcessVariablesGrid.SetDropTarget(ProcessVariableDropTarget(self)) - self.ProcessVariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, + self.ProcessVariablesGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGING, self.OnProcessVariablesGridCellChange) self.ProcessVariablesGrid.Bind(wx.grid.EVT_GRID_CELL_LEFT_CLICK, self.OnProcessVariablesGridCellLeftClick) @@ -678,7 +682,7 @@ startup_commands_label = wx.StaticText(self.EthercatMasterEditor, label=_("Startup service variables assignments:")) - startup_commands_header.AddWindow(startup_commands_label, 1, + startup_commands_header.Add(startup_commands_label, 1, flag=wx.ALIGN_CENTER_VERTICAL) for name, bitmap, help in [ @@ -686,14 +690,14 @@ ("DeleteCommandButton", "remove_element", _("Remove startup service variable"))]: button = wx.lib.buttons.GenBitmapButton(self.EthercatMasterEditor, bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) - startup_commands_header.AddWindow(button, border=5, flag=wx.LEFT) + startup_commands_header.Add(button, border=5, flag=wx.LEFT) self.StartupCommandsGrid = CustomGrid(self.EthercatMasterEditor, style=wx.VSCROLL) self.StartupCommandsGrid.SetDropTarget(StartupCommandDropTarget(self)) self.StartupCommandsGrid.SetMinSize(wx.Size(0, 150)) - self.StartupCommandsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGE, + self.StartupCommandsGrid.Bind(wx.grid.EVT_GRID_CELL_CHANGING, self.OnStartupCommandsGridCellChange) self.StartupCommandsGrid.Bind(wx.grid.EVT_GRID_EDITOR_SHOWN, self.OnStartupCommandsGridEditorShow) @@ -702,29 +706,29 @@ main_staticbox = wx.StaticBox(self.EthercatMasterEditor, label=_("Node filter:")) staticbox_sizer = wx.StaticBoxSizer(main_staticbox, wx.VERTICAL) - self.EthercatMasterEditorSizer.AddSizer(staticbox_sizer, 0, border=10, flag=wx.GROW | wx.ALL) + self.EthercatMasterEditorSizer.Add(staticbox_sizer, 0, border=10, flag=wx.GROW | wx.ALL) main_staticbox_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=6, vgap=0) main_staticbox_sizer.AddGrowableCol(0) main_staticbox_sizer.AddGrowableRow(2) main_staticbox_sizer.AddGrowableRow(4) main_staticbox_sizer.AddGrowableRow(5) - staticbox_sizer.AddSizer(main_staticbox_sizer, 1, flag=wx.GROW) - main_staticbox_sizer.AddWindow(self.NodesFilter, border=5, flag=wx.GROW | wx.ALL) - main_staticbox_sizer.AddSizer(process_variables_header, border=5, + staticbox_sizer.Add(main_staticbox_sizer, 1, flag=wx.GROW) + main_staticbox_sizer.Add(self.NodesFilter, border=5, flag=wx.GROW | wx.ALL) + main_staticbox_sizer.Add(process_variables_header, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) - main_staticbox_sizer.AddWindow(self.ProcessVariablesGrid, 1, + main_staticbox_sizer.Add(self.ProcessVariablesGrid, 1, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) - main_staticbox_sizer.AddSizer(startup_commands_header, + main_staticbox_sizer.Add(startup_commands_header, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) - main_staticbox_sizer.AddWindow(self.StartupCommandsGrid, 1, + main_staticbox_sizer.Add(self.StartupCommandsGrid, 1, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) second_staticbox = wx.StaticBox(self.EthercatMasterEditor, label=_("Nodes variables filter:")) second_staticbox_sizer = wx.StaticBoxSizer(second_staticbox, wx.VERTICAL) - second_staticbox_sizer.AddSizer(self.NodesVariables, 1, border=5, flag=wx.GROW | wx.ALL) - - main_staticbox_sizer.AddSizer(second_staticbox_sizer, 1, + second_staticbox_sizer.Add(self.NodesVariables, 1, border=5, flag=wx.GROW | wx.ALL) + + main_staticbox_sizer.Add(second_staticbox_sizer, 1, border=5, flag=wx.GROW | wx.LEFT | wx.RIGHT | wx.BOTTOM) self.EthercatMasterEditor.SetSizer(self.EthercatMasterEditorSizer) @@ -1113,21 +1117,21 @@ ESI_files_label = wx.StaticText(parent, label=_("ESI Files:")) - self.AddWindow(ESI_files_label, border=10, + self.Add(ESI_files_label, border=10, flag=wx.TOP | wx.LEFT | wx.RIGHT) folder_tree_sizer = wx.FlexGridSizer(cols=2, hgap=5, rows=1, vgap=0) folder_tree_sizer.AddGrowableCol(0) folder_tree_sizer.AddGrowableRow(0) - self.AddSizer(folder_tree_sizer, border=10, + self.Add(folder_tree_sizer, border=10, flag=wx.GROW | wx.LEFT | wx.RIGHT) self.ESIFiles = FolderTree(parent, self.GetPath(), editable=False) self.ESIFiles.SetFilter(".xml") - folder_tree_sizer.AddWindow(self.ESIFiles, flag=wx.GROW) + folder_tree_sizer.Add(self.ESIFiles, flag=wx.GROW) buttons_sizer = wx.BoxSizer(wx.VERTICAL) - folder_tree_sizer.AddSizer(buttons_sizer, + folder_tree_sizer.Add(buttons_sizer, flag=wx.ALIGN_CENTER_VERTICAL) for idx, (name, bitmap, help, callback) in enumerate(buttons): @@ -1135,7 +1139,7 @@ bitmap=GetBitmap(bitmap), size=wx.Size(28, 28), style=wx.NO_BORDER) - button.SetToolTipString(help) + button.SetToolTip(help) setattr(self, name, button) if idx > 0: flag = wx.TOP @@ -1145,14 +1149,14 @@ callback = getattr(self, "On" + name, None) if callback is not None: parent.Bind(wx.EVT_BUTTON, callback, button) - buttons_sizer.AddWindow(button, border=10, flag=flag) + buttons_sizer.Add(button, border=10, flag=flag) modules_label = wx.StaticText(parent, label=_("Modules library:")) - self.AddSizer(modules_label, border=10, + self.Add(modules_label, border=10, flag=wx.LEFT | wx.RIGHT) - self.ModulesGrid = wx.gizmos.TreeListCtrl(parent, + self.ModulesGrid = wx.adv.TreeListCtrl(parent, style=wx.TR_DEFAULT_STYLE | wx.TR_ROW_LINES | wx.TR_COLUMN_LINES | @@ -1166,7 +1170,7 @@ self.OnModulesGridEndLabelEdit) self.ModulesGrid.GetHeaderWindow().Bind(wx.EVT_MOTION, self.OnModulesGridHeaderMotion) - self.AddWindow(self.ModulesGrid, border=10, + self.Add(self.ModulesGrid, border=10, flag=wx.GROW | wx.BOTTOM | wx.LEFT | wx.RIGHT) for colname, colsize, colalign in zip( @@ -1240,7 +1244,7 @@ _("Choose an XML file"), os.getcwd(), "", _("XML files (*.xml)|*.xml|All files|*.*"), - wx.OPEN) + wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: filepath = dialog.GetPath() @@ -1335,7 +1339,7 @@ if col > 0 and self.LastToolTipCol != col: self.LastToolTipCol = col _param, param_infos = self.ModuleLibrary.MODULES_EXTRA_PARAMS[col - 1] - wx.CallAfter(self.ModulesGrid.GetHeaderWindow().SetToolTipString, + wx.CallAfter(self.ModulesGrid.GetHeaderWindow().SetToolTip, param_infos["description"]) event.Skip() @@ -1359,13 +1363,14 @@ ("DeleteButton", "remove_element", _("Remove file from database"), None) ]) self.DatabaseSizer.SetControlMinSize(wx.Size(0, 0)) - main_sizer.AddSizer(self.DatabaseSizer, border=10, + main_sizer.Add(self.DatabaseSizer, border=10, flag=wx.GROW | wx.TOP | wx.LEFT | wx.RIGHT) button_sizer = self.CreateButtonSizer(wx.OK | wx.CANCEL | wx.CENTRE) - button_sizer.GetAffirmativeButton().SetLabel(_("Add file to project")) - button_sizer.GetCancelButton().SetLabel(_("Close")) - main_sizer.AddSizer(button_sizer, border=10, + # FIXME: find a way to change buttons label compatible with wxPython 4.x + # button_sizer.GetAffirmativeButton().SetLabel(_("Add file to project")) + # button_sizer.GetCancelButton().SetLabel(_("Close")) + main_sizer.Add(button_sizer, border=10, flag=wx.ALIGN_RIGHT | wx.BOTTOM | wx.LEFT | wx.RIGHT) self.SetSizer(main_sizer) diff -r ac0e6de439b5 -r 838242d34741 etherlab/EtherCATManagementEditor.py --- a/etherlab/EtherCATManagementEditor.py Wed Mar 01 10:54:54 2023 +0100 +++ b/etherlab/EtherCATManagementEditor.py Fri Mar 03 19:20:49 2023 +0100 @@ -15,7 +15,7 @@ import wx import wx.grid -import wx.gizmos +import wx.adv import wx.lib.buttons # -------------------------------------------------------------------- @@ -135,7 +135,7 @@ self.SizerDic["SlaveInfosDetailsInnerSizer"].AddMany([self.StaticTextDic[statictext_name], self.TextCtrlDic[textctrl_name]]) - self.SizerDic["SlaveInfosDetailsBox"].AddSizer(self.SizerDic["SlaveInfosDetailsInnerSizer"]) + self.SizerDic["SlaveInfosDetailsBox"].Add(self.SizerDic["SlaveInfosDetailsInnerSizer"]) self.SyncManagersGrid = CustomGrid(self, size=wx.Size(605, 155), style=wx.VSCROLL) @@ -153,7 +153,7 @@ for button_name, button_id, button_label, button_tooltipstring, event_method, sub_item in buttons: self.ButtonDic[button_name] = wx.Button(self, id=button_id, label=_(button_label)) self.ButtonDic[button_name].Bind(wx.EVT_BUTTON, event_method) - self.ButtonDic[button_name].SetToolTipString(button_tooltipstring) + self.ButtonDic[button_name].SetToolTip(button_tooltipstring) self.SizerDic["SlaveState_up_sizer"].Add(self.ButtonDic[button_name]) for statictext_name, statictext_label, textctrl_name in sub_item: self.StaticTextDic[statictext_name] = wx.StaticText(self, label=_(statictext_label)) @@ -166,7 +166,7 @@ ("StopTimerButton", "Stop State Monitoring", "Slave State Update Stop", self.CurrentStateThreadStop)]: self.ButtonDic[button_name] = wx.Button(self, label=_(button_label)) self.ButtonDic[button_name].Bind(wx.EVT_BUTTON, event_method) - self.ButtonDic[button_name].SetToolTipString(button_tooltipstring) + self.ButtonDic[button_name].SetToolTip(button_tooltipstring) self.SizerDic["SlaveState_down_sizer"].Add(self.ButtonDic[button_name]) self.SizerDic["SlaveState_sizer"].AddMany([self.SizerDic["SlaveState_up_sizer"], @@ -1497,7 +1497,7 @@ if check_connect_flag: status, _log_count = self.Controler.GetCTRoot()._connector.GetPLCstatus() if status is not PlcStatus.Started: - dialog = wx.FileDialog(self, _("Choose a binary file"), os.getcwd(), "", _("bin files (*.bin)|*.bin"), wx.OPEN) + dialog = wx.FileDialog(self, _("Choose a binary file"), os.getcwd(), "", _("bin files (*.bin)|*.bin"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: filepath = dialog.GetPath() @@ -1729,7 +1729,7 @@ wx.Panel.__init__(self, parent, -1, size=(350, 500)) - self.Tree = wx.gizmos.TreeListCtrl(self, -1, size=(350, 500), + self.Tree = wx.adv.TreeListCtrl(self, -1, size=(350, 500), style=(wx.TR_DEFAULT_STYLE | wx.TR_FULL_ROW_HIGHLIGHT | wx.TR_HIDE_ROOT | @@ -1896,7 +1896,7 @@ @param event : wx.EVT_BUTTON object """ dialog = wx.FileDialog(self, _("Choose a binary file"), os.getcwd(), "", - _("bin files (*.bin)|*.bin"), wx.OPEN) + _("bin files (*.bin)|*.bin"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: filepath = dialog.GetPath() @@ -2692,7 +2692,7 @@ self.TextCtrl[key] = wx.TextCtrl(self, size=wx.Size(130, 24), style=wx.TE_READONLY) self.MasterStateSizer['innerMasterState'].AddMany([self.StaticText[key], self.TextCtrl[key]]) - self.MasterStateSizer['masterState'].AddSizer(self.MasterStateSizer['innerMasterState']) + self.MasterStateSizer['masterState'].Add(self.MasterStateSizer['innerMasterState']) # ----------------------- Ethernet Network Card Information --------------------------------------- for key, label in [ @@ -2705,7 +2705,7 @@ self.TextCtrl[key] = wx.TextCtrl(self, size=wx.Size(130, 24), style=wx.TE_READONLY) self.MasterStateSizer['innerDeviceInfo'].AddMany([self.StaticText[key], self.TextCtrl[key]]) - self.MasterStateSizer['deviceInfo'].AddSizer(self.MasterStateSizer['innerDeviceInfo']) + self.MasterStateSizer['deviceInfo'].Add(self.MasterStateSizer['innerDeviceInfo']) # ----------------------- Network Frame Information ----------------------------------------------- for key, label in [ @@ -2722,13 +2722,13 @@ self.TextCtrl[key][index] = wx.TextCtrl(self, size=wx.Size(130, 24), style=wx.TE_READONLY) self.MasterStateSizer['innerFrameInfo'].Add(self.TextCtrl[key][index]) - self.MasterStateSizer['frameInfo'].AddSizer(self.MasterStateSizer['innerFrameInfo']) + self.MasterStateSizer['frameInfo'].Add(self.MasterStateSizer['innerFrameInfo']) # ------------------------------- Slave Information ----------------------------------------------- self.SITreeListCtrl = SITreeListCtrl(self, self.Controler) self.MasterStateSizer["innerSlaveInfo"].AddMany([self.SIUpdateButton, self.SITreeListCtrl]) - self.MasterStateSizer["slaveInfo"].AddSizer( + self.MasterStateSizer["slaveInfo"].Add( self.MasterStateSizer["innerSlaveInfo"]) # --------------------------------- Main Sizer ---------------------------------------------------- @@ -2743,7 +2743,7 @@ ("main", [ "innerTop", "innerMiddle", "innerBottom"])]: for key2 in sub: - self.MasterStateSizer[key].AddSizer(self.MasterStateSizer[key2]) + self.MasterStateSizer[key].Add(self.MasterStateSizer[key2]) self.SetSizer(self.MasterStateSizer["main"]) @@ -2798,7 +2798,7 @@ self.Controler=controler - self.Tree = wx.gizmos.TreeListCtrl(self, -1, size=wx.Size(750,350), + self.Tree = wx.adv.TreeListCtrl(self, -1, size=wx.Size(750,350), style=wx.TR_HAS_BUTTONS |wx.TR_HIDE_ROOT |wx.TR_ROW_LINES diff -r ac0e6de439b5 -r 838242d34741 exemples/python/plc.xml --- a/exemples/python/plc.xml Wed Mar 01 10:54:54 2023 +0100 +++ b/exemples/python/plc.xml Fri Mar 03 19:20:49 2023 +0100 @@ -1,7 +1,7 @@ <?xml version='1.0' encoding='utf-8'?> <project xmlns="http://www.plcopen.org/xml/tc6_0201" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xmlns:xhtml="http://www.w3.org/1999/xhtml" xsi:schemaLocation="http://www.plcopen.org/xml/tc6_0201"> <fileHeader companyName="" productName="Beremiz" productVersion="0.0" creationDateTime="2008-12-14T16:21:19" contentDescription="This example shows many features in Beremiz: 1. How to implement python extensions. 2. How to implement basic C extension. 3. How to use C code in IEC POUs. 4. How to call C functions from python code. 5. How to avoid race conditions between IEC, C and python code. 6. How to convert betweet different IEC types. "/> - <contentHeader name="Beremiz Python Support Tests" modificationDateTime="2020-10-19T23:53:08"> + <contentHeader name="Beremiz Python Support Tests" modificationDateTime="2022-07-03T16:04:31"> <coordinateInfo> <pageSize x="1024" y="1024"/> <fbd> @@ -269,12 +269,12 @@ </interface> <body> <FBD> - <inVariable localId="4" height="30" width="160" executionOrderId="0" negated="false"> - <position x="295" y="450"/> - <connectionPointOut> - <relPosition x="160" y="15"/> - </connectionPointOut> - <expression>'666'</expression> + <inVariable localId="4" height="30" width="315" executionOrderId="0" negated="false"> + <position x="200" y="390"/> + <connectionPointOut> + <relPosition x="315" y="15"/> + </connectionPointOut> + <expression>'sys.stdout.write("Hello world\n")'</expression> </inVariable> <block localId="5" width="125" height="80" typeName="python_eval" instanceName="py1" executionOrderId="0"> <position x="686" y="400"/> @@ -293,9 +293,11 @@ <variable formalParameter="CODE"> <connectionPointIn> <relPosition x="0" y="65"/> - <connection refLocalId="4"> + <connection refLocalId="80" formalParameter="OUT"> <position x="686" y="465"/> - <position x="455" y="465"/> + <position x="653" y="465"/> + <position x="653" y="485"/> + <position x="630" y="485"/> </connection> </connectionPointIn> </variable> @@ -739,12 +741,6 @@ Happy hacking! ]]></xhtml:p> </content> </comment> - <comment localId="31" height="90" width="345"> - <position x="295" y="485"/> - <content> - <xhtml:p><![CDATA[Sleep here is bad. It blocks other py_eval instances. Whith a wxGlade GUI, GUI freeze for a second.]]></xhtml:p> - </content> - </comment> <comment localId="6" height="80" width="345"> <position x="295" y="630"/> <content> @@ -1443,10 +1439,10 @@ </connectionPointIn> <expression>Test_Python_Var</expression> </outVariable> - <inVariable localId="79" executionOrderId="0" height="25" width="30" negated="false"> + <inVariable localId="79" executionOrderId="0" height="27" width="30" negated="false"> <position x="560" y="1340"/> <connectionPointOut> - <relPosition x="30" y="10"/> + <relPosition x="30" y="15"/> </connectionPointOut> <expression>23</expression> </inVariable> @@ -1464,6 +1460,44 @@ </connectionPointOut> <expression>SomeVarName</expression> </inOutVariable> + <block localId="80" typeName="MOVE" executionOrderId="0" height="40" width="60"> + <position x="570" y="455"/> + <inputVariables> + <variable formalParameter="IN"> + <connectionPointIn> + <relPosition x="0" y="30"/> + <connection refLocalId="82"> + <position x="578" y="485"/> + <position x="532" y="485"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="60" y="30"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <connector name="Connection0" localId="81" height="30" width="130"> + <position x="545" y="390"/> + <connectionPointIn> + <relPosition x="0" y="15"/> + <connection refLocalId="4"> + <position x="545" y="405"/> + <position x="515" y="405"/> + </connection> + </connectionPointIn> + </connector> + <continuation name="Connection0" localId="82" height="30" width="130"> + <position x="410" y="470"/> + <connectionPointOut> + <relPosition x="130" y="15"/> + </connectionPointOut> + </continuation> </FBD> </body> </pou> diff -r ac0e6de439b5 -r 838242d34741 exemples/svghmi_traffic_light/svghmi_0@svghmi/svghmi.svg --- a/exemples/svghmi_traffic_light/svghmi_0@svghmi/svghmi.svg Wed Mar 01 10:54:54 2023 +0100 +++ b/exemples/svghmi_traffic_light/svghmi_0@svghmi/svghmi.svg Fri Mar 03 19:20:49 2023 +0100 @@ -1251,14 +1251,14 @@ inkscape:pageopacity="0.0" inkscape:pageshadow="2" inkscape:zoom="1.979899" - inkscape:cx="205.65994" - inkscape:cy="103.00174" + inkscape:cx="52.116754" + inkscape:cy="96.940825" inkscape:document-units="px" inkscape:current-layer="layer1" showgrid="false" units="px" - inkscape:window-width="1600" - inkscape:window-height="836" + inkscape:window-width="3840" + inkscape:window-height="2096" inkscape:window-x="0" inkscape:window-y="27" inkscape:window-maximized="1" @@ -1274,7 +1274,7 @@ <dc:format>image/svg+xml</dc:format> <dc:type rdf:resource="http://purl.org/dc/dcmitype/StillImage" /> - <dc:title></dc:title> + <dc:title /> </cc:Work> </rdf:RDF> </metadata> @@ -1283,6 +1283,14 @@ inkscape:groupmode="layer" id="layer1" transform="translate(37.474617,-760.93329)"> + <rect + style="opacity:1;vector-effect:none;fill:#ffffff;fill-opacity:1;stroke:none;stroke-width:1;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + id="rect250" + width="320" + height="240" + x="-37.474617" + y="760.93329" + inkscape:label="HMI:Page:Home" /> <path style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#282828;fill-opacity:1;stroke:none;stroke-width:2.04116011;marker:none;enable-background:accumulate" d="m 114.28125,14.28125 v 130 h 18.9375 v 93.5625 h 5.71875 V 176.4375 h 8.90625 v 15.71875 h 36.4375 v -32.5 h -36.4375 v 12.125 h -8.90625 v -27.5 h 21.78125 v -130 z" @@ -1529,13 +1537,5 @@ x="62.818459" y="812.17749" style="font-size:6.17188501px;line-height:1.25;font-family:sans-serif">ON</tspan></text> - <rect - style="opacity:1;vector-effect:none;fill:none;fill-opacity:1;stroke:none;stroke-width:1;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" - id="rect250" - width="320" - height="240" - x="-37.474617" - y="760.93329" - inkscape:label="HMI:Page:Home" /> </g> </svg> diff -r ac0e6de439b5 -r 838242d34741 fake_wx.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/fake_wx.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,111 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +import sys +import new +from types import ModuleType + +# TODO use gettext instead +def get_translation(txt): + return txt + + +class FakeObject: + def __init__(self, *args, **kwargs): + self.__classname__ = kwargs["__classname__"] + + def __getattr__(self,name): + if name.startswith('__'): + raise AttributeError, name + return FakeObject(__classname__=self.__classname__+"."+name) + + def __call__(self, *args, **kwargs): + return FakeObject(__classname__=self.__classname__+"()") + + def __getitem__(self, key): + raise IndexError, key + + def __str__(self): + return self.__classname__ + + def __or__(self, other): + return FakeObject(__classname__=self.__classname__+"|"+other.__classname__) + + +class FakeClass: + def __init__(self, *args, **kwargs): + print("DUMMY Class __init__ !",self.__name__,args,kwargs) + + +class FakeModule(ModuleType): + def __init__(self, name, classes): + self.__modname__ = name + self.__objects__ = dict(map(lambda desc: + (desc, new.classobj(desc, (FakeClass,), {})) + if type(desc)==str else desc, classes)) + ModuleType(name) + + def __getattr__(self,name): + if name.startswith('__'): + raise AttributeError, name + + if self.__objects__.has_key(name): + return self.__objects__[name] + + obj = FakeObject(__classname__=self.__modname__+"."+name) + self.__objects__[name] = obj + return obj + + +# Keep track of already faked modules to catch those +# that are already present in sys.modules from start +# (i.e. mpl_toolkits for exemple) +already_patched = {} + +for name, classes in [ + # list given for each module name contains name string for a FakeClass, + # otherwise a tuple (name, object) for arbitrary object/function/class + ('wx',[ + 'Panel', 'PyCommandEvent', 'Dialog', 'PopupWindow', 'TextEntryDialog', + 'Notebook', 'ListCtrl', 'TextDropTarget', 'PyControl', 'TextCtrl', + 'SplitterWindow', 'Frame', 'Printout', 'StaticBitmap', 'DropTarget', + ('GetTranslation', get_translation)]), + ('wx.lib.agw.advancedsplash',[]), + ('wx.dataview',['DataViewIndexListModel', 'PyDataViewIndexListModel']), + ('wx.lib.buttons',['GenBitmapTextButton']), + ('wx.adv',['EditableListBox']), + ('wx.grid',[ + 'Grid', 'PyGridTableBase', 'GridCellEditor', 'GridCellTextEditor', + 'GridCellChoiceEditor']), + ('wx.lib.agw.customtreectrl',['CustomTreeCtrl']), + ('wx.lib.gizmos',[]), + ('wx.lib.intctrl',['IntCtrl']), + ('matplotlib.pyplot',[]), + ('matplotlib.backends.backend_wxagg',['FigureCanvasWxAgg']), + ('wx.stc',['StyledTextCtrl']), + ('wx.lib.scrolledpanel',[]), + ('wx.lib.mixins.listctrl',['ColumnSorterMixin', 'ListCtrlAutoWidthMixin']), + ('wx.dataview',['PyDataViewIndexListModel']), + ('matplotlib.backends.backend_agg',[]), + ('wx.aui',[]), + ('mpl_toolkits.mplot3d',[])]: + modpath = None + parentmod = None + for identifier in name.split("."): + modpath = (modpath + "." + identifier) if modpath else identifier + mod = sys.modules.get(modpath, None) + + if mod is None or modpath not in already_patched: + mod = FakeModule(modpath, classes) + sys.modules[modpath] = mod + already_patched[modpath] = True + + if parentmod is not None: + parentmod.__objects__[identifier] = mod + + parentmod = mod + +from six.moves import builtins + +builtins.__dict__['_'] = get_translation + diff -r ac0e6de439b5 -r 838242d34741 graphics/FBD_Objects.py --- a/graphics/FBD_Objects.py Wed Mar 01 10:54:54 2023 +0100 +++ b/graphics/FBD_Objects.py Fri Mar 03 19:20:49 2023 +0100 @@ -122,10 +122,10 @@ # Returns if the point given is in the bounding box def HitTest(self, pt, connectors=True): if self.Name != "": - test_text = self.GetTextBoundingBox().InsideXY(pt.x, pt.y) + test_text = self.GetTextBoundingBox().Contains(pt.x, pt.y) else: test_text = False - test_block = self.GetBlockBoundingBox(connectors).InsideXY(pt.x, pt.y) + test_block = self.GetBlockBoundingBox(connectors).Contains(pt.x, pt.y) return test_text or test_block # Returns the bounding box of the name outside the block @@ -392,7 +392,7 @@ # pos = event.GetLogicalPosition(dc) # for input in self.Inputs: # rect = input.GetRedrawRect() -# if rect.InsideXY(pos.x, pos.y): +# if rect.Contains(pos.x, pos.y): # print "Find input" # tip = wx.TipWindow(self.Parent, "Test") # tip.SetBoundingRect(rect) @@ -771,6 +771,7 @@ Graphic_Element.Draw(self, dc) dc.SetPen(MiterPen(wx.BLACK)) dc.SetBrush(wx.WHITE_BRUSH) + dc.SetTextForeground(wx.BLACK) if getattr(dc, "printing", False): name_size = dc.GetTextExtent(self.Name) @@ -1011,6 +1012,7 @@ Graphic_Element.Draw(self, dc) dc.SetPen(MiterPen(wx.BLACK)) dc.SetBrush(wx.WHITE_BRUSH) + dc.SetTextForeground(wx.BLACK) if getattr(dc, "printing", False): name_size = dc.GetTextExtent(self.Name) diff -r ac0e6de439b5 -r 838242d34741 graphics/GraphicCommons.py --- a/graphics/GraphicCommons.py Wed Mar 01 10:54:54 2023 +0100 +++ b/graphics/GraphicCommons.py Fri Mar 03 19:20:49 2023 +0100 @@ -388,11 +388,11 @@ rect = self.BoundingBox else: rect = wx.Rect(self.Pos.x, self.Pos.y, self.Size[0], self.Size[1]) - return rect.InsideXY(pt.x, pt.y) + return rect.Contains(pt.x, pt.y) # Returns if the point given is in the bounding box def IsInSelection(self, rect): - return rect.InsideXY(self.BoundingBox.x, self.BoundingBox.y) and rect.InsideXY(self.BoundingBox.x + self.BoundingBox.width, self.BoundingBox.y + self.BoundingBox.height) + return rect.Contains(self.BoundingBox.x, self.BoundingBox.y) and rect.Contains(self.BoundingBox.x + self.BoundingBox.width, self.BoundingBox.y + self.BoundingBox.height) # Override this method for refreshing the bounding box def RefreshBoundingBox(self): @@ -448,7 +448,7 @@ intern_rect = wx.Rect(left + HANDLE_SIZE, top + HANDLE_SIZE, right - left - HANDLE_SIZE, bottom - top - HANDLE_SIZE) # Verify that this element is selected - if self.Selected and extern_rect.InsideXY(pt.x, pt.y) and not intern_rect.InsideXY(pt.x, pt.y): + if self.Selected and extern_rect.Contains(pt.x, pt.y) and not intern_rect.Contains(pt.x, pt.y): # Find if point is on a handle horizontally if left <= pt.x < left + HANDLE_SIZE: handle_x = 1 @@ -1401,7 +1401,7 @@ width = ANCHOR_DISTANCE * 2 + abs(self.Direction[0]) * CONNECTOR_SIZE height = ANCHOR_DISTANCE * 2 + abs(self.Direction[1]) * CONNECTOR_SIZE rect = wx.Rect(x, y, width, height) - inside = rect.InsideXY(pt.x, pt.y) + inside = rect.Contains(pt.x, pt.y) return inside @@ -1933,7 +1933,7 @@ # Calculate a rectangle around the segment rect = wx.Rect(min(x1, x2) - ANCHOR_DISTANCE, min(y1, y2) - ANCHOR_DISTANCE, abs(x1 - x2) + 2 * ANCHOR_DISTANCE, abs(y1 - y2) + 2 * ANCHOR_DISTANCE) - test |= rect.InsideXY(pt.x, pt.y) + test |= rect.Contains(pt.x, pt.y) return test # Returns the wire start or end point if the point given is on one of them @@ -1941,13 +1941,13 @@ # Test the wire start point rect = wx.Rect(self.Points[0].x - ANCHOR_DISTANCE, self.Points[0].y - ANCHOR_DISTANCE, 2 * ANCHOR_DISTANCE, 2 * ANCHOR_DISTANCE) - if rect.InsideXY(pt.x, pt.y): + if rect.Contains(pt.x, pt.y): return 0 # Test the wire end point if len(self.Points) > 1: rect = wx.Rect(self.Points[-1].x - ANCHOR_DISTANCE, self.Points[-1].y - ANCHOR_DISTANCE, 2 * ANCHOR_DISTANCE, 2 * ANCHOR_DISTANCE) - if rect.InsideXY(pt.x, pt.y): + if rect.Contains(pt.x, pt.y): return -1 return None @@ -1961,7 +1961,7 @@ # Calculate a rectangle around the segment rect = wx.Rect(min(x1, x2) - ANCHOR_DISTANCE, min(y1, y2) - ANCHOR_DISTANCE, abs(x1 - x2) + 2 * ANCHOR_DISTANCE, abs(y1 - y2) + 2 * ANCHOR_DISTANCE) - if rect.InsideXY(pt.x, pt.y): + if rect.Contains(pt.x, pt.y): return i, self.Segments[i] return None diff -r ac0e6de439b5 -r 838242d34741 graphics/RubberBand.py --- a/graphics/RubberBand.py Wed Mar 01 10:54:54 2023 +0100 +++ b/graphics/RubberBand.py Fri Mar 03 19:20:49 2023 +0100 @@ -94,7 +94,7 @@ # Change viewer mouse cursor to reflect a rubberband bounding box is # edited - self.DrawingSurface.SetCursor(wx.StockCursor(wx.CURSOR_CROSS)) + self.DrawingSurface.SetCursor(wx.Cursor(wx.CURSOR_CROSS)) self.Redraw() @@ -195,3 +195,25 @@ """ # Erase last bbox and draw current bbox self.DrawBoundingBoxes([self.CurrentBBox], dc) + + +def PatchRubberBandForGTK3(): + """ + GTK3 implementation of DC doesn't support SetLogicalFuntion(XOR) + Then Rubberband can't be erased by just redrawing it on the same place + So this is a complete refresh instead, eating a lot of CPU. + """ + def Redraw(self, dc=None): + self.Viewer.Refresh() + self.Draw() + + RubberBand.Redraw = Redraw + + def Erase(self, dc=None): + self.Viewer.Refresh() + + RubberBand.Erase = Erase + + +if "gtk3" in wx.PlatformInfo: + PatchRubberBandForGTK3() diff -r ac0e6de439b5 -r 838242d34741 graphics/SFC_Objects.py --- a/graphics/SFC_Objects.py Wed Mar 01 10:54:54 2023 +0100 +++ b/graphics/SFC_Objects.py Fri Mar 03 19:20:49 2023 +0100 @@ -719,7 +719,7 @@ self.Pos.y + (self.Size[1] - text_height) // 2, text_width, text_height) - test_text = text_bbx.InsideXY(pt.x, pt.y) + test_text = text_bbx.Contains(pt.x, pt.y) else: test_text = False return test_text or Graphic_Element.HitTest(self, pt, connectors) @@ -1204,7 +1204,7 @@ # Returns if the point given is in the bounding box def HitTest(self, pt, connectors=True): - return self.BoundingBox.InsideXY(pt.x, pt.y) or self.TestConnector(pt, exclude=False) is not None + return self.BoundingBox.Contains(pt.x, pt.y) or self.TestConnector(pt, exclude=False) is not None # Refresh the divergence bounding box def RefreshBoundingBox(self): @@ -1592,7 +1592,7 @@ self.Pos.y + (self.Size[1] - text_height) // 2, text_width, text_height) - return text_bbx.InsideXY(pt.x, pt.y) or Graphic_Element.HitTest(self, pt, connectors) + return text_bbx.Contains(pt.x, pt.y) or Graphic_Element.HitTest(self, pt, connectors) # Refresh the jump bounding box def RefreshBoundingBox(self): diff -r ac0e6de439b5 -r 838242d34741 images/Build.png Binary file images/Build.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/Clean.png Binary file images/Clean.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/Connect.png Binary file images/Connect.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/Disconnect.png Binary file images/Disconnect.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/Transfer.png Binary file images/Transfer.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/about_brz_logo.png Binary file images/about_brz_logo.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/brz.ico Binary file images/brz.ico has changed diff -r ac0e6de439b5 -r 838242d34741 images/brz.png Binary file images/brz.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/genicons.sh --- a/images/genicons.sh Wed Mar 01 10:54:54 2023 +0100 +++ b/images/genicons.sh Fri Mar 03 19:20:49 2023 +0100 @@ -16,8 +16,8 @@ done cp ico024.png brz.png -convert -compress none ico*.png brz.ico -rm -f ico*.png +convert -compress none ico???.png brz.ico +rm -f ico???.png convert -compress none poeico*.png poe.ico diff -r ac0e6de439b5 -r 838242d34741 images/icons.svg --- a/images/icons.svg Wed Mar 01 10:54:54 2023 +0100 +++ b/images/icons.svg Fri Mar 03 19:20:49 2023 +0100 @@ -32,7 +32,7 @@ </metadata> <sodipodi:namedview inkscape:window-height="2096" - inkscape:window-width="3840" + inkscape:window-width="2880" inkscape:pageshadow="2" inkscape:pageopacity="0" guidetolerance="10.0" @@ -43,17 +43,20 @@ pagecolor="#ffffff" id="base" showgrid="true" - inkscape:zoom="32" - inkscape:cx="1126.6889" - inkscape:cy="857.99192" - inkscape:window-x="1600" + inkscape:zoom="4" + inkscape:cx="384.40645" + inkscape:cy="510.71306" + inkscape:window-x="0" inkscape:window-y="27" - inkscape:current-layer="svg2" + inkscape:current-layer="g19354" showguides="true" inkscape:guide-bbox="true" - inkscape:window-maximized="1" + inkscape:window-maximized="0" inkscape:measure-start="904.956,703.964" - inkscape:measure-end="930.144,704.058"> + inkscape:measure-end="930.144,704.058" + inkscape:object-paths="true" + inkscape:snap-bbox="true" + inkscape:bbox-paths="true"> <inkscape:grid type="xygrid" id="grid16717" @@ -88311,6 +88314,16 @@ cx="-159.0049" cy="-108.7241" r="6.9022002" /> + <clipPath + clipPathUnits="userSpaceOnUse" + id="clipPath16483"> + <path + sodipodi:nodetypes="ccccccccccccccccccc" + inkscape:connector-curvature="0" + id="use16485" + d="m 566.50059,73.36489 c -3.21171,0 -6.18403,1.71679 -7.78988,4.49822 -0.54331,0.94101 -0.88738,1.959 -1.06307,2.99881 h -6.14112 c -2.02768,-0.0286 -2.02768,3.0275 0,2.99882 h 6.14112 c 0.17569,1.03979 0.51976,2.05778 1.06307,2.99881 1.60585,2.78143 4.57817,4.49822 7.78988,4.49822 0.82807,-9e-5 1.49932,-0.67134 1.49941,-1.4994 v -1.49941 h 4.49822 c 2.02743,0.02842 2.02743,-3.027239 0,-2.99882 H 568 v -5.99762 h 4.49822 c 2.02743,0.02842 2.02743,-3.027239 0,-2.99882 H 568 v -1.49941 c -9e-5,-0.82806 -0.67134,-1.49931 -1.49941,-1.4994 z" + style="color:#000000;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:medium;line-height:normal;font-family:sans-serif;font-variant-ligatures:normal;font-variant-position:normal;font-variant-caps:normal;font-variant-numeric:normal;font-variant-alternates:normal;font-feature-settings:normal;text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;text-decoration-style:solid;text-decoration-color:#000000;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-orientation:mixed;dominant-baseline:auto;baseline-shift:baseline;text-anchor:start;white-space:normal;shape-padding:0;clip-rule:nonzero;display:inline;overflow:visible;visibility:visible;opacity:1;isolation:auto;mix-blend-mode:normal;color-interpolation:sRGB;color-interpolation-filters:linearRGB;solid-color:#000000;solid-opacity:1;vector-effect:none;fill-opacity:1;fill-rule:nonzero;color-rendering:auto;image-rendering:auto;shape-rendering:auto;text-rendering:auto;enable-background:accumulate" /> + </clipPath> </defs> <g id="g19063" @@ -89174,7 +89187,7 @@ inkscape:radius="1" inkscape:original="M 70 192.36133 L 70 214.36133 L 87 214.36133 L 87 197.36133 L 82 192.36133 L 70 192.36133 z " xlink:href="#path18378" - style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" + style="color:#000000;fill:#aaaaaa;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" id="path18380" inkscape:href="#path18378" d="m 68,192.375 0,22 19,0 0,-17 -5,-5 -14,0 z" /> @@ -89183,18 +89196,13 @@ inkscape:connector-curvature="0" id="path18378" d="m 70,192.36218 0,22 17,0 0,-17 -5,-5 z" - style="color:#000000;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" /> + style="color:#000000;fill:#ededed;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" /> <path d="m 80.431156,207.75778 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m -11,-1 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m 9,-9 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m -5,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m -7,-1 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1" style="color:#000000;fill:#cccccc;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" id="path18400" inkscape:connector-curvature="0" /> <path - id="path18402" - d="m 79.568848,193.4415 0,2 -3,0 0,4 3,0 0,2 4,-4 -4,-4 z m -14,2 0,4 1,0 0,-4 -1,0 z m 2,0 0,4 1,0 0,-4 -1,0 z m 2,0 0,4 2,0 0,-4 -2,0 z m 3,0 0,4 3,0 0,-4 -3,0 z" - style="fill:#808080;stroke:none" - inkscape:connector-curvature="0" /> - <path id="path19304" style="color:#000000;fill:#000080;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" d="m 80,207.36218 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m -11,-1 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m 9,-9 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m -5,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1 m -7,-1 0,1 1,0 0,-1 -1,0 z m 1,1 0,4 1,0 0,-4 -1,0 z m 0,4 -1,0 0,1 1,0 0,-1 z m -1,0 0,-4 -1,0 0,4 1,0 z m 3,-4 1,0 0,-1 1,0 0,5 1,0 0,1 -3,0 0,-1 1,0 0,-3 -1,0 0,-1" @@ -90133,7 +90141,7 @@ id="g18993" transform="translate(1165.0472,106.05367)"> <path - style="display:inline;overflow:visible;visibility:visible;fill:url(#linearGradient8148);fill-opacity:1;fill-rule:nonzero;stroke:#000000;stroke-width:0;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:10.43299961;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" + style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:#000000;stroke-width:0;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:10.43299961;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" id="splash" d="m -1031,857.23823 h 476 v 299.99997 h -476 z" inkscape:connector-curvature="0" /> @@ -90141,83 +90149,91 @@ id="g17803" transform="matrix(0.2224431,0,0,0.2224431,-580.61956,554.56584)"> <g - id="use16743" - mask="url(#mask6467)" - transform="translate(-1840,2339.9999)" /> - <g id="g7269" - transform="translate(0,89.910633)"> - <path - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:314.89779663px;line-height:125%;font-family:'Arial Black';text-align:start;writing-mode:lr-tb;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:4;marker:none;filter:url(#filter17760);enable-background:accumulate" - id="path17845" - d="m -1470.2813,1725.0291 c -56.0138,0.054 -112.0828,20.5177 -156.0937,61.5937 -85.0794,79.4058 -95.9453,209.1111 -29.5938,301.1563 l 9.7813,69.3437 0.9062,6.4375 5.125,-4 30.5938,-23.9687 c 87.5525,67.3697 213.0935,63.1007 295.9375,-14.2188 18.4642,-17.2329 33.4323,-36.8343 44.875,-57.9062 6.4003,0.736 13.3613,1.0937 20.875,1.0937 24.9087,0 44.0178,-3.5634 57.3437,-10.6875 13.3257,-7.1242 24.6943,-18.8804 34.125,-35.2812 l -61.6562,-5.6875 c -3.8953,4.9202 -7.5237,8.3649 -10.9063,10.3125 -5.5355,3.0752 -11.381,4.5937 -17.5312,4.5937 -2.2646,0 -4.435,-0.18 -6.5,-0.5625 3.5746,-10.6475 6.37,-21.5105 8.3437,-32.5 h 91.8125 v -7.0625 c -10e-5,-21.5262 -3.5522,-39.0091 -10.625,-52.4375 -7.0731,-13.4281 -17.3756,-23.6769 -30.9062,-30.75 -13.3838,-6.9958 -31.5824,-10.5176 -54.5938,-10.5937 -7.0146,-25.9757 -18.6908,-50.9762 -35.0625,-73.6875 l -9.7812,-69.3438 -0.9063,-6.4375 -5.125,4 -30.5937,23.9688 c -41.0402,-31.5796 -90.4197,-47.4228 -139.8438,-47.375 z m 228.125,206.2187 c 6.3617,0.8346 11.6486,3.3459 15.875,7.5313 5.279,5.2278 8.5511,13.9044 9.7813,26 h -24.7813 c 0.5248,-11.1718 0.225,-22.3843 -0.875,-33.5313 z m 118.9731,-33.6623 h 58.582 v 26.754 c 5.6377,-11.583 11.4549,-19.5528 17.4516,-23.9095 5.9965,-4.3563 13.4025,-6.5346 22.2182,-6.5347 9.2253,1e-4 19.3222,2.8703 30.2904,8.6104 l -19.3736,44.5901 c -7.3805,-3.0751 -13.2233,-4.6127 -17.5285,-4.6128 -8.2005,10e-5 -14.5559,3.3828 -19.066,10.1481 -6.458,9.5331 -9.6869,27.3691 -9.6868,53.508 v 54.7381 h -62.8873 z m 320.2793,97.1755 h -125.46709 c 1.12748,10.0456 3.84388,17.5285 8.14921,22.4487 6.04775,7.073 13.94069,10.6094 23.67883,10.6094 6.15024,0 11.99306,-1.5376 17.5285,-4.6128 3.38256,-1.9476 7.02151,-5.3815 10.91686,-10.3018 l 61.65724,5.6891 c -9.43072,16.4009 -20.80885,28.1634 -34.13443,35.2876 -13.3259,7.1241 -32.44322,10.6862 -57.35199,10.6862 -21.62881,0 -38.64475,-3.0495 -51.04789,-9.1486 -12.40324,-6.0991 -22.67944,-15.7859 -30.82862,-29.0604 -8.14922,-13.2745 -12.22382,-28.881 -12.22382,-46.8195 0,-25.5239 8.17483,-46.1788 24.52452,-61.9648 16.34962,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.82222,3.5366 55.35313,10.6093 13.53059,7.0731 23.83241,17.3236 30.9055,30.7517 7.0727,13.4284 10.60915,30.9056 10.60935,52.4318 z m -63.6561,-29.983 c -1.23021,-12.0956 -4.48476,-20.7573 -9.76368,-25.9852 -5.27917,-5.2277 -12.22393,-7.8416 -20.8343,-7.8417 -9.94316,10e-5 -17.88735,3.9466 -23.8326,11.8394 -3.79279,4.9204 -6.20167,12.2496 -7.22666,21.9875 z m 93.17774,-67.1925 h 58.4283 v 23.8326 c 8.40539,-9.9429 16.88773,-17.0158 25.44706,-21.2187 8.55912,-4.2026 18.88657,-6.304 30.98238,-6.3041 13.01809,1e-4 23.31991,2.3065 30.90549,6.9191 7.58526,4.6129 13.78685,11.4808 18.6048,20.6037 9.84037,-10.6605 18.80962,-17.9128 26.90778,-21.7569 8.09773,-3.8438 18.09204,-5.7658 29.98294,-5.7659 17.52823,1e-4 31.21274,5.2023 41.05357,15.6065 9.84026,10.4044 14.76054,26.6772 14.76083,48.8184 v 102.557 h -62.73354 v -93.024 c -2.3e-4,-7.3803 -1.43531,-12.8644 -4.30524,-16.4522 -4.20297,-5.6377 -9.43076,-8.4566 -15.68339,-8.4567 -7.38062,10e-5 -13.32595,2.6652 -17.83601,7.9954 -4.51044,5.3304 -6.76557,13.8897 -6.76538,25.6777 v 84.2598 h -62.73355 v -89.9488 c -1.2e-4,-7.1753 -0.41015,-12.0444 -1.23007,-14.6071 -1.3327,-4.1001 -3.63907,-7.4059 -6.91914,-9.9174 -3.2803,-2.5113 -7.12426,-3.767 -11.5319,-3.7671 -7.1755,10e-5 -13.06958,2.7165 -17.68225,8.1492 -4.61284,5.4329 -6.91922,14.3509 -6.91914,26.754 v 83.3372 h -62.73354 z m 316.74293,-62.1185 h 62.57978 v 42.5911 h -62.57978 z m 0,62.1185 h 62.57978 v 163.2917 h -62.57978 z m 95.79168,0 h 151.45231 v 36.5945 l -82.41466,83.9523 h 87.48869 v 42.7449 H -366.998 v -40.5923 l 78.10941,-79.9545 h -71.95906 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#d19f34;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="use16735" - d="m -1336.1632,1788.2263 c 0,0 56.3913,141.5671 -147.8368,147.7737 -204.2612,6.2076 -147.8368,147.7737 -147.8368,147.7737 -37.8479,-37.8317 -61.2676,-90.0855 -61.2676,-147.7737 0,-57.6882 23.4197,-109.942 61.2676,-147.7737 37.8479,-37.8318 90.124,-61.2415 147.8368,-61.2415 57.7128,0 109.9889,23.4097 147.8368,61.2415 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#469837;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="use16737" - d="m -1631.8368,2083.7737 c 0,0 -56.3913,-141.5671 147.8368,-147.7737 204.2612,-6.2076 147.8368,-147.7737 147.8368,-147.7737 37.8479,37.8317 61.2676,90.0855 61.2676,147.7737 0,57.6882 -23.4197,109.942 -61.2676,147.7737 -37.8479,37.8318 -90.124,61.2415 -147.8368,61.2415 -57.7128,0 -109.9889,-23.4097 -147.8368,-61.2415 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:#4c4c4c;stroke-width:49.86504364;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:10.43299961;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" - id="path16739" - transform="matrix(0.8023362,0,0,0.8019941,-2094.2929,1769.2301)" - d="m 1021.2642,207.94408 c 0,143.9361 -116.68326,260.61936 -260.61936,260.61936 -143.9361,0 -260.61936,-116.68326 -260.61936,-260.61936 0,-143.936098 116.68326,-260.61936 260.61936,-260.61936 143.9361,0 260.61936,116.683262 260.61936,260.61936 z" - inkscape:connector-curvature="0" /> - <path - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:306.80871582px;line-height:125%;font-family:'Arial Black';text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="path16741" - d="m -1577.2331,1825.1726 h 127.038 c 21.1728,2e-4 37.4271,5.2435 48.7628,15.7299 11.3353,10.4868 17.0031,23.4703 17.0033,38.9503 -2e-4,12.9836 -4.045,24.1194 -12.1345,33.4074 -5.3933,6.1923 -13.2833,11.086 -23.6698,14.6813 15.7797,3.7953 27.3898,10.312 34.8306,19.5501 7.4402,9.2383 11.1605,20.8485 11.1607,34.8306 -2e-4,11.3855 -2.6468,21.6224 -7.9399,30.7108 -5.2934,9.0884 -12.5342,16.2792 -21.7223,21.5725 -5.6929,3.2958 -14.2819,5.6927 -25.7671,7.1908 -15.2807,1.9975 -25.4177,2.9962 -30.4112,2.9962 h -117.1506 z m 68.4627,86.1401 h 29.5124 c 10.5863,10e-5 17.9519,-1.8225 22.0968,-5.468 4.1445,-3.6452 6.2169,-8.9135 6.217,-15.8049 -1e-4,-6.3916 -2.0725,-11.3853 -6.217,-14.9809 -4.1449,-3.5952 -11.3607,-5.3929 -21.6474,-5.3931 h -29.9618 z m 0,86.29 h 34.6059 c 11.6849,0 19.9244,-2.0723 24.7184,-6.2171 4.7938,-4.1447 7.1907,-9.7126 7.1909,-16.7037 -2e-4,-6.4916 -2.3722,-11.71 -7.116,-15.655 -4.7441,-3.9449 -13.0584,-5.9174 -24.9432,-5.9175 h -34.456 z" - inkscape:connector-curvature="0" /> - <g - id="use16745" - mask="url(#mask6467)" - transform="rotate(180,-563.99995,766)"> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447);enable-background:accumulate" - id="use6863" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" - id="use6865" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - </g> - <g - id="g7285" - mask="url(#mask6467)" - transform="translate(-1839.8676,2340.0508)"> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447);enable-background:accumulate" - id="path7287" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" - id="path7289" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - </g> - <path - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:314.89779663px;line-height:125%;font-family:'Arial Black';text-align:start;writing-mode:lr-tb;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:#dadada;stroke-width:4;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:10.43299961;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" - id="text16729" - d="m -1166.8587,1976.761 h -125.4671 c 1.1275,10.0456 3.8439,17.5285 8.1492,22.4487 6.0478,7.073 13.9407,10.6094 23.6789,10.6094 6.1502,0 11.993,-1.5376 17.5285,-4.6128 3.3825,-1.9476 7.0215,-5.3815 10.9168,-10.3018 l 61.6573,5.6891 c -9.4307,16.4009 -20.8089,28.1634 -34.1345,35.2876 -13.3259,7.1241 -32.4432,10.6862 -57.3519,10.6862 -21.6289,0 -38.6448,-3.0495 -51.0479,-9.1486 -12.4033,-6.0991 -22.6795,-15.7859 -30.8286,-29.0604 -8.1493,-13.2745 -12.2239,-28.881 -12.2239,-46.8195 0,-25.5239 8.1749,-46.1788 24.5245,-61.9648 16.3497,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.8223,3.5366 55.3532,10.6093 13.5306,7.0731 23.8324,17.3236 30.9055,30.7517 7.0727,13.4284 10.6091,30.9056 10.6093,52.4318 z m -63.6561,-29.983 c -1.2302,-12.0956 -4.4847,-20.7573 -9.7637,-25.9852 -5.2791,-5.2277 -12.2239,-7.8416 -20.8343,-7.8417 -9.9431,10e-5 -17.8873,3.9466 -23.8325,11.8394 -3.7928,4.9204 -6.2017,12.2496 -7.2267,21.9875 z m 93.3316,-67.1925 h 58.582 v 26.754 c 5.6377,-11.583 11.4549,-19.5528 17.4516,-23.9095 5.9965,-4.3563 13.4025,-6.5346 22.2182,-6.5347 9.2253,1e-4 19.3222,2.8703 30.2904,8.6104 l -19.3736,44.5901 c -7.3805,-3.0751 -13.2233,-4.6127 -17.5285,-4.6128 -8.2005,10e-5 -14.5559,3.3828 -19.066,10.1481 -6.458,9.5331 -9.6869,27.3691 -9.6868,53.508 v 54.7381 h -62.8873 z m 320.2793,97.1755 h -125.46709 c 1.12748,10.0456 3.84388,17.5285 8.14921,22.4487 6.04775,7.073 13.94069,10.6094 23.67883,10.6094 6.15024,0 11.99306,-1.5376 17.5285,-4.6128 3.38256,-1.9476 7.02151,-5.3815 10.91686,-10.3018 l 61.65724,5.6891 c -9.43072,16.4009 -20.80885,28.1634 -34.13443,35.2876 -13.3259,7.1241 -32.44322,10.6862 -57.35199,10.6862 -21.62881,0 -38.64475,-3.0495 -51.04789,-9.1486 -12.40324,-6.0991 -22.67944,-15.7859 -30.82862,-29.0604 -8.14922,-13.2745 -12.22382,-28.881 -12.22382,-46.8195 0,-25.5239 8.17483,-46.1788 24.52452,-61.9648 16.34962,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.82222,3.5366 55.35313,10.6093 13.53059,7.0731 23.83241,17.3236 30.9055,30.7517 7.0727,13.4284 10.60915,30.9056 10.60935,52.4318 z m -63.6561,-29.983 c -1.23021,-12.0956 -4.48476,-20.7573 -9.76368,-25.9852 -5.27917,-5.2277 -12.22393,-7.8416 -20.8343,-7.8417 -9.94316,10e-5 -17.88735,3.9466 -23.8326,11.8394 -3.79279,4.9204 -6.20167,12.2496 -7.22666,21.9875 z m 93.17774,-67.1925 h 58.4283 v 23.8326 c 8.40539,-9.9429 16.88773,-17.0158 25.44706,-21.2187 8.55912,-4.2026 18.88657,-6.304 30.98238,-6.3041 13.01809,1e-4 23.31991,2.3065 30.90549,6.9191 7.58526,4.6129 13.78685,11.4808 18.6048,20.6037 9.84037,-10.6605 18.80962,-17.9128 26.90778,-21.7569 8.09773,-3.8438 18.09204,-5.7658 29.98294,-5.7659 17.52823,1e-4 31.21274,5.2023 41.05357,15.6065 9.84026,10.4044 14.76054,26.6772 14.76083,48.8184 v 102.557 h -62.73354 v -93.024 c -2.3e-4,-7.3803 -1.43531,-12.8644 -4.30524,-16.4522 -4.20297,-5.6377 -9.43076,-8.4566 -15.68339,-8.4567 -7.38062,10e-5 -13.32595,2.6652 -17.83601,7.9954 -4.51044,5.3304 -6.76557,13.8897 -6.76538,25.6777 v 84.2598 h -62.73355 v -89.9488 c -1.2e-4,-7.1753 -0.41015,-12.0444 -1.23007,-14.6071 -1.3327,-4.1001 -3.63907,-7.4059 -6.91914,-9.9174 -3.2803,-2.5113 -7.12426,-3.767 -11.5319,-3.7671 -7.1755,10e-5 -13.06958,2.7165 -17.68225,8.1492 -4.61284,5.4329 -6.91922,14.3509 -6.91914,26.754 v 83.3372 h -62.73354 z m 316.74293,-62.1185 h 62.57978 v 42.5911 h -62.57978 z m 0,62.1185 h 62.57978 v 163.2917 h -62.57978 z m 95.79168,0 h 151.45231 v 36.5945 l -82.41466,83.9523 h 87.48869 v 42.7449 H -380.998 v -40.5923 l 78.10941,-79.9545 h -71.95906 z" - inkscape:connector-curvature="0" /> - <text - style="font-style:normal;font-weight:normal;font-size:71.35877228px;line-height:0%;font-family:'Bitstream Vera Sans';display:inline;fill:#000000;fill-opacity:1;stroke:none" - xml:space="preserve" - id="text3172" - y="2147.7705" - x="-1259.6362"><tspan - id="tspan3174" - y="2147.7705" - x="-1259.6362">Free Software for Automation </tspan></text> - </g> + transform="translate(0,107.89276)" /> + </g> + <g + transform="matrix(8.4066435,0,0,8.4066435,-1377.662,86.510482)" + style="stroke-width:0.26217723" + id="g52678"> + <path + style="opacity:1;vector-effect:none;fill:#9acd32;fill-opacity:1;stroke:none;stroke-width:0.06936772;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + d="m 43.7625,109.87305 h 50.998012 l -1.961981,2.54 H 41.80053 Z" + id="rect482-3" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccc" /> + <path + style="opacity:1;vector-effect:none;fill:#ff8c00;fill-opacity:1;stroke:none;stroke-width:0.06936772;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + d="m 46.296709,106.59222 h 50.998 l -1.847508,2.39183 H 44.44919 Z" + id="rect480-6" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccc" /> + <path + d="m 46.983389,108.98405 h 2.508251 c 1.05833,0 1.5875,-0.45508 1.5875,-1.25941 0,-0.21872 -0.0388,-0.40569 -0.11642,-0.56092 -0.0705,-0.15522 -0.15522,-0.26811 -0.254,-0.33866 -0.0917,-0.0776 -0.22225,-0.13759 -0.39158,-0.17992 -0.16228,-0.0423 -0.26018,-0.0529 -0.39158,-0.0529 h -0.39159 -2.550581 v -0.88899 h 2.730501 c 0.49389,0 0.88194,0.0388 1.16417,0.11641 0.28222,0.0705 0.53622,0.21873 0.762,0.4445 0.35983,0.34573 0.53975,0.80081 0.53975,1.36525 0,0.23989 -0.0353,0.45862 -0.10583,0.65617 -0.0706,0.1905 -0.14817,0.3422 -0.23284,0.45508 -0.0847,0.11289 -0.20108,0.21873 -0.34925,0.3175 -0.14111,0.0917 -0.24694,0.15523 -0.3175,0.1905 -0.0706,0.0282 -0.16581,0.0635 -0.28575,0.10584 0.13406,0.0353 0.24695,0.0706 0.33867,0.10583 0.0917,0.0353 0.21872,0.10231 0.381,0.20108 0.16933,0.0988 0.30339,0.21167 0.40217,0.33867 0.10583,0.11995 0.19755,0.29281 0.27516,0.51858 0.0847,0.21873 0.127,0.46567 0.127,0.74084 0,0.74789 -0.30691,1.32644 -0.92075,1.73566 -0.16227,0.10584 -0.35277,0.18698 -0.5715,0.24342 -0.21167,0.0564 -0.39158,0.0882 -0.53975,0.0952 -0.14111,0.007 -0.34572,0.0106 -0.61383,0.0106 l -2.783421,1e-5 v -0.93135 h 2.836331 c 0.43745,0 0.79728,-0.0388 1.0795,-0.26457 0.28223,-0.23284 0.42334,-0.56092 0.42334,-0.98425 0,-0.38806 -0.13053,-0.70556 -0.39159,-0.9525 -0.254,-0.24695 -0.6103,-0.33868 -1.06891,-0.33868 h -2.878671 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:0.06936772" + id="path415-7" + inkscape:connector-curvature="0" + sodipodi:nodetypes="csscccscccsccscccccccccsccccccscscscc" /> + <path + inkscape:connector-curvature="0" + id="path417-5" + transform="matrix(0.06936772,0,0,0.06936772,41.661795,105.56437)" + d="M 175.58008,2.0019531 V 14.970703 h 69.11328 V 2.0019531 Z m 0,47.2949219 v 0.002 12.814453 36.617188 13.425784 0.002 h 15.25781 v -0.002 h 55.07617 V 98.730469 H 190.83789 V 62.113281 h 51.26172 V 49.298828 h -51.26172 v -0.002 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:1" /> + <path + d="m 60.41363,108.99464 h 2.69874 c 0.47978,0 0.81492,-0.0564 1.00542,-0.16933 0.34572,-0.19756 0.51858,-0.52917 0.51858,-0.99484 0,-0.23283 -0.0423,-0.43391 -0.127,-0.60325 -0.0847,-0.16933 -0.17992,-0.2928 -0.28575,-0.37041 -0.0988,-0.0776 -0.23283,-0.13759 -0.40216,-0.17992 -0.16228,-0.0423 -0.28928,-0.067 -0.381,-0.0741 -0.0847,-0.007 -0.19403,-0.0106 -0.32809,-0.0106 l -2.69874,-1e-5 v -0.889 h 2.73049 c 0.79728,0 1.38289,0.11995 1.75684,0.35984 0.56444,0.35278 0.84666,0.87136 0.84666,1.55575 0,0.54328 -0.17992,0.99483 -0.53975,1.35466 -0.23283,0.23284 -0.53269,0.39864 -0.89958,0.49742 0.37395,0.0988 0.64911,0.254 0.8255,0.46567 0.17639,0.20461 0.28928,0.53975 0.33867,1.00541 0.11994,1.04423 0.27869,1.84503 0.47625,2.40242 h -1.13242 c -0.0988,-0.29633 -0.2152,-0.97014 -0.34925,-2.02142 -0.0635,-0.5715 -0.20105,-0.9525 -0.41275,-1.143 -0.21167,-0.1905 -0.63147,-0.28575 -1.25942,-0.28575 h -2.38124 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:0.06936772" + id="path419" + inkscape:connector-curvature="0" + sodipodi:nodetypes="cscssccccccscsscccccccscc" /> + <path + inkscape:connector-curvature="0" + id="path421" + transform="matrix(0.06936772,0,0,0.06936772,41.661795,105.56437)" + d="M 370.5625,2.0019531 V 14.970703 h 69.11328 V 2.0019531 Z m 0,47.2949219 v 0.002 12.814453 36.617188 13.425784 0.002 h 15.25586 v -0.002 h 55.07812 V 98.730469 H 385.81836 V 62.113281 h 51.26367 V 49.298828 h -51.26367 v -0.002 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:1" /> + <path + sodipodi:nodetypes="cccccccccc" + inkscape:connector-curvature="0" + id="path423" + d="m 83.95087,105.70311 v 0.88911 h 1.05833 v -0.88911 z m 0,3.28094 v 4.36046 h 1.05833 v -4.36046 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:0.06936772" /> + <path + inkscape:connector-curvature="0" + id="path425" + d="m 73.98146,106.60281 v -0.89959 h 1.873271 l 1.429369,4.16984 h -1.0883 l -1.18753,-3.27025 z" + style="fill:#000000;stroke:none;stroke-width:0.06936772px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" /> + <path + inkscape:connector-curvature="0" + id="path427" + d="m 79.07313,108.98405 -1.299141,3.42925 h -0.68162 l 0.328661,0.93121 h 1.005631 l 0.33951,-0.93121 1.250059,-3.42925 z" + style="fill:#000000;stroke:none;stroke-width:0.06936772px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" /> + <path + inkscape:connector-curvature="0" + id="path429" + d="m 80.22551,105.70311 -0.315741,0.89969 h 1.024753 v 2.38125 0.88883 h 1.037137 v -0.88883 -2.38125 -0.89969 z" + style="fill:#000000;stroke:none;stroke-width:0.06936772px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" /> + <path + inkscape:connector-curvature="0" + id="path431" + d="m 80.93453,112.41306 -8e-6,0.93133 h 1.037148 v -0.93133 z" + style="fill:#000000;stroke:none;stroke-width:0.06936772px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" /> + <path + style="fill:#000000;stroke:none;stroke-width:0.06936772px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + d="m 73.981409,108.98405 v 0.78341 0.10542 3.47163 h 1.026811 v -3.47163 -0.10542 -0.78341 z" + id="path433" + inkscape:connector-curvature="0" /> + <path + sodipodi:nodetypes="ccccccccccccc" + inkscape:connector-curvature="0" + id="path435" + d="m 86.448391,105.70311 v 0.93121 h 5.55625 l 0.727599,-0.93121 z m 2.462379,3.28094 -2.57865,3.30212 v 1.05834 h 5.746929 V 112.4133 H 87.5491 l 2.698541,-3.42925 z" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:0.06936772" /> + <path + style="opacity:1;vector-effect:none;fill:#000000;fill-opacity:1;stroke:none;stroke-width:0.06936772;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + d="m 60.413582,112.41305 h 1.04775 v 0.93134 h -1.04775 z" + id="rect474" + inkscape:connector-curvature="0" /> </g> </g> <text @@ -90261,8 +90277,9 @@ height="178.66196" x="-1492.3632" y="2013.0917" - id="ico64" - style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" /> + id="ico064" + style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" + inkscape:label="#ico064" /> <use transform="translate(223.29672,0.68429344)" id="use15274" @@ -90276,69 +90293,9 @@ id="g19356" mask="url(#mask6467)" transform="translate(-1840,2339.9999)" /> - <g - id="g19358" - transform="matrix(0.3669311,0,0,0.3669311,-1086.1197,1386.8468)"> - <path - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:314.89779663px;line-height:125%;font-family:'Arial Black';text-align:start;writing-mode:lr-tb;text-anchor:start;display:inline;overflow:visible;visibility:visible;opacity:0.5;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:4;marker:none;filter:url(#filter19931);enable-background:accumulate" - id="path19360" - d="m -1253,2027.2478 c -3.5746,10.6475 -4.3073,15.1469 -15.75,36.2188 -11.4427,21.0719 -26.4108,40.6733 -44.875,57.9062 -82.844,77.3195 -208.385,81.5885 -295.9375,14.2188 l -30.5938,23.9687 -5.125,4 -0.9062,-6.4375 -9.7813,-69.3437 c -66.3515,-92.0452 -55.4856,-221.7505 29.5938,-301.1563 44.0109,-41.076 100.0799,-61.5397 156.0937,-61.5937 49.4241,-0.048 98.8036,15.7954 139.8438,47.375 l 30.5937,-23.9688 5.125,-4 0.9063,6.4375 9.7812,69.3438 c 16.3717,22.7113 28.0479,47.7118 35.0625,73.6875 7.0146,25.9757 5.7125,26.1967 6.8125,37.3437 1.1,11.147 1.3998,22.3595 0.875,33.5313 -0.5248,11.1718 -1.4013,18.9792 -3.375,29.9687 -1.9737,10.9895 -4.7691,21.8525 -8.3437,32.5 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#d19f34;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="path19362" - d="m -1336.1632,1788.2263 c 0,0 56.3913,141.5671 -147.8368,147.7737 -204.2612,6.2076 -147.8368,147.7737 -147.8368,147.7737 -37.8479,-37.8317 -61.2676,-90.0855 -61.2676,-147.7737 0,-57.6882 23.4197,-109.942 61.2676,-147.7737 37.8479,-37.8318 90.124,-61.2415 147.8368,-61.2415 57.7128,0 109.9889,23.4097 147.8368,61.2415 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#469837;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="path19364" - d="m -1631.8368,2083.7737 c 0,0 -56.3913,-141.5671 147.8368,-147.7737 204.2612,-6.2076 147.8368,-147.7737 147.8368,-147.7737 37.8479,37.8317 61.2676,90.0855 61.2676,147.7737 0,57.6882 -23.4197,109.942 -61.2676,147.7737 -37.8479,37.8318 -90.124,61.2415 -147.8368,61.2415 -57.7128,0 -109.9889,-23.4097 -147.8368,-61.2415 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:#4c4c4c;stroke-width:49.86504364;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:10.43299961;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" - id="path19366" - transform="matrix(0.8023362,0,0,0.8019941,-2094.2929,1769.2301)" - d="m 1021.2642,207.94408 c 0,143.9361 -116.68326,260.61936 -260.61936,260.61936 -143.9361,0 -260.61936,-116.68326 -260.61936,-260.61936 0,-143.936098 116.68326,-260.61936 260.61936,-260.61936 143.9361,0 260.61936,116.683262 260.61936,260.61936 z" - inkscape:connector-curvature="0" /> - <path - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:306.80871582px;line-height:125%;font-family:'Arial Black';text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" - id="path19368" - d="m -1577.2331,1825.1726 h 127.038 c 21.1728,2e-4 37.4271,5.2435 48.7628,15.7299 11.3353,10.4868 17.0031,23.4703 17.0033,38.9503 -2e-4,12.9836 -4.045,24.1194 -12.1345,33.4074 -5.3933,6.1923 -13.2833,11.086 -23.6698,14.6813 15.7797,3.7953 27.3898,10.312 34.8306,19.5501 7.4402,9.2383 11.1605,20.8485 11.1607,34.8306 -2e-4,11.3855 -2.6468,21.6224 -7.9399,30.7108 -5.2934,9.0884 -12.5342,16.2792 -21.7223,21.5725 -5.6929,3.2958 -14.2819,5.6927 -25.7671,7.1908 -15.2807,1.9975 -25.4177,2.9962 -30.4112,2.9962 h -117.1506 z m 68.4627,86.1401 h 29.5124 c 10.5863,10e-5 17.9519,-1.8225 22.0968,-5.468 4.1445,-3.6452 6.2169,-8.9135 6.217,-15.8049 -1e-4,-6.3916 -2.0725,-11.3853 -6.217,-14.9809 -4.1449,-3.5952 -11.3607,-5.3929 -21.6474,-5.3931 h -29.9618 z m 0,86.29 h 34.6059 c 11.6849,0 19.9244,-2.0723 24.7184,-6.2171 4.7938,-4.1447 7.1907,-9.7126 7.1909,-16.7037 -2e-4,-6.4916 -2.3722,-11.71 -7.116,-15.655 -4.7441,-3.9449 -13.0584,-5.9174 -24.9432,-5.9175 h -34.456 z" - inkscape:connector-curvature="0" /> - <g - id="g19370" - mask="url(#mask6467)" - transform="rotate(180,-563.99995,766)"> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447);enable-background:accumulate" - id="path19372" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" - id="path19374" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - </g> - <g - id="g19376" - mask="url(#mask6467)" - transform="translate(-1839.8676,2340.0508)"> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447);enable-background:accumulate" - id="path19378" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - <path - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" - id="path19380" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - inkscape:connector-curvature="0" /> - </g> - </g> <rect - style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" - id="ico48" + style="display:inline;overflow:visible;visibility:visible;fill:none;fill-opacity:1;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" + id="ico048" y="2012.4073" x="-1715.66" height="178.66196" @@ -90348,7 +90305,7 @@ transform="matrix(0.5,0,0,0.5,-593.54387,1095.1925)"> <rect style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" - id="ico24" + id="ico024" y="2013.0917" x="-1492.3632" height="178.66196" @@ -90367,7 +90324,7 @@ transform="matrix(0.6666666,0,0,0.6666666,-493.70173,729.90034)"> <rect style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" - id="ico32" + id="ico032" y="2013.0917" x="-1492.3632" height="178.66196" @@ -90389,7 +90346,7 @@ height="178.66196" x="-1492.3632" y="2013.0917" - id="ico16" + id="ico016" style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:none;stroke-width:0;marker:none;enable-background:accumulate" /> <use transform="translate(223.29672,0.68429344)" @@ -90400,6 +90357,49 @@ height="1052.3622" xlink:href="#g19358" /> </g> + <g + id="g19358" + transform="matrix(0.3669311,0,0,0.3669311,-1086.1197,1386.8468)"> + <g + id="g837" + transform="matrix(0.48690873,0,0,0.48690873,-1715.6909,1704.8447)" + inkscape:label="g837"> + <rect + id="rect2" + ry="200" + rx="200" + height="1000" + width="1000" + x="0" + y="0" + style="fill:#eeeeec" /> + <path + id="rect482" + d="M 0,526.82227 V 721.9043 H 1000 V 526.82227 Z" + style="opacity:1;vector-effect:none;fill:#9acd32;fill-opacity:1;stroke:none;stroke-width:5.32772112;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + inkscape:connector-curvature="0" /> + <path + id="rect480" + d="M 0,274.8418 V 458.54297 H 1000 V 274.8418 Z" + style="opacity:1;vector-effect:none;fill:#ff8c00;fill-opacity:1;stroke:none;stroke-width:5.32772112;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none" + inkscape:connector-curvature="0" /> + <g + transform="translate(9.7650495)" + id="g145"> + <path + sodipodi:nodetypes="csscccscccsccscccccccccsccccccscscscc" + inkscape:connector-curvature="0" + id="path415" + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:5.32772112" + d="M 39.514141,458.54323 H 232.15795 c 81.28402,0 121.92641,-34.95199 121.92641,-96.72778 0,-16.79858 -2.98,-31.15863 -8.94153,-43.08092 -5.41468,-11.92152 -11.92152,-20.59193 -19.50822,-26.01046 -7.04293,-5.95999 -17.0697,-10.56746 -30.07493,-13.81858 -12.46376,-3.24881 -19.98287,-4.06293 -30.07492,-4.06293 H 235.40906 39.514141 V 206.56454 H 249.22765 c 37.93274,0 67.73655,2.97999 89.41295,8.94075 21.67564,5.41469 41.18387,16.79935 58.52468,34.1394 27.6364,26.55346 41.45498,61.50544 41.45498,104.85671 0,18.42452 -2.71118,35.22387 -8.12817,50.39651 -5.42236,14.63117 -11.38005,26.28234 -17.88305,34.95198 -6.5053,8.67041 -15.44376,16.79935 -26.82381,24.38528 -10.83782,7.04293 -18.96599,11.92229 -24.38528,14.63117 -5.42237,2.16588 -12.73488,4.87706 -21.94676,8.12894 10.29635,2.71119 18.96676,5.42237 26.01123,8.12817 7.04293,2.71119 16.79857,7.85783 29.26233,15.44376 13.00523,7.58824 23.30158,16.25711 30.88828,26.01122 8.12818,9.21265 15.17264,22.48899 21.1334,39.82904 6.50531,16.79935 9.75412,35.76534 9.75412,56.89951 0,57.44097 -23.57193,101.87595 -70.71732,133.3057 -12.46299,8.12893 -27.09416,14.36081 -43.89351,18.69563 -16.25711,4.33175 -30.07493,6.77412 -41.45498,7.31175 -10.83782,0.53763 -26.55269,0.81412 -47.14462,0.81412 l -213.777979,7.7e-4 V 721.90351 H 257.35582 c 33.59792,0 61.23432,-2.98 82.90996,-20.32005 21.6764,-17.88305 32.51422,-43.08092 32.51422,-75.59437 0,-29.80458 -10.02523,-54.18986 -30.07569,-73.15585 C 323.19608,533.86648 295.8308,526.82125 260.6077,526.82125 H 39.514141 Z" /> + <path + style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:10.58333302px;line-height:1.25;font-family:'Univers LT Std';-inkscape-font-specification:'Univers LT Std, Normal';font-variant-ligatures:normal;font-variant-caps:normal;font-variant-numeric:normal;font-feature-settings:normal;text-align:start;letter-spacing:0px;word-spacing:0px;writing-mode:lr-tb;text-anchor:start;fill:#000000;fill-opacity:1;stroke:none;stroke-width:5.32772112" + d="m 566.23593,206.56384 v 69.09388 h 368.21628 v -69.09388 z m 0,251.97415 v 0.0107 68.27183 195.08616 71.52884 0.0107 h 81.28935 v -0.0107 H 940.95576 V 721.90639 H 647.52528 V 526.82023 H 920.63343 V 458.5484 H 647.52528 v -0.0107 z" + id="path417" + inkscape:connector-curvature="0" /> + </g> + </g> + </g> </g> <text style="font-style:normal;font-weight:normal;font-size:13.88476658px;line-height:0%;font-family:'Bitstream Vera Sans';fill:#000000;fill-opacity:1;stroke:none" @@ -91172,13 +91172,6 @@ x="37.5" y="473.61218" id="tspan16384">Icons</tspan></text> - <path - sodipodi:type="inkscape:offset" - inkscape:radius="1" - inkscape:original="M 505 135.34375 L 505 147.34375 L 502 147.34375 L 506 151.34375 L 510 147.34375 L 507 147.34375 L 507 135.34375 L 505 135.34375 z M 498 135.375 L 494 139.375 L 497 139.375 L 497 151.375 L 499 151.375 L 499 139.375 L 502 139.375 L 498 135.375 z " - style="color:#000000;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" - id="path18475" - d="m 504.90625,134.34375 a 1.0001,1.0001 0 0 0 -0.90625,1 l 0,11 -2,0 a 1.0001,1.0001 0 0 0 -0.71875,1.71875 l 4,4 a 1.0001,1.0001 0 0 0 1.4375,0 l 4,-4 A 1.0001,1.0001 0 0 0 510,146.34375 l -2,0 0,-11 a 1.0001,1.0001 0 0 0 -1,-1 l -2,0 a 1.0001,1.0001 0 0 0 -0.0937,0 z m -7.03125,0.0312 a 1.0001,1.0001 0 0 0 -0.59375,0.28125 l -4,4 A 1.0001,1.0001 0 0 0 494,140.375 l 2,0 0,11 a 1.0001,1.0001 0 0 0 1,1 l 2,0 a 1.0001,1.0001 0 0 0 1,-1 l 0,-11 2,0 a 1.0001,1.0001 0 0 0 0.71875,-1.71875 l -4,-4 A 1.0001,1.0001 0 0 0 497.875,134.375 z" /> <rect width="24" height="24" @@ -91187,13 +91180,6 @@ id="Transfer" style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;stroke-linecap:square;stroke-linejoin:miter;marker:none;marker-start:none;marker-mid:none;marker-end:none;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" inkscape:label="#rect16270" /> - <path - sodipodi:type="inkscape:offset" - inkscape:radius="1" - inkscape:original="M 558 141.375 L 555.4375 144.375 L 550 144.375 L 550 145.375 L 555.4375 145.375 L 558 148.375 L 562 148.34375 L 562 144.875 L 562 141.40625 L 558 141.375 z M 567 141.375 L 563 141.40625 L 563 144.875 L 563 148.34375 L 567 148.375 L 569.5625 145.375 L 574 145.375 L 574 144.375 L 569.5625 144.375 L 567 141.375 z " - style="fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.10000000000000001;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" - id="path18481" - d="m 558,141.375 -2.5625,3 -5.4375,0 0,1 5.4375,0 2.5625,3 4,-0.0312 0,-3.46875 0,-3.46875 -4,-0.0312 z m 9,0 -4,0.0312 0,3.46875 0,3.46875 4,0.0312 2.5625,-3 4.4375,0 0,-1 -4.4375,0 -2.5625,-3 z" /> <rect inkscape:label="#rect16270" style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;stroke-linecap:square;stroke-linejoin:miter;marker:none;marker-start:none;marker-mid:none;marker-end:none;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" @@ -91202,13 +91188,6 @@ x="550" height="24" width="24" /> - <path - sodipodi:type="inkscape:offset" - inkscape:radius="1" - inkscape:original="M 616 141.375 L 613.4375 144.375 L 608 144.375 L 608 145.375 L 613.4375 145.375 L 616 148.375 L 620 148.34375 L 620 144.875 L 620 141.40625 L 616 141.375 z M 629 141.375 L 625 141.40625 L 625 144.875 L 625 148.34375 L 629 148.375 L 631.5625 145.375 L 636 145.375 L 636 144.375 L 631.5625 144.375 L 629 141.375 z " - style="fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.10000000000000001;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" - id="path18491" - d="m 616,141.375 -2.5625,3 -5.4375,0 0,1 5.4375,0 2.5625,3 4,-0.0312 0,-3.46875 0,-3.46875 -4,-0.0312 z m 13,0 -4,0.0312 0,3.46875 0,3.46875 4,0.0312 2.5625,-3 4.4375,0 0,-1 -4.4375,0 -2.5625,-3 z" /> <rect width="24" height="24" @@ -91217,12 +91196,6 @@ id="Disconnect" style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;stroke-linecap:square;stroke-linejoin:miter;marker:none;marker-start:none;marker-mid:none;marker-end:none;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" inkscape:label="#rect16270" /> - <path - style="fill:#008000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.10000000000000001;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:8.59499931000000039;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" - d="m 562,141.40625 -4,-0.0441 -2.5625,3.01282 -5.4375,0 0,1 5.4375,0 2.5625,2.98718 4,-0.0184 0,-3.46875 z m 1,0 0,3.46875 0,3.46875 4,0.0184 2.5625,-2.98718 4.4375,0 0,-1 -4.4375,0 L 567,141.36218 z" - id="path16742" - inkscape:connector-curvature="0" - sodipodi:nodetypes="cccccccccccccccccccc" /> <rect inkscape:label="#rect16270" style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" @@ -91254,7 +91227,7 @@ transform="matrix(0.1343319,0,0,0.1343319,885.45598,321.13309)" /> <path style="fill:#0fff09;fill-opacity:1;fill-rule:evenodd;stroke:#1d0000;stroke-width:0.30481818;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-opacity:1" - d="m 666.0806,603.80447 10.83519,5.4176 -10.83519,5.41759 z" + d="m 661.47632,598.046 10.83519,5.4176 -10.83519,5.41759 z" id="rect16426" sodipodi:nodetypes="cccc" inkscape:connector-curvature="0" /> @@ -91280,8 +91253,8 @@ id="rect17210" width="10.821424" height="10.821424" - x="666.58472" - y="634.71997" /> + x="661.57739" + y="629.05286" /> <rect inkscape:label="#rect16270" style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;stroke-linecap:square;stroke-linejoin:miter;marker:none;marker-start:none;marker-mid:none;marker-end:none;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" @@ -92909,7 +92882,7 @@ x="-1060.788" y="501.19318" id="ImportFile" - style="fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" /> + style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:0;fill-rule:evenodd;stroke:none;stroke-width:1;marker:none;enable-background:accumulate" /> <g id="g17936" transform="translate(-1334.2792,308.62148)"> @@ -92932,7 +92905,7 @@ inkscape:connector-curvature="0" /> <path d="m 277.24218,192.81529 h 11.5 c 0.683,0.2373 4.541,3.1281 5.5,5 0,5.7292 4e-5,11.271 4e-5,17 h -17 v -22 z" - style="fill:url(#linearGradient17977);stroke:url(#linearGradient17979);stroke-width:0.99992001;stroke-linejoin:round" + style="display:inline;fill:url(#linearGradient17977);stroke:url(#linearGradient17979);stroke-width:0.99992001;stroke-linejoin:round" id="path4160" inkscape:connector-curvature="0" /> <path @@ -92968,15 +92941,11 @@ r="34.144001" transform="matrix(0.3316761,0,0,0.3316761,48.927852,9.2318583)" id="circle29-8" - style="fill:#84c225;fill-rule:evenodd;stroke:#5d9d35;stroke-width:2.82220006" - sodipodi:ry="34.144001" - sodipodi:rx="34.144001" - sodipodi:cy="110.081" - sodipodi:cx="100.287" /> + style="fill:#84c225;fill-rule:evenodd;stroke:#5d9d35;stroke-width:2.82220006" /> <path - d="m 84.515333,38.943636 0,3.981494 3.981494,0 0,4.799639 -3.981494,0 0,3.981494 -4.782372,0 0,-3.981494 -3.981494,0 0,-4.799639 3.981494,0 0,-3.981494 4.782372,0" + d="m 84.515333,38.943636 v 3.981494 h 3.981494 v 4.799639 h -3.981494 v 3.981494 H 79.732961 V 47.724769 H 75.751467 V 42.92513 h 3.981494 v -3.981494 h 4.782372" id="text1332-4" - style="font-size:12px;font-style:normal;font-weight:normal;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;visibility:visible;display:inline;overflow:visible;font-family:Bitstream Vera Sans" + style="font-style:normal;font-weight:normal;font-size:12px;font-family:'Bitstream Vera Sans';display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none" inkscape:connector-curvature="0" /> <path d="m 82.190677,35.644078 c 5.025924,0 9.194867,3.673581 9.969229,8.481465 -6.921917,-5.82623 -17.958314,0.09291 -16.467662,9.346307 -2.201037,-1.852678 -3.600446,-4.62745 -3.600446,-7.728889 0,-5.576508 4.522377,-10.098883 10.098879,-10.098883 z" @@ -93722,54 +93691,26 @@ </g> <path id="path18470" - style="color:#000000;fill:#ffcc00;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" - d="m 506,151.34936 3.99998,-4 -2.99999,-1e-5 -3e-5,-11.99998 -1.99998,-2e-5 -10e-6,12 -2.99998,3e-5 4.00001,3.99998 z m -8,-15.98718 -4,4 3,0 0,12 2,0 0,-12 3,0 -4,-4 z" /> - <path - sodipodi:nodetypes="cccccccccccccccccccc" + style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#ffcc00;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;enable-background:accumulate" + d="m 507,153.36218 4.99998,-6.01282 -2.99999,-1e-5 -3e-5,-13.99998 -3.99998,-2e-5 -10e-6,14 -2.99998,3e-5 z m -10,-20 -5,6 h 3 v 14 h 4 v -14 h 3 z" inkscape:connector-curvature="0" - id="path18485" - d="m 620,141.40625 -4,-0.0441 -2.5625,3.01282 -5.4375,0 0,1 5.4375,0 2.5625,2.98718 4,-0.0184 0,-3.46875 z m 5,0 0,3.46875 0,3.46875 4,0.0184 2.5625,-2.98718 4.4375,0 0,-1 -4.4375,0 L 629,141.36218 z" - style="fill:#008000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:0.1;marker:none;visibility:visible;display:inline;overflow:visible;enable-background:accumulate" /> - <path - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" - d="m 620,139.36218 -1,-1" - id="path18493" - inkscape:connector-curvature="0" /> - <path - inkscape:connector-curvature="0" - id="path19263" - d="m 625,139.36218 1,-1" - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" /> - <path - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" - d="m 622.52384,138.1738 0,-1.4142" - id="path19265" - inkscape:connector-curvature="0" /> - <path - inkscape:connector-curvature="0" - id="path19267" - d="m 620,150.36218 -1,1" - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" /> - <path - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" - d="m 625,150.36218 1,1" - id="path19269" - inkscape:connector-curvature="0" /> - <path - inkscape:connector-curvature="0" - id="path19271" - d="m 622.52384,151.55056 0,1.4142" - style="fill:none;stroke:#000000;stroke-width:1px;stroke-linecap:round;stroke-linejoin:miter;stroke-opacity:1" /> - <path - style="fill:#00ff00;stroke:none;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" - d="M 79 192.375 L 79 194.375 L 76 194.375 L 76 198.375 L 79 198.375 L 79 200.375 L 83 196.375 L 79 192.375 z M 65 194.375 L 65 198.375 L 66 198.375 L 66 194.375 L 65 194.375 z M 67 194.375 L 67 198.375 L 68 198.375 L 68 194.375 L 67 194.375 z M 69 194.375 L 69 198.375 L 71 198.375 L 71 194.375 L 69 194.375 z M 72 194.375 L 72 198.375 L 75 198.375 L 75 194.375 L 72 194.375 z " - id="path18382" /> - <path - sodipodi:nodetypes="ccccccccccccccccccccccccccccc" - inkscape:connector-curvature="0" - id="path18467" - d="m 105,193.88061 0,5.01282 2,0 0,-5.01282 z m 0,6.01282 0,4 2,0 0,-4 z m 0,5 0,3 2,0 0,-3 z m 0,4 0,2 2,0 0,-2 z m -2,3 1,1 4,0 1,-1 z m 2,2 1,1 1,-1 z" - style="fill:#808080;stroke:none" /> + sodipodi:nodetypes="cccccccccccccccc" /> + <g + id="g52799" + transform="rotate(90,68.506409,196.86859)"> + <path + inkscape:connector-curvature="0" + style="fill:#808080;stroke:none" + d="m 79.943848,189.4415 v 2.9335 h -15.375 v 6.0665 h 15.375 v 3 l 6,-6 z" + id="path18402" + sodipodi:nodetypes="cccccccc" /> + <path + id="path18382" + d="m 79.375,188.375 v 2.9335 H 64 v 6.0665 h 15.375 v 3 l 6,-6 z" + style="fill:#00ff00;stroke:none;stroke-width:1px;stroke-linecap:butt;stroke-linejoin:miter;stroke-opacity:1" + inkscape:connector-curvature="0" + sodipodi:nodetypes="cccccccc" /> + </g> <g id="g18416" clip-path="none"> @@ -93778,7 +93719,7 @@ inkscape:radius="1" inkscape:original="M 108 192.36133 L 108 214.36133 L 110 214.36133 L 110 203.36133 L 111 203.36133 L 111 213.36133 L 113 213.36133 L 113 201.36133 L 114 201.36133 L 114 214.36133 L 117 214.36133 L 117 202.36133 L 118 202.36133 L 118 215.36133 L 120 215.36133 L 120 201.36133 L 121 201.36133 L 121 212.36133 L 123 212.36133 L 123 202.36133 L 124 202.36133 L 124 214.36133 L 125 214.36133 L 125 197.36133 L 120 192.36133 L 108 192.36133 z " xlink:href="#path18406" - style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;enable-background:accumulate" + style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#aaaaaa;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;enable-background:accumulate" id="path18446" inkscape:href="#path18406" d="m 108,191.36133 a 1.0001,1.0001 0 0 0 -1,1 v 22 a 1.0001,1.0001 0 0 0 1,1 h 2 a 1.0001,1.0001 0 0 0 1,-1 h 2 a 1.0001,1.0001 0 0 0 1,1 h 3 a 1.0001,1.0001 0 0 0 1,1 h 2 a 1.0001,1.0001 0 0 0 1,-1 v -2 h 2 v 1 a 1.0001,1.0001 0 0 0 1,1 h 1 a 1.0001,1.0001 0 0 0 1,-1 v -17 a 1.0001,1.0001 0 0 0 -0.29297,-0.70703 l -5,-5 A 1.0001,1.0001 0 0 0 120,191.36133 Z" /> @@ -93787,7 +93728,7 @@ inkscape:connector-curvature="0" id="path18406" d="m 108,192.36218 v 22 h 2 v -11 h 1 v 10 h 2 v -12 h 1 v 13 h 3 v -12 h 1 v 13 h 2 v -14 h 1 v 11 h 2 v -10 h 1 v 12 h 1 v -17 l -5,-5 z" - style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;enable-background:accumulate" /> + style="color:#000000;display:inline;overflow:visible;visibility:visible;fill:#ededed;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:10;marker:none;enable-background:accumulate" /> <g id="g18450" clip-path="url(#clipPath18454)"> @@ -93803,12 +93744,6 @@ id="path18412" /> </g> </g> - <path - style="fill:#ff0000;stroke:none" - d="m 104,193.34936 0,5.01282 2,0 0,-5.01282 z m 0,6.01282 0,4 2,0 0,-4 z m 0,5 0,3 2,0 0,-3 z m 0,4 0,2 2,0 0,-2 z m -2,3 1,1 4,0 1,-1 z m 2,2 1,1 1,-1 z" - id="path18458" - inkscape:connector-curvature="0" - sodipodi:nodetypes="ccccccccccccccccccccccccccccc" /> <text style="font-style:normal;font-weight:normal;font-size:20px;line-height:0%;font-family:'Bitstream Vera Sans';fill:#000000;fill-opacity:1;stroke:none" xml:space="preserve" @@ -93949,86 +93884,15 @@ style="font-size:51.04000092px">%% about_brz_logo %%</tspan></text> <g transform="matrix(0.2224431,0,0,0.2224431,608.34301,1025.5992)" - id="about_brz_logo" - inkscape:label="#g17803-0"> - <g - transform="translate(-1840,2339.9999)" - mask="url(#mask6467-7-2)" - id="use16743-9" /> - <g - transform="translate(0,89.910633)" - id="g7269-3"> - <path - inkscape:connector-curvature="0" - d="m -1470.2813,1725.0291 c -56.0138,0.054 -112.0828,20.5177 -156.0937,61.5937 -85.0794,79.4058 -95.9453,209.1111 -29.5938,301.1563 l 9.7813,69.3437 0.9062,6.4375 5.125,-4 30.5938,-23.9687 c 87.5525,67.3697 213.0935,63.1007 295.9375,-14.2188 18.4642,-17.2329 33.4323,-36.8343 44.875,-57.9062 6.4003,0.736 13.3613,1.0937 20.875,1.0937 24.9087,0 44.0178,-3.5634 57.3437,-10.6875 13.3257,-7.1242 24.6943,-18.8804 34.125,-35.2812 l -61.6562,-5.6875 c -3.8953,4.9202 -7.5237,8.3649 -10.9063,10.3125 -5.5355,3.0752 -11.381,4.5937 -17.5312,4.5937 -2.2646,0 -4.435,-0.18 -6.5,-0.5625 3.5746,-10.6475 6.37,-21.5105 8.3437,-32.5 h 91.8125 v -7.0625 c -10e-5,-21.5262 -3.5522,-39.0091 -10.625,-52.4375 -7.0731,-13.4281 -17.3756,-23.6769 -30.9062,-30.75 -13.3838,-6.9958 -31.5824,-10.5176 -54.5938,-10.5937 -7.0146,-25.9757 -18.6908,-50.9762 -35.0625,-73.6875 l -9.7812,-69.3438 -0.9063,-6.4375 -5.125,4 -30.5937,23.9688 c -41.0402,-31.5796 -90.4197,-47.4228 -139.8438,-47.375 z m 228.125,206.2187 c 6.3617,0.8346 11.6486,3.3459 15.875,7.5313 5.279,5.2278 8.5511,13.9044 9.7813,26 h -24.7813 c 0.5248,-11.1718 0.225,-22.3843 -0.875,-33.5313 z m 118.9731,-33.6623 h 58.582 v 26.754 c 5.6377,-11.583 11.4549,-19.5528 17.4516,-23.9095 5.9965,-4.3563 13.4025,-6.5346 22.2182,-6.5347 9.2253,1e-4 19.3222,2.8703 30.2904,8.6104 l -19.3736,44.5901 c -7.3805,-3.0751 -13.2233,-4.6127 -17.5285,-4.6128 -8.2005,10e-5 -14.5559,3.3828 -19.066,10.1481 -6.458,9.5331 -9.6869,27.3691 -9.6868,53.508 v 54.7381 h -62.8873 z m 320.2793,97.1755 h -125.46709 c 1.12748,10.0456 3.84388,17.5285 8.14921,22.4487 6.04775,7.073 13.94069,10.6094 23.67883,10.6094 6.15024,0 11.99306,-1.5376 17.5285,-4.6128 3.38256,-1.9476 7.02151,-5.3815 10.91686,-10.3018 l 61.65724,5.6891 c -9.43072,16.4009 -20.80885,28.1634 -34.13443,35.2876 -13.3259,7.1241 -32.44322,10.6862 -57.35199,10.6862 -21.62881,0 -38.64475,-3.0495 -51.04789,-9.1486 -12.40324,-6.0991 -22.67944,-15.7859 -30.82862,-29.0604 -8.14922,-13.2745 -12.22382,-28.881 -12.22382,-46.8195 0,-25.5239 8.17483,-46.1788 24.52452,-61.9648 16.34962,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.82222,3.5366 55.35313,10.6093 13.53059,7.0731 23.83241,17.3236 30.9055,30.7517 7.0727,13.4284 10.60915,30.9056 10.60935,52.4318 z m -63.6561,-29.983 c -1.23021,-12.0956 -4.48476,-20.7573 -9.76368,-25.9852 -5.27917,-5.2277 -12.22393,-7.8416 -20.8343,-7.8417 -9.94316,10e-5 -17.88735,3.9466 -23.8326,11.8394 -3.79279,4.9204 -6.20167,12.2496 -7.22666,21.9875 z m 93.17774,-67.1925 h 58.4283 v 23.8326 c 8.40539,-9.9429 16.88773,-17.0158 25.44706,-21.2187 8.55912,-4.2026 18.88657,-6.304 30.98238,-6.3041 13.01809,1e-4 23.31991,2.3065 30.90549,6.9191 7.58526,4.6129 13.78685,11.4808 18.6048,20.6037 9.84037,-10.6605 18.80962,-17.9128 26.90778,-21.7569 8.09773,-3.8438 18.09204,-5.7658 29.98294,-5.7659 17.52823,1e-4 31.21274,5.2023 41.05357,15.6065 9.84026,10.4044 14.76054,26.6772 14.76083,48.8184 v 102.557 h -62.73354 v -93.024 c -2.3e-4,-7.3803 -1.43531,-12.8644 -4.30524,-16.4522 -4.20297,-5.6377 -9.43076,-8.4566 -15.68339,-8.4567 -7.38062,10e-5 -13.32595,2.6652 -17.83601,7.9954 -4.51044,5.3304 -6.76557,13.8897 -6.76538,25.6777 v 84.2598 h -62.73355 v -89.9488 c -1.2e-4,-7.1753 -0.41015,-12.0444 -1.23007,-14.6071 -1.3327,-4.1001 -3.63907,-7.4059 -6.91914,-9.9174 -3.2803,-2.5113 -7.12426,-3.767 -11.5319,-3.7671 -7.1755,10e-5 -13.06958,2.7165 -17.68225,8.1492 -4.61284,5.4329 -6.91922,14.3509 -6.91914,26.754 v 83.3372 h -62.73354 z m 316.74293,-62.1185 h 62.57978 v 42.5911 h -62.57978 z m 0,62.1185 h 62.57978 v 163.2917 h -62.57978 z m 95.79168,0 h 151.45231 v 36.5945 l -82.41466,83.9523 h 87.48869 v 42.7449 H -366.998 v -40.5923 l 78.10941,-79.9545 h -71.95906 z" - id="path17845-6" - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:314.89779663px;line-height:125%;font-family:'Arial Black';text-align:start;writing-mode:lr-tb;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:4;marker:none;filter:url(#filter17760-6-7);enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m -1336.1632,1788.2263 c 0,0 56.3913,141.5671 -147.8368,147.7737 -204.2612,6.2076 -147.8368,147.7737 -147.8368,147.7737 -37.8479,-37.8317 -61.2676,-90.0855 -61.2676,-147.7737 0,-57.6882 23.4197,-109.942 61.2676,-147.7737 37.8479,-37.8318 90.124,-61.2415 147.8368,-61.2415 57.7128,0 109.9889,23.4097 147.8368,61.2415 z" - id="use16735-0" - style="display:inline;overflow:visible;visibility:visible;fill:#d19f34;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m -1631.8368,2083.7737 c 0,0 -56.3913,-141.5671 147.8368,-147.7737 204.2612,-6.2076 147.8368,-147.7737 147.8368,-147.7737 37.8479,37.8317 61.2676,90.0855 61.2676,147.7737 0,57.6882 -23.4197,109.942 -61.2676,147.7737 -37.8479,37.8318 -90.124,61.2415 -147.8368,61.2415 -57.7128,0 -109.9889,-23.4097 -147.8368,-61.2415 z" - id="use16737-6" - style="display:inline;overflow:visible;visibility:visible;fill:#469837;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m 1021.2642,207.94408 c 0,143.9361 -116.68326,260.61936 -260.61936,260.61936 -143.9361,0 -260.61936,-116.68326 -260.61936,-260.61936 0,-143.936098 116.68326,-260.61936 260.61936,-260.61936 143.9361,0 260.61936,116.683262 260.61936,260.61936 z" - transform="matrix(0.8023362,0,0,0.8019941,-2094.2929,1769.2301)" - id="path16739-2" - style="display:inline;overflow:visible;visibility:visible;fill:none;stroke:#4c4c4c;stroke-width:49.86504364;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:10.43299961;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m -1577.2331,1825.1726 h 127.038 c 21.1728,2e-4 37.4271,5.2435 48.7628,15.7299 11.3353,10.4868 17.0031,23.4703 17.0033,38.9503 -2e-4,12.9836 -4.045,24.1194 -12.1345,33.4074 -5.3933,6.1923 -13.2833,11.086 -23.6698,14.6813 15.7797,3.7953 27.3898,10.312 34.8306,19.5501 7.4402,9.2383 11.1605,20.8485 11.1607,34.8306 -2e-4,11.3855 -2.6468,21.6224 -7.9399,30.7108 -5.2934,9.0884 -12.5342,16.2792 -21.7223,21.5725 -5.6929,3.2958 -14.2819,5.6927 -25.7671,7.1908 -15.2807,1.9975 -25.4177,2.9962 -30.4112,2.9962 h -117.1506 z m 68.4627,86.1401 h 29.5124 c 10.5863,10e-5 17.9519,-1.8225 22.0968,-5.468 4.1445,-3.6452 6.2169,-8.9135 6.217,-15.8049 -1e-4,-6.3916 -2.0725,-11.3853 -6.217,-14.9809 -4.1449,-3.5952 -11.3607,-5.3929 -21.6474,-5.3931 h -29.9618 z m 0,86.29 h 34.6059 c 11.6849,0 19.9244,-2.0723 24.7184,-6.2171 4.7938,-4.1447 7.1907,-9.7126 7.1909,-16.7037 -2e-4,-6.4916 -2.3722,-11.71 -7.116,-15.655 -4.7441,-3.9449 -13.0584,-5.9174 -24.9432,-5.9175 h -34.456 z" - id="path16741-6" - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:306.80871582px;line-height:125%;font-family:'Arial Black';text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:40;marker:none;enable-background:accumulate" /> - <g - transform="rotate(180,-563.99995,766)" - mask="url(#mask6467-7-2)" - id="use16745-1"> - <path - inkscape:connector-curvature="0" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - id="use6863-8" - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447-9-6);enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - id="use6865-7" - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" /> - </g> - <g - transform="translate(-1839.8676,2340.0508)" - mask="url(#mask6467-7-2)" - id="g7285-9"> - <path - inkscape:connector-curvature="0" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - id="path7287-2" - style="display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1;marker:none;filter:url(#filter6447-9-6);enable-background:accumulate" /> - <path - inkscape:connector-curvature="0" - d="m 507.8125,-566.84375 c -7.54052,0.31127 -14.32442,4.87714 -17.4375,11.84375 -3.32061,7.43106 -1.79456,16.12851 3.84375,22 71.38742,76.4228 67.29917,195.79932 -9.15625,267.15625 C 418.92868,-204.1201 321.00173,-198.52349 249.15625,-248 l 26.65625,-20.875 5.125,-4 -6.03125,-2.40625 -105.9375,-42.59375 -6,-2.4375 0.90625,6.4375 15.9375,113 0.90625,6.4375 5.125,-4 30.59375,-23.96875 c 87.55252,67.36975 213.09347,63.10079 295.9375,-14.21875 92.27769,-86.12407 97.25455,-231.41793 11.09375,-323.65625 -3.63563,-4.00109 -8.72059,-6.38195 -14.125,-6.5625 -0.50858,-0.0174 -1.02855,-0.0208 -1.53125,0 z" - id="path7289-0" - style="display:inline;overflow:visible;visibility:visible;fill:#000000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:49.86504364;marker:none;enable-background:accumulate" /> - </g> - <path - inkscape:connector-curvature="0" - d="m -1166.8587,1976.761 h -125.4671 c 1.1275,10.0456 3.8439,17.5285 8.1492,22.4487 6.0478,7.073 13.9407,10.6094 23.6789,10.6094 6.1502,0 11.993,-1.5376 17.5285,-4.6128 3.3825,-1.9476 7.0215,-5.3815 10.9168,-10.3018 l 61.6573,5.6891 c -9.4307,16.4009 -20.8089,28.1634 -34.1345,35.2876 -13.3259,7.1241 -32.4432,10.6862 -57.3519,10.6862 -21.6289,0 -38.6448,-3.0495 -51.0479,-9.1486 -12.4033,-6.0991 -22.6795,-15.7859 -30.8286,-29.0604 -8.1493,-13.2745 -12.2239,-28.881 -12.2239,-46.8195 0,-25.5239 8.1749,-46.1788 24.5245,-61.9648 16.3497,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.8223,3.5366 55.3532,10.6093 13.5306,7.0731 23.8324,17.3236 30.9055,30.7517 7.0727,13.4284 10.6091,30.9056 10.6093,52.4318 z m -63.6561,-29.983 c -1.2302,-12.0956 -4.4847,-20.7573 -9.7637,-25.9852 -5.2791,-5.2277 -12.2239,-7.8416 -20.8343,-7.8417 -9.9431,10e-5 -17.8873,3.9466 -23.8325,11.8394 -3.7928,4.9204 -6.2017,12.2496 -7.2267,21.9875 z m 93.3316,-67.1925 h 58.582 v 26.754 c 5.6377,-11.583 11.4549,-19.5528 17.4516,-23.9095 5.9965,-4.3563 13.4025,-6.5346 22.2182,-6.5347 9.2253,1e-4 19.3222,2.8703 30.2904,8.6104 l -19.3736,44.5901 c -7.3805,-3.0751 -13.2233,-4.6127 -17.5285,-4.6128 -8.2005,10e-5 -14.5559,3.3828 -19.066,10.1481 -6.458,9.5331 -9.6869,27.3691 -9.6868,53.508 v 54.7381 h -62.8873 z m 320.2793,97.1755 h -125.46709 c 1.12748,10.0456 3.84388,17.5285 8.14921,22.4487 6.04775,7.073 13.94069,10.6094 23.67883,10.6094 6.15024,0 11.99306,-1.5376 17.5285,-4.6128 3.38256,-1.9476 7.02151,-5.3815 10.91686,-10.3018 l 61.65724,5.6891 c -9.43072,16.4009 -20.80885,28.1634 -34.13443,35.2876 -13.3259,7.1241 -32.44322,10.6862 -57.35199,10.6862 -21.62881,0 -38.64475,-3.0495 -51.04789,-9.1486 -12.40324,-6.0991 -22.67944,-15.7859 -30.82862,-29.0604 -8.14922,-13.2745 -12.22382,-28.881 -12.22382,-46.8195 0,-25.5239 8.17483,-46.1788 24.52452,-61.9648 16.34962,-15.7857 38.9265,-23.6787 67.7307,-23.6788 23.3712,1e-4 41.82222,3.5366 55.35313,10.6093 13.53059,7.0731 23.83241,17.3236 30.9055,30.7517 7.0727,13.4284 10.60915,30.9056 10.60935,52.4318 z m -63.6561,-29.983 c -1.23021,-12.0956 -4.48476,-20.7573 -9.76368,-25.9852 -5.27917,-5.2277 -12.22393,-7.8416 -20.8343,-7.8417 -9.94316,10e-5 -17.88735,3.9466 -23.8326,11.8394 -3.79279,4.9204 -6.20167,12.2496 -7.22666,21.9875 z m 93.17774,-67.1925 h 58.4283 v 23.8326 c 8.40539,-9.9429 16.88773,-17.0158 25.44706,-21.2187 8.55912,-4.2026 18.88657,-6.304 30.98238,-6.3041 13.01809,1e-4 23.31991,2.3065 30.90549,6.9191 7.58526,4.6129 13.78685,11.4808 18.6048,20.6037 9.84037,-10.6605 18.80962,-17.9128 26.90778,-21.7569 8.09773,-3.8438 18.09204,-5.7658 29.98294,-5.7659 17.52823,1e-4 31.21274,5.2023 41.05357,15.6065 9.84026,10.4044 14.76054,26.6772 14.76083,48.8184 v 102.557 h -62.73354 v -93.024 c -2.3e-4,-7.3803 -1.43531,-12.8644 -4.30524,-16.4522 -4.20297,-5.6377 -9.43076,-8.4566 -15.68339,-8.4567 -7.38062,10e-5 -13.32595,2.6652 -17.83601,7.9954 -4.51044,5.3304 -6.76557,13.8897 -6.76538,25.6777 v 84.2598 h -62.73355 v -89.9488 c -1.2e-4,-7.1753 -0.41015,-12.0444 -1.23007,-14.6071 -1.3327,-4.1001 -3.63907,-7.4059 -6.91914,-9.9174 -3.2803,-2.5113 -7.12426,-3.767 -11.5319,-3.7671 -7.1755,10e-5 -13.06958,2.7165 -17.68225,8.1492 -4.61284,5.4329 -6.91922,14.3509 -6.91914,26.754 v 83.3372 h -62.73354 z m 316.74293,-62.1185 h 62.57978 v 42.5911 h -62.57978 z m 0,62.1185 h 62.57978 v 163.2917 h -62.57978 z m 95.79168,0 h 151.45231 v 36.5945 l -82.41466,83.9523 h 87.48869 v 42.7449 H -380.998 v -40.5923 l 78.10941,-79.9545 h -71.95906 z" - id="text16729-2" - style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:314.89779663px;line-height:125%;font-family:'Arial Black';text-align:start;writing-mode:lr-tb;text-anchor:start;display:inline;overflow:visible;visibility:visible;fill:#ffffff;fill-opacity:1;fill-rule:nonzero;stroke:#dadada;stroke-width:4;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:10.43299961;stroke-dashoffset:0;stroke-opacity:1;marker:none;enable-background:accumulate" /> - <text - x="-1259.6362" - y="2147.7705" - id="text3172-3" - xml:space="preserve" - style="font-style:normal;font-weight:normal;font-size:71.35877228px;line-height:0%;font-family:'Bitstream Vera Sans';display:inline;fill:#000000;fill-opacity:1;stroke:none"><tspan - x="-1259.6362" - y="2147.7705" - id="tspan3174-7">Free Software for Automation </tspan></text> - </g> + id="about_brz_logo"> + <use + transform="matrix(4.4955317,0,0,4.4955317,2592.5922,-2515.4545)" + x="0" + y="0" + xlink:href="#g52678" + id="use52780" + width="100%" + height="100%" /> </g> <g transform="translate(960.38982,282.02716)" @@ -95240,4 +95104,49 @@ d="m 1106,195.36218 v 1 h -6 v -1 z" sodipodi:nodetypes="ccccc" /> </g> + <g + id="g52819" + transform="rotate(45,111.50001,200.12138)"> + <path + style="fill:#808080;stroke:none" + d="m 103.15931,201.66277 h 17.01282 v -2.00001 h -17.01282 z" + id="path52811" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccc" /> + <path + sodipodi:nodetypes="ccccc" + inkscape:connector-curvature="0" + id="path52805" + d="m 112.66573,209.16918 v -17.01282 h -2.00001 v 17.01282 z" + style="fill:#808080;stroke:none" /> + <path + style="fill:#ff0000;stroke:none" + d="M 112.33428,208.08643 V 191.0736 h -2.00001 v 17.01283 z" + id="path52807" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccc" /> + <path + sodipodi:nodetypes="ccccc" + inkscape:connector-curvature="0" + id="path52813" + d="m 102.82786,200.58002 h 17.01283 v -2.00001 h -17.01283 z" + style="fill:#ff0000;stroke:none" /> + </g> + <path + sodipodi:nodetypes="ccccccccccccccccccc" + inkscape:connector-curvature="0" + id="use16453" + d="m 565.50059,134.36455 c -3.21171,0 -6.18403,1.71679 -7.78988,4.49822 -0.54331,0.94101 -0.88738,1.959 -1.06307,2.99881 h -4.14112 c -2.02768,-0.0286 -2.02768,3.0275 0,2.99882 h 4.14112 c 0.17569,1.03979 0.51976,2.05778 1.06307,2.99881 1.60585,2.78143 4.57817,4.49822 7.78988,4.49822 0.82807,-9e-5 1.49932,-0.67134 1.49941,-1.4994 v -1.49941 h 4.49822 c 2.02743,0.0284 2.02743,-3.02724 0,-2.99882 H 567 v -5.99762 h 4.49822 c 2.02743,0.0284 2.02743,-3.02724 0,-2.99882 H 567 v -1.49941 c -9e-5,-0.82806 -0.67134,-1.49931 -1.49941,-1.4994 z" + style="color:#000000;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:medium;line-height:normal;font-family:sans-serif;font-variant-ligatures:normal;font-variant-position:normal;font-variant-caps:normal;font-variant-numeric:normal;font-variant-alternates:normal;font-feature-settings:normal;text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;text-decoration-style:solid;text-decoration-color:#000000;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-orientation:mixed;dominant-baseline:auto;baseline-shift:baseline;text-anchor:start;white-space:normal;shape-padding:0;clip-rule:nonzero;display:inline;overflow:visible;visibility:visible;opacity:1;isolation:auto;mix-blend-mode:normal;color-interpolation:sRGB;color-interpolation-filters:linearRGB;solid-color:#000000;solid-opacity:1;vector-effect:none;fill:#008000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1.49940741;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;color-rendering:auto;image-rendering:auto;shape-rendering:auto;text-rendering:auto;enable-background:accumulate" /> + <path + style="color:#000000;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;font-size:medium;line-height:normal;font-family:sans-serif;font-variant-ligatures:normal;font-variant-position:normal;font-variant-caps:normal;font-variant-numeric:normal;font-variant-alternates:normal;font-feature-settings:normal;text-indent:0;text-align:start;text-decoration:none;text-decoration-line:none;text-decoration-style:solid;text-decoration-color:#000000;letter-spacing:normal;word-spacing:normal;text-transform:none;writing-mode:lr-tb;direction:ltr;text-orientation:mixed;dominant-baseline:auto;baseline-shift:baseline;text-anchor:start;white-space:normal;shape-padding:0;clip-rule:nonzero;display:inline;overflow:visible;visibility:visible;opacity:1;isolation:auto;mix-blend-mode:normal;color-interpolation:sRGB;color-interpolation-filters:linearRGB;solid-color:#000000;solid-opacity:1;vector-effect:none;fill:#008000;fill-opacity:1;fill-rule:nonzero;stroke:none;stroke-width:1.49940741;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:4;stroke-dasharray:none;stroke-dashoffset:0;stroke-opacity:1;color-rendering:auto;image-rendering:auto;shape-rendering:auto;text-rendering:auto;enable-background:accumulate" + d="m 625.50059,134.36455 c -3.21171,0 -6.18403,1.71679 -7.78988,4.49822 -0.54331,0.94101 -0.88738,1.959 -1.06307,2.99881 h -4.14112 c -2.02768,-0.0286 -2.02768,3.0275 0,2.99882 h 4.14112 c 0.17569,1.03979 0.51976,2.05778 1.06307,2.99881 1.60585,2.78143 4.57817,4.49822 7.78988,4.49822 0.82807,-9e-5 1.49932,-0.67134 1.49941,-1.4994 v -1.49941 h 4.49822 c 2.02743,0.0284 2.02743,-3.02724 0,-2.99882 H 627 v -5.99762 h 4.49822 c 2.02743,0.0284 2.02743,-3.02724 0,-2.99882 H 627 v -1.49941 c -9e-5,-0.82806 -0.67134,-1.49931 -1.49941,-1.4994 z" + id="path16494" + inkscape:connector-curvature="0" + sodipodi:nodetypes="ccccccccccccccccccc" /> + <path + style="opacity:1;vector-effect:none;fill:#ff1b00;fill-opacity:1;stroke:none;stroke-width:0.74999982;stroke-opacity:1;marker:none" + d="m 615.63605,136.99738 a 8.9999978,8.9999978 0 0 0 0,12.7279 8.9999978,8.9999978 0 0 0 12.7279,0 8.9999978,8.9999978 0 0 0 0,-12.7279 8.9999978,8.9999978 0 0 0 -12.7279,0 z m 1.59098,1.59098 a 6.7499981,6.7499981 0 0 1 8.68207,-0.72921 l -9.40608,9.40612 a 6.7499981,6.7499981 0 0 1 0.72401,-8.67691 z m 0.8618,10.27309 9.40609,-9.40612 a 6.7499981,6.7499981 0 0 1 -0.72195,8.67897 6.7499981,6.7499981 0 0 1 -8.68414,0.72715 z" + id="path16496" + inkscape:connector-curvature="0" /> </svg> diff -r ac0e6de439b5 -r 838242d34741 images/icoplay24.png Binary file images/icoplay24.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/icostop24.png Binary file images/icostop24.png has changed diff -r ac0e6de439b5 -r 838242d34741 images/poe.ico Binary file images/poe.ico has changed diff -r ac0e6de439b5 -r 838242d34741 images/splash.png Binary file images/splash.png has changed diff -r ac0e6de439b5 -r 838242d34741 opc_ua/client.py --- a/opc_ua/client.py Wed Mar 01 10:54:54 2023 +0100 +++ b/opc_ua/client.py Fri Mar 03 19:20:49 2023 +0100 @@ -6,7 +6,7 @@ from editors.ConfTreeNodeEditor import ConfTreeNodeEditor from PLCControler import LOCATION_CONFNODE, LOCATION_VAR_INPUT, LOCATION_VAR_OUTPUT -from .opcua_client_maker import OPCUAClientPanel, OPCUAClientModel, UA_IEC_types +from .opcua_client_maker import OPCUAClientPanel, OPCUAClientModel, UA_IEC_types, authParams import util.paths as paths @@ -22,6 +22,9 @@ ("include",), ("arch",)]] +# Tests need to use other default hosts +OPCUA_DEFAULT_HOST = os.environ.get("OPCUA_DEFAULT_HOST", "127.0.0.1") + class OPCUAClientEditor(ConfTreeNodeEditor): CONFNODEEDITOR_TABS = [ (_("OPC-UA Client"), "CreateOPCUAClient_UI")] @@ -29,18 +32,57 @@ def Log(self, msg): self.Controler.GetCTRoot().logger.write(msg) - def UriGetter(self): - return self.Controler.GetServerURI() - def CreateOPCUAClient_UI(self, parent): - return OPCUAClientPanel(parent, self.Controler.GetModelData(), self.Log, self.UriGetter) + return OPCUAClientPanel(parent, self.Controler.GetModelData(), self.Log, self.Controler.GetConfig) class OPCUAClient(object): XSD = """<?xml version="1.0" encoding="ISO-8859-1" ?> <xsd:schema xmlns:xsd="http://www.w3.org/2001/XMLSchema"> <xsd:element name="OPCUAClient"> <xsd:complexType> - <xsd:attribute name="Server_URI" type="xsd:string" use="optional" default="opc.tcp://localhost:4840"/> + <xsd:sequence> + <xsd:element name="AuthType" minOccurs="0"> + <xsd:complexType> + <xsd:choice minOccurs="0"> + <xsd:element name="x509"> + <xsd:complexType> + <xsd:sequence> + <xsd:element name="Policy"> + <xsd:annotation> + <xsd:documentation>Default to Basic256Sha256 if not specified</xsd:documentation> + </xsd:annotation> + <xsd:complexType> + <xsd:choice minOccurs="0"> + <xsd:element name="Basic256Sha256"/> + <xsd:element name="Basic128Rsa15"/> + <xsd:element name="Basic256"/> + </xsd:choice> + </xsd:complexType> + </xsd:element> + <xsd:element name="Mode"> + <xsd:complexType> + <xsd:choice minOccurs="0"> + <xsd:element name="SignAndEncrypt"/> + <xsd:element name="Sign"/> + </xsd:choice> + </xsd:complexType> + </xsd:element> + </xsd:sequence> + <xsd:attribute name="Certificate" type="xsd:string" use="optional" default="certificate.pem"/> + <xsd:attribute name="PrivateKey" type="xsd:string" use="optional" default="private_key.pem"/> + </xsd:complexType> + </xsd:element> + <xsd:element name="UserPassword"> + <xsd:complexType> + <xsd:attribute name="User" type="xsd:string" use="optional"/> + <xsd:attribute name="Password" type="xsd:string" use="optional"/> + </xsd:complexType> + </xsd:element> + </xsd:choice> + </xsd:complexType> + </xsd:element> + </xsd:sequence> + <xsd:attribute name="Server_URI" type="xsd:string" use="optional" default="opc.tcp://"""+OPCUA_DEFAULT_HOST+""":4840"/> </xsd:complexType> </xsd:element> </xsd:schema> @@ -49,7 +91,7 @@ EditorType = OPCUAClientEditor def __init__(self): - self.modeldata = OPCUAClientModel(self.Log) + self.modeldata = OPCUAClientModel(self.Log, self.CTNMarkModified) filepath = self.GetFileName() if os.path.isfile(filepath): @@ -60,9 +102,30 @@ def GetModelData(self): return self.modeldata - - def GetServerURI(self): - return self.GetParamsAttributes("OPCUAClient.Server_URI")["value"] + + def GetConfig(self): + def cfg(path): + try: + attr=self.GetParamsAttributes("OPCUAClient."+path) + except ValueError: + return None + return attr["value"] + + AuthType = cfg("AuthType") + res = dict(URI=cfg("Server_URI"), AuthType=AuthType) + + paramList = authParams.get(AuthType, None) + if paramList: + for name,default in paramList: + value = cfg("AuthType."+name) + if value == "" or value is None: + value = default + # cryptomaterial is expected to be in project's user provide file directory + if name in ["Certificate","PrivateKey"]: + value = os.path.join(self.GetCTRoot()._getProjectFilesPath(), value) + res[name] = value + + return res def GetFileName(self): return os.path.join(self.CTNPath(), 'selected.csv') @@ -76,16 +139,18 @@ locstr = "_".join(map(str, current_location)) c_path = os.path.join(buildpath, "opcua_client__%s.c" % locstr) - c_code = self.modeldata.GenerateC(c_path, locstr, - self.GetParamsAttributes("OPCUAClient.Server_URI")["value"]) + c_code = '#include "beremiz.h"\n' + c_code += self.modeldata.GenerateC(c_path, locstr, self.GetConfig()) with open(c_path, 'wb') as c_file: c_file.write(c_code) - LDFLAGS = [' "' + os.path.join(Open62541LibraryPath, "libopen62541.a") + '"'] + LDFLAGS = ['"' + os.path.join(Open62541LibraryPath, "libopen62541.a") + '"', '-lcrypto'] CFLAGS = ' '.join(['-I"' + path + '"' for path in Open62541IncludePaths]) + # Note: all user provided files are systematicaly copied, including cryptomaterial + return [(c_path, CFLAGS)], LDFLAGS, True def GetVariableLocationTree(self): diff -r ac0e6de439b5 -r 838242d34741 opc_ua/opcua_client_maker.py --- a/opc_ua/opcua_client_maker.py Wed Mar 01 10:54:54 2023 +0100 +++ b/opc_ua/opcua_client_maker.py Fri Mar 03 19:20:49 2023 +0100 @@ -7,7 +7,7 @@ from opcua import ua import wx -from wx.lib.agw.hypertreelist import HyperTreeList as TreeListCtrl +import wx.lib.gizmos as gizmos # Formerly wx.gizmos in Classic import wx.dataview as dv @@ -38,9 +38,19 @@ directions = ["input", "output"] -class OPCUASubListModel(dv.PyDataViewIndexListModel): +authParams = { + "x509":[ + ("Certificate", "certificate.der"), + ("PrivateKey", "private_key.pem"), + ("Policy", "Basic256Sha256"), + ("Mode", "SignAndEncrypt")], + "UserPassword":[ + ("User", None), + ("Password", None)]} + +class OPCUASubListModel(dv.DataViewIndexListModel): def __init__(self, data, log): - dv.PyDataViewIndexListModel.__init__(self, len(data)) + dv.DataViewIndexListModel.__init__(self, len(data)) self.data = data self.log = log @@ -140,7 +150,7 @@ self.dvc.AppendTextColumn(colname, idx, width=width, mode=dv.DATAVIEW_CELL_EDITABLE) DropTarget = NodeDropTarget(self) - self.dvc.SetDropTarget(DropTarget) + self.SetDropTarget(DropTarget) self.Sizer = wx.BoxSizer(wx.VERTICAL) @@ -230,7 +240,7 @@ class OPCUAClientPanel(wx.SplitterWindow): - def __init__(self, parent, modeldata, log, uri_getter): + def __init__(self, parent, modeldata, log, config_getter): self.log = log wx.SplitterWindow.__init__(self, parent, -1) @@ -242,7 +252,7 @@ self.inout_sizer.AddGrowableRow(1) self.client = None - self.uri_getter = uri_getter + self.config_getter = config_getter self.connect_button = wx.ToggleButton(self.inout_panel, -1, "Browse Server") @@ -278,15 +288,35 @@ def OnConnectButton(self, event): if self.connect_button.GetValue(): + config = self.config_getter() + self.client = Client(config["URI"]) + self.log("OPCUA browser: connecting to {}\n".format(config["URI"])) + + AuthType = config["AuthType"] + if AuthType=="UserPasword": + self.client.set_user(config["User"]) + self.client.set_password(config["Password"]) + elif AuthType=="x509": + self.client.set_security_string( + "{Policy},{Mode},{Certificate},{PrivateKey}".format(**config)) + + try : + self.client.connect() + except Exception as e: + self.log("OPCUA browser: "+str(e)+"\n") + self.client = None + self.connect_button.SetValue(False) + return + self.tree_panel = wx.Panel(self) self.tree_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=2, vgap=0) self.tree_sizer.AddGrowableCol(0) self.tree_sizer.AddGrowableRow(0) - self.tree = TreeListCtrl(self.tree_panel, -1, style=0, agwStyle= - wx.TR_DEFAULT_STYLE - | wx.TR_MULTIPLE - | wx.TR_FULL_ROW_HIGHLIGHT + self.tree = gizmos.TreeListCtrl(self.tree_panel, -1, style=0, agwStyle= + gizmos.TR_DEFAULT_STYLE + | gizmos.TR_MULTIPLE + | gizmos.TR_FULL_ROW_HIGHLIGHT ) prepare_image_list() @@ -298,8 +328,6 @@ self.tree.SetMainColumn(0) - self.client = Client(self.uri_getter()) - self.client.connect() self.client.load_type_definitions() # load definition of server specific structures/extension objects rootnode = self.client.get_root_node() @@ -419,9 +447,10 @@ class OPCUAClientList(list): - def __init__(self, log = lambda m:None): + def __init__(self, log, change_callback): super(OPCUAClientList, self).__init__(self) self.log = log + self.change_callback = change_callback def append(self, value): v = dict(zip(lstcolnames, value)) @@ -452,13 +481,19 @@ list.append(self, [v[n] for n in lstcolnames]) + self.change_callback() + return True + def __delitem__(self, index): + list.__delitem__(self, index) + self.change_callback() + class OPCUAClientModel(dict): - def __init__(self, log = lambda m:None): + def __init__(self, log, change_callback = lambda : None): super(OPCUAClientModel, self).__init__() for direction in directions: - self[direction] = OPCUAClientList(log) + self[direction] = OPCUAClientList(log, change_callback) def LoadCSV(self,path): with open(path, 'rb') as csvfile: @@ -468,7 +503,8 @@ self[direction][:] = [] for row in reader: direction = row[0] - self[direction].append(row[1:]) + # avoids calling change callback whe loading CSV + list.append(self[direction],row[1:]) def SaveCSV(self,path): with open(path, 'wb') as csvfile: @@ -478,85 +514,198 @@ for row in data: writer.writerow([direction] + row) - def GenerateC(self, path, locstr, server_uri): + def GenerateC(self, path, locstr, config): template = """/* code generated by beremiz OPC-UA extension */ #include <open62541/client_config_default.h> #include <open62541/client_highlevel.h> #include <open62541/plugin/log_stdout.h> +#include <open62541/plugin/securitypolicy.h> +#include <open62541/plugin/securitypolicy_default.h> + +#include <open62541/types.h> +#include <open62541/types_generated_handling.h> + +#define _Log(level, ...) \\ + {{ \\ + char mstr[256]; \\ + snprintf(mstr, 255, __VA_ARGS__); \\ + LogMessage(level, mstr, strlen(mstr)); \\ + }} + +#define LogInfo(...) _Log(LOG_INFO, __VA_ARGS__); +#define LogError(...) _Log(LOG_CRITICAL, __VA_ARGS__); +#define LogWarning(...) _Log(LOG_WARNING, __VA_ARGS__); + +static UA_INLINE UA_ByteString +loadFile(const char *const path) {{ + UA_ByteString fileContents = UA_STRING_NULL; + + FILE *fp = fopen(path, "rb"); + if(!fp) {{ + errno = 0; + LogError("OPC-UA could not open %s", path); + return fileContents; + }} + + fseek(fp, 0, SEEK_END); + fileContents.length = (size_t)ftell(fp); + fileContents.data = (UA_Byte *)UA_malloc(fileContents.length * sizeof(UA_Byte)); + if(fileContents.data) {{ + fseek(fp, 0, SEEK_SET); + size_t read = fread(fileContents.data, sizeof(UA_Byte), fileContents.length, fp); + if(read != fileContents.length){{ + UA_ByteString_clear(&fileContents); + LogError("OPC-UA could not read %s", path); + }} + }} else {{ + fileContents.length = 0; + LogError("OPC-UA Not enough memoty to load %s", path); + }} + fclose(fp); + + return fileContents; +}} static UA_Client *client; +static UA_ClientConfig *cc; #define DECL_VAR(ua_type, C_type, c_loc_name) \\ static UA_Variant c_loc_name##_variant; \\ static C_type c_loc_name##_buf = 0; \\ C_type *c_loc_name = &c_loc_name##_buf; -%(decl)s - -void __cleanup_%(locstr)s(void) -{ +{decl} + +void __cleanup_{locstr}(void) +{{ UA_Client_disconnect(client); UA_Client_delete(client); -} - +}} + +#define INIT_NoAuth() \\ + LogInfo("OPC-UA Init no auth"); \\ + UA_ClientConfig_setDefault(cc); \\ + retval = UA_Client_connect(client, uri); + +/* Note : Single policy is enforced here, by default open62541 client supports all policies */ +#define INIT_x509(Policy, UpperCaseMode, PrivateKey, Certificate) \\ + LogInfo("OPC-UA Init x509 %s,%s,%s,%s", #Policy, #UpperCaseMode, PrivateKey, Certificate); \\ + \\ + UA_ByteString certificate = loadFile(Certificate); \\ + UA_ByteString privateKey = loadFile(PrivateKey); \\ + \\ + cc->securityMode = UA_MESSAGESECURITYMODE_##UpperCaseMode; \\ + \\ + /* replacement for default behaviour */ \\ + /* UA_ClientConfig_setDefaultEncryption(cc, certificate, privateKey, NULL, 0, NULL, 0); */ \\ + do{{ \\ + retval = UA_ClientConfig_setDefault(cc); \\ + if(retval != UA_STATUSCODE_GOOD) \\ + break; \\ + \\ + UA_SecurityPolicy *sp = (UA_SecurityPolicy*) \\ + UA_realloc(cc->securityPolicies, sizeof(UA_SecurityPolicy) * 2); \\ + if(!sp){{ \\ + retval = UA_STATUSCODE_BADOUTOFMEMORY; \\ + break; \\ + }} \\ + cc->securityPolicies = sp; \\ + \\ + retval = UA_SecurityPolicy_##Policy(&cc->securityPolicies[cc->securityPoliciesSize], \\ + certificate, privateKey, &cc->logger); \\ + if(retval != UA_STATUSCODE_GOOD) {{ \\ + UA_LOG_WARNING(&cc->logger, UA_LOGCATEGORY_USERLAND, \\ + "Could not add SecurityPolicy Policy with error code %s", \\ + UA_StatusCode_name(retval)); \\ + UA_free(cc->securityPolicies); \\ + cc->securityPolicies = NULL; \\ + break; \\ + }} \\ + \\ + ++cc->securityPoliciesSize; \\ + }} while(0); \\ + \\ + retval = UA_Client_connect(client, uri); \\ + \\ + UA_ByteString_clear(&certificate); \\ + UA_ByteString_clear(&privateKey); + +#define INIT_UserPassword(User, Password) \\ + LogInfo("OPC-UA Init UserPassword %s,%s", User, Password); \\ + UA_ClientConfig_setDefault(cc); \\ + retval = UA_Client_connectUsername(client, uri, User, Password); #define INIT_READ_VARIANT(ua_type, c_loc_name) \\ UA_Variant_init(&c_loc_name##_variant); -#define INIT_WRITE_VARIANT(ua_type, ua_type_enum, c_loc_name) \\ +#define INIT_WRITE_VARIANT(ua_type, ua_type_enum, c_loc_name) \\ UA_Variant_setScalar(&c_loc_name##_variant, (ua_type*)c_loc_name, &UA_TYPES[ua_type_enum]); -int __init_%(locstr)s(int argc,char **argv) -{ +int __init_{locstr}(int argc,char **argv) +{{ UA_StatusCode retval; client = UA_Client_new(); - UA_ClientConfig_setDefault(UA_Client_getConfig(client)); -%(init)s - - /* Connect to server */ - retval = UA_Client_connect(client, "%(uri)s"); - if(retval != UA_STATUSCODE_GOOD) { + cc = UA_Client_getConfig(client); + char *uri = "{uri}"; +{init} + + if(retval != UA_STATUSCODE_GOOD) {{ + LogError("OPC-UA Init Failed %d", retval); UA_Client_delete(client); return EXIT_FAILURE; - } -} + }} + return 0; +}} #define READ_VALUE(ua_type, ua_type_enum, c_loc_name, ua_nodeid_type, ua_nsidx, ua_node_id) \\ retval = UA_Client_readValueAttribute( \\ client, ua_nodeid_type(ua_nsidx, ua_node_id), &c_loc_name##_variant); \\ if(retval == UA_STATUSCODE_GOOD && UA_Variant_isScalar(&c_loc_name##_variant) && \\ - c_loc_name##_variant.type == &UA_TYPES[ua_type_enum]) { \\ + c_loc_name##_variant.type == &UA_TYPES[ua_type_enum]) {{ \\ c_loc_name##_buf = *(ua_type*)c_loc_name##_variant.data; \\ UA_Variant_clear(&c_loc_name##_variant); /* Unalloc requiered on each read ! */ \\ - } - -void __retrieve_%(locstr)s(void) -{ + }} + +void __retrieve_{locstr}(void) +{{ UA_StatusCode retval; -%(retrieve)s -} - -#define WRITE_VALUE(ua_type, c_loc_name, ua_nodeid_type, ua_nsidx, ua_node_id) \\ +{retrieve} +}} + +#define WRITE_VALUE(ua_type, c_loc_name, ua_nodeid_type, ua_nsidx, ua_node_id) \\ UA_Client_writeValueAttribute( \\ client, ua_nodeid_type(ua_nsidx, ua_node_id), &c_loc_name##_variant); -void __publish_%(locstr)s(void) -{ -%(publish)s -} +void __publish_{locstr}(void) +{{ +{publish} +}} """ formatdict = dict( locstr = locstr, - uri = server_uri, + uri = config["URI"], decl = "", cleanup = "", init = "", retrieve = "", publish = "" ) + + AuthType = config["AuthType"] + if AuthType == "x509": + config["UpperCaseMode"] = config["Mode"].upper() + formatdict["init"] += """ + INIT_x509({Policy}, {UpperCaseMode}, "{PrivateKey}", "{Certificate}")""".format(**config) + elif AuthType == "UserPassword": + formatdict["init"] += """ + INIT_UserPassword("{User}", "{Password}")""".format(**config) + else: + formatdict["init"] += """ + INIT_NoAuth()""" + for direction, data in self.iteritems(): iec_direction_prefix = {"input": "__I", "output": "__Q"}[direction] for row in data: @@ -570,18 +719,18 @@ DECL_VAR({ua_type}, {C_type}, {c_loc_name})""".format(**locals()) if direction == "input": - formatdict["init"] +=""" + formatdict["init"] += """ INIT_READ_VARIANT({ua_type}, {c_loc_name})""".format(**locals()) formatdict["retrieve"] += """ READ_VALUE({ua_type}, {ua_type_enum}, {c_loc_name}, {ua_nodeid_type}, {ua_nsidx}, {ua_node_id})""".format(**locals()) if direction == "output": - formatdict["init"] +=""" + formatdict["init"] += """ INIT_WRITE_VARIANT({ua_type}, {ua_type_enum}, {c_loc_name})""".format(**locals()) formatdict["publish"] += """ WRITE_VALUE({ua_type}, {c_loc_name}, {ua_nodeid_type}, {ua_nsidx}, {ua_node_id})""".format(**locals()) - Ccode = template%formatdict + Ccode = template.format(**formatdict) return Ccode @@ -594,7 +743,20 @@ frame = wx.Frame(None, -1, "OPCUA Client Test App", size=(800,600)) - uri = sys.argv[1] if len(sys.argv)>1 else "opc.tcp://localhost:4840" + argc = len(sys.argv) + + config={} + config["URI"] = sys.argv[1] if argc>1 else "opc.tcp://localhost:4840" + + if argc > 2: + AuthType = sys.argv[2] + config["AuthType"] = AuthType + for (name, default), value in izip_longest(authParams[AuthType], sys.argv[3:]): + if value is None: + if default is None: + raise Exception(name+" param expected") + value = default + config[name] = value test_panel = wx.Panel(frame) test_sizer = wx.FlexGridSizer(cols=1, hgap=0, rows=2, vgap=0) @@ -603,7 +765,7 @@ modeldata = OPCUAClientModel(print) - opcuatestpanel = OPCUAClientPanel(test_panel, modeldata, print, lambda:uri) + opcuatestpanel = OPCUAClientPanel(test_panel, modeldata, print, lambda:config) def OnGenerate(evt): dlg = wx.FileDialog( @@ -624,7 +786,11 @@ -I ../../open62541/arch/ ../../open62541/build/bin/libopen62541.a */ -"""%(path, path[:-2]) + modeldata.GenerateC(path, "test", uri) + """ +"""%(path, path[:-2]) + modeldata.GenerateC(path, "test", config) + """ + +int LogMessage(uint8_t level, char* buf, uint32_t size){ + printf("log level:%d message:'%.*s'\\n", level, size, buf); +}; int main(int argc, char *argv[]) { diff -r ac0e6de439b5 -r 838242d34741 runtime/PLCObject.py --- a/runtime/PLCObject.py Wed Mar 01 10:54:54 2023 +0100 +++ b/runtime/PLCObject.py Fri Mar 03 19:20:49 2023 +0100 @@ -623,7 +623,7 @@ def RepairPLC(self): self.PurgePLC() - MainWorker.quit() + MainWorker.finish() @RunInMain def PurgePLC(self): diff -r ac0e6de439b5 -r 838242d34741 runtime/Worker.py --- a/runtime/Worker.py Wed Mar 01 10:54:54 2023 +0100 +++ b/runtime/Worker.py Fri Mar 03 19:20:49 2023 +0100 @@ -9,7 +9,8 @@ from __future__ import absolute_import import sys -from threading import Lock, Condition +from threading import Lock, Condition, Thread + import six from six.moves import _thread @@ -51,6 +52,8 @@ self.free = Condition(self.mutex) self.job = None self.enabled = False + self.stopper = None + self.own_thread = None def reraise(self, job): """ @@ -86,6 +89,61 @@ self.mutex.release() + def interleave(self, waker, stopper, *args, **kwargs): + """ + as for twisted reactor's interleave, it passes all jobs to waker func + additionaly, it creates a new thread to wait for new job. + """ + self.feed = Condition(self.mutex) + self._threadID = _thread.get_ident() + self.stopper = stopper + + def wakerfeedingloop(): + self.mutex.acquire() + self.enabled = True + if args or kwargs: + def first_job_todo(): + _job = job(*args, **kwargs) + _job.do() + if not _job.success: + self.reraise(_job) + self.mutex.acquire() + self.feed.notify() + self.mutex.release() + waker(first_job_todo) + self.feed.wait() + + while not self._finish: + self.todo.wait() + def job_todo(): + self.mutex.acquire() + if self.job is not None: + self.job.do() + self.feed.notify() + self.done.notify() + self.mutex.release() + if self._finish: + break + waker(job_todo) + self.feed.wait() + + self.mutex.release() + self.own_thread = Thread(target = wakerfeedingloop) + self.own_thread.start() + + def stop(self): + """ + !interleave + """ + self.mutex.acquire() + self._finish = True + self.enabled = False + self.job = None + self.todo.notify() + self.done.notify() + self.mutex.release() + self.own_thread.join() + def call(self, *args, **kwargs): """ creates a job, execute it in worker thread, and deliver result. @@ -136,3 +194,9 @@ self.todo.notify() self.done.notify() self.mutex.release() + + def finish(self): + if self.own_thread is None: + self.quit() + if self.stopper is not None: + self.stopper() diff -r ac0e6de439b5 -r 838242d34741 svghmi/i18n.py --- a/svghmi/i18n.py Wed Mar 01 10:54:54 2023 +0100 +++ b/svghmi/i18n.py Fri Mar 03 19:20:49 2023 +0100 @@ -20,6 +20,7 @@ # https://pypi.org/project/pycountry/18.12.8/ # python2 -m pip install pycountry==18.12.8 --user import pycountry +from dialogs import MessageBoxOnce cmd_parser = re.compile(r'(?:"([^"]+)"\s*|([^\s]+)\s*)?') @@ -39,10 +40,21 @@ poedit_path = None else: - try: - poedit_path = subprocess.check_output("command -v poedit", shell=True).strip() - except subprocess.CalledProcessError: - poedit_path = None + if os.environ.has_key("SNAP"): + MessageBoxOnce("Launching POEdit with xdg-open", + "Confined app can't launch POEdit directly.\n"+ + "Instead, PO/POT file is passed to xdg-open.\n"+ + "Please select POEdit when proposed.\n\n"+ + "Notes: \n"+ + " - POEdit must be installed on you system.\n"+ + " - If no choice is proposed, use file manager to change POT/PO file properties.\n", + "SVGHMII18SnapWarning") + poedit_path = "xdg-open" + else: + try: + poedit_path = subprocess.check_output("command -v poedit", shell=True).strip() + except subprocess.CalledProcessError: + poedit_path = None if poedit_path is None: wx.MessageBox("POEdit is not found or installed !") diff -r ac0e6de439b5 -r 838242d34741 svghmi/svghmi.py --- a/svghmi/svghmi.py Wed Mar 01 10:54:54 2023 +0100 +++ b/svghmi/svghmi.py Fri Mar 03 19:20:49 2023 +0100 @@ -8,6 +8,7 @@ from __future__ import absolute_import import os +import sys import shutil import hashlib import shlex @@ -302,10 +303,14 @@ return ret -if wx.Platform == '__WXMSW__': +if sys.platform.startswith('win'): default_cmds={ "launch":"cmd.exe /c 'start msedge {url}'", "watchdog":"cmd.exe /k 'echo watchdog for {url} !'"} +elif os.environ.has_key("SNAP"): + default_cmds={ + "launch":"xdg-open {url}", + "watchdog":"echo Watchdog for {name} !"} else: default_cmds={ "launch":"chromium {url}", @@ -736,7 +741,7 @@ return res def _ImportSVG(self): - dialog = wx.FileDialog(self.GetCTRoot().AppFrame, _("Choose a SVG file"), os.getcwd(), "", _("SVG files (*.svg)|*.svg|All files|*.*"), wx.OPEN) + dialog = wx.FileDialog(self.GetCTRoot().AppFrame, _("Choose a SVG file"), os.getcwd(), "", _("SVG files (*.svg)|*.svg|All files|*.*"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: svgpath = dialog.GetPath() if os.path.isfile(svgpath): @@ -780,7 +785,7 @@ def _EditPO(self): """ Select a specific translation and edit it with POEdit """ project_path = self.CTNPath() - dialog = wx.FileDialog(self.GetCTRoot().AppFrame, _("Choose a PO file"), project_path, "", _("PO files (*.po)|*.po"), wx.OPEN) + dialog = wx.FileDialog(self.GetCTRoot().AppFrame, _("Choose a PO file"), project_path, "", _("PO files (*.po)|*.po"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: POFile = dialog.GetPath() if os.path.isfile(POFile): @@ -806,7 +811,7 @@ _("Choose a font"), os.path.expanduser("~"), "", - _("Font files (*.ttf;*.otf;*.woff;*.woff2)|*.ttf;*.otf;*.woff;*.woff2"), wx.OPEN) + _("Font files (*.ttf;*.otf;*.woff;*.woff2)|*.ttf;*.otf;*.woff;*.woff2"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: fontfile = dialog.GetPath() @@ -843,7 +848,7 @@ _("Choose a font to remove"), fontdir, "", - _("Font files (*.ttf;*.otf;*.woff;*.woff2)|*.ttf;*.otf;*.woff;*.woff2"), wx.OPEN) + _("Font files (*.ttf;*.otf;*.woff;*.woff2)|*.ttf;*.otf;*.woff;*.woff2"), wx.FD_OPEN) if dialog.ShowModal() == wx.ID_OK: fontfile = dialog.GetPath() if os.path.isfile(fontfile): diff -r ac0e6de439b5 -r 838242d34741 svghmi/ui.py --- a/svghmi/ui.py Wed Mar 01 10:54:54 2023 +0100 +++ b/svghmi/ui.py Fri Mar 03 19:20:49 2023 +0100 @@ -31,6 +31,19 @@ from util.ProcessLogger import ProcessLogger +# When running as a confined Snap, /tmp isn't accessible from the outside +# and Widget DnD to Inkscape can't work, since it can't find generated svg +# This forces tmp directory in $SNAP_USER_DATA, accessible from other apps +if os.environ.has_key("SNAP"): + NamedTemporaryFile_orig = NamedTemporaryFile + tmpdir = os.path.join(os.environ["SNAP_USER_DATA"], ".tmp") + if not os.path.exists(tmpdir): + os.mkdir(tmpdir) + def NamedTemporaryFile(*args,**kwargs): + kwargs["dir"] = tmpdir + return NamedTemporaryFile_orig(*args, **kwargs) + + ScriptDirectory = paths.AbsDir(__file__) HMITreeDndMagicWord = "text/beremiz-hmitree" @@ -58,13 +71,13 @@ display_name = ('{} (class={})'.format(c.name, c.hmiclass)) \ if c.hmiclass is not None else c.name tc_child = self.AppendItem(current_tc_root, display_name) - self.SetPyData(tc_child, c) + self.SetItemData(tc_child, c) self._recurseTree(c,tc_child) else: display_name = '{} {}'.format(c.nodetype[4:], c.name) tc_child = self.AppendItem(current_tc_root, display_name) - self.SetPyData(tc_child, c) + self.SetItemData(tc_child, c) def OnTreeNodeSelection(self, event): items = self.GetSelections() @@ -106,7 +119,7 @@ root_display_name = _("Please build to see HMI Tree") \ if hmi_tree_root is None else "HMI" self.root = self.AddRoot(root_display_name) - self.SetPyData(self.root, hmi_tree_root) + self.SetItemData(self.root, hmi_tree_root) if hmi_tree_root is not None: self._recurseTree(hmi_tree_root, self.root) @@ -146,11 +159,11 @@ for d in dirlist: current_tc_root = self.AppendItem(current_tc_root, d) res.append(current_tc_root) - self.SetPyData(current_tc_root, None) + self.SetItemData(current_tc_root, None) dirlist = [] res.pop() tc_child = self.AppendItem(current_tc_root, f) - self.SetPyData(tc_child, p) + self.SetItemData(tc_child, p) return res def MakeTree(self, lib_dir = None): @@ -163,7 +176,7 @@ root_display_name = _("Please select widget library directory") \ if lib_dir is None else os.path.basename(lib_dir) self.root = self.AddRoot(root_display_name) - self.SetPyData(self.root, None) + self.SetItemData(self.root, None) if lib_dir is not None and os.path.exists(lib_dir): self._recurseTree(lib_dir, self.root, []) @@ -464,7 +477,8 @@ # TODO: spawn a thread, to decouple thumbnail gen status, result, _err_result = ProcessLogger( - self.Controler.GetCTRoot().logger, + #self.Controler.GetCTRoot().logger, + None, '"' + inkpath + '" "' + svgpath + '" ' + export_opt + ' "' + thumbpath + '" -D -h ' + str(_preview_height)).spin() diff -r ac0e6de439b5 -r 838242d34741 targets/XSD_toolchain_makefile --- a/targets/XSD_toolchain_makefile Wed Mar 01 10:54:54 2023 +0100 +++ b/targets/XSD_toolchain_makefile Fri Mar 03 19:20:49 2023 +0100 @@ -1,3 +1,3 @@ - <xsd:attribute name="Command" type="xsd:string" use="optional" default="make -C %(buildpath)s all BEREMIZSRC=%(src)s BEREMIZCFLAGS=%(cflags)s MD5=%(md5)s USE_BEREMIZ=1 FROM_BEREMIZ=1"/> + <xsd:attribute name="Command" type="xsd:string" use="optional" default="make -C %(buildpath)s -f ../project_files/Makefile all BEREMIZSRC=%(src)s BEREMIZCFLAGS=%(cflags)s MD5=%(md5)s USE_BEREMIZ=1 FROM_BEREMIZ=1"/> diff -r ac0e6de439b5 -r 838242d34741 targets/toolchain_gcc.py --- a/targets/toolchain_gcc.py Wed Mar 01 10:54:54 2023 +0100 +++ b/targets/toolchain_gcc.py Fri Mar 03 19:20:49 2023 +0100 @@ -51,14 +51,24 @@ """ Returns list of builder specific CFLAGS """ - return [self.CTRInstance.GetTarget().getcontent().getCFLAGS()] + cflags = [self.CTRInstance.GetTarget().getcontent().getCFLAGS()] + if os.environ.has_key("CFLAGS"): + cflags.append(os.environ["CFLAGS"]) + if os.environ.has_key("SYSROOT"): + cflags.append("--sysroot="+os.environ["SYSROOT"]) + return cflags def getBuilderLDFLAGS(self): """ Returns list of builder specific LDFLAGS """ - return self.CTRInstance.LDFLAGS + \ + ldflags = self.CTRInstance.LDFLAGS + \ [self.CTRInstance.GetTarget().getcontent().getLDFLAGS()] + if os.environ.has_key("LDFLAGS"): + ldflags.append(os.environ["LDFLAGS"]) + if os.environ.has_key("SYSROOT"): + ldflags.append("--sysroot="+os.environ["SYSROOT"]) + return ldflags def getCompiler(self): """ diff -r ac0e6de439b5 -r 838242d34741 tests/Makefile --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/Makefile Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,229 @@ +#! gmake + +# beremiz/tests/Makefile : +# +# Makefile to prepare and run Beremiz tests. +# +# For developper to: +# - quickly run a test (TDD) on current code +# - write new tests, debug existing tests +# +# Use cases : +# +# run given tests +# $ make run_python_exemple.sikuli +# +# run tests from particular test classes +# $ make ide_tests +# +# run one particular test in a Xnest window +# $ make xnest_run_python_exemple.sikuli +# +# run Xnest window with just xterm +# $ make xnest_xterm +# +# run Xnest window with sikuli IDE and xterm +# $ make xnest_sikuli +# +# build minimal beremiz and matiec to run tests +# $ make built_apps +# +# For CI/CD scripts to catch and report all failures. Use cases : +# +# run all tests +# $ make +# +# +# Test results, and other test byproducts are in $(test_dir), +# $(test_dir) defaults to $(HOME)/test and can be overloaded: +# $ make test_dir=${HOME}/other_test_dir +# +# Makefile attemps to use xvfb-run to run each test individually with its own +# X server instance. This behavior can be overloaded +# $ DISPLAY=:42 make xserver_command='echo "Using $DISPLAY X Server !";' +# +# Matiec and Beremiz code are expected to be clean, ready to build +# Any change in Matiec directory triggers rebuild of matiec. +# Any change in Matiec and Beremiz directory triggers copy of source code +# to $(test_dir)/build. +# +# BEREMIZPYTHONPATH is expected to be absolute path to python interpreter +# +# Please note: +# In order to run asside a freshly build Matiec, tested beremiz instance +# needs to run on code from $(test_dir)/build/beremiz, a fresh copy +# of the Beremiz directory $(src)/beremiz, where we run tests from. +# + +all: source_check cli_tests ide_tests runtime_tests + +# Variable $(src) is directory such that executed +# $(src)/Makefile is this file. +src := $(abspath $(dir $(lastword $(MAKEFILE_LIST)))) + +# $(workspace) is directory containing this project +workspace ?= $(abspath $(src)/../..) + +test_dir ?= $(HOME)/test +build_dir = $(test_dir)/build + +# +# SOURCE and BUILD +# + +BUILT_PROJECTS=beremiz matiec open62541 + +tar_opts=--absolute-names --exclude=.hg --exclude=.git --exclude=.*.pyc --exclude=.*.swp + +# sha1 checksum of source is used to force copy/compile on each change + +define make_checksum_assign +$(1)_checksum = $(shell tar $(tar_opts) -c $(workspace)/$(1) | sha1sum | cut -d ' ' -f 1) +endef +$(foreach project,$(BUILT_PROJECTS),$(eval $(call make_checksum_assign,$(project)))) + +$(build_dir): + mkdir -p $(build_dir) + +define make_src_rule +$(build_dir)/$(1)/$($(1)_checksum).sha1: | $(build_dir) $(workspace)/$(1) + rm -rf $(build_dir)/$(1) + tar -C $(workspace) $(tar_opts) -c $(1) | tar -C $(build_dir) -x + touch $$@ +endef +$(foreach project,$(BUILT_PROJECTS),$(eval $(call make_src_rule,$(project)))) + +$(build_dir)/matiec/iec2c: $(build_dir)/matiec/$(matiec_checksum).sha1 + cd $(build_dir)/matiec && \ + autoreconf -i && \ + ./configure && \ + make + +$(build_dir)/open62541/build/bin/libopen62541.a: $(build_dir)/open62541/$(open62541_checksum).sha1 + cd $(build_dir)/open62541 && \ + rm -rf build && mkdir build && cd build && \ + cmake -D UA_ENABLE_ENCRYPTION=OPENSSL .. && \ + make + +built_apps: $(build_dir)/matiec/iec2c $(build_dir)/beremiz/$(beremiz_checksum).sha1 $(build_dir)/open62541/build/bin/libopen62541.a + touch $@ + +define log_command + $(call $(1),$(2)) | tee test_stdout.txt; exit $$$${PIPESTATUS[0]} +endef + +define prep_test + rm -rf $(test_dir)/$(1)_results + mkdir $(test_dir)/$(1)_results + cd $(test_dir)/$(1)_results +endef + +# +# IDE TESTS +# + +ide_test_dir = $(src)/ide_tests +sikuli_ide_tests = $(subst $(ide_test_dir)/,,$(wildcard $(ide_test_dir)/*.sikuli)) +pytest_ide_tests = $(subst $(ide_test_dir)/,,$(wildcard $(ide_test_dir)/*.pytest)) + +fluxbox_command ?= echo "session.screen0.toolbar.placement: TopCenter" > fluxbox_init; (fluxbox -rc fluxbox_init >/dev/null 2>&1 &) + +define sikuli_idetest_command + $(fluxbox_command); BEREMIZPATH=$(build_dir)/beremiz sikulix -r $(src)/ide_tests/$(1) +endef + + +DELAY=400 +KILL_DELAY=430 +PYTEST=$(dir $(BEREMIZPYTHONPATH))/pytest +define pytest_idetest_command + $(fluxbox_command); PYTHONPATH=$(ide_test_dir) timeout -k $(KILL_DELAY) $(DELAY) $(PYTEST) --maxfail=1 --timeout=100 $(src)/ide_tests/$(1) +endef + +# Xnest based interactive sessions for tests edit and debug. +# Would be nice with something equivalent to xvfb-run, waiting for USR1. +# Arbitrary "sleep 1" is probably enough for interactive use +define xnest_run + Xnest :42 -geometry 1920x1080+0+0 & export xnestpid=$$!; sleep 1; DISPLAY=:42 $(1); export res=$$?; kill $${xnestpid} 2>/dev/null; exit $${res} +endef + +xserver_command ?= xvfb-run -s '-screen 0 1920x1080x24' + +define make_idetest_rule +$(test_dir)/$(1)_results/.passed: built_apps + $(call prep_test,$(1)); $(xserver_command) bash -c '$(call log_command,$(2),$(1))' + touch $$@ + +# Manually invoked rule {testname}.sikuli +$(1): $(test_dir)/$(1)_results/.passed + +# Manually invoked rule xnest_{testname}.sikuli +# runs test in xnest so that one can see what happens +xnest_$(1): built_apps + $(call prep_test,$(1)); $$(call xnest_run, bash -c '$(call log_command,$(2),$(1))') + +ide_tests_targets += $(test_dir)/$(1)_results/.passed +endef +$(foreach idetest,$(sikuli_ide_tests),$(eval $(call make_idetest_rule,$(idetest),sikuli_idetest_command))) +$(foreach idetest,$(pytest_ide_tests),$(eval $(call make_idetest_rule,$(idetest),pytest_idetest_command))) + +ide_tests : $(ide_tests_targets) + echo "$(ide_tests_targets) : Passed" + +xnest_xterm: built_apps + $(call xnest_run, bash -c '$(fluxbox_command);xterm') + +xnest_sikuli: built_apps + $(call xnest_run, bash -c '$(fluxbox_command);(BEREMIZPATH=$(build_dir)/beremiz xterm -e sikulix &);xterm') + +xvfb_sikuli: built_apps + echo "******************************************" + echo "On host, run 'xvncviewer 127.0.0.1:5900' to see sikuli X session" + echo "Docker container must be created with TESTDEBUG=YES. For example :" + echo "./clean_docker_container.sh && ./build_docker_image.sh && TESTDEBUG=YES ./create_docker_container.sh && ./do_test_in_docker.sh xvfb_sikuli" + echo "******************************************" + $(xserver_command) bash -c '(fluxbox &);(x11vnc &);(BEREMIZPATH=$(build_dir)/beremiz xterm -e sikulix &);xterm' + +# +# CLI TESTS +# + +cli_test_dir = $(src)/cli_tests +cli_tests = $(subst $(cli_test_dir)/,,$(wildcard $(cli_test_dir)/*.bash)) + +define clitest_command + BEREMIZPATH=$(build_dir)/beremiz source $(src)/cli_tests/$(1) +endef + +define make_clitest_rule +$(test_dir)/$(1)_results/.passed: built_apps + $(call prep_test,$(1)); bash -c '$(call log_command,$(2),$(1))' + touch $$@ + +# Manually invoked rule +$(1): $(test_dir)/$(1)_results/.passed + +cli_tests_targets += $(test_dir)/$(1)_results/.passed +endef +$(foreach clitest,$(cli_tests),$(eval $(call make_clitest_rule,$(clitest),clitest_command))) + +cli_tests: $(cli_tests_targets) + echo "$(cli_tests_targets) : Passed" + +clean_results: + rm -rf $(test_dir)/*_results + +clean: clean_results + rm -rf $(build_dir) + + +# TODOs + +source_check: + echo TODO $@ + +runtime_tests: + echo TODO $@ + + + diff -r ac0e6de439b5 -r 838242d34741 tests/cli_tests/opcua_test.bash --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/cli_tests/opcua_test.bash Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,87 @@ +#!/bin/bash + +rm -f ./SRVOK ./PLCOK + +# Run server +$BEREMIZPYTHONPATH - > >( + echo "Start SRV loop" + while read line; do + # Wait for server to print modified value + echo "SRV>> $line" + if [[ "$line" == 3.4 ]]; then + echo "PLC could write value" + touch ./SRVOK + fi + done + echo "End SRV loop" +) << EOF & + +import sys +import os +import time + +from opcua import ua, Server + +server = Server() +host = os.environ.get("OPCUA_DEFAULT_HOST", "127.0.0.1") +endpoint = "opc.tcp://"+host+":4840/freeopcua/server/" +server.set_endpoint(endpoint) + +uri = "http://beremiz.github.io" +idx = server.register_namespace(uri) + +objects = server.get_objects_node() + +testobj = objects.add_object(idx, "TestObject") +testvarout = testobj.add_variable(idx, "TestOut", 1.2) +testvar = testobj.add_variable(idx, "TestIn", 5.6) +testvar.set_writable() + +server.start() + +try: + while True: + time.sleep(1) + print testvar.get_value() + sys.stdout.flush() +finally: + server.stop() +EOF +SERVER_PID=$! + +# Start PLC with opcua test +setsid $BEREMIZPYTHONPATH $BEREMIZPATH/Beremiz_cli.py -k \ + --project-home $BEREMIZPATH/tests/projects/opcua_client build transfer run > >( +echo "Start PLC loop" +while read line; do + # Wait for PLC runtime to output expected value on stdout + echo "PLC>> $line" + if [[ "$line" == 1.2 ]]; then + echo "PLC could read value" + touch ./PLCOK + fi +done +echo "End PLC loop" +) & +PLC_PID=$! + +echo all subprocess started, start polling results +res=110 # default to ETIMEDOUT +c=30 +while ((c--)); do + if [[ -a ./SRVOK && -a ./PLCOK ]]; then + echo got results. + res=0 # OK success + break + else + echo waiting.... $c + sleep 1 + fi +done + +# Kill PLC and subprocess +echo will kill PLC:$PLC_PID and SERVER:$SERVER_PID +pkill -s $PLC_PID +kill $SERVER_PID + +exit $res diff -r ac0e6de439b5 -r 838242d34741 tests/cli_tests/opcua_test_encrypted.bash --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/cli_tests/opcua_test_encrypted.bash Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,100 @@ +#!/bin/bash + +rm -f ./SRVOK ./PLCOK + + +yes "" | openssl req -x509 -newkey rsa:2048 -keyout my_private_key.pem -out my_cert.pem \ + -days 355 -nodes -addext "subjectAltName = URI:urn:example.org:FreeOpcUa:python-opcua" +openssl x509 -outform der -in my_cert.pem -out my_cert.der + +# Run server +$BEREMIZPYTHONPATH - > >( + echo "Start SRV loop" + while read line; do + # Wait for server to print modified value + echo "SRV>> $line" + if [[ "$line" == 3.4 ]]; then + echo "PLC could write value" + touch ./SRVOK + fi + done + echo "End SRV loop" +) << EOF & + +import sys +import os +import time + +from opcua import ua, Server + +server = Server() +host = os.environ.get("OPCUA_DEFAULT_HOST", "127.0.0.1") +endpoint = "opc.tcp://"+host+":4840/freeopcua/server/" +server.set_endpoint(endpoint) + +server.set_security_policy([ua.SecurityPolicyType.Basic256Sha256_SignAndEncrypt]) +server.load_certificate("my_cert.der") +server.load_private_key("my_private_key.pem") + +uri = "http://beremiz.github.io" +idx = server.register_namespace(uri) + +objects = server.get_objects_node() + +testobj = objects.add_object(idx, "TestObject") +testvarout = testobj.add_variable(idx, "TestOut", 1.2) +testvar = testobj.add_variable(idx, "TestIn", 5.6) +testvar.set_writable() + +server.start() + +try: + while True: + time.sleep(1) + print testvar.get_value() + sys.stdout.flush() +finally: + server.stop() +EOF +SERVER_PID=$! + +PROJECT_FILES_DIR=$BEREMIZPATH/tests/projects/opcua_client_encrypted/project_files +mkdir $PROJECT_FILES_DIR +cp my_cert.der my_private_key.pem $PROJECT_FILES_DIR + +# Start PLC with opcua test +setsid $BEREMIZPYTHONPATH $BEREMIZPATH/Beremiz_cli.py -k \ + --project-home $BEREMIZPATH/tests/projects/opcua_client_encrypted build transfer run > >( +echo "Start PLC loop" +while read line; do + # Wait for PLC runtime to output expected value on stdout + echo "PLC>> $line" + if [[ "$line" == 1.2 ]]; then + echo "PLC could read value" + touch ./PLCOK + fi +done +echo "End PLC loop" +) & +PLC_PID=$! + +echo all subprocess started, start polling results +res=110 # default to ETIMEDOUT +c=45 +while ((c--)); do + if [[ -a ./SRVOK && -a ./PLCOK ]]; then + echo got results. + res=0 # OK success + break + else + echo waiting.... $c + sleep 1 + fi +done + +# Kill PLC and subprocess +echo will kill PLC:$PLC_PID and SERVER:$SERVER_PID +pkill -s $PLC_PID +kill $SERVER_PID + +exit $res diff -r ac0e6de439b5 -r 838242d34741 tests/cli_tests/run_python_example.bash --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/cli_tests/run_python_example.bash Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,15 @@ +#!/bin/bash + +# Run python example throug command line, and check usual output + +coproc setsid $BEREMIZPYTHONPATH $BEREMIZPATH/Beremiz_cli.py -k --project-home $BEREMIZPATH/exemples/python build transfer run; + +while read -u ${COPROC[0]} line; do + echo "$line" + if [[ "$line" == *Grumpf* ]]; then + pkill -9 -s $COPROC_PID + exit 0 + fi +done + +exit 42 diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/conftest.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/conftest.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,78 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +# This file is part of Beremiz, a Integrated Development Environment for +# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. +# +# Copyright (C) 2017: Andrey Skvortsov +# +# See COPYING file for copyrights details. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License +# as published by the Free Software Foundation; either version 2 +# of the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. + + +from __future__ import absolute_import +import os +import sys + +# import pytest +# import xvfbwrapper + + +def init_environment(): + """Append module root directory to sys.path""" + try: + import Beremiz as _Beremiz + except ImportError: + sys.path.append( + os.path.abspath( + os.path.join( + os.path.dirname(__file__), '..', '..') + ) + ) + + +init_environment() + +# +# Something seems to be broken in Beremiz application, +# because after tests in test_application.py during Xvfb shutdown +# pytest returns error message: +# pytest: Fatal IO error 11 (Die Ressource ist zur Zeit nicht verfügbar) on X server :2821. +# +# As a result of that pytest returns code 1 as some tests were failed, +# but they aren't. +# +# To avoid this Xvfb is launched and killed not by pytest. +# $ Xvfb :42 -screen 0 1280x1024x24 & +# $ export DISPLAY=:42 +# $ pytest --timeout=10 ./tests/tools +# $ pkill -9 Xvfb +# +# TODO: find root of this problem. + + +# vdisplay = None +# +# @pytest.fixture(scope="session", autouse=True) +# def start_xvfb_server(request): +# global vdisplay +# vdisplay = xvfbwrapper.Xvfb(width=1280, height=720) +# vdisplay.start() +# request.addfinalizer(stop_xvfb_server) +# +# def stop_xvfb_server(): +# if vdisplay is not None: +# vdisplay.stop() diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/debug_project.sikuli/1646066996789.png Binary file tests/ide_tests/debug_project.sikuli/1646066996789.png has changed diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/debug_project.sikuli/1646066996790.png Binary file tests/ide_tests/debug_project.sikuli/1646066996790.png has changed diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/debug_project.sikuli/debug_project.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/debug_project.sikuli/debug_project.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,79 @@ +""" This test opens, modifies, builds and runs exemple project named "python". +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import run_test + +def test(app): + + app.k.Clean() + + app.waitForChangeAndIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitForChangeAndIdleStdout() + + app.k.Transfer() + + app.waitForChangeAndIdleStdout() + + app.click("main") + + app.WaitIdleUI() + + app.click("1646066996789.png") + + app.WaitIdleUI() + + app.click("example") + + app.WaitIdleUI() + + app.type(Key.DOWN * 10, Key.CTRL) + + app.WaitIdleUI() + + app.k.Run() + + # wait up to 10 seconds for 10 Grumpfs + app.waitPatternInStdout("Grumpf", 10, 10) + + app.rightClick("1646066996790.png") + + # app.click("Force value") + + app.type(Key.DOWN) + + app.type(Key.ENTER) + + # app.click("1646062660790.png") + + # app.type("a", Key.CTRL) + + # app.type(Key.BACKSPACE) + app.type(Key.HOME) + + app.type("a", Key.CTRL) + + app.type(Key.DELETE) + + app.type("'sys.stdout.write(\"DEBUG TEST OK\\n\")'") + + app.type(Key.ENTER) + + # wait 10 seconds for 10 patterns + return app.waitPatternInStdout("DEBUG TEST OK", 10) + +run_test(test, exemple="python") diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/edit_project.sikuli/edit_project.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/edit_project.sikuli/edit_project.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,61 @@ +""" This test opens, modifies, builds and runs exemple project named "python". +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import run_test + +def test(app): + + app.doubleClick("main") + + app.WaitIdleUI() + + app.click("example") + + app.WaitIdleUI() + + app.type(Key.DOWN * 10, Key.CTRL) + + app.WaitIdleUI() + + app.doubleClick("Hello") + + app.WaitIdleUI() + + app.type(Key.TAB*3) # select text content + + app.type("'sys.stdout.write(\"EDIT TEST OK\\n\")'") + + app.type(Key.ENTER) + + app.WaitIdleUI() + + app.k.Clean() + + app.waitForChangeAndIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitForChangeAndIdleStdout() + + app.k.Transfer() + + app.waitForChangeAndIdleStdout() + + app.k.Run() + + # wait 10 seconds for 10 patterns + return app.waitPatternInStdout("EDIT TEST OK", 10) + +run_test(test, exemple="python") diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/load_and_build_tests.pytest/test_application.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/load_and_build_tests.pytest/test_application.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,232 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +# This file is part of Beremiz, a Integrated Development Environment for +# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. +# +# Copyright (C) 2017: Andrey Skvortsov +# +# See COPYING file for copyrights details. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License +# as published by the Free Software Foundation; either version 2 +# of the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. + + +from __future__ import absolute_import +from __future__ import print_function +import os +import sys +import unittest +import time + +import six +import pytest +import wx +import ddt + +import conftest +import Beremiz +# import PLCOpenEditor + + +class UserApplicationTest(unittest.TestCase): + def InstallExceptionHandler(self): + def handle_exception(e_type, e_value, e_traceback, exit=False): + # traceback.print_exception(e_type, e_value, e_traceback) + self.exc_info = [e_type, e_value, e_traceback] + self.exc_info = None + self.old_excepthook = sys.excepthook + sys.excepthook = handle_exception + + def StartApp(self): + self.app = None + + def FinishApp(self): + wx.CallAfter(self.app.frame.Close) + self.app.MainLoop() + self.app = None + + def setUp(self): + self.app = None + + def tearDown(self): + if self.app is not None and self.app.frame is not None: + self.FinishApp() + + def RunUIActions(self, actions): + for act in actions: + wx.CallAfter(*act) + self.ProcessEvents() + + def CheckForErrors(self): + if self.exc_info is not None: + # reraise catched previously exception + exc_type = self.exc_info[0] + exc_value = self.exc_info[1] + exc_traceback = self.exc_info[2] + six.reraise(exc_type, exc_value, exc_traceback) + + def ProcessEvents(self): + for dummy in range(0, 30): + self.CheckForErrors() + wx.Yield() + time.sleep(0.01) + + +@ddt.ddt +class BeremizApplicationTest(UserApplicationTest): + """Test Beremiz as whole application""" + + def StartApp(self): + self.app = Beremiz.BeremizIDELauncher() + # disable default exception handler in Beremiz + self.app.InstallExceptionHandler = lambda: None + self.InstallExceptionHandler() + self.app.handle_exception = sys.excepthook + self.app.PreStart() + self.ProcessEvents() + self.app.frame.Show() + self.ProcessEvents() + self.app.frame.ShowFullScreen(True) + self.ProcessEvents() + + def FinishApp(self): + wx.CallAfter(self.app.frame.Close) + self.app.MainLoop() + time.sleep(1) + self.app = None + + def GetSkippedProjectTreeItems(self): + """ + Returns the list of skipped items in the project tree. + + Beremiz test don't need to skip any elemnts in the project tree. + """ + return [] + + def OpenAllProjectElements(self): + """Open editor for every object in the project tree""" + self.app.frame.ProjectTree.ExpandAll() + self.ProcessEvents() + item = self.app.frame.ProjectTree.GetRootItem() + skip = self.GetSkippedProjectTreeItems() + tree_id = self.app.frame.ProjectTree.GetId() + while item is not None: + self.app.frame.ProjectTree.SelectItem(item, True) + self.ProcessEvents() + if item not in skip: + event = wx.lib.agw.customtreectrl.TreeEvent( + wx.lib.agw.customtreectrl.wxEVT_TREE_ITEM_ACTIVATED, + tree_id, item) + self.app.frame.OnProjectTreeItemActivated(event) + self.ProcessEvents() + item = self.app.frame.ProjectTree.GetNextVisible(item) + + def CheckTestProject(self, project): + sys.argv = ["", project] + self.StartApp() + self.OpenAllProjectElements() + user_actions = self.GetUserActions() + self.RunUIActions(user_actions) + self.FinishApp() + + def GetProjectPath(self, project): + return os.path.abspath(os.path.join(os.path.dirname(__file__), "..","..","projects", project)) + + def GetUserActions(self): + """ + Returns list of user actions that will be executed + on every test project by testCheckProject test. + """ + user_actions = [ + [self.app.frame.SwitchFullScrMode, None], + [self.app.frame.SwitchFullScrMode, None], + [self.app.frame.CTR._Clean], + [self.app.frame.CTR._Build], + [self.app.frame.CTR._Connect], + [self.app.frame.CTR._Transfer], + [self.app.frame.CTR._Run], + [self.app.frame.CTR._Stop], + [self.app.frame.CTR._Disconnect], + [self.app.frame.CTR._Clean], + ] + return user_actions + + def testStartUp(self): + """Checks whether the app starts and finishes correctly""" + sys.argv = [""] + self.StartApp() + self.FinishApp() + + # TODO: also use "exemples/*" projects + @ddt.data( + #"first_steps", + "logging", + #"traffic_lights", + #"wxGlade", + #"python", + #"wiimote", + # "wxHMI", + ) + @pytest.mark.timeout(300) + def testCheckProject(self, name): + """ + Checks that test PLC project can be open, + compiled and run on SoftPLC. + """ + project = self.GetProjectPath(name) + print("Testing example " + name) + self.CheckTestProject(project) + + +# class PLCOpenEditorApplicationTest(BeremizApplicationTest): +# """Test PLCOpenEditor as whole application""" +# +# def StartApp(self): +# self.app = PLCOpenEditor.PLCOpenEditorApp() +# # disable default exception handler in application +# self.app.InstallExceptionHandler = lambda: None +# self.InstallExceptionHandler() +# self.app.Show() +# self.ProcessEvents() +# self.app.frame.ShowFullScreen(True) +# self.ProcessEvents() +# +# def FinishApp(self): +# wx.CallAfter(self.app.frame.Close) +# self.app.MainLoop() +# time.sleep(1) +# self.app = None +# +# def GetSkippedProjectTreeItems(self): +# """ +# Returns the list of skipped items in the project tree. +# +# Root item opens dialog window for project settings. +# To avoid code that handles closing dialog windows just skip this item. +# """ +# return [self.app.frame.ProjectTree.GetRootItem()] +# +# def GetUserActions(self): +# return [] +# +# def GetProjectPath(self, project): +# """Open PLC program in every Beremiz test project""" +# project_dir = BeremizApplicationTest.GetProjectPath(self, project) +# return os.path.join(project_dir, "plc.xml") +# + +if __name__ == '__main__': + conftest.init_environment() + unittest.main() diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/new_project.sikuli/new_project.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/new_project.sikuli/new_project.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,136 @@ +""" This test opens, builds and runs a new project. +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import * + +def test(app): + + new_project_path = os.path.join(os.path.abspath(os.path.curdir), "new_test_project") + + # New project path must exist (usually created in directory selection dialog) + os.mkdir(new_project_path) + + app.WaitIdleUI() + + # Create new project (opens new project directory selection dialog) + app.k.New() + + app.WaitIdleUI() + + # Move to "Home" section of file selecor, otherwise address is + # "file ignored" at first run + app.type("f", Key.CTRL) + app.WaitIdleUI() + app.type(Key.ESC) + app.WaitIdleUI() + app.type(Key.TAB) + app.WaitIdleUI() + + # Enter directory by name + app.k.Address() + app.WaitIdleUI() + + # Fill address bar + app.type(new_project_path + Key.ENTER) + + app.WaitIdleUI() + + # When prompted for creating first program select type ST + app.type(Key.TAB*4) # go to lang dropdown + app.type(Key.DOWN*2) # change selected language + app.type(Key.ENTER) # validate + + app.WaitIdleUI() + + # Name created program + app.type("Test program") + + app.WaitIdleUI() + + # Focus on Variable grid + app.type(Key.TAB*4) + + # Add 2 variables + app.type(Key.ADD*2) + + # Focus on ST text + app.WaitIdleUI() + + app.type(Key.TAB*8) + + app.type("""\ + LocalVar0 := LocalVar1; + {printf("Test OK\\n");fflush(stdout);} + """) + + app.k.Save() + + # Close ST POU + app.type("w", Key.CTRL) + + app.WaitIdleUI() + + # Focus project tree and select root item + app.type(Key.TAB) + + app.type(Key.LEFT) + + app.type(Key.UP) + + # Edit root item + app.type(Key.ENTER) + + app.WaitIdleUI() + + # Switch to config tab + app.type(Key.RIGHT*2) + + # Focus on URI + app.type(Key.TAB) + + # Set URI + app.type("LOCAL://") + + # FIXME: Select other field to ensure URI is validated + app.type(Key.TAB) + + app.k.Save() + + # Close project config editor + app.type("w", Key.CTRL) + + app.WaitIdleUI() + + # Focus seems undefined at that time (FIXME) + # Force focussing on "something" so that next shortcut is taken + app.type(Key.TAB) + + app.waitIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitIdleStdout() + + app.k.Transfer() + + app.waitIdleStdout() + + app.k.Run() + + # wait 10 seconds + return app.waitPatternInStdout("Test OK", 10) + + +run_test(test) diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse.sikuli/opcua_browse.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/opcua_browse.sikuli/opcua_browse.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,65 @@ +""" This test opens, modifies, builds and runs exemple project named "python". +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import run_test, AuxiliaryProcess + +def test(app): + + server = AuxiliaryProcess(app, ["/bin/bash",os.path.join(getBundlePath(),"opcua_service.bash")]) + + app.doubleClick(["opcua_0", "opcua"]) + + app.WaitIdleUI() + + app.click("Server") + + app.WaitIdleUI() + + app.doubleClick("Objects") + + app.WaitIdleUI() + + app.doubleClick("TestObject") + + app.dragNdrop(["TestIn", "Testln"], "output variables") + + app.wait(1) + + app.dragNdrop("TestOut", "input variables") + + app.wait(3) + + app.k.Clean() + + app.waitForChangeAndIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitForChangeAndIdleStdout() + + app.k.Transfer() + + app.waitForChangeAndIdleStdout() + + app.k.Run() + + # wait 10 seconds for 10 patterns + res = app.waitPatternInStdout("6.8", 10) + + server.close() + + return res + +run_test(test, testproject="opcua_browse") diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse.sikuli/opcua_browse_server.png Binary file tests/ide_tests/opcua_browse.sikuli/opcua_browse_server.png has changed diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse.sikuli/opcua_service.bash --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/opcua_browse.sikuli/opcua_service.bash Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,40 @@ +#!/bin/bash + +echo "Instant OPC-UA server for test" + +# Run server +exec $BEREMIZPYTHONPATH - << EOF + +import sys +import os +import time + +from opcua import ua, Server + +server = Server() +host = os.environ.get("OPCUA_DEFAULT_HOST", "127.0.0.1") +endpoint = "opc.tcp://"+host+":4840/freeopcua/server/" +server.set_endpoint(endpoint) + +uri = "http://beremiz.github.io" +idx = server.register_namespace(uri) + +objects = server.get_objects_node() + +testobj = objects.add_object(idx, "TestObject") +testvarout = testobj.add_variable(idx, "TestOut", 1.2) +testvar = testobj.add_variable(idx, "TestIn", 5.6) +testvar.set_writable() + +server.start() + +try: + while True: + time.sleep(1) + inval=testvar.get_value() + print inval + testvarout.set_value(inval*2) + sys.stdout.flush() +finally: + server.stop() +EOF diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_browse_encrypted.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_browse_encrypted.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,67 @@ +""" This test opens, modifies, builds and runs exemple project named "python". +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import run_test, AuxiliaryProcess + +def test(app): + + server = AuxiliaryProcess(app, ["/bin/bash",os.path.join(getBundlePath(),"opcua_service.bash")]) + + server.waitPatternInStdout("CERTS READY", 5) + + app.doubleClick(["opcua_0", "opcua"]) + + app.WaitIdleUI() + + app.click("Server") + + app.WaitIdleUI() + + app.doubleClick("Objects") + + app.WaitIdleUI() + + app.doubleClick("TestObject") + + app.dragNdrop(["TestIn", "Testln"], "output variables") + + app.wait(1) + + app.dragNdrop("TestOut", "input variables") + + app.wait(3) + + app.k.Clean() + + app.waitForChangeAndIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitForChangeAndIdleStdout() + + app.k.Transfer() + + app.waitForChangeAndIdleStdout() + + app.k.Run() + + # wait 10 seconds for 10 patterns + res = app.waitPatternInStdout("6.8", 10) + + server.close() + + return res + +run_test(test, testproject="opcua_browse_encrypted") diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_browse_server.png Binary file tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_browse_server.png has changed diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_service.bash --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/opcua_browse_encrypted.sikuli/opcua_service.bash Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,54 @@ +#!/bin/bash + +echo "Instant encrypted OPC-UA server for test" + +yes "" | openssl req -x509 -newkey rsa:2048 -keyout my_private_key.pem -out my_cert.pem \ + -days 355 -nodes -addext "subjectAltName = URI:urn:example.org:FreeOpcUa:python-opcua" +openssl x509 -outform der -in my_cert.pem -out my_cert.der + +PROJECT_FILES_DIR=$BEREMIZPATH/tests/projects/opcua_browse_encrypted/project_files +mkdir $PROJECT_FILES_DIR +cp my_cert.der my_private_key.pem $PROJECT_FILES_DIR + +echo "CERTS READY" + +# Run server +exec $BEREMIZPYTHONPATH - << EOF + +import sys +import os +import time + +from opcua import ua, Server + +server = Server() +host = os.environ.get("OPCUA_DEFAULT_HOST", "127.0.0.1") +endpoint = "opc.tcp://"+host+":4840/freeopcua/server/" +server.set_endpoint(endpoint) + +server.set_security_policy([ua.SecurityPolicyType.Basic256Sha256_SignAndEncrypt]) +server.load_certificate("my_cert.der") +server.load_private_key("my_private_key.pem") + +uri = "http://beremiz.github.io" +idx = server.register_namespace(uri) + +objects = server.get_objects_node() + +testobj = objects.add_object(idx, "TestObject") +testvarout = testobj.add_variable(idx, "TestOut", 1.2) +testvar = testobj.add_variable(idx, "TestIn", 5.6) +testvar.set_writable() + +server.start() + +try: + while True: + time.sleep(1) + inval=testvar.get_value() + print inval + testvarout.set_value(inval*2) + sys.stdout.flush() +finally: + server.stop() +EOF diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/run_python_exemple.sikuli/run_python_exemple.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/run_python_exemple.sikuli/run_python_exemple.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,39 @@ +""" This test opens, builds and runs exemple project named "python". +Test succeeds if runtime's stdout behaves as expected +""" + +import os +import time + +# allow module import from current test directory's parent +addImportPath(os.path.dirname(getBundlePath())) + +# common test definitions module +from sikuliberemiz import * + +def test(app): + # Start the app + + app.k.Clean() + + app.waitForChangeAndIdleStdout() + + app.k.Build() + + app.waitPatternInStdout("Successfully built.", 10) + + app.k.Connect() + + app.waitForChangeAndIdleStdout() + + app.k.Transfer() + + app.waitForChangeAndIdleStdout() + + app.k.Run() + + # wait 10 seconds for 10 Grumpfs + return app.waitPatternInStdout("Grumpf", 10, 10) + +run_test(test, exemple="python") + diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/sikuliberemiz.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/sikuliberemiz.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,441 @@ +"Commons definitions for sikuli based beremiz IDE GUI tests" + +import os +import sys +import subprocess +import traceback +import signal +import re +from threading import Thread, Event, Lock +from time import time as timesec +from xml.sax.saxutils import escape as escape_xml + +import sikuli + +beremiz_path = os.environ["BEREMIZPATH"] +python_bin = os.environ.get("BEREMIZPYTHONPATH", "/usr/bin/python") +opj = os.path.join + +tessdata_path = os.environ["TESSDATAPATH"] + +ansi_escape = re.compile(r'(?:\x1B[@-_]|[\x80-\x9F])[0-?]*[ -/]*[@-~]') +def escape_ansi(line): + return ansi_escape.sub('', line) + +def escape(txt): + return escape_xml(escape_ansi(txt)) + +class KBDShortcut: + """Send shortut to app by calling corresponding methods. + + example: + k = KBDShortcut() + k.Clean() + """ + + fkeys = {"Stop": sikuli.Key.F4, + "Run": sikuli.Key.F5, + "Transfer": sikuli.Key.F6, + "Connect": sikuli.Key.F7, + "Clean": sikuli.Key.F9, + "Build": sikuli.Key.F11, + "Save": ("s",sikuli.Key.CTRL), + "New": ("n",sikuli.Key.CTRL), + "Address": ("l",sikuli.Key.CTRL)} # to reach address bar in GTK's file selector + + def __init__(self, app): + self.app = app + + def __getattr__(self, name): + fkey = self.fkeys[name] + if type(fkey) != tuple: + fkey = (fkey,) + + def PressShortCut(): + self.app.sikuliapp.focus() + sikuli.type(*fkey) + self.app.ReportText("Sending " + name + " shortcut") + + return PressShortCut + + +class IDEIdleObserver: + "Detects when IDE is idle. This is particularly handy when staring an operation and witing for the en of it." + + def __init__(self): + """ + Parameters: + app (class BeremizApp) + """ + self.r = sikuli.Region(self.sikuliapp.window()) + self.targetOffset = self.r.getTopLeft() + + self.idechanged = False + + # 200 was selected because default 50 was still catching cursor blinking in console + # FIXME : remove blinking cursor in console + self.r.onChange(200,self._OnIDEWindowChange) + self.r.observeInBackground() + + def __del__(self): + self.r.stopObserver() + + def _OnIDEWindowChange(self, event): + self.idechanged = True + + def WaitIdleUI(self, period=1, timeout=15): + """ + Wait for IDE to stop changing + Parameters: + period (int): how many seconds with no change to consider idle + timeout (int): how long to wait for idle, in seconds + """ + c = max(timeout/period,1) + while c > 0: + self.idechanged = False + sikuli.wait(period) + if not self.idechanged: + break + c = c - 1 + + self.ReportScreenShot("UI is idle" if c != 0 else "UI is not idle") + + if c == 0: + raise Exception("Window did not idle before timeout") + + +class stdoutIdleObserver: + "Detects when IDE's stdout is idle. Can be more reliable than pixel based version (false changes ?)" + + def __init__(self): + """ + Parameters: + app (class BeremizApp) + """ + self.stdoutchanged = False + + self.event = Event() + + self.pattern = None + self.success_event = Event() + + if self.proc is not None: + self.thread = Thread(target = self._waitStdoutProc).start() + + def __del__(self): + pass # self.thread.join() ? + + def _waitStdoutProc(self): + while True: + a = self.proc.stdout.readline() + if len(a) == 0 or a is None: + break + self.ReportOutput(a) + self.event.set() + if self.pattern is not None and a.find(self.pattern) >= 0: + sys.stdout.write("found pattern in '" + a +"'") + self.success_event.set() + + def waitForChangeAndIdleStdout(self, period=2, timeout=15): + """ + Wait for IDE'stdout to start changing + Parameters: + timeout (int): how long to wait for change, in seconds + """ + start_time = timesec() + + wait_result = self.event.wait(timeout) + + self.ReportScreenShot("stdout changed" if wait_result else "stdout didn't change") + + if wait_result: + self.event.clear() + else: + raise Exception("Stdout didn't become active before timeout") + + self.waitIdleStdout(period, timeout - (timesec() - start_time)) + + def waitIdleStdout(self, period=2, timeout=15): + """ + Wait for IDE'stdout to stop changing + Parameters: + period (int): how many seconds with no change to consider idle + timeout (int): how long to wait for idle, in seconds + """ + end_time = timesec() + timeout + self.event.clear() + while timesec() < end_time: + if self.event.wait(period): + # no timeout -> got event -> not idle -> loop again + self.event.clear() + else: + # timeout -> no event -> idle -> exit + self.ReportScreenShot("stdout is idle") + return True + + self.ReportScreenShot("stdout did not idle") + + raise Exception("Stdout did not idle before timeout") + + def waitPatternInStdout(self, pattern, timeout, count=1): + found = 0 + self.pattern = pattern + end_time = timesec() + timeout + while True: + remain = end_time - timesec() + if remain <= 0 : + res = False + break + + res = self.success_event.wait(remain) + if res: + self.success_event.clear() + found = found + 1 + if found >= count: + break + self.pattern = None + self.ReportScreenShot("found pattern" if res else "pattern not found") + return res + +class BeremizApp(IDEIdleObserver, stdoutIdleObserver): + def __init__(self, projectpath=None, exemple=None, testproject=None): + """ + Starts Beremiz IDE, waits for main window to appear, maximize it. + + Parameters: + projectpath (str): path to project to open + exemple (str): path relative to exemples directory + + Returns: + Sikuli App class instance + """ + self.ocropts = sikuli.OCR.globalOptions() + self.ocropts.dataPath(tessdata_path) + self.ocropts.oem(2) + self.ocropts.smallFont() + + self.imgnum = 0 + self.starttime = timesec() + self.screen = sikuli.Screen() + + self.report = open("report.xhtml", "w") + self.report.write("""\ +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8"/> + <meta name="color-scheme" content="light dark"/> + <title>Test report</title> + </head> + <body> +""") + + command = [python_bin, opj(beremiz_path,"Beremiz.py"), "--log=/dev/stdout"] + + if exemple is not None: + command.append(opj(beremiz_path,"exemples",exemple)) + elif projectpath is not None: + command.append(projectpath) + elif testproject is not None: + command.append(opj(beremiz_path,"tests","projects",testproject)) + + + # App class is broken in Sikuli 2.0.5: can't start process with arguments. + # + # Workaround : - use subprocess module to spawn IDE process, + # - use wmctrl to find IDE window details and maximize it + # - pass exact window title to App class constructor + + self.ReportText("Launching " + repr(command)) + + self.proc = subprocess.Popen(command, stdout=subprocess.PIPE, bufsize=0) + + # Window are macthed against process' PID + ppid = self.proc.pid + + # Timeout 5s + c = 50 + while c > 0: + # equiv to "wmctrl -l -p | grep $pid" + try: + wlist = filter(lambda l:(len(l)>2 and l[2]==str(ppid)), map(lambda s:s.split(None,4), subprocess.check_output(["wmctrl", "-l", "-p"]).splitlines())) + except subprocess.CalledProcessError: + wlist = [] + + # window with no title only has 4 fields do describe it + # beremiz splashcreen has no title + # wait until main window is visible + if len(wlist) == 1 and len(wlist[0]) == 5: + windowID,_zero,wpid,_XID,wtitle = wlist[0] + break + + sikuli.wait(0.1) + c = c - 1 + + if c == 0: + raise Exception("Couldn't find Beremiz window") + + # Maximize window x and y + subprocess.check_call(["wmctrl", "-i", "-r", windowID, "-b", "add,maximized_vert,maximized_horz"]) + + # switchApp creates an App object by finding window by title, is not supposed to spawn a process + self.sikuliapp = sikuli.switchApp(wtitle) + self.k = KBDShortcut(self) + + IDEIdleObserver.__init__(self) + stdoutIdleObserver.__init__(self) + + # stubs for common sikuli calls to allow adding hooks later + for name, takes_matches in [ + ("click", True), + ("doubleClick", True), + ("type", False), + ("rightClick", True), + ("wait", False)]: + def makeMyMeth(n,m): + def myMeth(*args, **kwargs): + self.ReportScreenShot("Begin: " + n + "(" + repr(args) + "," + repr(kwargs) + ")") + if m: + args = map(self.handle_PFRML_arg, args) + kwargs = dict(map(lambda k,v:(k,self.handle_PFRML_arg(v)), kwargs.items())) + try: + getattr(sikuli, n)(*args, **kwargs) + finally: + self.ReportScreenShot("end: " + n + "(" + repr(args) + "," + repr(kwargs) + ")") + return myMeth + setattr(self, name, makeMyMeth(name,takes_matches)) + + def handle_PFRML_arg(self, arg): + if type(arg)==list: + return self.findBest(*arg) + if type(arg)==str and not arg.endswith(".png"): + return self.findBest(arg) + return arg + + def findBest(self, *args): + #match = self.r.findBest(*args) + match = None + matches = sikuli.OCR.readWords(self.r) + sikuli.OCR.readLines(self.r) + for m in matches: + mText = m.getText().encode('ascii', 'ignore') + for arg in args: + if arg in mText: + if match is None: + match = m + if mText == arg: + match = m + break + if match is None: + self.ReportText("Not found: " + repr(args) + " OCR content: ") + for m in matches: + self.ReportText(repr(m) + ": " + m.getText().encode('ascii', 'ignore')) + raise Exception("Not Found: " + repr(args)) + + # translate match to screen ref + #match.setTargetOffset(self.targetOffset) + match.setTopLeft(match.getTopLeft().offset(self.targetOffset)) + + self.ReportTextImage("Found for " + repr(args) + ": " + + " ".join([repr(match), repr(match.getTarget()), repr(match.getTargetOffset())]), + self.screen.capture(match)) + return match.getTarget() + + def dragNdrop(self, src, dst): + self.ReportScreenShot("Drag: (" + repr(src) + ")") + sikuli.drag(self.handle_PFRML_arg(src)) + sikuli.mouseMove(5,0) + sikuli.dropAt(self.handle_PFRML_arg(dst)) + self.ReportScreenShot("Drop: (" + repr(dst) + ")") + + def close(self): + + self.ReportScreenShot("Close app") + os.kill(self.proc.pid, signal.SIGTERM) + #self.sikuliapp.close() + #self.sikuliapp = None + + self.report.write(""" + </body> +</html>""") + self.report.close() + + def __del__(self): + if self.sikuliapp is not None: + self.sikuliapp.close() + IDEIdleObserver.__del__(self) + stdoutIdleObserver.__del__(self) + + def ReportScreenShot(self, msg): + cap = self.screen.capture(self.r) + self.ReportTextImage(msg, cap) + + def ReportTextImage(self, msg, img): + elapsed = "%.3fs: "%(timesec() - self.starttime) + fname = "capture"+str(self.imgnum)+".png" + img.save(".", fname) + self.imgnum = self.imgnum + 1 + self.report.write( "<p>" + escape(elapsed + msg) + "<br/><img src=\""+ fname + "\"/>" + "</p>") + + def ReportText(self, text): + elapsed = "%.3fs: "%(timesec() - self.starttime) + #res = u"<p><![CDATA[" + elapsed + text + "]]></p>" + res = u"<p>" + escape(elapsed + text) + "</p>" + self.report.write(res) + + def ReportOutput(self, text): + elapsed = "%.3fs: "%(timesec() - self.starttime) + sys.stdout.write(elapsed + text) + self.report.write("<pre>" + escape(elapsed + text) + "</pre>") + + +class AuxiliaryProcess(stdoutIdleObserver): + def __init__(self, beremiz_app, command): + self.app = beremiz_app + self.app.ReportText("Launching process " + repr(command)) + self.proc = subprocess.Popen(command, stdout=subprocess.PIPE, bufsize=0) + self.app.ReportText("Launched process " + repr(command) + " PID: " + str(self.proc.pid)) + stdoutIdleObserver.__init__(self) + + def close(self): + if self.proc is not None: + proc = self.proc + self.proc = None + # self.proc.stdout.close() + self.app.ReportText("Kill process PID: " + str(proc.pid)) + try: + os.kill(proc.pid, signal.SIGTERM) + except OSError: + pass + proc.wait() + # self.thread.join() + + def ReportOutput(self, text): + self.app.ReportOutput("Aux: "+text) + + def ReportScreenShot(self, msg): + self.app.ReportOutput("Aux: "+msg) + + def __del__(self): + self.close() + +def run_test(func, *args, **kwargs): + app = BeremizApp(*args, **kwargs) + try: + success = func(app) + except: + # sadly, sys.excepthook is broken in sikuli/jython + # purpose of this run_test function is to work around it. + # and catch exception cleanly anyhow + e_type, e_value, e_traceback = sys.exc_info() + err_msg = "\n".join(traceback.format_exception(e_type, e_value, e_traceback)) + app.ReportOutput(err_msg) + success = False + + app.close() + + if success: + sikuli.exit(0) + else: + sikuli.exit(1) + + + diff -r ac0e6de439b5 -r 838242d34741 tests/ide_tests/wx_widgets.pytest/test_CustomIntCtrl.py --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/ide_tests/wx_widgets.pytest/test_CustomIntCtrl.py Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,140 @@ +#!/usr/bin/env python +# -*- coding: utf-8 -*- + +# This file is part of Beremiz, a Integrated Development Environment for +# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. +# +# Copyright (C) 2017: Andrey Skvortsov +# +# See COPYING file for copyrights details. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License +# as published by the Free Software Foundation; either version 2 +# of the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. + + +from __future__ import absolute_import +from __future__ import division +import unittest +import time + +import wx +import conftest +import controls.CustomIntCtrl + + +class TestCustomIntCtrl(unittest.TestCase): + def setUp(self): + self.app = wx.App() + self.frame = wx.Frame(None) + + def tearDown(self): + self.frame.Destroy() + wx.CallAfter(wx.Exit) + self.app.MainLoop() + + def testMaxLimit(self): + """Test working upper bound""" + self.AddControls() + self.int_ctrl.SetValue(self.max_val + 100) + self.ProcessEvents() + + self.txt_ctrl.SetFocus() + self.ProcessEvents() + self.assertEqual(self.int_ctrl.GetValue(), self.max_val) + + def testMinLimit(self): + """Test working lower bound""" + self.AddControls() + self.int_ctrl.SetValue(self.min_val - 100) + self.ProcessEvents() + + self.txt_ctrl.SetFocus() + self.ProcessEvents() + + self.assertEqual(self.int_ctrl.GetValue(), self.min_val) + + def testCorrectValue(self): + """Test case if no limiting is necessary""" + self.AddControls() + val = (self.max_val + self.min_val) // 2 + self.int_ctrl.SetValue(val) + self.ProcessEvents() + + self.txt_ctrl.SetFocus() + self.ProcessEvents() + + self.assertEqual(self.int_ctrl.GetValue(), val) + + def testEventBinding(self): + """Test event sending after edit and bound checks are done""" + self.AddControls() + self.event_happend = False + + def EventHandler(event): + self.event_happend = True + event.Skip() + + self.int_ctrl.Bind(controls.CustomIntCtrl.EVT_CUSTOM_INT, EventHandler) + + val = (self.max_val + self.min_val) // 2 + + self.int_ctrl.SetValue(val) + self.ProcessEvents() + self.txt_ctrl.SetFocus() + + self.ProcessEvents() + self.txt_ctrl.SetFocus() + self.ProcessEvents() + + self.assertEqual(self.int_ctrl.GetValue(), val) + self.assertTrue(self.event_happend) + + def testLongNumbers(self): + """Test support of long integer""" + self.AddControls() + val = 40000000000 + self.int_ctrl.SetMax(val) + self.int_ctrl.SetValue(val) + self.ProcessEvents() + + self.txt_ctrl.SetFocus() + self.ProcessEvents() + + self.assertEqual(val, val) + + def ProcessEvents(self): + for dummy in range(0, 10): + wx.Yield() + time.sleep(0.01) + + def AddControls(self): + vs = wx.BoxSizer(wx.VERTICAL) + self.int_ctrl = controls.CustomIntCtrl(self.frame) + self.txt_ctrl = wx.TextCtrl(self.frame) + vs.Add(self.int_ctrl, 0, wx.ALIGN_CENTRE | wx.ALL, 5) + vs.Add(self.txt_ctrl, 0, wx.ALIGN_CENTRE | wx.ALL, 5) + self.frame.SetSizer(vs) + vs.Fit(self.frame) + self.frame.Show() + self.frame.Raise() + + self.min_val = 50 + self.max_val = 100 + self.int_ctrl.SetBounds(self.min_val, self.max_val) + self.ProcessEvents() + + +if __name__ == '__main__': + conftest.init_environment() + unittest.main() diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/beremiz.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/beremiz.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,4 @@ +<?xml version='1.0' encoding='utf-8'?> +<BeremizRoot xmlns:xsd="http://www.w3.org/2001/XMLSchema" URI_location="LOCAL://"> + <TargetType/> +</BeremizRoot> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/opcua_0@opcua/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/opcua_0@opcua/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="0" Name="opcua_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/opcua_0@opcua/confnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/opcua_0@opcua/confnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,4 @@ +<?xml version='1.0' encoding='utf-8'?> +<OPCUAClient xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <AuthType/> +</OPCUAClient> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/plc.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/plc.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,208 @@ +<?xml version='1.0' encoding='utf-8'?> +<project xmlns:ns1="http://www.plcopen.org/xml/tc6_0201" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns="http://www.plcopen.org/xml/tc6_0201"> + <fileHeader companyName="Unknown" productName="Unnamed" productVersion="1" creationDateTime="2022-07-16T10:46:25"/> + <contentHeader name="Unnamed" modificationDateTime="2022-11-10T17:51:34"> + <coordinateInfo> + <fbd> + <scaling x="5" y="5"/> + </fbd> + <ld> + <scaling x="0" y="0"/> + </ld> + <sfc> + <scaling x="0" y="0"/> + </sfc> + </coordinateInfo> + </contentHeader> + <types> + <dataTypes/> + <pous> + <pou name="program0" pouType="program"> + <interface> + <localVars> + <variable name="LocalVar0" address="%IL0.2"> + <type> + <LREAL/> + </type> + </variable> + <variable name="LocalVar1" address="%QL0.3"> + <type> + <LREAL/> + </type> + </variable> + </localVars> + <localVars> + <variable name="python_poll0"> + <type> + <derived name="python_poll"/> + </type> + </variable> + </localVars> + </interface> + <body> + <FBD> + <inVariable localId="1" executionOrderId="0" height="25" width="85" negated="false"> + <position x="160" y="190"/> + <connectionPointOut> + <relPosition x="85" y="10"/> + </connectionPointOut> + <expression>LocalVar0</expression> + </inVariable> + <outVariable localId="2" executionOrderId="0" height="24" width="82" negated="false"> + <position x="238" y="49"/> + <connectionPointIn> + <relPosition x="0" y="11"/> + <connection refLocalId="9"> + <position x="238" y="60"/> + <position x="204" y="60"/> + </connection> + </connectionPointIn> + <expression>LocalVar1</expression> + </outVariable> + <block localId="4" typeName="python_poll" instanceName="python_poll0" executionOrderId="0" height="60" width="98"> + <position x="658" y="101"/> + <inputVariables> + <variable formalParameter="TRIG"> + <connectionPointIn> + <relPosition x="0" y="29"/> + <connection refLocalId="7"> + <position x="658" y="130"/> + <position x="623" y="130"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="CODE"> + <connectionPointIn> + <relPosition x="0" y="49"/> + <connection refLocalId="6" formalParameter="OUT"> + <position x="658" y="150"/> + <position x="560" y="150"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="ACK"> + <connectionPointOut> + <relPosition x="98" y="29"/> + </connectionPointOut> + </variable> + <variable formalParameter="RESULT"> + <connectionPointOut> + <relPosition x="98" y="49"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="5" typeName="LREAL_TO_STRING" executionOrderId="0" height="40" width="130"> + <position x="280" y="170"/> + <inputVariables> + <variable formalParameter="IN"> + <connectionPointIn> + <relPosition x="0" y="30"/> + <connection refLocalId="1"> + <position x="280" y="200"/> + <position x="255" y="200"/> + <position x="255" y="200"/> + <position x="300" y="200"/> + <position x="300" y="200"/> + <position x="245" y="200"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="130" y="30"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="6" typeName="CONCAT" executionOrderId="0" height="165" width="63"> + <position x="497" y="108"/> + <inputVariables> + <variable formalParameter="IN1"> + <connectionPointIn> + <relPosition x="0" y="42"/> + <connection refLocalId="3"> + <position x="497" y="150"/> + <position x="330" y="150"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN2"> + <connectionPointIn> + <relPosition x="0" y="92"/> + <connection refLocalId="5" formalParameter="OUT"> + <position x="497" y="200"/> + <position x="410" y="200"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN3"> + <connectionPointIn> + <relPosition x="0" y="142"/> + <connection refLocalId="8"> + <position x="497" y="250"/> + <position x="225" y="250"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="63" y="42"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <inVariable localId="7" executionOrderId="0" height="24" width="44" negated="false"> + <position x="579" y="116"/> + <connectionPointOut> + <relPosition x="44" y="14"/> + </connectionPointOut> + <expression>TRUE</expression> + </inVariable> + <inVariable localId="3" executionOrderId="0" height="25" width="180" negated="false"> + <position x="160" y="140"/> + <connectionPointOut> + <relPosition x="180" y="10"/> + </connectionPointOut> + <expression>'pfunc("'</expression> + </inVariable> + <inVariable localId="8" executionOrderId="0" height="25" width="230" negated="false"> + <position x="165" y="240"/> + <connectionPointOut> + <relPosition x="230" y="10"/> + </connectionPointOut> + <expression>'\n")'</expression> + </inVariable> + <inVariable localId="9" executionOrderId="0" height="29" width="45" negated="false"> + <position x="159" y="47"/> + <connectionPointOut> + <relPosition x="45" y="13"/> + </connectionPointOut> + <expression>3.4</expression> + </inVariable> + </FBD> + </body> + </pou> + </pous> + </types> + <instances> + <configurations> + <configuration name="config"> + <resource name="resource1"> + <task name="task0" priority="0" interval="T#100ms"> + <pouInstance name="instance0" typeName="program0"/> + </task> + </resource> + </configuration> + </configurations> + </instances> +</project> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/py_ext_0@py_ext/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/py_ext_0@py_ext/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="1" Name="py_ext_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse/py_ext_0@py_ext/pyfile.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse/py_ext_0@py_ext/pyfile.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,36 @@ +<?xml version='1.0' encoding='utf-8'?> +<PyFile xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <variables/> + <globals> + <xhtml:p><![CDATA[ +import sys +def pfunc(arg): + sys.stdout.write(arg) + sys.stdout.flush() + +pfunc("globals section\n") + +]]></xhtml:p> + </globals> + <init> + <xhtml:p><![CDATA[ +pfunc("init section\n") +]]></xhtml:p> + </init> + <cleanup> + <xhtml:p><![CDATA[ +pfunc("cleanup section\n") +]]></xhtml:p> + </cleanup> + <start> + <xhtml:p><![CDATA[ +pfunc("start section\n") +]]></xhtml:p> + </start> + <stop> + <xhtml:p><![CDATA[ +pfunc("stop section\n") + +]]></xhtml:p> + </stop> +</PyFile> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/beremiz.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/beremiz.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,4 @@ +<?xml version='1.0' encoding='utf-8'?> +<BeremizRoot xmlns:xsd="http://www.w3.org/2001/XMLSchema" URI_location="LOCAL://"> + <TargetType/> +</BeremizRoot> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/opcua_0@opcua/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/opcua_0@opcua/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="0" Name="opcua_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/opcua_0@opcua/confnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/opcua_0@opcua/confnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,9 @@ +<?xml version='1.0' encoding='utf-8'?> +<OPCUAClient xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <AuthType> + <x509 Certificate="my_cert.der" PrivateKey="my_private_key.pem"> + <Policy/> + <Mode/> + </x509> + </AuthType> +</OPCUAClient> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/plc.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/plc.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,208 @@ +<?xml version='1.0' encoding='utf-8'?> +<project xmlns:ns1="http://www.plcopen.org/xml/tc6_0201" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns="http://www.plcopen.org/xml/tc6_0201"> + <fileHeader companyName="Unknown" productName="Unnamed" productVersion="1" creationDateTime="2022-07-16T10:46:25"/> + <contentHeader name="Unnamed" modificationDateTime="2022-11-10T17:51:34"> + <coordinateInfo> + <fbd> + <scaling x="5" y="5"/> + </fbd> + <ld> + <scaling x="0" y="0"/> + </ld> + <sfc> + <scaling x="0" y="0"/> + </sfc> + </coordinateInfo> + </contentHeader> + <types> + <dataTypes/> + <pous> + <pou name="program0" pouType="program"> + <interface> + <localVars> + <variable name="LocalVar0" address="%IL0.2"> + <type> + <LREAL/> + </type> + </variable> + <variable name="LocalVar1" address="%QL0.3"> + <type> + <LREAL/> + </type> + </variable> + </localVars> + <localVars> + <variable name="python_poll0"> + <type> + <derived name="python_poll"/> + </type> + </variable> + </localVars> + </interface> + <body> + <FBD> + <inVariable localId="1" executionOrderId="0" height="25" width="85" negated="false"> + <position x="160" y="190"/> + <connectionPointOut> + <relPosition x="85" y="10"/> + </connectionPointOut> + <expression>LocalVar0</expression> + </inVariable> + <outVariable localId="2" executionOrderId="0" height="24" width="82" negated="false"> + <position x="238" y="49"/> + <connectionPointIn> + <relPosition x="0" y="11"/> + <connection refLocalId="9"> + <position x="238" y="60"/> + <position x="204" y="60"/> + </connection> + </connectionPointIn> + <expression>LocalVar1</expression> + </outVariable> + <block localId="4" typeName="python_poll" instanceName="python_poll0" executionOrderId="0" height="60" width="98"> + <position x="658" y="101"/> + <inputVariables> + <variable formalParameter="TRIG"> + <connectionPointIn> + <relPosition x="0" y="29"/> + <connection refLocalId="7"> + <position x="658" y="130"/> + <position x="623" y="130"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="CODE"> + <connectionPointIn> + <relPosition x="0" y="49"/> + <connection refLocalId="6" formalParameter="OUT"> + <position x="658" y="150"/> + <position x="560" y="150"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="ACK"> + <connectionPointOut> + <relPosition x="98" y="29"/> + </connectionPointOut> + </variable> + <variable formalParameter="RESULT"> + <connectionPointOut> + <relPosition x="98" y="49"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="5" typeName="LREAL_TO_STRING" executionOrderId="0" height="40" width="130"> + <position x="280" y="170"/> + <inputVariables> + <variable formalParameter="IN"> + <connectionPointIn> + <relPosition x="0" y="30"/> + <connection refLocalId="1"> + <position x="280" y="200"/> + <position x="255" y="200"/> + <position x="255" y="200"/> + <position x="300" y="200"/> + <position x="300" y="200"/> + <position x="245" y="200"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="130" y="30"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="6" typeName="CONCAT" executionOrderId="0" height="165" width="63"> + <position x="497" y="108"/> + <inputVariables> + <variable formalParameter="IN1"> + <connectionPointIn> + <relPosition x="0" y="42"/> + <connection refLocalId="3"> + <position x="497" y="150"/> + <position x="330" y="150"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN2"> + <connectionPointIn> + <relPosition x="0" y="92"/> + <connection refLocalId="5" formalParameter="OUT"> + <position x="497" y="200"/> + <position x="410" y="200"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN3"> + <connectionPointIn> + <relPosition x="0" y="142"/> + <connection refLocalId="8"> + <position x="497" y="250"/> + <position x="225" y="250"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="63" y="42"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <inVariable localId="7" executionOrderId="0" height="24" width="44" negated="false"> + <position x="579" y="116"/> + <connectionPointOut> + <relPosition x="44" y="14"/> + </connectionPointOut> + <expression>TRUE</expression> + </inVariable> + <inVariable localId="3" executionOrderId="0" height="25" width="180" negated="false"> + <position x="160" y="140"/> + <connectionPointOut> + <relPosition x="180" y="10"/> + </connectionPointOut> + <expression>'pfunc("'</expression> + </inVariable> + <inVariable localId="8" executionOrderId="0" height="25" width="230" negated="false"> + <position x="165" y="240"/> + <connectionPointOut> + <relPosition x="230" y="10"/> + </connectionPointOut> + <expression>'\n")'</expression> + </inVariable> + <inVariable localId="9" executionOrderId="0" height="29" width="45" negated="false"> + <position x="159" y="47"/> + <connectionPointOut> + <relPosition x="45" y="13"/> + </connectionPointOut> + <expression>3.4</expression> + </inVariable> + </FBD> + </body> + </pou> + </pous> + </types> + <instances> + <configurations> + <configuration name="config"> + <resource name="resource1"> + <task name="task0" priority="0" interval="T#100ms"> + <pouInstance name="instance0" typeName="program0"/> + </task> + </resource> + </configuration> + </configurations> + </instances> +</project> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/py_ext_0@py_ext/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/py_ext_0@py_ext/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="1" Name="py_ext_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_browse_encrypted/py_ext_0@py_ext/pyfile.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_browse_encrypted/py_ext_0@py_ext/pyfile.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,36 @@ +<?xml version='1.0' encoding='utf-8'?> +<PyFile xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <variables/> + <globals> + <xhtml:p><![CDATA[ +import sys +def pfunc(arg): + sys.stdout.write(arg) + sys.stdout.flush() + +pfunc("globals section\n") + +]]></xhtml:p> + </globals> + <init> + <xhtml:p><![CDATA[ +pfunc("init section\n") +]]></xhtml:p> + </init> + <cleanup> + <xhtml:p><![CDATA[ +pfunc("cleanup section\n") +]]></xhtml:p> + </cleanup> + <start> + <xhtml:p><![CDATA[ +pfunc("start section\n") +]]></xhtml:p> + </start> + <stop> + <xhtml:p><![CDATA[ +pfunc("stop section\n") + +]]></xhtml:p> + </stop> +</PyFile> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/beremiz.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/beremiz.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,4 @@ +<?xml version='1.0' encoding='utf-8'?> +<BeremizRoot xmlns:xsd="http://www.w3.org/2001/XMLSchema" URI_location="LOCAL://"> + <TargetType/> +</BeremizRoot> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/opcua_0@opcua/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/opcua_0@opcua/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="0" Name="opcua_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/opcua_0@opcua/confnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/opcua_0@opcua/confnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<OPCUAClient xmlns:xsd="http://www.w3.org/2001/XMLSchema"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/opcua_0@opcua/selected.csv --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/opcua_0@opcua/selected.csv Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +input,TestOut,2,int,2,Double,0 +output,TestIn,2,int,3,Double,0 diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/plc.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/plc.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,208 @@ +<?xml version='1.0' encoding='utf-8'?> +<project xmlns:ns1="http://www.plcopen.org/xml/tc6_0201" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns="http://www.plcopen.org/xml/tc6_0201"> + <fileHeader companyName="Unknown" productName="Unnamed" productVersion="1" creationDateTime="2022-07-16T10:46:25"/> + <contentHeader name="Unnamed" modificationDateTime="2022-07-16T22:47:46"> + <coordinateInfo> + <fbd> + <scaling x="5" y="5"/> + </fbd> + <ld> + <scaling x="0" y="0"/> + </ld> + <sfc> + <scaling x="0" y="0"/> + </sfc> + </coordinateInfo> + </contentHeader> + <types> + <dataTypes/> + <pous> + <pou name="program0" pouType="program"> + <interface> + <localVars> + <variable name="LocalVar0" address="%IL0.0"> + <type> + <LREAL/> + </type> + </variable> + <variable name="LocalVar1" address="%QL0.0"> + <type> + <LREAL/> + </type> + </variable> + </localVars> + <localVars> + <variable name="python_poll0"> + <type> + <derived name="python_poll"/> + </type> + </variable> + </localVars> + </interface> + <body> + <FBD> + <inVariable localId="1" executionOrderId="0" height="25" width="85" negated="false"> + <position x="160" y="190"/> + <connectionPointOut> + <relPosition x="85" y="10"/> + </connectionPointOut> + <expression>LocalVar0</expression> + </inVariable> + <outVariable localId="2" executionOrderId="0" height="24" width="82" negated="false"> + <position x="238" y="49"/> + <connectionPointIn> + <relPosition x="0" y="11"/> + <connection refLocalId="9"> + <position x="238" y="60"/> + <position x="204" y="60"/> + </connection> + </connectionPointIn> + <expression>LocalVar1</expression> + </outVariable> + <block localId="4" typeName="python_poll" instanceName="python_poll0" executionOrderId="0" height="60" width="98"> + <position x="658" y="101"/> + <inputVariables> + <variable formalParameter="TRIG"> + <connectionPointIn> + <relPosition x="0" y="29"/> + <connection refLocalId="7"> + <position x="658" y="130"/> + <position x="623" y="130"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="CODE"> + <connectionPointIn> + <relPosition x="0" y="49"/> + <connection refLocalId="6" formalParameter="OUT"> + <position x="658" y="150"/> + <position x="560" y="150"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="ACK"> + <connectionPointOut> + <relPosition x="98" y="29"/> + </connectionPointOut> + </variable> + <variable formalParameter="RESULT"> + <connectionPointOut> + <relPosition x="98" y="49"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="5" typeName="LREAL_TO_STRING" executionOrderId="0" height="40" width="130"> + <position x="280" y="170"/> + <inputVariables> + <variable formalParameter="IN"> + <connectionPointIn> + <relPosition x="0" y="30"/> + <connection refLocalId="1"> + <position x="280" y="200"/> + <position x="255" y="200"/> + <position x="255" y="200"/> + <position x="300" y="200"/> + <position x="300" y="200"/> + <position x="245" y="200"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="130" y="30"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="6" typeName="CONCAT" executionOrderId="0" height="165" width="63"> + <position x="497" y="108"/> + <inputVariables> + <variable formalParameter="IN1"> + <connectionPointIn> + <relPosition x="0" y="42"/> + <connection refLocalId="3"> + <position x="497" y="150"/> + <position x="330" y="150"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN2"> + <connectionPointIn> + <relPosition x="0" y="92"/> + <connection refLocalId="5" formalParameter="OUT"> + <position x="497" y="200"/> + <position x="410" y="200"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN3"> + <connectionPointIn> + <relPosition x="0" y="142"/> + <connection refLocalId="8"> + <position x="497" y="250"/> + <position x="225" y="250"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="63" y="42"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <inVariable localId="7" executionOrderId="0" height="24" width="44" negated="false"> + <position x="579" y="116"/> + <connectionPointOut> + <relPosition x="44" y="14"/> + </connectionPointOut> + <expression>TRUE</expression> + </inVariable> + <inVariable localId="3" executionOrderId="0" height="25" width="180" negated="false"> + <position x="160" y="140"/> + <connectionPointOut> + <relPosition x="180" y="10"/> + </connectionPointOut> + <expression>'pfunc("'</expression> + </inVariable> + <inVariable localId="8" executionOrderId="0" height="25" width="230" negated="false"> + <position x="165" y="240"/> + <connectionPointOut> + <relPosition x="230" y="10"/> + </connectionPointOut> + <expression>'\n")'</expression> + </inVariable> + <inVariable localId="9" executionOrderId="0" height="29" width="45" negated="false"> + <position x="159" y="47"/> + <connectionPointOut> + <relPosition x="45" y="13"/> + </connectionPointOut> + <expression>3.4</expression> + </inVariable> + </FBD> + </body> + </pou> + </pous> + </types> + <instances> + <configurations> + <configuration name="config"> + <resource name="resource1"> + <task name="task0" priority="0" interval="T#100ms"> + <pouInstance name="instance0" typeName="program0"/> + </task> + </resource> + </configuration> + </configurations> + </instances> +</project> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/py_ext_0@py_ext/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/py_ext_0@py_ext/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="1" Name="py_ext_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client/py_ext_0@py_ext/pyfile.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client/py_ext_0@py_ext/pyfile.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,36 @@ +<?xml version='1.0' encoding='utf-8'?> +<PyFile xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <variables/> + <globals> + <xhtml:p><![CDATA[ +import sys +def pfunc(arg): + sys.stdout.write(arg) + sys.stdout.flush() + +pfunc("globals section\n") + +]]></xhtml:p> + </globals> + <init> + <xhtml:p><![CDATA[ +pfunc("init section\n") +]]></xhtml:p> + </init> + <cleanup> + <xhtml:p><![CDATA[ +pfunc("cleanup section\n") +]]></xhtml:p> + </cleanup> + <start> + <xhtml:p><![CDATA[ +pfunc("start section\n") +]]></xhtml:p> + </start> + <stop> + <xhtml:p><![CDATA[ +pfunc("stop section\n") + +]]></xhtml:p> + </stop> +</PyFile> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/beremiz.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/beremiz.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,4 @@ +<?xml version='1.0' encoding='utf-8'?> +<BeremizRoot xmlns:xsd="http://www.w3.org/2001/XMLSchema" URI_location="LOCAL://"> + <TargetType/> +</BeremizRoot> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/opcua_0@opcua/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/opcua_0@opcua/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="0" Name="opcua_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/opcua_0@opcua/confnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/opcua_0@opcua/confnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,9 @@ +<?xml version='1.0' encoding='utf-8'?> +<OPCUAClient xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <AuthType> + <x509 Certificate="my_cert.der" PrivateKey="my_private_key.pem"> + <Policy/> + <Mode/> + </x509> + </AuthType> +</OPCUAClient> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/opcua_0@opcua/selected.csv --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/opcua_0@opcua/selected.csv Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +input,TestOut,2,int,2,Double,0 +output,TestIn,2,int,3,Double,0 diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/plc.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/plc.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,208 @@ +<?xml version='1.0' encoding='utf-8'?> +<project xmlns:ns1="http://www.plcopen.org/xml/tc6_0201" xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns="http://www.plcopen.org/xml/tc6_0201"> + <fileHeader companyName="Unknown" productName="Unnamed" productVersion="1" creationDateTime="2022-07-16T10:46:25"/> + <contentHeader name="Unnamed" modificationDateTime="2022-09-15T20:56:16"> + <coordinateInfo> + <fbd> + <scaling x="5" y="5"/> + </fbd> + <ld> + <scaling x="0" y="0"/> + </ld> + <sfc> + <scaling x="0" y="0"/> + </sfc> + </coordinateInfo> + </contentHeader> + <types> + <dataTypes/> + <pous> + <pou name="program0" pouType="program"> + <interface> + <localVars> + <variable name="LocalVar0" address="%IL0.0"> + <type> + <LREAL/> + </type> + </variable> + <variable name="LocalVar1" address="%QL0.0"> + <type> + <LREAL/> + </type> + </variable> + </localVars> + <localVars> + <variable name="python_poll0"> + <type> + <derived name="python_poll"/> + </type> + </variable> + </localVars> + </interface> + <body> + <FBD> + <inVariable localId="1" executionOrderId="0" height="25" width="85" negated="false"> + <position x="160" y="190"/> + <connectionPointOut> + <relPosition x="85" y="10"/> + </connectionPointOut> + <expression>LocalVar0</expression> + </inVariable> + <outVariable localId="2" executionOrderId="0" height="24" width="82" negated="false"> + <position x="238" y="49"/> + <connectionPointIn> + <relPosition x="0" y="11"/> + <connection refLocalId="9"> + <position x="238" y="60"/> + <position x="204" y="60"/> + </connection> + </connectionPointIn> + <expression>LocalVar1</expression> + </outVariable> + <block localId="4" typeName="python_poll" instanceName="python_poll0" executionOrderId="0" height="60" width="98"> + <position x="658" y="101"/> + <inputVariables> + <variable formalParameter="TRIG"> + <connectionPointIn> + <relPosition x="0" y="29"/> + <connection refLocalId="7"> + <position x="658" y="130"/> + <position x="623" y="130"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="CODE"> + <connectionPointIn> + <relPosition x="0" y="49"/> + <connection refLocalId="6" formalParameter="OUT"> + <position x="658" y="150"/> + <position x="560" y="150"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="ACK"> + <connectionPointOut> + <relPosition x="98" y="29"/> + </connectionPointOut> + </variable> + <variable formalParameter="RESULT"> + <connectionPointOut> + <relPosition x="98" y="49"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="5" typeName="LREAL_TO_STRING" executionOrderId="0" height="40" width="130"> + <position x="280" y="170"/> + <inputVariables> + <variable formalParameter="IN"> + <connectionPointIn> + <relPosition x="0" y="30"/> + <connection refLocalId="1"> + <position x="280" y="200"/> + <position x="255" y="200"/> + <position x="255" y="200"/> + <position x="300" y="200"/> + <position x="300" y="200"/> + <position x="245" y="200"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="130" y="30"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <block localId="6" typeName="CONCAT" executionOrderId="0" height="165" width="63"> + <position x="497" y="108"/> + <inputVariables> + <variable formalParameter="IN1"> + <connectionPointIn> + <relPosition x="0" y="42"/> + <connection refLocalId="3"> + <position x="497" y="150"/> + <position x="330" y="150"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN2"> + <connectionPointIn> + <relPosition x="0" y="92"/> + <connection refLocalId="5" formalParameter="OUT"> + <position x="497" y="200"/> + <position x="410" y="200"/> + </connection> + </connectionPointIn> + </variable> + <variable formalParameter="IN3"> + <connectionPointIn> + <relPosition x="0" y="142"/> + <connection refLocalId="8"> + <position x="497" y="250"/> + <position x="225" y="250"/> + </connection> + </connectionPointIn> + </variable> + </inputVariables> + <inOutVariables/> + <outputVariables> + <variable formalParameter="OUT"> + <connectionPointOut> + <relPosition x="63" y="42"/> + </connectionPointOut> + </variable> + </outputVariables> + </block> + <inVariable localId="7" executionOrderId="0" height="24" width="44" negated="false"> + <position x="579" y="116"/> + <connectionPointOut> + <relPosition x="44" y="14"/> + </connectionPointOut> + <expression>TRUE</expression> + </inVariable> + <inVariable localId="3" executionOrderId="0" height="25" width="180" negated="false"> + <position x="160" y="140"/> + <connectionPointOut> + <relPosition x="180" y="10"/> + </connectionPointOut> + <expression>'pfunc("'</expression> + </inVariable> + <inVariable localId="8" executionOrderId="0" height="25" width="230" negated="false"> + <position x="165" y="240"/> + <connectionPointOut> + <relPosition x="230" y="10"/> + </connectionPointOut> + <expression>'\n")'</expression> + </inVariable> + <inVariable localId="9" executionOrderId="0" height="29" width="45" negated="false"> + <position x="159" y="47"/> + <connectionPointOut> + <relPosition x="45" y="13"/> + </connectionPointOut> + <expression>3.4</expression> + </inVariable> + </FBD> + </body> + </pou> + </pous> + </types> + <instances> + <configurations> + <configuration name="config"> + <resource name="resource1"> + <task name="task0" priority="0" interval="T#100ms"> + <pouInstance name="instance0" typeName="program0"/> + </task> + </resource> + </configuration> + </configurations> + </instances> +</project> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/py_ext_0@py_ext/baseconfnode.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/py_ext_0@py_ext/baseconfnode.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,2 @@ +<?xml version='1.0' encoding='utf-8'?> +<BaseParams xmlns:xsd="http://www.w3.org/2001/XMLSchema" IEC_Channel="1" Name="py_ext_0"/> diff -r ac0e6de439b5 -r 838242d34741 tests/projects/opcua_client_encrypted/py_ext_0@py_ext/pyfile.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/projects/opcua_client_encrypted/py_ext_0@py_ext/pyfile.xml Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,36 @@ +<?xml version='1.0' encoding='utf-8'?> +<PyFile xmlns:xhtml="http://www.w3.org/1999/xhtml" xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <variables/> + <globals> + <xhtml:p><![CDATA[ +import sys +def pfunc(arg): + sys.stdout.write(arg) + sys.stdout.flush() + +pfunc("globals section\n") + +]]></xhtml:p> + </globals> + <init> + <xhtml:p><![CDATA[ +pfunc("init section\n") +]]></xhtml:p> + </init> + <cleanup> + <xhtml:p><![CDATA[ +pfunc("cleanup section\n") +]]></xhtml:p> + </cleanup> + <start> + <xhtml:p><![CDATA[ +pfunc("start section\n") +]]></xhtml:p> + </start> + <stop> + <xhtml:p><![CDATA[ +pfunc("stop section\n") + +]]></xhtml:p> + </stop> +</PyFile> diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/Dockerfile --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/Dockerfile Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,90 @@ +# +# Dockerfile for Beremiz +# This container is used to run tests for Beremiz +# +FROM ubuntu:focal + +ENV TERM xterm-256color + +ENV LANG en_US.UTF-8 +ENV LANGUAGE en_US:en +ENV LC_ALL en_US.UTF-8 + +ARG UNAME=testing +ENV UNAME ${UNAME} +ARG UID=1000 +ARG GID=1000 +RUN groupadd -g $GID $UNAME +RUN useradd -m -u $UID -g $GID -s /bin/bash $UNAME + +RUN set -xe \ + && apt-get update \ + && apt-get install locales \ + && locale-gen en_US.UTF-8 \ + && update-locale LANG=en_US.UTF-8 + +RUN set -xe \ + && TZ="America/Paris" \ + DEBIAN_FRONTEND="noninteractive" \ + apt-get install -y --no-install-recommends \ + `# to run sikuli` \ + wget \ + openjdk-11-jre \ + libtesseract4 \ + \ + `# to run X based tests` \ + fluxbox \ + wmctrl xdotool xvfb \ + x11vnc xterm xnest \ + materia-gtk-theme \ + \ + `# to build tested apps` \ + build-essential automake flex bison mercurial \ + libgtk-3-dev libgl1-mesa-dev libglu1-mesa-dev \ + libpython2.7-dev libssl-dev \ + python2 virtualenv cmake + + +# force bigger font and flat theme for GTK in order to make OCR more reliable +RUN mkdir -p /etc/gtk-3.0 +RUN env echo -e '[Settings]\ngtk-font-name=FreeSans,12\ngtk-theme-name=Materia\n' > /etc/gtk-3.0/settings.ini + +# link obtained from https://raiman.github.io/SikuliX1/downloads.html +RUN set -xe && \ + wget -qP /usr/local/bin \ + https://launchpad.net/sikuli/sikulix/2.0.5/+download/sikulixide-2.0.5.jar && \ + echo 0795f1e0866ee5a7a84e4c89793ea78c /usr/local/bin/sikulixide-2.0.5.jar | md5sum -c && \ + ( echo '#!/bin/sh' && \ + echo "exec java -jar /usr/local/bin/sikulixide-*.jar \"\$@\"" \ + ) | install /dev/stdin /usr/local/bin/sikulix + + +# easy to remember 'do_tests' alias to invoke main makefile +RUN env echo -e '#!/bin/bash\nmake -f /home/testing/src/beremiz/tests/Makefile $*' > /usr/local/bin/do_tests +RUN chmod +x /usr/local/bin/do_tests + +USER $UNAME + +RUN mkdir /home/$UNAME/build /home/$UNAME/src /home/$UNAME/test + +RUN virtualenv --python=$(which python2) ~/beremizenv + +RUN ~/beremizenv/bin/pip install \ + pytest pytest-timeout ddt \ + lxml future matplotlib zeroconf2 enum34 pyro sslpsk posix_spawn \ + twisted nevow autobahn click opcua \ + wxPython==4.1.1 + +RUN set -xe && \ + cd /home/$UNAME && mkdir tessdata && \ + wget -q https://github.com/tesseract-ocr/tessdata/archive/refs/tags/4.1.0.tar.gz \ + -O tessdata.tar.gz && \ + echo 89e25c7c40a59be7195422a01f57fcb2 tessdata.tar.gz | md5sum -c && \ + tar --strip-components=1 -C tessdata -x -v -z -f tessdata.tar.gz && \ + rm tessdata.tar.gz + +ENV TESSDATAPATH /home/$UNAME/tessdata + +# Points to python binary that test will use +ENV BEREMIZPYTHONPATH /home/$UNAME/beremizenv/bin/python + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/beremiz-requirements/Dockerfile --- a/tests/tools/Docker/beremiz-requirements/Dockerfile Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,69 +0,0 @@ -# -# Dockerfile for Beremiz -# This container is used to run tests for Beremiz -# -# To run test localy use following command executed from beremiz directory: -# $ docker run --volume=$PWD:/beremiz --workdir="/beremiz" --volume=$PWD/../CanFestival-3:/CanFestival-3 --memory=1g --entrypoint=/beremiz/tests/tools/check_source.sh skvorl/beremiz-requirements -# - -FROM skvorl/python2.7-wxpython -MAINTAINER Andrey Skvortsov <andrej.skvortzov@gmail.com> - -RUN set -xe \ - && apt-get update \ - && apt-get install -y --no-install-recommends \ - python-nevow \ - python-lxml \ - python-zeroconf \ - python-m2crypto \ - python-autobahn \ - python-future \ - python-simplejson \ - && apt-get install -y --no-install-recommends ca-certificates \ - && apt-get install -y --no-install-recommends wxglade python-cwiid \ - && apt-get install -y --no-install-recommends build-essential automake flex bison mercurial python-pip \ - && apt-get install -y --no-install-recommends \ - pep8 \ - pylint \ - python-pytest \ - python-pytest-timeout \ - gettext \ - python-ddt \ - libpython2.7-dev \ - \ - && apt-get install -y python3-pip \ - && pip3 install crossbar \ - \ - && /usr/bin/pip install gnosis \ - pyro \ - sslpsk \ - posix_spawn \ - && cd / \ - && hg clone http://dev.automforge.net/CanFestival-3 \ - && cd CanFestival-3 \ - && ./configure \ - \ - && cd / \ - && hg clone -r 24ef30a9bcee1e65b027be2c7f7a8d52c41a7479 https://bitbucket.org/automforge/matiec \ - && cd matiec \ - && autoreconf -i \ - && ./configure \ - && make \ - && make install \ - && mkdir /usr/lib/matiec \ - && cp -vR lib/* /usr/lib/matiec \ - && rm -rf /matiec \ - \ - && cd / \ - && hg clone https://bitbucket.org/mjsousa/modbus Modbus \ - && cd Modbus \ - && make \ - \ - && cd / \ - && svn checkout https://svn.code.sf.net/p/bacnet/code/trunk/bacnet-stack/ BACnet \ - && cd BACnet \ - && make MAKE_DEFINE='-fPIC' all \ - \ - && apt-get remove -y bison flex automake python-pip python3-pip libpython2.7-dev \ - && apt-get autoremove -y \ - && apt-get clean -y \ diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/build_docker_image.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/build_docker_image.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,10 @@ +#!/bin/bash + +set -e + +echo "Building docker image" +docker build \ + --build-arg UID=$(id -u) \ + --build-arg GID=$(id -g) \ + -t beremiz_sikuli . + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/clean_docker_container.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/clean_docker_container.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,5 @@ +#!/bin/bash + +# delete container +docker rm beremiz_sikuli_current + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/clean_docker_image.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/clean_docker_image.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,5 @@ +#!/bin/bash + +# delete image +docker rmi beremiz_sikuli + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/create_docker_container.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/create_docker_container.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,30 @@ +#!/bin/bash + +set -e + +# source directory containing beremiz, matiec, etc.. +SRCDIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" && cd ../../../.. && pwd )" +echo "SOURCE direcory : $SRCDIR" + +# absolute path to test directory. ~/test if not given as only argument +TESTDIR=${1:-~/test} +mkdir -p $TESTDIR +echo "TEST direcory : $TESTDIR" + +UNAME=testing +UHOME=/home/$UNAME + +# define TESTDEBUG in env to enable dev-mode. This enables : +# - debug pasthrough for Xnest +# - VNC port passthrough +DEBUGARGS="-v /tmp/.X11-unix/X0:/tmp/.X11-unix/X0 -e DISPLAY=$DISPLAY -p 5900:5900" + +echo "Creating docker container" +docker create \ + --name beremiz_sikuli_current \ + -v $SRCDIR:$UHOME/src \ + -v $TESTDIR:$UHOME/test \ + `if [ "$TESTDEBUG" == "YES" ]; then echo $DEBUGARGS; fi` \ + -w $UHOME/test \ + -i -t beremiz_sikuli /bin/bash + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/do_test_in_docker.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/do_test_in_docker.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,11 @@ +#!/bin/bash + +set -e + +CONTAINER=beremiz_sikuli_current + +docker stop $CONTAINER +docker start $CONTAINER +docker exec $CONTAINER bash -c "do_tests $1" +docker stop $CONTAINER + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/enter_docker.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/enter_docker.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,5 @@ +#!/bin/bash + +CONTAINER=beremiz_sikuli_current + +docker start -i $CONTAINER diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/enter_docker_as_root.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/enter_docker_as_root.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,7 @@ +#!/bin/bash + +CONTAINER=beremiz_sikuli_current + +docker start $CONTAINER +docker exec -i -t -u root $CONTAINER bash +docker stop $CONTAINER diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/python2.7-wxpython/Dockerfile --- a/tests/tools/Docker/python2.7-wxpython/Dockerfile Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,11 +0,0 @@ -# -# Dockerfile for wxPython3.0 running on python2.7 -# - -FROM python:2.7-stretch - -RUN set -xe \ - && apt-get update \ - && apt-get install -y --no-install-recommends python-wxgtk3.0 python-matplotlib \ - && apt-get install -y --no-install-recommends python-xvfbwrapper xvfb \ - && apt-get clean diff -r ac0e6de439b5 -r 838242d34741 tests/tools/Docker/rebuild_docker.sh --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/tests/tools/Docker/rebuild_docker.sh Fri Mar 03 19:20:49 2023 +0100 @@ -0,0 +1,9 @@ +#!/bin/bash + +set -e + +./clean_docker_container.sh || true +./clean_docker_image.sh || true +./build_docker_image.sh +./create_docker_container.sh $1 + diff -r ac0e6de439b5 -r 838242d34741 tests/tools/conftest.py --- a/tests/tools/conftest.py Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,78 +0,0 @@ -#!/usr/bin/env python -# -*- coding: utf-8 -*- - -# This file is part of Beremiz, a Integrated Development Environment for -# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. -# -# Copyright (C) 2017: Andrey Skvortsov -# -# See COPYING file for copyrights details. -# -# This program is free software; you can redistribute it and/or -# modify it under the terms of the GNU General Public License -# as published by the Free Software Foundation; either version 2 -# of the License, or (at your option) any later version. -# -# This program is distributed in the hope that it will be useful, -# but WITHOUT ANY WARRANTY; without even the implied warranty of -# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -# GNU General Public License for more details. -# -# You should have received a copy of the GNU General Public License -# along with this program; if not, write to the Free Software -# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. - - -from __future__ import absolute_import -import os -import sys - -# import pytest -# import xvfbwrapper - - -def init_environment(): - """Append module root directory to sys.path""" - try: - import Beremiz as _Beremiz - except ImportError: - sys.path.append( - os.path.abspath( - os.path.join( - os.path.dirname(__file__), '..', '..') - ) - ) - - -init_environment() - -# -# Something seems to be broken in Beremiz application, -# because after tests in test_application.py during Xvfb shutdown -# pytest returns error message: -# pytest: Fatal IO error 11 (Die Ressource ist zur Zeit nicht verfügbar) on X server :2821. -# -# As a result of that pytest returns code 1 as some tests were failed, -# but they aren't. -# -# To avoid this Xvfb is launched and killed not by pytest. -# $ Xvfb :42 -screen 0 1280x1024x24 & -# $ export DISPLAY=:42 -# $ pytest --timeout=10 ./tests/tools -# $ pkill -9 Xvfb -# -# TODO: find root of this problem. - - -# vdisplay = None -# -# @pytest.fixture(scope="session", autouse=True) -# def start_xvfb_server(request): -# global vdisplay -# vdisplay = xvfbwrapper.Xvfb(width=1280, height=720) -# vdisplay.start() -# request.addfinalizer(stop_xvfb_server) -# -# def stop_xvfb_server(): -# if vdisplay is not None: -# vdisplay.stop() diff -r ac0e6de439b5 -r 838242d34741 tests/tools/run_python_tests.sh --- a/tests/tools/run_python_tests.sh Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,61 +0,0 @@ -#!/bin/sh - - - -cleanup() -{ - find $PYTEST_DIR -name '*.pyc' -delete -} - - - -print_help() -{ - echo "Usage: run_python_tests.sh [--on-local-xserver]" - echo "" - echo "--on-local-xserver" - echo " all tests are run on local X-server. " - echo " User can see test in action." - echo " Any interaction (mouse, keyboard) should be avoided" - echo " By default without arguments script runs pytest on virtual X serverf." - echo "" - - exit 1 -} - -main() -{ - LC_ALL=ru_RU.utf-8 - PYTEST_DIR=./tests/tools - - if [ ! -d $PYTEST_DIR ]; then - echo "Script should be run from top directory in repository" - exit 1; - fi - - use_xvfb=0 - if [ "$1" != "--on-local-xserver" ]; then - export DISPLAY=:42 - use_xvfb=1 - Xvfb $DISPLAY -screen 0 1280x1024x24 & - sleep 1 - fi - - - cleanup - - ret=0 - DELAY=400 - KILL_DELAY=$(($DELAY + 30)) - timeout -k $KILL_DELAY $DELAY pytest --timeout=10 ./tests/tools - ret=$? - - cleanup - - [ $use_xvfb = 1 ] && pkill -9 Xvfb - exit $ret -} - - -[ "$1" = "--help" -o "$1" = "-h" ] && print_help -main $@ diff -r ac0e6de439b5 -r 838242d34741 tests/tools/test_CustomIntCtrl.py --- a/tests/tools/test_CustomIntCtrl.py Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,140 +0,0 @@ -#!/usr/bin/env python -# -*- coding: utf-8 -*- - -# This file is part of Beremiz, a Integrated Development Environment for -# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. -# -# Copyright (C) 2017: Andrey Skvortsov -# -# See COPYING file for copyrights details. -# -# This program is free software; you can redistribute it and/or -# modify it under the terms of the GNU General Public License -# as published by the Free Software Foundation; either version 2 -# of the License, or (at your option) any later version. -# -# This program is distributed in the hope that it will be useful, -# but WITHOUT ANY WARRANTY; without even the implied warranty of -# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -# GNU General Public License for more details. -# -# You should have received a copy of the GNU General Public License -# along with this program; if not, write to the Free Software -# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. - - -from __future__ import absolute_import -from __future__ import division -import unittest -import time - -import wx -import conftest -import controls.CustomIntCtrl - - -class TestCustomIntCtrl(unittest.TestCase): - def setUp(self): - self.app = wx.App() - self.frame = wx.Frame(None) - - def tearDown(self): - self.frame.Destroy() - wx.CallAfter(self.app.Exit) - self.app.MainLoop() - - def testMaxLimit(self): - """Test working upper bound""" - self.AddControls() - self.int_ctrl.SetValue(self.max_val + 100) - self.ProcessEvents() - - self.txt_ctrl.SetFocus() - self.ProcessEvents() - self.assertEqual(self.int_ctrl.GetValue(), self.max_val) - - def testMinLimit(self): - """Test working lower bound""" - self.AddControls() - self.int_ctrl.SetValue(self.min_val - 100) - self.ProcessEvents() - - self.txt_ctrl.SetFocus() - self.ProcessEvents() - - self.assertEqual(self.int_ctrl.GetValue(), self.min_val) - - def testCorrectValue(self): - """Test case if no limiting is necessary""" - self.AddControls() - val = (self.max_val + self.min_val) // 2 - self.int_ctrl.SetValue(val) - self.ProcessEvents() - - self.txt_ctrl.SetFocus() - self.ProcessEvents() - - self.assertEqual(self.int_ctrl.GetValue(), val) - - def testEventBinding(self): - """Test event sending after edit and bound checks are done""" - self.AddControls() - self.event_happend = False - - def EventHandler(event): - self.event_happend = True - event.Skip() - - self.int_ctrl.Bind(controls.CustomIntCtrl.EVT_CUSTOM_INT, EventHandler) - - val = (self.max_val + self.min_val) // 2 - - self.int_ctrl.SetValue(val) - self.ProcessEvents() - self.txt_ctrl.SetFocus() - - self.ProcessEvents() - self.txt_ctrl.SetFocus() - self.ProcessEvents() - - self.assertEqual(self.int_ctrl.GetValue(), val) - self.assertTrue(self.event_happend) - - def testLongNumbers(self): - """Test support of long integer""" - self.AddControls() - val = 40000000000 - self.int_ctrl.SetMax(val) - self.int_ctrl.SetValue(val) - self.ProcessEvents() - - self.txt_ctrl.SetFocus() - self.ProcessEvents() - - self.assertEqual(val, val) - - def ProcessEvents(self): - for dummy in range(0, 10): - wx.Yield() - time.sleep(0.01) - - def AddControls(self): - vs = wx.BoxSizer(wx.VERTICAL) - self.int_ctrl = controls.CustomIntCtrl(self.frame) - self.txt_ctrl = wx.TextCtrl(self.frame) - vs.Add(self.int_ctrl, 0, wx.ALIGN_CENTRE | wx.ALL, 5) - vs.Add(self.txt_ctrl, 0, wx.ALIGN_CENTRE | wx.ALL, 5) - self.frame.SetSizer(vs) - vs.Fit(self.frame) - self.frame.Show() - self.frame.Raise() - - self.min_val = 50 - self.max_val = 100 - self.int_ctrl.SetBounds(self.min_val, self.max_val) - self.ProcessEvents() - - -if __name__ == '__main__': - conftest.init_environment() - unittest.main() diff -r ac0e6de439b5 -r 838242d34741 tests/tools/test_application.py --- a/tests/tools/test_application.py Wed Mar 01 10:54:54 2023 +0100 +++ /dev/null Thu Jan 01 00:00:00 1970 +0000 @@ -1,231 +0,0 @@ -#!/usr/bin/env python -# -*- coding: utf-8 -*- - -# This file is part of Beremiz, a Integrated Development Environment for -# programming IEC 61131-3 automates supporting plcopen standard and CanFestival. -# -# Copyright (C) 2017: Andrey Skvortsov -# -# See COPYING file for copyrights details. -# -# This program is free software; you can redistribute it and/or -# modify it under the terms of the GNU General Public License -# as published by the Free Software Foundation; either version 2 -# of the License, or (at your option) any later version. -# -# This program is distributed in the hope that it will be useful, -# but WITHOUT ANY WARRANTY; without even the implied warranty of -# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -# GNU General Public License for more details. -# -# You should have received a copy of the GNU General Public License -# along with this program; if not, write to the Free Software -# Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. - - -from __future__ import absolute_import -from __future__ import print_function -import os -import sys -import unittest -import time - -import six -import pytest -import wx -import ddt - -import conftest -import Beremiz -import PLCOpenEditor - - -class UserApplicationTest(unittest.TestCase): - def InstallExceptionHandler(self): - def handle_exception(e_type, e_value, e_traceback, exit=False): - # traceback.print_exception(e_type, e_value, e_traceback) - self.exc_info = [e_type, e_value, e_traceback] - self.exc_info = None - self.old_excepthook = sys.excepthook - sys.excepthook = handle_exception - - def StartApp(self): - self.app = None - - def FinishApp(self): - wx.CallAfter(self.app.frame.Close) - self.app.MainLoop() - self.app = None - - def setUp(self): - self.app = None - - def tearDown(self): - if self.app is not None and self.app.frame is not None: - self.FinishApp() - - def RunUIActions(self, actions): - for act in actions: - wx.CallAfter(*act) - self.ProcessEvents() - - def CheckForErrors(self): - if self.exc_info is not None: - # reraise catched previously exception - exc_type = self.exc_info[0] - exc_value = self.exc_info[1] - exc_traceback = self.exc_info[2] - six.reraise(exc_type, exc_value, exc_traceback) - - def ProcessEvents(self): - for dummy in range(0, 30): - self.CheckForErrors() - wx.Yield() - time.sleep(0.01) - - -@ddt.ddt -class BeremizApplicationTest(UserApplicationTest): - """Test Beremiz as whole application""" - - def StartApp(self): - self.app = Beremiz.BeremizIDELauncher() - # disable default exception handler in Beremiz - self.app.InstallExceptionHandler = lambda: None - self.InstallExceptionHandler() - self.app.handle_exception = sys.excepthook - self.app.PreStart() - self.ProcessEvents() - self.app.frame.Show() - self.ProcessEvents() - self.app.frame.ShowFullScreen(True) - self.ProcessEvents() - - def FinishApp(self): - wx.CallAfter(self.app.frame.Close) - self.app.MainLoop() - time.sleep(1) - self.app = None - - def GetSkippedProjectTreeItems(self): - """ - Returns the list of skipped items in the project tree. - - Beremiz test don't need to skip any elemnts in the project tree. - """ - return [] - - def OpenAllProjectElements(self): - """Open editor for every object in the project tree""" - self.app.frame.ProjectTree.ExpandAll() - self.ProcessEvents() - item = self.app.frame.ProjectTree.GetRootItem() - skip = self.GetSkippedProjectTreeItems() - tree_id = self.app.frame.ProjectTree.GetId() - while item is not None: - self.app.frame.ProjectTree.SelectItem(item, True) - self.ProcessEvents() - if item not in skip: - event = wx.lib.agw.customtreectrl.TreeEvent( - wx.lib.agw.customtreectrl.wxEVT_TREE_ITEM_ACTIVATED, - tree_id, item) - self.app.frame.OnProjectTreeItemActivated(event) - self.ProcessEvents() - item = self.app.frame.ProjectTree.GetNextVisible(item) - - def CheckTestProject(self, project): - sys.argv = ["", project] - self.StartApp() - self.OpenAllProjectElements() - user_actions = self.GetUserActions() - self.RunUIActions(user_actions) - self.FinishApp() - - def GetProjectPath(self, project): - return os.path.abspath(os.path.join(os.path.dirname(__file__), "..", project)) - - def GetUserActions(self): - """ - Returns list of user actions that will be executed - on every test project by testCheckProject test. - """ - user_actions = [ - [self.app.frame.SwitchFullScrMode, None], - [self.app.frame.SwitchFullScrMode, None], - [self.app.frame.CTR._Clean], - [self.app.frame.CTR._Build], - [self.app.frame.CTR._Connect], - [self.app.frame.CTR._Transfer], - [self.app.frame.CTR._Run], - [self.app.frame.CTR._Stop], - [self.app.frame.CTR._Disconnect], - [self.app.frame.CTR._Clean], - ] - return user_actions - - def testStartUp(self): - """Checks whether the app starts and finishes correctly""" - sys.argv = [""] - self.StartApp() - self.FinishApp() - - @ddt.data( - "first_steps", - "logging", - "traffic_lights", - "wxGlade", - "python", - "wiimote", - "wxHMI", - ) - @pytest.mark.timeout(30) - def testCheckProject(self, name): - """ - Checks that test PLC project can be open, - compiled and run on SoftPLC. - """ - project = self.GetProjectPath(name) - print("Testing example " + name) - self.CheckTestProject(project) - - -class PLCOpenEditorApplicationTest(BeremizApplicationTest): - """Test PLCOpenEditor as whole application""" - - def StartApp(self): - self.app = PLCOpenEditor.PLCOpenEditorApp() - # disable default exception handler in application - self.app.InstallExceptionHandler = lambda: None - self.InstallExceptionHandler() - self.app.Show() - self.ProcessEvents() - self.app.frame.ShowFullScreen(True) - self.ProcessEvents() - - def FinishApp(self): - wx.CallAfter(self.app.frame.Close) - self.app.MainLoop() - time.sleep(1) - self.app = None - - def GetSkippedProjectTreeItems(self): - """ - Returns the list of skipped items in the project tree. - - Root item opens dialog window for project settings. - To avoid code that handles closing dialog windows just skip this item. - """ - return [self.app.frame.ProjectTree.GetRootItem()] - - def GetUserActions(self): - return [] - - def GetProjectPath(self, project): - """Open PLC program in every Beremiz test project""" - project_dir = BeremizApplicationTest.GetProjectPath(self, project) - return os.path.join(project_dir, "plc.xml") - - -if __name__ == '__main__': - conftest.init_environment() - unittest.main() diff -r ac0e6de439b5 -r 838242d34741 util/BitmapLibrary.py --- a/util/BitmapLibrary.py Wed Mar 01 10:54:54 2023 +0100 +++ b/util/BitmapLibrary.py Fri Mar 03 19:20:49 2023 +0100 @@ -71,7 +71,7 @@ height = max(bmp1.GetHeight(), bmp2.GetHeight()) # Create bitmap with both icons - bmp = wx.EmptyBitmap(width, height) + bmp = wx.Bitmap(width, height) dc = wx.MemoryDC() dc.SelectObject(bmp) dc.Clear() diff -r ac0e6de439b5 -r 838242d34741 util/ExceptionHandler.py --- a/util/ExceptionHandler.py Wed Mar 01 10:54:54 2023 +0100 +++ b/util/ExceptionHandler.py Fri Mar 03 19:20:49 2023 +0100 @@ -49,7 +49,7 @@ trcbck_lst.append(trcbck) # Allow clicking.... - cap = wx.Window_GetCapture() + cap = wx.Window.GetCapture() if cap: cap.ReleaseMouse() @@ -81,8 +81,14 @@ def get_last_traceback(tb): - while tb.tb_next: - tb = tb.tb_next + while True: + if not hasattr(tb, "tb_next"): + break + if tb.tb_next: + tb = tb.tb_next + else: + break + return tb @@ -93,7 +99,7 @@ ignored_exceptions = [] # a problem with a line in a module is only reported once per session -def AddExceptHook(app_version='[No version]'): +def AddExceptHook(app_version='[No version]', logf = None): def save_bug_report(e_type, e_value, e_traceback, bug_report_path, date): info = { @@ -111,7 +117,8 @@ if e_traceback: info['traceback'] = ''.join(traceback.format_tb(e_traceback)) + '%s: %s' % (e_type, e_value) last_tb = get_last_traceback(e_traceback) - exception_locals = last_tb.tb_frame.f_locals # the locals at the level of the stack trace where the exception actually occurred + # save locals at the level of the stack trace where the exception actually occurred + exception_locals = last_tb.tb_frame.f_locals if last_tb else {}; info['locals'] = format_namespace(exception_locals) if 'self' in exception_locals: try: @@ -125,13 +132,17 @@ lst = info.keys() lst.sort() for a in lst: - output.write(a + ":\n" + str(info[a]) + "\n\n") + line = a + ":\n" + str(info[a]) + "\n\n" + output.write(line) + if logf is not None: + logf.write(line) output.close() def handle_exception(e_type, e_value, e_traceback, exit=False): traceback.print_exception(e_type, e_value, e_traceback) # this is very helpful when there's an exception in the rest of this func last_tb = get_last_traceback(e_traceback) - ex = (last_tb.tb_frame.f_code.co_filename, last_tb.tb_frame.f_lineno) + ex = (last_tb.tb_frame.f_code.co_filename if last_tb else "unknown", + last_tb.tb_frame.f_lineno if last_tb else None) if ex not in ignored_exceptions: ignored_exceptions.append(ex) date = time.ctime() diff -r ac0e6de439b5 -r 838242d34741 util/ProcessLogger.py --- a/util/ProcessLogger.py Wed Mar 01 10:54:54 2023 +0100 +++ b/util/ProcessLogger.py Fri Mar 03 19:20:49 2023 +0100 @@ -47,6 +47,7 @@ self.callback = callback self.endcallback = endcallback self.fd = fd + self.daemon = True def run(self): outchunk = None diff -r ac0e6de439b5 -r 838242d34741 util/paths.py --- a/util/paths.py Wed Mar 01 10:54:54 2023 +0100 +++ b/util/paths.py Fri Mar 03 19:20:49 2023 +0100 @@ -55,3 +55,8 @@ """ return os.path.join(AbsParentDir(__file__, 2), name) +def Bpath(*names): + """ + Return path of files in Beremiz project + """ + return os.path.join(AbsParentDir(__file__, 1), *names) diff -r ac0e6de439b5 -r 838242d34741 version.py --- a/version.py Wed Mar 01 10:54:54 2023 +0100 +++ b/version.py Fri Mar 03 19:20:49 2023 +0100 @@ -25,13 +25,10 @@ from __future__ import absolute_import from __future__ import unicode_literals +from __future__ import print_function -import subprocess import os -import util.paths as paths - - def GetCommunityHelpMsg(): return _( "The best place to ask questions about Beremiz/PLCOpenEditor\n" @@ -45,54 +42,23 @@ ) -def GetAppRevision(): - rev = None - app_dir = paths.AbsDir(__file__) - try: - pipe = subprocess.Popen( - ["hg", "id", "-i"], - stdout=subprocess.PIPE, - cwd=app_dir - ) - rev = pipe.communicate()[0] - if pipe.returncode != 0: - rev = None - except Exception: - pass +def GetAboutDialogInfo(info): - # if this is not mercurial repository - # try to read revision from file - if rev is None: - try: - f = open(os.path.join(app_dir, "revision")) - rev = f.readline() - except Exception: - pass - return rev - - -def GetAboutDialogInfo(): - import wx - info = wx.AboutDialogInfo() - - info.Name = "Beremiz" info.Version = app_version info.Copyright = "" + info.Copyright += "(C) 2006-2022 Edouard Tisserant\n" + info.Copyright += "(C) 2003-2021 Mario de Sousa\n" info.Copyright += "(C) 2016-2018 Andrey Skvortsov\n" - info.Copyright += "(C) 2008-2018 Eduard Tisserant\n" - info.Copyright += "(C) 2008-2015 Laurent Bessard" + info.Copyright += "(C) 2006-2013 Laurent Bessard\n" info.WebSite = ("http://beremiz.org", "beremiz.org") - info.Description = _("Open Source framework for automation, " - "implemented IEC 61131 IDE with constantly growing set of extensions " - "and flexible PLC runtime.") - info.Developers = ( + "Edouard Tisserant <contact@beremiz.fr>", + "Mario de Sousa <msousa@fe.up.pt>", "Andrey Skvortsov <andrej.skvortzov@gmail.com>", "Sergey Surkov <surkov.sv@summatechnology.ru>", - "Edouard Tisserant <edouard.tisserant@gmail.com>", "Laurent Bessard <laurent.bessard@gmail.com>") info.License = ( @@ -112,14 +78,12 @@ ) # read license file - path = paths.AbsDir(__file__) - license_path = os.path.join(path, "COPYING") + license_path = os.path.join( + os.path.dirname(os.path.realpath(__file__)), "COPYING") if os.path.exists(license_path): with open(license_path) as f: info.License += f.read() - info.Icon = wx.Icon(os.path.join(path, "images", "about_brz_logo.png"), wx.BITMAP_TYPE_PNG) - info.Translators = ( "Basque", "José Miguel Andonegi <jm.andonegi@gmail.com>, 2019", @@ -218,7 +182,7 @@ return info -app_version = "1.2" -rev = GetAppRevision() -if rev is not None: - app_version = app_version + "-" + rev.rstrip() +app_version = "1.3-beta2" + +if __name__ == "__main__": + print(app_version) diff -r ac0e6de439b5 -r 838242d34741 xmlclass/xmlclass.py --- a/xmlclass/xmlclass.py Wed Mar 01 10:54:54 2023 +0100 +++ b/xmlclass/xmlclass.py Fri Mar 03 19:20:49 2023 +0100 @@ -598,11 +598,15 @@ else: return "" + def Initial(): + p = etree.Element(infos["name"]) + return p + return { "type": TAG, "extract": ExtractTag, "generate": GenerateTag, - "initial": lambda: None, + "initial": Initial, "check": lambda x: x is None or infos["minOccurs"] == 0 and x } @@ -1450,14 +1454,14 @@ parts = path.split(".", 1) if parts[0] in attributes: if len(parts) != 1: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) attr_type = gettypeinfos(attributes[parts[0]]["attr_type"]["basename"], attributes[parts[0]]["attr_type"]["facets"]) value = getattr(self, parts[0], "") elif parts[0] in elements: if elements[parts[0]]["elmt_type"]["type"] == SIMPLETYPE: if len(parts) != 1: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) attr_type = gettypeinfos(elements[parts[0]]["elmt_type"]["basename"], elements[parts[0]]["elmt_type"]["facets"]) value = getattr(self, parts[0], "") @@ -1466,7 +1470,7 @@ else: attr = getattr(self, parts[0], None) if attr is None: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) if len(parts) == 1: return attr.getElementInfos(parts[0]) else: @@ -1477,7 +1481,7 @@ elif "base" in classinfos: classinfos["base"].getElementInfos(name, path) else: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) else: if not derived: children.extend(self.getElementAttributes()) @@ -1519,7 +1523,7 @@ parts = path.split(".", 1) if parts[0] in attributes: if len(parts) != 1: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) if attributes[parts[0]]["attr_type"]["basename"] == "boolean": setattr(self, parts[0], value) elif attributes[parts[0]]["use"] == "optional" and value == None: @@ -1534,7 +1538,7 @@ elif parts[0] in elements: if elements[parts[0]]["elmt_type"]["type"] == SIMPLETYPE: if len(parts) != 1: - raise ValueError("Wrong path!") + raise ValueError("Wrong path: "+path) if elements[parts[0]]["elmt_type"]["basename"] == "boolean": setattr(self, parts[0], value) elif attributes[parts[0]]["minOccurs"] == 0 and value == "": @@ -1738,6 +1742,8 @@ def tostring(self): return NAMESPACE_PATTERN.sub("", etree.tostring(self, pretty_print=True, encoding='utf-8')).decode('utf-8') + def getElementInfos(self, name, path=None, derived=False): + return {"name": name, "type": TAG, "value": None, "use": None, "children": []} class XMLElementClassLookUp(etree.PythonElementClassLookup):